![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Bakuriani Rooming List.xlsx | 2025-11-21 06:53 | 11K | |
![[ ]](/icons/unknown.gif) | Bakuriani Rooming List (1).xlsx | 2025-11-21 06:53 | 11K | |
![[ ]](/icons/unknown.gif) | dashboard analitikuri moduli.docx | 2025-11-21 06:53 | 710K | |
![[ ]](/icons/unknown.gif) | Untitled (73) | 2025-11-21 06:53 | 0 | |
![[ ]](/icons/unknown.gif) | HSSP Staff Info-updated- 1_Feb_2012.docx | 2025-11-21 06:53 | 28K | |
![[ ]](/icons/layout.gif) | Final_methodology_2001-2006.pdf | 2025-11-21 06:53 | 490K | |
![[ ]](/icons/unknown.gif) | Copy of Bakuriani Rooming List.xlsx | 2025-11-21 06:53 | 11K | |
![[ ]](/icons/unknown.gif) | Birthday list_HSSP (4).doc | 2025-11-21 06:53 | 187K | |
![[ ]](/icons/unknown.gif) | test fils.rar | 2025-11-21 06:53 | 333K | |
![[IMG]](/icons/image2.gif) | image013 (8).png | 2025-11-21 06:53 | 49K | |
![[IMG]](/icons/image2.gif) | image012 (13).png | 2025-11-21 06:53 | 2.7K | |
![[IMG]](/icons/image2.gif) | image010 (19).png | 2025-11-21 06:53 | 7.4K | |
![[IMG]](/icons/image2.gif) | image008 (27).png | 2025-11-21 06:53 | 3.2K | |
![[IMG]](/icons/image2.gif) | image007 (58).jpg | 2025-11-21 06:53 | 771 | |
![[IMG]](/icons/image2.gif) | image006 (76).png | 2025-11-21 06:53 | 2.9K | |
![[IMG]](/icons/image2.gif) | image005 (116).jpg | 2025-11-21 06:53 | 964 | |
![[IMG]](/icons/image2.gif) | image004 (203).jpg | 2025-11-21 06:53 | 2.0K | |
![[IMG]](/icons/image2.gif) | image003 (390).jpg | 2025-11-21 06:53 | 755 | |
![[IMG]](/icons/image2.gif) | image002 (1054).jpg | 2025-11-21 06:53 | 789 | |
![[IMG]](/icons/image2.gif) | image001 (2169).jpg | 2025-11-21 06:53 | 69K | |
![[IMG]](/icons/image2.gif) | image001 (2168).jpg | 2025-11-21 06:53 | 69K | |
![[IMG]](/icons/image2.gif) | image001 (2167).jpg | 2025-11-21 06:53 | 1.1K | |
![[ ]](/icons/unknown.gif) | Untitled (72) | 2025-11-21 06:53 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (71) | 2025-11-21 06:53 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (70) | 2025-11-21 06:53 | 0 | |
![[IMG]](/icons/image2.gif) | Register Pharmacy.png | 2025-11-21 06:53 | 240K | |
![[ ]](/icons/unknown.gif) | Pharmacy registration form.bmml | 2025-11-21 06:53 | 58K | |
![[ ]](/icons/unknown.gif) | MDi_SOW_March_2012.docx | 2025-11-21 06:53 | 30K | |
![[IMG]](/icons/image2.gif) | Full list of pharmacies.png | 2025-11-21 06:53 | 150K | |
![[ ]](/icons/unknown.gif) | Full list of pharmacies.bmml | 2025-11-21 06:53 | 32K | |
![[ ]](/icons/unknown.gif) | სადაზღვეოს ვალიდაციები.docx | 2025-11-21 06:53 | 19K | |
![[ ]](/icons/unknown.gif) | სადაზღვეოს ვალიდაციები (2).docx | 2025-11-21 06:53 | 18K | |
![[ ]](/icons/unknown.gif) | სადაზღვეოს ვალიდაციები (1).docx | 2025-11-21 06:53 | 18K | |
![[ ]](/icons/unknown.gif) | სადაზღვეოვების ტესტირება.xlsx | 2025-11-21 06:53 | 14K | |
![[ ]](/icons/unknown.gif) | statistical forms final22_02_2012.xlsx | 2025-11-21 06:53 | 43K | |
![[ ]](/icons/unknown.gif) | dashboard administrative (vers_ 1_1).docx | 2025-11-21 06:53 | 865K | |
![[IMG]](/icons/image2.gif) | b0b841441ba1.jpg | 2025-11-21 06:53 | 79K | |
![[ ]](/icons/layout.gif) | Ticket receipt March 2012.pdf | 2025-11-21 06:53 | 129K | |
![[ ]](/icons/unknown.gif) | Regulation mockups.docx | 2025-11-21 06:53 | 15K | |
![[ ]](/icons/unknown.gif) | Regulation Module.rar | 2025-11-21 06:53 | 6.6M | |
![[ ]](/icons/unknown.gif) | Pharmaceutical module.rar | 2025-11-21 06:53 | 4.3M | |
![[IMG]](/icons/image2.gif) | Noise in japan language.jpg | 2025-11-21 06:53 | 15K | |
![[ ]](/icons/unknown.gif) | LE_COSTA_CONCORDIA_LA_MORT_D'UN_GEANT_(2).pps | 2025-11-21 06:53 | 6.1M | |
![[ ]](/icons/unknown.gif) | ვალიდაციები (1).docx | 2025-11-21 06:53 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (1189).png | 2025-11-21 06:53 | 46K | |
![[ ]](/icons/unknown.gif) | Immunization module_ Technical Document_ Draft V3_0.docx | 2025-11-21 06:53 | 2.8M | |
![[ ]](/icons/unknown.gif) | სადაზღვეოს ახალი დავალებები.docx | 2025-11-21 06:53 | 15K | |
![[ ]](/icons/unknown.gif) | ვალიდაციები.docx | 2025-11-21 06:53 | 15K | |
![[IMG]](/icons/image2.gif) | regioni- raioni.PNG | 2025-11-21 06:53 | 17K | |
![[ ]](/icons/unknown.gif) | kodebi.xls | 2025-11-21 06:53 | 28K | |
![[IMG]](/icons/image2.gif) | dab Tarigi.PNG | 2025-11-21 06:53 | 9.9K | |
![[ ]](/icons/unknown.gif) | Imunization Eng.rar | 2025-11-21 06:53 | 1.1M | |
![[ ]](/icons/unknown.gif) | Guideline for statistical formesfinal.doc | 2025-11-21 06:53 | 311K | |
![[VID]](/icons/movie.gif) | De goede buur.wmv | 2025-11-21 06:53 | 2.4M | |
![[ ]](/icons/unknown.gif) | Birthday list_HSSP (3).doc | 2025-11-21 06:53 | 187K | |
![[IMG]](/icons/image2.gif) | A1 edit.PNG | 2025-11-21 06:53 | 90K | |
![[IMG]](/icons/image2.gif) | A1.PNG | 2025-11-21 06:53 | 124K | |
![[ ]](/icons/layout.gif) | property-finder-ws-doc.pdf | 2025-11-21 06:52 | 43K | |
![[ ]](/icons/layout.gif) | enreg-ws-doc (2).pdf | 2025-11-21 06:52 | 63K | |
![[ ]](/icons/layout.gif) | enreg-ws-doc (1).pdf | 2025-11-21 06:52 | 63K | |
![[ ]](/icons/unknown.gif) | tatas.rar | 2025-11-21 06:52 | 2.9M | |
![[ ]](/icons/unknown.gif) | Profebi2011.xlsx | 2025-11-21 06:52 | 576K | |
![[ ]](/icons/unknown.gif) | Field names_drug registry_eng.docx | 2025-11-21 06:52 | 15K | |
![[ ]](/icons/unknown.gif) | Drug database_proposed fields.xlsx | 2025-11-21 06:52 | 11K | |
![[ ]](/icons/unknown.gif) | Drug_info_databases_March_22_2012.docx | 2025-11-21 06:52 | 40K | |
![[ ]](/icons/unknown.gif) | 28 March მცხეთის განრიგი (last).docx | 2025-11-21 06:52 | 16K | |
![[ ]](/icons/unknown.gif) | დანართი 4.xlsx | 2025-11-21 06:52 | 20K | |
![[ ]](/icons/layout.gif) | დანართი 4.pdf | 2025-11-21 06:52 | 284K | |
![[ ]](/icons/unknown.gif) | დანართი 3.xlsx | 2025-11-21 06:52 | 22K | |
![[ ]](/icons/layout.gif) | დანართი 3.pdf | 2025-11-21 06:52 | 287K | |
![[ ]](/icons/unknown.gif) | დანართი 2.xlsx | 2025-11-21 06:52 | 24K | |
![[ ]](/icons/layout.gif) | დანართი 2.pdf | 2025-11-21 06:52 | 301K | |
![[ ]](/icons/layout.gif) | დანართი 1.pdf | 2025-11-21 06:52 | 593K | |
![[ ]](/icons/unknown.gif) | დანართი 1.docx | 2025-11-21 06:52 | 96K | |
![[ ]](/icons/unknown.gif) | reporting module_GEO.docx | 2025-11-21 06:52 | 2.7M | |
![[ ]](/icons/unknown.gif) | out-patient module.docx | 2025-11-21 06:52 | 658K | |
![[ ]](/icons/unknown.gif) | out-patient _ENG (version 1_1).doc | 2025-11-21 06:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | module for psychiatric hospitals_ENG.doc | 2025-11-21 06:52 | 1.3M | |
![[ ]](/icons/unknown.gif) | Financing Module V1_ENG.docx | 2025-11-21 06:52 | 1.9M | |
![[ ]](/icons/unknown.gif) | Armenia delegation.docx | 2025-11-21 06:52 | 13K | |
![[ ]](/icons/unknown.gif) | Armenia Study Tour Agenda.docx | 2025-11-21 06:52 | 52K | |
![[IMG]](/icons/image2.gif) | image001 (141).gif | 2025-11-21 06:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | B1_piradobis_problema.xls | 2025-11-21 06:52 | 31K | |
![[ ]](/icons/unknown.gif) | B1_piradobis_problema (1).xls | 2025-11-21 06:52 | 31K | |
![[ ]](/icons/unknown.gif) | ActiveBenefsAndComps.xlsx | 2025-11-21 06:52 | 2.7M | |
![[ ]](/icons/unknown.gif) | A1 personal N.xls | 2025-11-21 06:52 | 38K | |
![[ ]](/icons/unknown.gif) | A1 personal N (1).xls | 2025-11-21 06:52 | 38K | |
![[ ]](/icons/unknown.gif) | modul statuss last version.xlsx | 2025-11-21 06:52 | 18K | |
![[ ]](/icons/unknown.gif) | ePrescription.pptx | 2025-11-21 06:52 | 39K | |
![[ ]](/icons/unknown.gif) | Drug_database_field_names_April_13_2012_V2.docx | 2025-11-21 06:52 | 123K | |
![[ ]](/icons/unknown.gif) | Drug_database_field_names_April_12_2012.docx | 2025-11-21 06:52 | 123K | |
![[ ]](/icons/unknown.gif) | Prescribing_features_April_19_2012.docx | 2025-11-21 06:52 | 32K | |
![[ ]](/icons/unknown.gif) | Geo NDC_.bmml | 2025-11-21 06:52 | 33K | |
![[ ]](/icons/unknown.gif) | GS_Features_April_19_2012.docx | 2025-11-21 06:52 | 22K | |
![[ ]](/icons/unknown.gif) | Basic_features_April_19_2012.docx | 2025-11-21 06:52 | 18K | |
![[ ]](/icons/unknown.gif) | A_2 საანგარიშო თარიღისათვის დარეგულირების პროცესში მყოფი პრეტენზიების სტ_ ფორმა.xls | 2025-11-21 06:52 | 124K | |
![[ ]](/icons/unknown.gif) | 4_damatebiTi wamali.bmml | 2025-11-21 06:52 | 24K | |
![[ ]](/icons/unknown.gif) | 3_.bmml | 2025-11-21 06:52 | 27K | |
