![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | amendment N1 - green lab.eml | 2020-06-14 11:48 | 52K | |
| HLPF Side Event.eml | 2020-06-06 09:47 | 85K | |
| West-Coast Launch Steriall-Vegetable and Fruits wash.eml | 2020-05-26 12:40 | 345K | |
| Waiting for you on Pod Mobile.eml | 2020-05-17 12:29 | 3.8K | |
| Waiting for you on Pod Mobile (1).eml | 2020-05-17 12:29 | 3.9K | |
| Waiting for you on Pod Mobile (2).eml | 2020-05-17 12:29 | 3.9K | |
| UPR Report.eml | 2020-05-16 22:23 | 1.0K | |
| 9 May 9th - Holiday.eml | 2020-05-10 11:51 | 1.0K | |
| საჭიროების წერილი.eml | 2020-04-11 10:41 | 10M | |
| Your Payment Advice For Contract Value USD$1_1M.eml | 2020-04-03 03:51 | 1.6K | |
| Re Antigen Free samples from Beijing Savant Biotechnology Co_,Ltd.eml | 2020-03-29 13:39 | 152K | |
| webex link.eml | 2020-03-16 22:36 | 900 | |
| webex link (1).eml | 2020-03-16 22:32 | 938 | |
| COVID19.eml | 2020-03-05 18:29 | 2.9M | |
| No Name.eml | 2020-03-04 12:58 | 808 | |
| EMS - კვარტალური რეპორტი.eml | 2020-03-04 12:05 | 853 | |
| EMS - კვარტალური რეპორტი (1).eml | 2020-03-04 12:03 | 853 | |
| EMS - კვარტალური რეპორტი (2).eml | 2020-03-04 11:53 | 853 | |
| EMS - კვარტალური რეპორტი (3).eml | 2020-03-04 11:53 | 853 | |
| EMS - კვარტალური რეპორტი (4).eml | 2020-03-04 11:48 | 853 | |
| EMS - კვარტალური რეპორტი (5).eml | 2020-03-04 11:48 | 852 | |
| EMS - კვარტალური რეპორტი (6).eml | 2020-03-04 11:47 | 852 | |
| EMS - კვარტალური რეპორტი (7).eml | 2020-03-04 11:42 | 853 | |
| Don't miss this chance to boost your manliness!.eml | 2018-12-21 16:46 | 2.0K | |
| informacia.eml | 2018-09-10 13:39 | 4.2M | |
| New vacancies in our company.eml | 2018-09-03 09:17 | 1.4K | |
| mnikoleishvili@moh_gov_ge.eml | 2018-08-16 18:50 | 1.9K | |
| mnikoleishvili@moh_gov_ge (1).eml | 2018-08-16 14:44 | 2.0K | |
| New offer.eml | 2018-08-10 19:30 | 2.2K | |
| Interesting offer.eml | 2018-08-10 15:17 | 2.2K | |
| Staff Wanted.eml | 2018-08-08 18:35 | 1.3K | |
| Interesting work.eml | 2018-07-19 15:55 | 1.4K | |
| New vacancies in our company (1).eml | 2018-07-19 06:19 | 1.5K | |
| New offer (1).eml | 2018-07-12 14:41 | 1.3K | |
| Interesting offer (1).eml | 2018-07-11 15:34 | 1.3K | |
| Good day!.eml | 2018-07-11 10:38 | 2.7K | |
| Good day! (1).eml | 2018-07-09 17:23 | 1.5K | |
| Interesting offer (2).eml | 2018-07-09 09:59 | 1.5K | |
| Good day! (2).eml | 2018-07-06 13:10 | 1.3K | |
| Hello!.eml | 2018-07-05 13:26 | 1.5K | |
| New offer (2).eml | 2018-07-04 19:19 | 1.5K | |
| Staff Wanted (1).eml | 2018-07-04 17:37 | 2.8K | |
| New vacancies in our company (2).eml | 2018-07-04 02:15 | 1.4K | |
| Hello! (1).eml | 2018-07-03 14:22 | 1.4K | |
| New vacancies in our company (3).eml | 2018-07-03 09:45 | 1.4K | |
| RuneScape Account - login validation.eml | 2018-06-15 14:53 | 7.2K | |
