![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Attachments/ | 2025-11-20 11:42 | - | |
![[TXT]](/icons/text.gif) | amendment N1 - green lab.htm | 2020-06-14 11:48 | 4.7K | |
| HLPF Side Event.htm | 2020-06-06 09:47 | 11K | |
| West-Coast Launch Steriall-Vegetable and Fruits wash.htm | 2020-05-26 12:40 | 355K | |
| Waiting for you on Pod Mobile.htm | 2020-05-17 12:29 | 7.4K | |
| Waiting for you on Pod Mobile (1).htm | 2020-05-17 12:29 | 7.4K | |
| Waiting for you on Pod Mobile (2).htm | 2020-05-17 12:29 | 7.4K | |
| UPR Report.htm | 2020-05-16 22:23 | 4.5K | |
| 9 May 9th - Holiday.htm | 2020-05-10 11:51 | 4.5K | |
| საჭიროების წერილი.htm | 2020-04-11 10:41 | 5.5K | |
| Your Payment Advice For Contract Value USD$1_1M.htm | 2020-04-03 03:51 | 5.0K | |
| Re Antigen Free samples from Beijing Savant Biotechnology Co_,Ltd.htm | 2020-03-29 13:39 | 18K | |
| webex link.htm | 2020-03-16 22:36 | 4.4K | |
| webex link (1).htm | 2020-03-16 22:32 | 4.4K | |
| COVID19.htm | 2020-03-05 18:29 | 7.3K | |
| No Name.htm | 2020-03-04 12:58 | 4.3K | |
| EMS - კვარტალური რეპორტი.htm | 2020-03-04 12:05 | 4.3K | |
| EMS - კვარტალური რეპორტი (1).htm | 2020-03-04 12:03 | 4.3K | |
| EMS - კვარტალური რეპორტი (2).htm | 2020-03-04 11:53 | 4.3K | |
| EMS - კვარტალური რეპორტი (3).htm | 2020-03-04 11:53 | 4.3K | |
| EMS - კვარტალური რეპორტი (4).htm | 2020-03-04 11:48 | 4.3K | |
| EMS - კვარტალური რეპორტი (5).htm | 2020-03-04 11:48 | 4.3K | |
| EMS - კვარტალური რეპორტი (6).htm | 2020-03-04 11:47 | 4.3K | |
| EMS - კვარტალური რეპორტი (7).htm | 2020-03-04 11:42 | 4.3K | |
| Don't miss this chance to boost your manliness!.htm | 2018-12-21 16:46 | 5.5K | |
| informacia.htm | 2018-09-10 13:39 | 10K | |
| New vacancies in our company.htm | 2018-09-03 09:17 | 4.9K | |
| mnikoleishvili@moh_gov_ge.htm | 2018-08-16 18:50 | 5.5K | |
| mnikoleishvili@moh_gov_ge (1).htm | 2018-08-16 14:44 | 5.5K | |
| New offer.htm | 2018-08-10 19:30 | 5.8K | |
| Interesting offer.htm | 2018-08-10 15:17 | 5.8K | |
| Staff Wanted.htm | 2018-08-08 18:35 | 4.8K | |
| Interesting work.htm | 2018-07-19 15:55 | 4.9K | |
| New vacancies in our company (1).htm | 2018-07-19 06:19 | 5.0K | |
| New offer (1).htm | 2018-07-12 14:41 | 4.8K | |
| Interesting offer (1).htm | 2018-07-11 15:34 | 4.8K | |
| Good day!.htm | 2018-07-11 10:38 | 6.2K | |
| Good day! (1).htm | 2018-07-09 17:23 | 5.0K | |
| Interesting offer (2).htm | 2018-07-09 09:59 | 5.0K | |
| Good day! (2).htm | 2018-07-06 13:10 | 4.8K | |
| Hello!.htm | 2018-07-05 13:26 | 5.0K | |
| New offer (2).htm | 2018-07-04 19:19 | 5.0K | |
| Staff Wanted (1).htm | 2018-07-04 17:37 | 6.3K | |
| New vacancies in our company (2).htm | 2018-07-04 02:15 | 4.9K | |
| Hello! (1).htm | 2018-07-03 14:22 | 4.9K | |
| New vacancies in our company (3).htm | 2018-07-03 09:45 | 4.9K | |