![[ ]](/icons/unknown.gif) | 2.bmml | 2025-11-21 06:52 | 30K | |
![[ ]](/icons/unknown.gif) | 1.bmml | 2025-11-21 06:52 | 7.1K | |
![[ ]](/icons/unknown.gif) | რეგულირების.doc | 2025-11-21 06:52 | 697K | |
![[ ]](/icons/unknown.gif) | wamlis registracia.bmml | 2025-11-21 06:52 | 55K | |
![[ ]](/icons/unknown.gif) | wamlis baza - sruli sia.bmml | 2025-11-21 06:52 | 29K | |
![[ ]](/icons/unknown.gif) | pharma web.rar | 2025-11-21 06:52 | 24K | |
![[ ]](/icons/unknown.gif) | Untitled (69) | 2025-11-21 06:52 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (68) | 2025-11-21 06:52 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (67) | 2025-11-21 06:52 | 0 | |
![[ ]](/icons/unknown.gif) | Document For Minister.docx | 2025-11-21 06:52 | 36K | |
![[ ]](/icons/unknown.gif) | Copy of GeoNDC-ის სტრუქტურა ბოლო.xlsx | 2025-11-21 06:52 | 14K | |
![[ ]](/icons/unknown.gif) | Copy of GeoNDC-ის სტრუქტურა ბოლო (1).xlsx | 2025-11-21 06:52 | 14K | |
![[ ]](/icons/unknown.gif) | Copy of რეესტრის რეკვიზიტები ბოლო.xlsx | 2025-11-21 06:52 | 18K | |
![[IMG]](/icons/image2.gif) | wamlis registracia.png | 2025-11-21 06:52 | 225K | |
![[IMG]](/icons/image2.gif) | wamlis registracia (2).png | 2025-11-21 06:52 | 214K | |
![[IMG]](/icons/image2.gif) | wamlis registracia (1).png | 2025-11-21 06:52 | 217K | |
![[IMG]](/icons/image2.gif) | wamlis baza - sruli sia.png | 2025-11-21 06:52 | 145K | |
![[ ]](/icons/unknown.gif) | persons-without-id (1).xlsx | 2025-11-21 06:52 | 83K | |
![[ ]](/icons/layout.gif) | marriott.pdf | 2025-11-21 06:52 | 885K | |
![[ ]](/icons/unknown.gif) | e-Prescribing features2.docx | 2025-11-21 06:52 | 40K | |
![[ ]](/icons/unknown.gif) | Untitled (66) | 2025-11-21 06:52 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (65) | 2025-11-21 06:52 | 0 | |
![[ ]](/icons/unknown.gif) | ProvidersWithoutTAX.xlsx | 2025-11-21 06:52 | 107K | |
![[ ]](/icons/unknown.gif) | Persons-with-problems.xlsx | 2025-11-21 06:52 | 2.8K | |
![[ ]](/icons/unknown.gif) | Persons-with-id.xlsx | 2025-11-21 06:52 | 128K | |
![[ ]](/icons/unknown.gif) | Parenteral.docx | 2025-11-21 06:52 | 21K | |
![[ ]](/icons/unknown.gif) | General System Features3.docx | 2025-11-21 06:52 | 27K | |
![[ ]](/icons/unknown.gif) | General System Features2.docx | 2025-11-21 06:52 | 24K | |
![[ ]](/icons/unknown.gif) | ფილიალები-ლიცენზიანებართვა.xls | 2025-11-21 06:52 | 869K | |
![[ ]](/icons/unknown.gif) | ფილიალები, 1 ორგანიზაცია-შეტყობინება.xlsx | 2025-11-21 06:52 | 12K | |
![[ ]](/icons/unknown.gif) | საქმიანობები.xls | 2025-11-21 06:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | ukas cvlilebebi.bmml | 2025-11-21 06:52 | 48K | |
![[ ]](/icons/unknown.gif) | uka 2.bmml | 2025-11-21 06:52 | 47K | |
![[ ]](/icons/unknown.gif) | uka 2 (2).bmml | 2025-11-21 06:52 | 47K | |
![[ ]](/icons/unknown.gif) | uka 2 (1).bmml | 2025-11-21 06:52 | 48K | |
![[IMG]](/icons/image2.gif) | sertific.jpg | 2025-11-21 06:52 | 68K | |
![[ ]](/icons/layout.gif) | scan0167.pdf | 2025-11-21 06:52 | 342K | |
![[ ]](/icons/unknown.gif) | persons-without-reg.xlsx | 2025-11-21 06:52 | 23K | |
![[ ]](/icons/unknown.gif) | persons-without-reg (1).xlsx | 2025-11-21 06:52 | 23K | |
![[ ]](/icons/unknown.gif) | persons-without-id.xlsx | 2025-11-21 06:52 | 83K | |
![[ ]](/icons/unknown.gif) | jgufis samushao versia.bmml | 2025-11-21 06:52 | 46K | |
![[IMG]](/icons/image2.gif) | farmacia.jpg | 2025-11-21 06:52 | 18K | |
![[ ]](/icons/layout.gif) | enreg-ws-doc.pdf | 2025-11-21 06:52 | 63K | |
![[ ]](/icons/unknown.gif) | USAID (1).doc | 2025-11-21 06:52 | 22K | |
![[ ]](/icons/unknown.gif) | Taskebi (1).docx | 2025-11-21 06:52 | 23K | |
![[ ]](/icons/unknown.gif) | Persons-with-problems-new.xlsx | 2025-11-21 06:52 | 3.1K | |
![[ ]](/icons/unknown.gif) | Persons-with-problems-new (1).xlsx | 2025-11-21 06:52 | 3.1K | |
![[ ]](/icons/unknown.gif) | Persons-with-id-new.xlsx | 2025-11-21 06:52 | 127K | |
![[ ]](/icons/unknown.gif) | Persons-with-id-new (1).xlsx | 2025-11-21 06:52 | 127K | |
![[ ]](/icons/unknown.gif) | HSSP Contact Info - board.docx | 2025-11-21 06:52 | 28K | |
![[ ]](/icons/unknown.gif) | Flight Arrival and Departure Times as of 8_May_2012.xlsx | 2025-11-21 06:52 | 14K | |
![[ ]](/icons/unknown.gif) | Corrections to the drug database mockups.docx | 2025-11-21 06:52 | 18K | |
![[IMG]](/icons/image2.gif) | 62633_221622624610007_178783838893886_347618_303732225_n.jpg | 2025-11-21 06:52 | 9.2K | |
![[ ]](/icons/unknown.gif) | წამლის რეესტრი_დასაშლელი.xls | 2025-11-21 06:52 | 5.6M | |
![[ ]](/icons/unknown.gif) | რეგისტრი 2012.xls | 2025-11-21 06:52 | 7.2M | |
![[ ]](/icons/unknown.gif) | wamlis sheyvana bazashi almoast final.bmml | 2025-11-21 06:52 | 70K | |
![[ ]](/icons/unknown.gif) | ePrecribing_March_13_2012.docx | 2025-11-21 06:52 | 170K | |
![[ ]](/icons/layout.gif) | Ticket May 2012.pdf | 2025-11-21 06:52 | 133K | |
![[ ]](/icons/unknown.gif) | Standards_for_Pharmaceutical_Module_February_29_2012.docx | 2025-11-21 06:52 | 375K | |
![[ ]](/icons/unknown.gif) | Specialities.xls | 2025-11-21 06:52 | 30K | |
![[ ]](/icons/unknown.gif) | Specialities-p.xls | 2025-11-21 06:52 | 172K | |
![[ ]](/icons/unknown.gif) | Parenteral medicines.docx | 2025-11-21 06:52 | 21K | |
![[ ]](/icons/unknown.gif) | General System Features.docx | 2025-11-21 06:52 | 27K | |
![[ ]](/icons/unknown.gif) | E-Prescribing features.docx | 2025-11-21 06:52 | 40K | |
![[ ]](/icons/unknown.gif) | Drug database_Final_KT edits.bmml | 2025-11-21 06:52 | 62K | |
![[ ]](/icons/unknown.gif) | Drug database_Final_KT edits (1).bmml | 2025-11-21 06:52 | 63K | |
![[ ]](/icons/unknown.gif) | Disadvantages of ALDAGI BCI ePrescribing Software.docx | 2025-11-21 06:52 | 16K | |
![[ ]](/icons/unknown.gif) | Disadvantages of ALDAGI BCI ePrescribing Software (1).docx | 2025-11-21 06:52 | 16K | |
![[ ]](/icons/unknown.gif) | DD_registration_May 17.bmml | 2025-11-21 06:52 | 76K | |
![[ ]](/icons/unknown.gif) | DD_full list and search page_May 17.bmml | 2025-11-21 06:52 | 27K | |
![[ ]](/icons/unknown.gif) | Basic features.docx | 2025-11-21 06:52 | 18K | |
![[ ]](/icons/unknown.gif) | regulation module-certification_ENG.docx | 2025-11-21 06:52 | 416K | |
![[ ]](/icons/unknown.gif) | regulation-certification.doc | 2025-11-21 06:52 | 764K | |
![[ ]](/icons/unknown.gif) | pharma cloud specifications_draft_May 25.docx | 2025-11-21 06:52 | 78K | |
![[ ]](/icons/unknown.gif) | may 22 registration (1).bmml | 2025-11-21 06:52 | 77K | |
![[IMG]](/icons/image2.gif) | image002 (1053).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1052).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1051).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1050).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image001 (1188).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1187).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1186).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1185).png | 2025-11-21 06:52 | 14K | |
![[ ]](/icons/unknown.gif) | aftiaqebi.doc | 2025-11-21 06:52 | 696K | |
![[ ]](/icons/unknown.gif) | New Microsoft Word Document.doc | 2025-11-21 06:52 | 42K | |
![[ ]](/icons/unknown.gif) | Ideas for the Pharmacy Cloud.docx | 2025-11-21 06:52 | 67K | |
![[ ]](/icons/unknown.gif) | DD_registration_May 22.bmml | 2025-11-21 06:52 | 78K | |
![[ ]](/icons/unknown.gif) | DD_mockup_eng_KT.bmml | 2025-11-21 06:52 | 62K | |
![[ ]](/icons/layout.gif) | C__Program Files_GSSCode-Client_Html_source.pdf | 2025-11-21 06:52 | 88K | |
![[ ]](/icons/layout.gif) | C__Program Files_GSSCode-Client_Html_source (1).pdf | 2025-11-21 06:52 | 88K | |
![[ ]](/icons/unknown.gif) | CASE REGISTRATION.docx | 2025-11-21 06:52 | 639K | |
![[ ]](/icons/unknown.gif) | CASE REGISTRATION (1).docx | 2025-11-21 06:52 | 635K | |
![[ ]](/icons/unknown.gif) | ABC 24_05_ - project issues.docx | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | ABC 24_05_ - project issues (1).docx | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | 2 რეგულირების ლიცენზირებ.doc | 2025-11-21 06:52 | 782K | |
![[ ]](/icons/unknown.gif) | 1 რეგულირების სერთიფიცირება.doc | 2025-11-21 06:52 | 717K | |