| Top no deposit offers you can't miss.eml | 2018-06-15 11:54 | 6.6K | |
| Viagr@ Levirta Ciallis.eml | 2018-06-15 05:44 | 2.2K | |
| Your Netflix Membership Has Been Suspended.eml | 2018-06-14 09:22 | 29K | |
| Time to get your money back.eml | 2018-06-13 16:04 | 1.6K | |
| Cash in BIG TIME over and over again.eml | 2018-06-12 12:42 | 2.3K | |
| MyEtherWallet Private Key-Notice.eml | 2018-06-12 12:30 | 6.8K | |
| Time to get your money back (1).eml | 2018-06-12 11:58 | 1.6K | |
| Not Just a Drug Mall, But a Family, Mnikoleishvili!.eml | 2018-06-11 15:40 | 5.2K | |
| I believe in the search for true, sincere love!.eml | 2018-06-11 12:58 | 1.1K | |
| Searching for a beloved prince is my main goal!.eml | 2018-06-11 10:39 | 1.1K | |
| Approved Canadian Healthcare, Mnikoleishvili.eml | 2018-06-05 07:43 | 4.6K | |
| mnikoleishvili@moh_gov_ge,LAST & FINAL WARNING NOTICE!.eml | 2018-06-05 05:15 | 1.9K | |
| Reaching out from LinkedIn.eml | 2018-06-04 12:45 | 2.7K | |
| EXTRA 26% OFF WINTER SALE, Mnikoleishvili.eml | 2018-05-31 14:01 | 5.9K | |
| The Medicine Shop with a Tender Loving Touch, Mnikoleishvili!.eml | 2018-05-30 06:43 | 5.0K | |
| $20FreeChip+200% WelcomeBonus up to $2,000!.eml | 2018-05-29 05:17 | 9.1K | |
| Did you get my email invite.eml | 2018-05-28 10:10 | 2.7K | |
| Viaagra Erect Pills.eml | 2018-05-28 08:41 | 426 | |
| Can you attend our May 2018 webinar.eml | 2018-05-23 08:38 | 2.7K | |
| Do you believe in love I am!.eml | 2018-05-18 01:53 | 1.0K | |
| I'm a princess who's waiting for her prince!.eml | 2018-05-17 23:21 | 1.1K | |
| I believe in the search for true, sincere love! (1).eml | 2018-05-16 17:22 | 1.0K | |
| Google.eml | 2018-05-16 03:29 | 247K | |
| L E V I T R A for the BEST PRICE _ 28% DISCOUNT, Mnikoleishvili.eml | 2018-05-15 16:26 | 4.6K | |
| Trusted Canadian Healthcare, Mnikoleishvili_.eml | 2018-05-14 09:00 | 5.7K | |
| Bonjour!.eml | 2018-05-02 17:35 | 738 | |
| Bonjour! (1).eml | 2018-05-02 11:23 | 702 | |
| Salut, mon cher_.eml | 2018-05-02 06:02 | 657 | |
| Salut!.eml | 2018-05-02 04:16 | 2.1K | |
| Bonjour cherie!.eml | 2018-05-01 23:00 | 2.0K | |
| Good day! (3).eml | 2018-04-30 16:54 | 1.4K | |
| Good day! (4).eml | 2018-04-30 13:28 | 1.4K | |
| Uliya.eml | 2018-04-27 11:57 | 713 | |
| Hello.eml | 2018-03-29 02:09 | 26K | |
| Hello! (2).eml | 2018-03-29 00:39 | 26K | |
| Hi!.eml | 2018-03-29 00:38 | 26K | |
| hi.eml | 2018-03-28 11:50 | 1.3K | |
| Your personal discount.eml | 2018-03-28 11:49 | 1.2K | |
| Hello (1).eml | 2018-03-28 04:12 | 26K | |
| Hello (2).eml | 2018-03-27 15:01 | 26K | |
| Ray Ban Factory Clearance - 90% OFF -Online Only.eml | 2018-03-23 15:09 | 9.6K | |
| mnikoleishvili@moh_gov_ge,LAST & FINAL WARNING NOTICE!!!.eml | 2018-03-16 14:21 | 1.6K | |
|
|---|