| RuneScape Account - login validation.htm | 2018-06-15 14:53 | 11K | |
| Top no deposit offers you can't miss.htm | 2018-06-15 11:54 | 10K | |
| Viagr@ Levirta Ciallis.htm | 2018-06-15 05:44 | 5.8K | |
| Your Netflix Membership Has Been Suspended.htm | 2018-06-14 09:22 | 33K | |
| Time to get your money back.htm | 2018-06-13 16:04 | 5.2K | |
| Cash in BIG TIME over and over again.htm | 2018-06-12 12:42 | 5.8K | |
| MyEtherWallet Private Key-Notice.htm | 2018-06-12 12:30 | 10K | |
| Time to get your money back (1).htm | 2018-06-12 11:58 | 5.1K | |
| Not Just a Drug Mall, But a Family, Mnikoleishvili!.htm | 2018-06-11 15:40 | 8.7K | |
| I believe in the search for true, sincere love!.htm | 2018-06-11 12:58 | 4.6K | |
| Searching for a beloved prince is my main goal!.htm | 2018-06-11 10:39 | 4.6K | |
| Approved Canadian Healthcare, Mnikoleishvili.htm | 2018-06-05 07:43 | 8.1K | |
| mnikoleishvili@moh_gov_ge,LAST & FINAL WARNING NOTICE!.htm | 2018-06-05 05:15 | 5.5K | |
| Reaching out from LinkedIn.htm | 2018-06-04 12:45 | 6.2K | |
| EXTRA 26% OFF WINTER SALE, Mnikoleishvili.htm | 2018-05-31 14:01 | 9.4K | |
| The Medicine Shop with a Tender Loving Touch, Mnikoleishvili!.htm | 2018-05-30 06:43 | 8.5K | |
| $20FreeChip+200% WelcomeBonus up to $2,000!.htm | 2018-05-29 05:17 | 13K | |
| Did you get my email invite.htm | 2018-05-28 10:10 | 6.2K | |
| Viaagra Erect Pills.htm | 2018-05-28 08:41 | 4.0K | |
| Can you attend our May 2018 webinar.htm | 2018-05-23 08:38 | 6.2K | |
| Do you believe in love I am!.htm | 2018-05-18 01:53 | 4.6K | |
| I'm a princess who's waiting for her prince!.htm | 2018-05-17 23:21 | 4.6K | |
| I believe in the search for true, sincere love! (1).htm | 2018-05-16 17:22 | 4.6K | |
| Google.htm | 2018-05-16 03:29 | 4.3K | |
| L E V I T R A for the BEST PRICE _ 28% DISCOUNT, Mnikoleishvili.htm | 2018-05-15 16:26 | 8.1K | |
| Trusted Canadian Healthcare, Mnikoleishvili_.htm | 2018-05-14 09:00 | 9.2K | |
| Bonjour!.htm | 2018-05-02 17:35 | 4.2K | |
| Bonjour! (1).htm | 2018-05-02 11:23 | 4.2K | |
| Salut, mon cher_.htm | 2018-05-02 06:02 | 4.1K | |
| Salut!.htm | 2018-05-02 04:16 | 5.6K | |
| Bonjour cherie!.htm | 2018-05-01 23:00 | 5.5K | |
| Good day! (3).htm | 2018-04-30 16:54 | 4.9K | |
| Good day! (4).htm | 2018-04-30 13:28 | 4.9K | |
| Uliya.htm | 2018-04-27 11:57 | 4.2K | |
| Hello.htm | 2018-03-29 02:09 | 30K | |
| Hello! (2).htm | 2018-03-29 00:39 | 30K | |
| Hi!.htm | 2018-03-29 00:38 | 30K | |
| hi.htm | 2018-03-28 11:50 | 4.8K | |
| Your personal discount.htm | 2018-03-28 11:49 | 4.7K | |
| Hello (1).htm | 2018-03-28 04:12 | 30K | |
| Hello (2).htm | 2018-03-27 15:01 | 30K | |
| Ray Ban Factory Clearance - 90% OFF -Online Only.htm | 2018-03-23 15:09 | 13K | |
| mnikoleishvili@moh_gov_ge,LAST & FINAL WARNING NOTICE!!!.htm | 2018-03-16 14:21 | 5.2K | |
|
|---|