![[ ]](/icons/unknown.gif) | phd prodcut list.xlsx | 2025-11-21 06:52 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1049).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1048).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1047).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1046).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1045).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1044).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1043).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1042).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1041).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1040).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1039).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1038).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1037).jpg | 2025-11-21 06:52 | 802 | |
![[IMG]](/icons/image2.gif) | image001 (1184).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1183).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1182).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1181).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1180).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1179).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1178).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1177).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1176).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1175).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1174).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1173).png | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1172).png | 2025-11-21 06:52 | 14K | |
![[ ]](/icons/unknown.gif) | xelshekrulebiT gaTvaliswinebuli samuSaos forma.xls | 2025-11-21 06:52 | 23K | |
![[ ]](/icons/unknown.gif) | may 22 registration.bmml | 2025-11-21 06:52 | 77K | |
![[ ]](/icons/unknown.gif) | e-health_ENG.pptx | 2025-11-21 06:52 | 841K | |
![[ ]](/icons/unknown.gif) | e-health_ENG (3).pptx | 2025-11-21 06:52 | 1.7M | |
![[ ]](/icons/unknown.gif) | e-health_ENG (2).pptx | 2025-11-21 06:52 | 1.7M | |
![[ ]](/icons/unknown.gif) | e-health_ENG (1).pptx | 2025-11-21 06:52 | 888K | |
![[ ]](/icons/unknown.gif) | anas samuSao forma.xls | 2025-11-21 06:52 | 23K | |
![[ ]](/icons/unknown.gif) | Update_Edits_Final _ENG.docx | 2025-11-21 06:52 | 35K | |
![[ ]](/icons/unknown.gif) | Taskebi.docx | 2025-11-21 06:52 | 23K | |
![[ ]](/icons/unknown.gif) | Notes from the meeting with My Family Clinic_May 29_KT.docx | 2025-11-21 06:52 | 18K | |
![[ ]](/icons/unknown.gif) | List of the issues to be clarified with the Ministry_e-prescription_May 31.docx | 2025-11-21 06:52 | 16K | |
![[ ]](/icons/unknown.gif) | List of the issues to be clarified with the Ministry_e-prescription_May 31 (1).docx | 2025-11-21 06:52 | 16K | |
![[ ]](/icons/unknown.gif) | List of the issues to be clarified with the Ministry_e-prescription.docx | 2025-11-21 06:52 | 15K | |
![[ ]](/icons/unknown.gif) | Features for Healthcare Cloud.docx | 2025-11-21 06:52 | 29K | |
![[ ]](/icons/unknown.gif) | Features for Healthcare Cloud (1).docx | 2025-11-21 06:52 | 29K | |
![[ ]](/icons/unknown.gif) | DD_registration_May 28.bmml | 2025-11-21 06:52 | 83K | |
![[ ]](/icons/layout.gif) | A4 Spring Berlin GE May2012-2 ge.pdf | 2025-11-21 06:52 | 706K | |
![[ ]](/icons/layout.gif) | A4 Spring Berlin GE May2012-2 en.pdf | 2025-11-21 06:52 | 554K | |
![[ ]](/icons/unknown.gif) | 29_05_2012 gauqmebuli.xlsx | 2025-11-21 06:52 | 79K | |
![[ ]](/icons/unknown.gif) | 29_05_2012 მოქმედი.xls | 2025-11-21 06:52 | 313K | |
![[ ]](/icons/unknown.gif) | 28_05-tamta (1).xls | 2025-11-21 06:52 | 92K | |
![[ ]](/icons/unknown.gif) | prescription process.bmml | 2025-11-21 06:52 | 19K | |
![[ ]](/icons/unknown.gif) | prescription History.bmml | 2025-11-21 06:52 | 10K | |
![[ ]](/icons/unknown.gif) | patient data.bmml | 2025-11-21 06:52 | 13K | |
![[ ]](/icons/unknown.gif) | mosargeblis statusi.bmml | 2025-11-21 06:52 | 60K | |
![[ ]](/icons/unknown.gif) | mosargeblis statusi (1).bmml | 2025-11-21 06:52 | 60K | |
![[IMG]](/icons/image2.gif) | licenzirebis baneri.jpg | 2025-11-21 06:52 | 50K | |
![[ ]](/icons/unknown.gif) | las vizit.bmml | 2025-11-21 06:52 | 13K | |
![[ ]](/icons/unknown.gif) | epri.rar | 2025-11-21 06:52 | 21K | |
![[ ]](/icons/unknown.gif) | drug selection.bmml | 2025-11-21 06:52 | 8.7K | |
![[ ]](/icons/unknown.gif) | diagnoze code generator.bmml | 2025-11-21 06:52 | 13K | |
![[ ]](/icons/unknown.gif) | all history.bmml | 2025-11-21 06:52 | 10K | |
![[ ]](/icons/unknown.gif) | VACATION Summer 2012.xls | 2025-11-21 06:52 | 41K | |
![[ ]](/icons/unknown.gif) | Untitled (64) | 2025-11-21 06:52 | 0 | |
![[ ]](/icons/unknown.gif) | Servise list - template.xlsx | 2025-11-21 06:52 | 11K | |
![[ ]](/icons/unknown.gif) | Servise list - template (1).xlsx | 2025-11-21 06:52 | 11K | |
![[ ]](/icons/unknown.gif) | Required info from GSDD.docx | 2025-11-21 06:52 | 28K | |
![[ ]](/icons/unknown.gif) | List of the issues clarified with the Ministry_E prescritions_ June 1.docx | 2025-11-21 06:52 | 20K | |
![[ ]](/icons/unknown.gif) | Features for Healthcare Cloud - Full.docx | 2025-11-21 06:52 | 39K | |
![[ ]](/icons/unknown.gif) | Features for Healthcare Cloud -ENG.docx | 2025-11-21 06:52 | 34K | |
![[ ]](/icons/unknown.gif) | Dublicates Personal Number.xlsx | 2025-11-21 06:52 | 37K | |
![[ ]](/icons/unknown.gif) | Dublicates Firstname Lastname Birthdate.xlsx | 2025-11-21 06:52 | 19K | |
![[IMG]](/icons/image2.gif) | 512rgXIYBIL__SS400_.jpg | 2025-11-21 06:52 | 26K | |
![[IMG]](/icons/image2.gif) | 61SifeUHVyL__SL1500_.jpg | 2025-11-21 06:52 | 67K | |
![[IMG]](/icons/image2.gif) | 51Z9sIkeAGL__SS500_.jpg | 2025-11-21 06:52 | 48K | |
![[ ]](/icons/unknown.gif) | ჯანდაცვა.docx | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | ჯანდაცვა (1).docx | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | გაერთიანებული ნაწილი-07_06_12.xls | 2025-11-21 06:52 | 1.7M | |
![[ ]](/icons/unknown.gif) | medea2012-1.pptx | 2025-11-21 06:52 | 3.7M | |
![[ ]](/icons/unknown.gif) | medea2012-1 (1).pptx | 2025-11-21 06:52 | 3.7M | |
![[IMG]](/icons/image2.gif) | dxevandeli dila ofisshi.png | 2025-11-21 06:52 | 202K | |
![[ ]](/icons/unknown.gif) | bebeficiary registr_eprescription_June 7.bmml | 2025-11-21 06:52 | 27K | |
![[ ]](/icons/unknown.gif) | VACATION Summer 2012 master (2).xls | 2025-11-21 06:52 | 39K | |
![[ ]](/icons/unknown.gif) | Select drug_Diagnosis_June8.bmml | 2025-11-21 06:52 | 35K | |
![[ ]](/icons/unknown.gif) | Select drug_Diagnosis_June8 (1).bmml | 2025-11-21 06:52 | 34K | |
![[ ]](/icons/unknown.gif) | Recepti.bmml | 2025-11-21 06:52 | 29K | |
![[ ]](/icons/unknown.gif) | Recepti (1).bmml | 2025-11-21 06:52 | 50K | |
![[ ]](/icons/unknown.gif) | New Folder.rar | 2025-11-21 06:52 | 23K | |
![[ ]](/icons/layout.gif) | MDi_Tamta_Kobakhidze_Biodata_June_7_2012.pdf | 2025-11-21 06:52 | 532K | |
![[ ]](/icons/unknown.gif) | June 12.rar | 2025-11-21 06:52 | 27K | |
![[ ]](/icons/unknown.gif) | Hot Line and Mediationშეცვლილი დადგენილების მიხედვით 06 06 2012.docx | 2025-11-21 06:52 | 572K | |
![[ ]](/icons/unknown.gif) | Hot Line and Mediationშეცვლილი დადგენილების მიხედვით 06 06 2012 (1).docx | 2025-11-21 06:52 | 572K | |
![[ ]](/icons/unknown.gif) | General info_details_eprescriptiom_June 7.bmml | 2025-11-21 06:52 | 36K | |
![[ ]](/icons/unknown.gif) | General info_details_eprescriptiom_June 7 (1).bmml | 2025-11-21 06:52 | 35K | |
![[ ]](/icons/unknown.gif) | GANSAXILVELI jUNE 8.rar | 2025-11-21 06:52 | 33K | |
![[ ]](/icons/unknown.gif) | GANSAXILVELI jUNE 8 (1).rar | 2025-11-21 06:52 | 33K | |
![[ ]](/icons/unknown.gif) | Drug base.docx | 2025-11-21 06:52 | 15K | |
![[IMG]](/icons/image2.gif) | DSCN2224.JPG | 2025-11-21 06:52 | 52K | |
![[IMG]](/icons/image2.gif) | DSCN2214.JPG | 2025-11-21 06:52 | 46K | |
![[ ]](/icons/unknown.gif) | 28_05-tamta.xls | 2025-11-21 06:52 | 92K | |
![[ ]](/icons/unknown.gif) | 4_ Drug Monogpraph_eprescription_June 7.bmml | 2025-11-21 06:52 | 117K | |
![[ ]](/icons/unknown.gif) | 4_ Drug Monogpraph_eprescription_June 7 (2).bmml | 2025-11-21 06:52 | 119K | |
![[ ]](/icons/unknown.gif) | 4_ Drug Monogpraph_eprescription_June 7 (1).bmml | 2025-11-21 06:52 | 120K | |
![[ ]](/icons/unknown.gif) | 3_ Select drug_eprescription_June 7.bmml | 2025-11-21 06:52 | 27K | |
![[ ]](/icons/unknown.gif) | 2_ Select diagnosis_eprescription_June 7.bmml | 2025-11-21 06:52 | 22K | |
![[IMG]](/icons/image2.gif) | 1_ Register Provider - license.png | 2025-11-21 06:52 | 278K | |
![[IMG]](/icons/image2.gif) | 1_ Register Provider - license (1).png | 2025-11-21 06:52 | 278K | |
![[ ]](/icons/unknown.gif) | 1_ Prescription history_eprescription_June 7.bmml | 2025-11-21 06:52 | 25K | |
![[ ]](/icons/unknown.gif) | 1_ Prescription history_eprescription_June 7 (2).bmml | 2025-11-21 06:52 | 18K | |
![[ ]](/icons/unknown.gif) | 1_ Prescription history_eprescription_June 7 (1).bmml | 2025-11-21 06:52 | 21K | |
![[ ]](/icons/unknown.gif) | წამლის მონაცემთა ბაზის რეკვიზიტებიT_T_.xlsx | 2025-11-21 06:52 | 13K | |
![[ ]](/icons/unknown.gif) | რეგულირების მოდული.pptx | 2025-11-21 06:52 | 3.0M | |
![[ ]](/icons/unknown.gif) | რეგულირების მოდული (1).pptx | 2025-11-21 06:52 | 3.0M | |
![[IMG]](/icons/image2.gif) | samedicino dawesebulebis_moduli.png | 2025-11-21 06:52 | 156K | |
![[IMG]](/icons/image2.gif) | sadazRvevo kom.png | 2025-11-21 06:52 | 153K | |
![[IMG]](/icons/image2.gif) | programuli modulis dizaini.png | 2025-11-21 06:52 | 169K | |
![[IMG]](/icons/image2.gif) | mediatoris moduli bolo.png | 2025-11-21 06:52 | 315K | |
![[IMG]](/icons/image2.gif) | ganacxadis registracia.png | 2025-11-21 06:52 | 181K | |
![[IMG]](/icons/image2.gif) | cxeli xazis moduli.png | 2025-11-21 06:52 | 243K | |
![[ ]](/icons/unknown.gif) | Untitled (63) | 2025-11-21 06:52 | 0 | |
![[ ]](/icons/unknown.gif) | Office procedures manual Georgia HSSP _Final.doc | 2025-11-21 06:52 | 64K | |
![[ ]](/icons/unknown.gif) | Hot Line_and_Mediation18_06_2012_last-1.docx | 2025-11-21 06:52 | 1.5M | |
![[ ]](/icons/unknown.gif) | HSSP Monthly Report may 2012.docx | 2025-11-21 06:52 | 114K | |
![[ ]](/icons/unknown.gif) | Drug Monogpraph_eprescription_June 13.bmml | 2025-11-21 06:52 | 116K | |
![[ ]](/icons/unknown.gif) | Birthday list_HSSP (2).doc | 2025-11-21 06:52 | 190K | |
![[ ]](/icons/unknown.gif) | Benepiciaris info.bmml | 2025-11-21 06:52 | 33K | |
![[ ]](/icons/unknown.gif) | 4_ Approval_narcotics_June 13.bmml | 2025-11-21 06:52 | 13K | |
![[ ]](/icons/unknown.gif) | 2_ Add drug and diagnosis_June 13.bmml | 2025-11-21 06:52 | 40K | |
![[ ]](/icons/unknown.gif) | 1_ Prescription history_June 13.bmml | 2025-11-21 06:52 | 27K | |
![[ ]](/icons/unknown.gif) | migeba-chabareba.docx | 2025-11-21 06:52 | 12K | |
![[ ]](/icons/unknown.gif) | migeba-chabareba (1).docx | 2025-11-21 06:52 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (424).png | 2025-11-21 06:52 | 65K | |
![[IMG]](/icons/image2.gif) | image003 (423).png | 2025-11-21 06:52 | 65K | |
![[IMG]](/icons/image2.gif) | image002 (446).png | 2025-11-21 06:52 | 90K | |
![[IMG]](/icons/image2.gif) | image002 (445).png | 2025-11-21 06:52 | 90K | |
![[IMG]](/icons/image2.gif) | image001 (1171).png | 2025-11-21 06:52 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (1170).png | 2025-11-21 06:52 | 61K | |
![[TXT]](/icons/text.gif) | Untitled attachment 00148.htm | 2025-11-21 06:52 | 92 | |
![[ ]](/icons/unknown.gif) | Prezentacia.pptx | 2025-11-21 06:52 | 2.6M | |
![[ ]](/icons/unknown.gif) | Gauqmebuli 2003 - Copy.xls | 2025-11-21 06:52 | 5.4M | |
![[ ]](/icons/unknown.gif) | After Email Downtime Login Instructions (2).docx | 2025-11-21 06:52 | 321K | |
![[ ]](/icons/unknown.gif) | After Email Downtime Login Instructions (1).docx | 2025-11-21 06:52 | 321K | |
![[ ]](/icons/unknown.gif) | A_1 test.xls | 2025-11-21 06:52 | 115K | |
![[ ]](/icons/unknown.gif) | 3_ Pharmacy interface.bmml | 2025-11-21 06:52 | 29K | |
![[ ]](/icons/unknown.gif) | მოქმედი რეესტრი.xls | 2025-11-21 06:52 | 11M | |
![[ ]](/icons/unknown.gif) | sammarTvelos ufrosis moduli.bmml | 2025-11-21 06:52 | 30K | |
![[ ]](/icons/unknown.gif) | sammarTvelos ufrosis moduli (1).bmml | 2025-11-21 06:52 | 32K | |
![[ ]](/icons/unknown.gif) | prescription.docx | 2025-11-21 06:52 | 16K | |
![[ ]](/icons/unknown.gif) | mediatoris moduli.bmml | 2025-11-21 06:52 | 31K | |
![[ ]](/icons/unknown.gif) | mediatoris moduli (2).bmml | 2025-11-21 06:52 | 30K | |
![[ ]](/icons/unknown.gif) | mediatoris moduli (1).bmml | 2025-11-21 06:52 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (422).png | 2025-11-21 06:52 | 65K | |
![[IMG]](/icons/image2.gif) | image002 (444).png | 2025-11-21 06:52 | 90K | |
![[IMG]](/icons/image2.gif) | image001 (1169).png | 2025-11-21 06:52 | 61K | |
![[ ]](/icons/unknown.gif) | ganacxadis registracia.bmml | 2025-11-21 06:52 | 67K | |
![[ ]](/icons/unknown.gif) | ganacxadis registracia (2).bmml | 2025-11-21 06:52 | 66K | |
![[ ]](/icons/unknown.gif) | ganacxadis registracia (1).bmml | 2025-11-21 06:52 | 70K | |
![[ ]](/icons/unknown.gif) | ganacxadis ganxilva (4).bmml | 2025-11-21 06:52 | 34K | |
![[ ]](/icons/unknown.gif) | ganacxadis ganxilva (3).bmml | 2025-11-21 06:52 | 35K | |
![[ ]](/icons/unknown.gif) | ganacxadis ganxilva (2).bmml | 2025-11-21 06:52 | 37K | |
![[ ]](/icons/unknown.gif) | ganacxadis ganxilva (1).bmml | 2025-11-21 06:52 | 36K | |
![[ ]](/icons/unknown.gif) | cxeli xazis moduli.bmml | 2025-11-21 06:52 | 29K | |
![[ ]](/icons/unknown.gif) | cxeli xaais moduli.bmml | 2025-11-21 06:52 | 27K | |
![[ ]](/icons/unknown.gif) | cxeli xaais moduli (2).bmml | 2025-11-21 06:52 | 31K | |
![[ ]](/icons/unknown.gif) | cxeli xaais moduli (1).bmml | 2025-11-21 06:52 | 28K | |
![[ ]](/icons/unknown.gif) | Hot Line and_Mediation24_06_2012_last.docx | 2025-11-21 06:52 | 338K | |
![[ ]](/icons/unknown.gif) | Hot Line and_Mediation22_06_2012_last-1.docx | 2025-11-21 06:52 | 332K | |
![[ ]](/icons/unknown.gif) | Eprescription_June 22.rar | 2025-11-21 06:52 | 31K | |
![[ ]](/icons/unknown.gif) | Cloud Mockups_provider_June 22.rar | 2025-11-21 06:52 | 2.7M | |
![[ ]](/icons/unknown.gif) | Cloud Design.rar | 2025-11-21 06:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | After Email Downtime Login Instructions.docx | 2025-11-21 06:52 | 323K | |
![[ ]](/icons/unknown.gif) | new ganacxadis forma mediatorisatvis.bmml | 2025-11-21 06:52 | 89K | |
![[IMG]](/icons/image2.gif) | image001 (2166).jpg | 2025-11-21 06:52 | 63K | |
![[ ]](/icons/unknown.gif) | ganacxadis ganxilva last (1).bmml | 2025-11-21 06:52 | 54K | |
![[ ]](/icons/unknown.gif) | ganacxadis ganxilva.bmml | 2025-11-21 06:52 | 50K | |
![[ ]](/icons/unknown.gif) | რესურსების გადანაწილება.xlsx | 2025-11-21 06:52 | 37K | |
![[IMG]](/icons/image2.gif) | image001 (2165).jpg | 2025-11-21 06:52 | 63K | |
![[IMG]](/icons/image2.gif) | image001 (2164).jpg | 2025-11-21 06:52 | 63K | |
![[IMG]](/icons/image2.gif) | image001 (2163).jpg | 2025-11-21 06:52 | 63K | |
![[IMG]](/icons/image2.gif) | image001 (2162).jpg | 2025-11-21 06:52 | 63K | |
![[ ]](/icons/unknown.gif) | unidentified.xls | 2025-11-21 06:52 | 561K | |
![[ ]](/icons/unknown.gif) | result (2).xls | 2025-11-21 06:52 | 35K | |
![[ ]](/icons/unknown.gif) | result (1).xls | 2025-11-21 06:52 | 43K | |
![[ ]](/icons/unknown.gif) | VACATION Summer 2012 master (1).xls | 2025-11-21 06:52 | 39K | |
![[ ]](/icons/unknown.gif) | Untitled (62) | 2025-11-21 06:52 | 0 | |
![[ ]](/icons/unknown.gif) | Lync Client Manual Install.docx | 2025-11-21 06:52 | 632K | |
![[IMG]](/icons/image2.gif) | IMG_6878.JPG | 2025-11-21 06:52 | 39K | |
![[IMG]](/icons/image2.gif) | IMG_6871.JPG | 2025-11-21 06:52 | 35K | |
![[IMG]](/icons/image2.gif) | IMG_6868.JPG | 2025-11-21 06:52 | 27K | |
![[IMG]](/icons/image2.gif) | IMG_6862.JPG | 2025-11-21 06:52 | 30K | |
![[IMG]](/icons/image2.gif) | IMG_6861.JPG | 2025-11-21 06:52 | 34K | |
![[IMG]](/icons/image2.gif) | IMG_6858.JPG | 2025-11-21 06:52 | 29K | |
![[IMG]](/icons/image2.gif) | IMG_6844.JPG | 2025-11-21 06:52 | 31K | |
![[IMG]](/icons/image2.gif) | IMG_6835.JPG | 2025-11-21 06:52 | 42K | |
![[IMG]](/icons/image2.gif) | IMG_6830.JPG | 2025-11-21 06:52 | 31K | |
![[IMG]](/icons/image2.gif) | IMG_6827.JPG | 2025-11-21 06:52 | 30K | |
![[IMG]](/icons/image2.gif) | IMG_6819.JPG | 2025-11-21 06:52 | 24K | |
![[IMG]](/icons/image2.gif) | IMG_6815.JPG | 2025-11-21 06:52 | 32K | |
![[IMG]](/icons/image2.gif) | IMG_6812.JPG | 2025-11-21 06:52 | 37K | |
![[IMG]](/icons/image2.gif) | IMG_6808.JPG | 2025-11-21 06:52 | 36K | |
![[IMG]](/icons/image2.gif) | IMG_6806.JPG | 2025-11-21 06:52 | 33K | |
![[IMG]](/icons/image2.gif) | IMG_6804.JPG | 2025-11-21 06:52 | 35K | |
![[IMG]](/icons/image2.gif) | IMG_6800.JPG | 2025-11-21 06:52 | 26K | |
![[IMG]](/icons/image2.gif) | IMG_6795.JPG | 2025-11-21 06:52 | 19K | |
![[IMG]](/icons/image2.gif) | IMG_6787.JPG | 2025-11-21 06:52 | 23K | |
![[IMG]](/icons/image2.gif) | IMG_6783.JPG | 2025-11-21 06:52 | 26K | |
![[ ]](/icons/unknown.gif) | #165 child pensioners students disabled 06 06 12.docx | 2025-11-21 06:52 | 87K | |
![[ ]](/icons/unknown.gif) | result.xls | 2025-11-21 06:52 | 1.1M | |
![[ ]](/icons/unknown.gif) | result - 6488 persons_2694.xls | 2025-11-21 06:52 | 1.5M | |
![[IMG]](/icons/image2.gif) | image001 (2161).jpg | 2025-11-21 06:52 | 458K | |
![[ ]](/icons/unknown.gif) | Regulirebis problemebi.docx | 2025-11-21 06:52 | 20K | |
![[IMG]](/icons/image2.gif) | 2 gio.PNG | 2025-11-21 06:52 | 17K | |
![[IMG]](/icons/image2.gif) | 1 sergo.PNG | 2025-11-21 06:52 | 19K | |
![[ ]](/icons/unknown.gif) | result - 6488 persons_მისამართით.xls | 2025-11-21 06:52 | 1.7M | |
![[ ]](/icons/unknown.gif) | doctors with personal numbers.xls | 2025-11-21 06:52 | 3.8M | |
![[ ]](/icons/unknown.gif) | doctors without personal numbers.xls | 2025-11-21 06:52 | 513K | |
![[ ]](/icons/unknown.gif) | Damtxvevebi.xlsx | 2025-11-21 06:52 | 9.3M | |
![[ ]](/icons/unknown.gif) | Damtxvevebi (1).xlsx | 2025-11-21 06:52 | 5.6M | |
![[ ]](/icons/unknown.gif) | Birthday list_HSSP (1).doc | 2025-11-21 06:52 | 189K | |
![[IMG]](/icons/image2.gif) | lile2.jpg | 2025-11-21 06:52 | 83K | |
![[IMG]](/icons/image2.gif) | lile1.jpg | 2025-11-21 06:52 | 108K | |
![[IMG]](/icons/image2.gif) | lile.jpg | 2025-11-21 06:52 | 102K | |
![[ ]](/icons/unknown.gif) | Filtris komponentebi.docx | 2025-11-21 06:52 | 23K | |
![[ ]](/icons/unknown.gif) | Filtris komponentebi (1).docx | 2025-11-21 06:52 | 18K | |
![[ ]](/icons/unknown.gif) | Copy of.xlsx | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | COPYOF~1 (1).XLS | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | 177 და ქონებრივი დავები (1).docx | 2025-11-21 06:52 | 20K | |
![[ ]](/icons/unknown.gif) | 027.doc | 2025-11-21 06:52 | 5.7M | |
![[ ]](/icons/unknown.gif) | შუამავალი ორგანიზაციები.docx | 2025-11-21 06:52 | 15K | |
![[ ]](/icons/unknown.gif) | დაზღვევის ტიპი.xlsx | 2025-11-21 06:52 | 9.7K | |
![[IMG]](/icons/image2.gif) | ganacxadis ganxilva last.png | 2025-11-21 06:52 | 218K | |
![[ ]](/icons/unknown.gif) | ganacxadis ganxilva last.bmml | 2025-11-21 06:52 | 56K | |
![[ ]](/icons/unknown.gif) | gadawyvetilebebi modulisatvis.docx | 2025-11-21 06:52 | 14K | |
![[ ]](/icons/unknown.gif) | VACATION Summer 2012 master.xls | 2025-11-21 06:52 | 47K | |
![[ ]](/icons/unknown.gif) | Prescription_to do_Aug 8.docx | 2025-11-21 06:52 | 23K | |
![[ ]](/icons/unknown.gif) | Prescription_comments_Moris and Sandro.docx | 2025-11-21 06:52 | 20K | |
![[ ]](/icons/unknown.gif) | Hot Line and_Mediation09_08_2012.docx | 2025-11-21 06:52 | 304K | |
![[ ]](/icons/unknown.gif) | Cloud_to do_after discussion_Aug 8.docx | 2025-11-21 06:52 | 20K | |
![[ ]](/icons/unknown.gif) | Cloud_comments_Moris and Sandro.docx | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | სადაზღვევო დაფარვები 05_07_12.xlsx | 2025-11-21 06:52 | 48K | |
![[ ]](/icons/unknown.gif) | რას ეხება სტანდატრული (1).xlsx | 2025-11-21 06:52 | 11K | |
![[ ]](/icons/unknown.gif) | პრობლემური საკითხები განხილვისთვის.docx | 2025-11-21 06:52 | 19K | |
![[ ]](/icons/unknown.gif) | ვის მიმართ.docx | 2025-11-21 06:52 | 12K | |
![[IMG]](/icons/image2.gif) | image011 (7).jpg | 2025-11-21 06:52 | 2.8K | |
![[IMG]](/icons/image2.gif) | image010 (18).png | 2025-11-21 06:52 | 2.5K | |
![[IMG]](/icons/image2.gif) | image009 (22).png | 2025-11-21 06:52 | 1.4K | |
![[IMG]](/icons/image2.gif) | image008 (26).png | 2025-11-21 06:52 | 1.2K | |
![[IMG]](/icons/image2.gif) | image007 (57).jpg | 2025-11-21 06:52 | 100K | |
![[IMG]](/icons/image2.gif) | image006 (83).jpg | 2025-11-21 06:52 | 2.8K | |
![[ ]](/icons/unknown.gif) | List of Fields for Case Registration.docx | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | List of Fields for Case Registration (1).docx | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | ტრენინგი მონაწილეთა სია v1 (2).xlsx | 2025-11-21 06:52 | 15K | |
![[ ]](/icons/unknown.gif) | ტრენინგი მონაწილეთა სია v1 (1).xlsx | 2025-11-21 06:52 | 15K | |
![[ ]](/icons/unknown.gif) | ტრეინინგის დღის წესრიგი v1 (2).xlsx | 2025-11-21 06:52 | 12K | |
![[ ]](/icons/unknown.gif) | ტრეინინგის დღის წესრიგი v1 (1).xlsx | 2025-11-21 06:52 | 12K | |
![[ ]](/icons/unknown.gif) | unknown (1).xls | 2025-11-21 06:52 | 512K | |
![[ ]](/icons/unknown.gif) | incorrect personal numbers (1).xls | 2025-11-21 06:52 | 2.3M | |
![[ ]](/icons/unknown.gif) | correct personal numbers (1).xls | 2025-11-21 06:52 | 878K | |
![[ ]](/icons/unknown.gif) | Sample- Participants info ENG.docx | 2025-11-21 06:52 | 114K | |
![[TXT]](/icons/text.gif) | ATT00001 (12).htm | 2025-11-21 06:52 | 92 | |
![[ ]](/icons/compressed.gif) | 27n - Copy.zip | 2025-11-21 06:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | შენიშვნები პროგრამაზე.docx | 2025-11-21 06:52 | 13K | |
![[ ]](/icons/unknown.gif) | ტრენინგი მონაწილეთა სია v1.xlsx | 2025-11-21 06:52 | 15K | |
![[ ]](/icons/unknown.gif) | ტრეინინგის დღის წესრიგი v1.xlsx | 2025-11-21 06:52 | 12K | |
![[ ]](/icons/unknown.gif) | სამუშაო ჯგუფები.docx | 2025-11-21 06:52 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (2160).jpg | 2025-11-21 06:52 | 8.2K | |
![[IMG]](/icons/image2.gif) | image001 (2159).jpg | 2025-11-21 06:52 | 8.2K | |
![[IMG]](/icons/image2.gif) | image001 (2158).jpg | 2025-11-21 06:52 | 8.2K | |
![[IMG]](/icons/image2.gif) | image001 (2157).jpg | 2025-11-21 06:52 | 8.2K | |
![[ ]](/icons/layout.gif) | brzaneba.pdf | 2025-11-21 06:52 | 179K | |
![[IMG]](/icons/image2.gif) | Old Database.tif | 2025-11-21 06:52 | 221K | |
![[ ]](/icons/unknown.gif) | INFOCOL_2002.rar | 2025-11-21 06:52 | 4.8M | |
![[ ]](/icons/unknown.gif) | ადოს_მომსახურების სახეები და ექიმების სპეციალობები ან თანამდებობები.doc | 2025-11-21 06:52 | 354K | |
![[ ]](/icons/unknown.gif) | unknown.xls | 2025-11-21 06:52 | 512K | |
![[ ]](/icons/unknown.gif) | satelefono kodebi.docx | 2025-11-21 06:52 | 20K | |
![[ ]](/icons/unknown.gif) | sadazRvevo kompaniebi 2.xlsx | 2025-11-21 06:52 | 41K | |
![[ ]](/icons/unknown.gif) | incorrect personal numbers.xls | 2025-11-21 06:52 | 144K | |
![[IMG]](/icons/image2.gif) | image001 (2156).jpg | 2025-11-21 06:52 | 8.2K | |
![[IMG]](/icons/image2.gif) | image001 (2155).jpg | 2025-11-21 06:52 | 8.2K | |
![[IMG]](/icons/image2.gif) | image001 (2154).jpg | 2025-11-21 06:52 | 8.2K | |
![[ ]](/icons/unknown.gif) | cvlilebebi.docx | 2025-11-21 06:52 | 17K | |
![[ ]](/icons/unknown.gif) | correct personal numbers.xls | 2025-11-21 06:52 | 3.7M | |
![[ ]](/icons/unknown.gif) | New Microsoft Office Word Document.docx | 2025-11-21 06:52 | 15K | |
![[ ]](/icons/unknown.gif) | InsuranceState programs.xlsx | 2025-11-21 06:52 | 11K | |
![[ ]](/icons/unknown.gif) | სადაზღვევო დაფარვები 30_08_12.xlsx | 2025-11-21 06:52 | 59K | |
![[ ]](/icons/unknown.gif) | სადაზღვევო დაფარვები 20_08_12.xlsx | 2025-11-21 06:52 | 57K | |
![[ ]](/icons/unknown.gif) | სადაზღვევო დაფარვები მერია20_08_12.xlsx | 2025-11-21 06:52 | 24K | |
![[ ]](/icons/unknown.gif) | რას ეხება სტანდატრული.xlsx | 2025-11-21 06:52 | 20K | |
![[ ]](/icons/unknown.gif) | მონაწილეთა მთლიანი სია (1).docx | 2025-11-21 06:52 | 28K | |
![[ ]](/icons/unknown.gif) | მონაწილეები მოდულების შესაბამისად (1).docx | 2025-11-21 06:52 | 28K | |
![[ ]](/icons/unknown.gif) | დამატებები.docx | 2025-11-21 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | erori.bmp | 2025-11-21 06:52 | 2.6M | |
![[ ]](/icons/unknown.gif) | Short Descs for Modules.docx | 2025-11-21 06:52 | 24K | |
![[ ]](/icons/unknown.gif) | 4 - EIDSS v4 Human Case Attributes for HMIS Team (1).xlsx | 2025-11-21 06:52 | 19K | |
![[IMG]](/icons/image2.gif) | 3 - Urgent Notification Form (Order 01-27 N) (1).png | 2025-11-21 06:52 | 75K | |
![[ ]](/icons/unknown.gif) | 2 - EIDSS Diagnoses with IDs (1).xls | 2025-11-21 06:52 | 48K | |
![[ ]](/icons/unknown.gif) | 1 - List of Fields for Case Registration in HMIS (EN) (1).docx | 2025-11-21 06:52 | 14K | |
![[ ]](/icons/unknown.gif) | რას ეხება სტანდატრული ბოლო 04,09,2012.xlsx | 2025-11-21 06:52 | 20K | |
![[ ]](/icons/unknown.gif) | მონაწილეთა მთლიანი სია.docx | 2025-11-21 06:52 | 28K | |
![[ ]](/icons/unknown.gif) | მონაწილეები მოდულების შესაბამისად.docx | 2025-11-21 06:52 | 28K | |
![[IMG]](/icons/image2.gif) | image003 (421).png | 2025-11-21 06:51 | 11K | |
![[ ]](/icons/unknown.gif) | CheckList-eServices.xlsx | 2025-11-21 06:51 | 216K | |
![[IMG]](/icons/image2.gif) | ATT00005 (4).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00004 (9).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00004 (8).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (22).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00003 (21).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00003 (20).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (59).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (35).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00002 (34).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (93).png | 2025-11-21 06:51 | 11K | |
![[ ]](/icons/unknown.gif) | 6-7 მოდული.docx | 2025-11-21 06:51 | 16K | |
![[ ]](/icons/unknown.gif) | 4 - EIDSS v4 Human Case Attributes for HMIS Team.xlsx | 2025-11-21 06:51 | 19K | |
![[IMG]](/icons/image2.gif) | 3 - Urgent Notification Form (Order 01-27 N).png | 2025-11-21 06:51 | 75K | |
![[ ]](/icons/unknown.gif) | 2 - EIDSS Diagnoses with IDs.xls | 2025-11-21 06:51 | 48K | |
![[ ]](/icons/unknown.gif) | 1 - List of Fields for Case Registration in HMIS (EN).docx | 2025-11-21 06:51 | 14K | |
![[ ]](/icons/unknown.gif) | რეკომენდაციები 14_09_12_.docx | 2025-11-21 06:51 | 38K | |
![[ ]](/icons/unknown.gif) | რეკომენდაციები.docx | 2025-11-21 06:51 | 32K | |
![[ ]](/icons/unknown.gif) | ელექტრონული სერვისები.pptx | 2025-11-21 06:51 | 1.1M | |
![[IMG]](/icons/image2.gif) | image005 (118).png | 2025-11-21 06:51 | 38K | |
![[IMG]](/icons/image2.gif) | image004 (179).png | 2025-11-21 06:51 | 26K | |
![[IMG]](/icons/image2.gif) | image003 (420).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (419).png | 2025-11-21 06:51 | 62K | |
![[IMG]](/icons/image2.gif) | image003 (418).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (417).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (416).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (415).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (414).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (1036).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1035).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1034).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1033).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1032).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1031).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1030).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (443).png | 2025-11-21 06:51 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (1168).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1167).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1166).png | 2025-11-21 06:51 | 63K | |
![[IMG]](/icons/image2.gif) | image001 (1165).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1164).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1163).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1162).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1161).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1160).png | 2025-11-21 06:51 | 9.6K | |
![[ ]](/icons/unknown.gif) | HMIS Fields with Comments and Action Items.xls | 2025-11-21 06:51 | 43K | |
![[ ]](/icons/unknown.gif) | ელექტრონული სერვისები.docx | 2025-11-21 06:51 | 22K | |
![[ ]](/icons/unknown.gif) | mediacion (Autosaved) (1).docx | 2025-11-21 06:51 | 852K | |
![[ ]](/icons/unknown.gif) | medea2012-1_ENG.pptx | 2025-11-21 06:51 | 3.0M | |
![[IMG]](/icons/image2.gif) | image003 (413).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (412).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (411).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (410).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (409).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (408).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (407).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (406).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (1029).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1028).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1027).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1026).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1025).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1024).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1023).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1022).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1159).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1158).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1157).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1156).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1155).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1154).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1153).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image003 (405).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (404).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (403).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (402).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (401).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (1021).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1020).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (1019).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1152).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1151).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1150).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1149).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1148).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1147).png | 2025-11-21 06:51 | 10K | |
![[ ]](/icons/unknown.gif) | eServices_Feedback_v1.xlsx | 2025-11-21 06:51 | 14K | |
![[ ]](/icons/unknown.gif) | HMIS Fields with Comments and Action Items (3) (1).xlsx | 2025-11-21 06:51 | 21K | |
![[ ]](/icons/unknown.gif) | Feedback.rar | 2025-11-21 06:51 | 421K | |
![[ ]](/icons/unknown.gif) | Copy of მედიაციის დავალებები 18 09 12.xlsx | 2025-11-21 06:51 | 15K | |
![[IMG]](/icons/image2.gif) | ATT00005 (3).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00004 (7).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (20).png | 2025-11-21 06:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | ATT00002 (58).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (92).png | 2025-11-21 06:51 | 11K | |
![[ ]](/icons/unknown.gif) | რეკომენდაციები_HSSP comments.docx | 2025-11-21 06:51 | 57K | |
![[ ]](/icons/unknown.gif) | მედიაციის დავალებები 18_09_12.xlsx | 2025-11-21 06:51 | 15K | |
![[ ]](/icons/unknown.gif) | მედიაციის დავალებები (4).xlsx | 2025-11-21 06:51 | 13K | |
![[ ]](/icons/unknown.gif) | მედიაციის დავალებები (3).xlsx | 2025-11-21 06:51 | 15K | |
![[ ]](/icons/unknown.gif) | მედიაციის დავალებები (1).xlsx | 2025-11-21 06:51 | 14K | |
![[ ]](/icons/unknown.gif) | mediacion (Autosaved).docx | 2025-11-21 06:51 | 856K | |
![[IMG]](/icons/image2.gif) | image002 (1018).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1146).png | 2025-11-21 06:51 | 9.6K | |
![[ ]](/icons/unknown.gif) | UNTITLED.PPTX | 2025-11-21 06:51 | 61K | |
![[ ]](/icons/unknown.gif) | UNTITLED (1).PPTX | 2025-11-21 06:51 | 61K | |
![[ ]](/icons/unknown.gif) | Memo For For_Case Registration Module_24 Sept_ 12.docx | 2025-11-21 06:51 | 33K | |
![[IMG]](/icons/image2.gif) | IMG_7544.JPG | 2025-11-21 06:51 | 44K | |
![[IMG]](/icons/image2.gif) | IMG_7543.JPG | 2025-11-21 06:51 | 35K | |
![[IMG]](/icons/image2.gif) | IMG_7542.JPG | 2025-11-21 06:51 | 45K | |
![[IMG]](/icons/image2.gif) | IMG_7541.JPG | 2025-11-21 06:51 | 62K | |
![[IMG]](/icons/image2.gif) | IMG_7540.JPG | 2025-11-21 06:51 | 62K | |
![[IMG]](/icons/image2.gif) | IMG_7507.JPG | 2025-11-21 06:51 | 39K | |
![[IMG]](/icons/image2.gif) | IMG_7506.JPG | 2025-11-21 06:51 | 45K | |
![[IMG]](/icons/image2.gif) | IMG_7505.JPG | 2025-11-21 06:51 | 31K | |
![[IMG]](/icons/image2.gif) | IMG_7504.JPG | 2025-11-21 06:51 | 54K | |
![[IMG]](/icons/image2.gif) | IMG_7503.JPG | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | IMG_7502.JPG | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | IMG_7501.JPG | 2025-11-21 06:51 | 64K | |
![[IMG]](/icons/image2.gif) | IMG_7500.JPG | 2025-11-21 06:51 | 73K | |
![[IMG]](/icons/image2.gif) | IMG_7499.JPG | 2025-11-21 06:51 | 53K | |
![[IMG]](/icons/image2.gif) | IMG_7498.JPG | 2025-11-21 06:51 | 54K | |
![[IMG]](/icons/image2.gif) | IMG_7497.JPG | 2025-11-21 06:51 | 60K | |
![[IMG]](/icons/image2.gif) | IMG_7496.JPG | 2025-11-21 06:51 | 56K | |
![[IMG]](/icons/image2.gif) | IMG_7495.JPG | 2025-11-21 06:51 | 44K | |
![[ ]](/icons/unknown.gif) | HMIS Fields with Comments and Action Items (3).xlsx | 2025-11-21 06:51 | 21K | |
![[ ]](/icons/unknown.gif) | HIMS-Recomendations_v1.pptx | 2025-11-21 06:51 | 1.2M | |
![[IMG]](/icons/image2.gif) | DSCN2488.JPG | 2025-11-21 06:51 | 38K | |
![[IMG]](/icons/image2.gif) | DSCN2487.JPG | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | DSCN2486.JPG | 2025-11-21 06:51 | 41K | |
![[IMG]](/icons/image2.gif) | DSCN2485.JPG | 2025-11-21 06:51 | 48K | |
![[IMG]](/icons/image2.gif) | DSCN2484.JPG | 2025-11-21 06:51 | 50K | |
![[IMG]](/icons/image2.gif) | DSCN2483.JPG | 2025-11-21 06:51 | 28K | |
![[IMG]](/icons/image2.gif) | DSCN2482.JPG | 2025-11-21 06:51 | 31K | |
![[IMG]](/icons/image2.gif) | DSCN2481.JPG | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | DSCN2480.JPG | 2025-11-21 06:51 | 46K | |
![[IMG]](/icons/image2.gif) | DSCN2479.JPG | 2025-11-21 06:51 | 41K | |
![[IMG]](/icons/image2.gif) | DSCN2478.JPG | 2025-11-21 06:51 | 43K | |
![[IMG]](/icons/image2.gif) | DSCN2477.JPG | 2025-11-21 06:51 | 25K | |
![[IMG]](/icons/image2.gif) | DSCN2476.JPG | 2025-11-21 06:51 | 39K | |
![[IMG]](/icons/image2.gif) | DSCN2475.JPG | 2025-11-21 06:51 | 30K | |
![[IMG]](/icons/image2.gif) | DSCN2474.JPG | 2025-11-21 06:51 | 48K | |
![[IMG]](/icons/image2.gif) | DSCN2473.JPG | 2025-11-21 06:51 | 45K | |
![[IMG]](/icons/image2.gif) | DSCN2472.JPG | 2025-11-21 06:51 | 56K | |
![[IMG]](/icons/image2.gif) | DSCN2471.JPG | 2025-11-21 06:51 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN2470.JPG | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | DSCN2468.JPG | 2025-11-21 06:51 | 56K | |
![[IMG]](/icons/image2.gif) | DSCN2467.JPG | 2025-11-21 06:51 | 51K | |
![[IMG]](/icons/image2.gif) | DSCN2466.JPG | 2025-11-21 06:51 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN2465.JPG | 2025-11-21 06:51 | 54K | |
![[IMG]](/icons/image2.gif) | DSCN2464.JPG | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | DSCN2462.JPG | 2025-11-21 06:51 | 67K | |
![[IMG]](/icons/image2.gif) | DSCN2461.JPG | 2025-11-21 06:51 | 23K | |
![[IMG]](/icons/image2.gif) | DSCN2460.JPG | 2025-11-21 06:51 | 23K | |
![[IMG]](/icons/image2.gif) | DSCN2459.JPG | 2025-11-21 06:51 | 34K | |
![[IMG]](/icons/image2.gif) | DSCN2458.JPG | 2025-11-21 06:51 | 44K | |
![[IMG]](/icons/image2.gif) | DSCN2457.JPG | 2025-11-21 06:51 | 48K | |
![[IMG]](/icons/image2.gif) | DSCN2456.JPG | 2025-11-21 06:51 | 44K | |
![[IMG]](/icons/image2.gif) | DSCN2455.JPG | 2025-11-21 06:51 | 30K | |
![[IMG]](/icons/image2.gif) | DSCN2454.JPG | 2025-11-21 06:51 | 47K | |
![[IMG]](/icons/image2.gif) | DSCN2453.JPG | 2025-11-21 06:51 | 47K | |
![[IMG]](/icons/image2.gif) | DSCN2452.JPG | 2025-11-21 06:51 | 31K | |
![[IMG]](/icons/image2.gif) | DSCN2451.JPG | 2025-11-21 06:51 | 30K | |
![[IMG]](/icons/image2.gif) | DSCN2450.JPG | 2025-11-21 06:51 | 36K | |
![[IMG]](/icons/image2.gif) | DSCN2449.JPG | 2025-11-21 06:51 | 56K | |
![[IMG]](/icons/image2.gif) | DSCN2448.JPG | 2025-11-21 06:51 | 53K | |
![[IMG]](/icons/image2.gif) | DSCN2447.JPG | 2025-11-21 06:51 | 36K | |
![[IMG]](/icons/image2.gif) | DSCN2446.JPG | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | DSCN2445.JPG | 2025-11-21 06:51 | 39K | |
![[IMG]](/icons/image2.gif) | DSCN2444.JPG | 2025-11-21 06:51 | 37K | |
![[IMG]](/icons/image2.gif) | DSCN2443.JPG | 2025-11-21 06:51 | 52K | |
![[IMG]](/icons/image2.gif) | DSCN2442.JPG | 2025-11-21 06:51 | 47K | |
![[IMG]](/icons/image2.gif) | DSCN2441.JPG | 2025-11-21 06:51 | 28K | |
![[IMG]](/icons/image2.gif) | DSCN2440.JPG | 2025-11-21 06:51 | 50K | |
![[IMG]](/icons/image2.gif) | DSCN2439.JPG | 2025-11-21 06:51 | 70K | |
![[IMG]](/icons/image2.gif) | DSCN2438.JPG | 2025-11-21 06:51 | 27K | |
![[IMG]](/icons/image2.gif) | DSCN2437.JPG | 2025-11-21 06:51 | 44K | |
![[IMG]](/icons/image2.gif) | DSCN2436.JPG | 2025-11-21 06:51 | 64K | |
![[IMG]](/icons/image2.gif) | DSCN2435.JPG | 2025-11-21 06:51 | 42K | |
![[IMG]](/icons/image2.gif) | DSCN2434.JPG | 2025-11-21 06:51 | 34K | |
![[IMG]](/icons/image2.gif) | DSCN2433.JPG | 2025-11-21 06:51 | 24K | |
![[IMG]](/icons/image2.gif) | DSCN2432.JPG | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | DSCN2431.JPG | 2025-11-21 06:51 | 69K | |
![[IMG]](/icons/image2.gif) | DSCN2430.JPG | 2025-11-21 06:51 | 66K | |
![[IMG]](/icons/image2.gif) | DSCN2429.JPG | 2025-11-21 06:51 | 43K | |
![[IMG]](/icons/image2.gif) | DSCN2428.JPG | 2025-11-21 06:51 | 42K | |
![[IMG]](/icons/image2.gif) | DSCN2427.JPG | 2025-11-21 06:51 | 35K | |
![[IMG]](/icons/image2.gif) | DSCN2426.JPG | 2025-11-21 06:51 | 35K | |
![[IMG]](/icons/image2.gif) | DSCN2425.JPG | 2025-11-21 06:51 | 47K | |
![[IMG]](/icons/image2.gif) | DSCN2424.JPG | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | DSCN2423.JPG | 2025-11-21 06:51 | 60K | |
![[IMG]](/icons/image2.gif) | DSCN2422.JPG | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | DSCN2421.JPG | 2025-11-21 06:51 | 52K | |
![[IMG]](/icons/image2.gif) | DSCN2420.JPG | 2025-11-21 06:51 | 34K | |
![[IMG]](/icons/image2.gif) | DSCN2419.JPG | 2025-11-21 06:51 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN2418.JPG | 2025-11-21 06:51 | 60K | |
![[IMG]](/icons/image2.gif) | DSCN2417.JPG | 2025-11-21 06:51 | 48K | |
![[IMG]](/icons/image2.gif) | DSCN2416.JPG | 2025-11-21 06:51 | 52K | |
![[IMG]](/icons/image2.gif) | DSCN2415.JPG | 2025-11-21 06:51 | 35K | |
![[IMG]](/icons/image2.gif) | DSCN2414.JPG | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | DSCN2413.JPG | 2025-11-21 06:51 | 23K | |
![[IMG]](/icons/image2.gif) | DSCN2412.JPG | 2025-11-21 06:51 | 35K | |
![[IMG]](/icons/image2.gif) | DSCN2411.JPG | 2025-11-21 06:51 | 21K | |
![[IMG]](/icons/image2.gif) | DSCN2410.JPG | 2025-11-21 06:51 | 55K | |
![[IMG]](/icons/image2.gif) | DSCN2409.JPG | 2025-11-21 06:51 | 50K | |
![[IMG]](/icons/image2.gif) | DSCN2408.JPG | 2025-11-21 06:51 | 63K | |
![[IMG]](/icons/image2.gif) | DSCN2407.JPG | 2025-11-21 06:51 | 67K | |
![[IMG]](/icons/image2.gif) | DSCN2406.JPG | 2025-11-21 06:51 | 50K | |
![[IMG]](/icons/image2.gif) | DSCN2404.JPG | 2025-11-21 06:51 | 53K | |
![[IMG]](/icons/image2.gif) | DSCN2403.JPG | 2025-11-21 06:51 | 50K | |
![[IMG]](/icons/image2.gif) | DSCN2402.JPG | 2025-11-21 06:51 | 50K | |
![[IMG]](/icons/image2.gif) | DSCN2401.JPG | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | DSCN2400.JPG | 2025-11-21 06:51 | 50K | |
![[IMG]](/icons/image2.gif) | DSCN2399.JPG | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | DSCN2398.JPG | 2025-11-21 06:51 | 59K | |
![[IMG]](/icons/image2.gif) | DSCN2397.JPG | 2025-11-21 06:51 | 38K | |
![[IMG]](/icons/image2.gif) | DSCN2396.JPG | 2025-11-21 06:51 | 56K | |
![[IMG]](/icons/image2.gif) | DSCN2395.JPG | 2025-11-21 06:51 | 40K | |
![[IMG]](/icons/image2.gif) | DSCN2394.JPG | 2025-11-21 06:51 | 43K | |
![[IMG]](/icons/image2.gif) | DSCN2393.JPG | 2025-11-21 06:51 | 36K | |
![[IMG]](/icons/image2.gif) | DSCN2392.JPG | 2025-11-21 06:51 | 36K | |
![[IMG]](/icons/image2.gif) | DSCN2391.JPG | 2025-11-21 06:51 | 39K | |
![[IMG]](/icons/image2.gif) | DSCN2390.JPG | 2025-11-21 06:51 | 37K | |
![[IMG]](/icons/image2.gif) | DSCN2389.JPG | 2025-11-21 06:51 | 39K | |
![[IMG]](/icons/image2.gif) | DSCN2388.JPG | 2025-11-21 06:51 | 34K | |
![[IMG]](/icons/image2.gif) | DSCN2387.JPG | 2025-11-21 06:51 | 59K | |
![[IMG]](/icons/image2.gif) | DSCN2386.JPG | 2025-11-21 06:51 | 33K | |
![[IMG]](/icons/image2.gif) | DSCN2385.JPG | 2025-11-21 06:51 | 31K | |
![[IMG]](/icons/image2.gif) | DSCN2384.JPG | 2025-11-21 06:51 | 60K | |
![[IMG]](/icons/image2.gif) | DSCN2383.JPG | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | DSCN2382.JPG | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | DSCN2381.JPG | 2025-11-21 06:51 | 54K | |
![[IMG]](/icons/image2.gif) | DSCN2380.JPG | 2025-11-21 06:51 | 45K | |
![[IMG]](/icons/image2.gif) | DSCN2379.JPG | 2025-11-21 06:51 | 70K | |
![[IMG]](/icons/image2.gif) | DSCN2378.JPG | 2025-11-21 06:51 | 74K | |
![[IMG]](/icons/image2.gif) | DSCN2377.JPG | 2025-11-21 06:51 | 73K | |
![[IMG]](/icons/image2.gif) | DSCN2376.JPG | 2025-11-21 06:51 | 41K | |
![[IMG]](/icons/image2.gif) | DSCN2375.JPG | 2025-11-21 06:51 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN2373.JPG | 2025-11-21 06:51 | 39K | |
![[IMG]](/icons/image2.gif) | DSCN2372.JPG | 2025-11-21 06:51 | 46K | |
![[IMG]](/icons/image2.gif) | DSCN2371.JPG | 2025-11-21 06:51 | 32K | |
![[IMG]](/icons/image2.gif) | DSCN2370.JPG | 2025-11-21 06:51 | 34K | |
![[IMG]](/icons/image2.gif) | DSCN2367.JPG | 2025-11-21 06:51 | 33K | |
![[IMG]](/icons/image2.gif) | DSCN2366.JPG | 2025-11-21 06:51 | 23K | |
![[IMG]](/icons/image2.gif) | DSCN2365.JPG | 2025-11-21 06:51 | 32K | |
![[IMG]](/icons/image2.gif) | DSCN2364.JPG | 2025-11-21 06:51 | 29K | |
![[IMG]](/icons/image2.gif) | DSCN2363.JPG | 2025-11-21 06:51 | 29K | |
![[IMG]](/icons/image2.gif) | DSCN2362.JPG | 2025-11-21 06:51 | 59K | |
![[IMG]](/icons/image2.gif) | DSCN2361.JPG | 2025-11-21 06:51 | 56K | |
![[IMG]](/icons/image2.gif) | DSCN2358.JPG | 2025-11-21 06:51 | 34K | |
![[IMG]](/icons/image2.gif) | DSCN2357.JPG | 2025-11-21 06:51 | 32K | |
![[IMG]](/icons/image2.gif) | DSCN2356.JPG | 2025-11-21 06:51 | 43K | |
![[IMG]](/icons/image2.gif) | DSCN2355.JPG | 2025-11-21 06:51 | 45K | |
![[IMG]](/icons/image2.gif) | DSCN2354.JPG | 2025-11-21 06:51 | 43K | |
![[IMG]](/icons/image2.gif) | DSCN2353.JPG | 2025-11-21 06:51 | 47K | |
![[IMG]](/icons/image2.gif) | DSCN2352.JPG | 2025-11-21 06:51 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN2351.JPG | 2025-11-21 06:51 | 38K | |
![[IMG]](/icons/image2.gif) | DSCN2350.JPG | 2025-11-21 06:51 | 36K | |
![[IMG]](/icons/image2.gif) | DSCN2349.JPG | 2025-11-21 06:51 | 36K | |
![[IMG]](/icons/image2.gif) | DSCN2348.JPG | 2025-11-21 06:51 | 53K | |
![[IMG]](/icons/image2.gif) | DSCN2347.JPG | 2025-11-21 06:51 | 56K | |
![[IMG]](/icons/image2.gif) | DSCN2346.JPG | 2025-11-21 06:51 | 60K | |
![[ ]](/icons/unknown.gif) | Copy of რას ეხება სტანდატრული ბოლო 04,09,2012.xlsx | 2025-11-21 06:51 | 20K | |
![[ ]](/icons/unknown.gif) | ATT34572.xlsx | 2025-11-21 06:51 | 38K | |
![[ ]](/icons/unknown.gif) | ATT34572 (3).xlsx | 2025-11-21 06:51 | 37K | |
![[ ]](/icons/unknown.gif) | ATT34572 (2).xlsx | 2025-11-21 06:51 | 37K | |
![[ ]](/icons/unknown.gif) | ATT34572 (1).xlsx | 2025-11-21 06:51 | 38K | |
![[IMG]](/icons/image2.gif) | ATT00003 (19).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | ATT00002 (33).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | ATT00001 (91).png | 2025-11-21 06:51 | 13K | |
![[ ]](/icons/unknown.gif) | რეკომენდაციები 21_09_2012.docx | 2025-11-21 06:51 | 168K | |
![[ ]](/icons/unknown.gif) | რეკომენდაციები 20_09_2012_v3.docx | 2025-11-21 06:51 | 113K | |
![[ ]](/icons/unknown.gif) | რეკომენდაციები 20_09_2012.docx | 2025-11-21 06:51 | 99K | |
![[ ]](/icons/unknown.gif) | რეკომენდაციები - final.docx | 2025-11-21 06:51 | 168K | |
![[ ]](/icons/unknown.gif) | მედიაციის დავალებები.xlsx | 2025-11-21 06:51 | 15K | |
![[ ]](/icons/unknown.gif) | მედიაციის დავალებები (2).xlsx | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image008 (34).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image007 (52).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | image006 (75).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image005 (117).png | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (202).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (201).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (178).png | 2025-11-21 06:51 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (400).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | image003 (399).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | image003 (398).png | 2025-11-21 06:51 | 1.2K | |
![[IMG]](/icons/image2.gif) | image003 (389).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image002 (1017).jpg | 2025-11-21 06:51 | 79K | |
![[IMG]](/icons/image2.gif) | image002 (442).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (441).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | image002 (440).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2153).jpg | 2025-11-21 06:51 | 123K | |
![[IMG]](/icons/image2.gif) | image001 (2152).jpg | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (1145).png | 2025-11-21 06:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | image001 (1144).png | 2025-11-21 06:51 | 13K | |
![[ ]](/icons/unknown.gif) | NCDC.xls | 2025-11-21 06:51 | 46K | |
![[ ]](/icons/unknown.gif) | Memo For_Outpatient Module_25 Sept_ 12.docx | 2025-11-21 06:51 | 33K | |
![[ ]](/icons/unknown.gif) | Hot Line-and_Mediation 24 09 2012.docx | 2025-11-21 06:51 | 194K | |
![[ ]](/icons/unknown.gif) | Copy of დაზღვევის კატეგორიები ssa - mediation 19 09 12.xlsx | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00006 (4).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | ATT00004 (10).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | ATT00003 (18).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (57).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (90).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (89).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (88).png | 2025-11-21 06:51 | 11K | |
![[ ]](/icons/unknown.gif) | 177 და ქონებრივი დავები.docx | 2025-11-21 06:51 | 20K | |
![[IMG]](/icons/image2.gif) | image010 (20).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image009 (21).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | image008 (33).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image008 (25).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (56).jpg | 2025-11-21 06:51 | 79K | |
![[IMG]](/icons/image2.gif) | image007 (51).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | image006 (82).jpg | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image006 (74).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image005 (116).png | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image005 (115).png | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (177).png | 2025-11-21 06:51 | 1.4K | |
![[IMG]](/icons/image2.gif) | image004 (176).png | 2025-11-21 06:51 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (397).png | 2025-11-21 06:51 | 1.2K | |
![[IMG]](/icons/image2.gif) | image003 (396).png | 2025-11-21 06:51 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (1016).jpg | 2025-11-21 06:51 | 79K | |
![[IMG]](/icons/image2.gif) | image002 (1015).jpg | 2025-11-21 06:51 | 100K | |
![[IMG]](/icons/image2.gif) | image002 (1014).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1013).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1012).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1011).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1010).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1009).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image001 (2151).jpg | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (2150).jpg | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (1143).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1142).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1141).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1140).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1139).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1138).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image017 (2).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image016 (4).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | image015 (3).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image014 (11).jpg | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image013 (7).png | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | image012 (12).png | 2025-11-21 06:51 | 1.4K | |
![[IMG]](/icons/image2.gif) | image011 (18).png | 2025-11-21 06:51 | 1.2K | |
![[IMG]](/icons/image2.gif) | image010 (19).jpg | 2025-11-21 06:51 | 79K | |
![[IMG]](/icons/image2.gif) | image009 (18).jpg | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image002 (1008).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1007).jpg | 2025-11-21 06:51 | 25K | |
![[IMG]](/icons/image2.gif) | image002 (1006).jpg | 2025-11-21 06:51 | 25K | |
![[IMG]](/icons/image2.gif) | image002 (1005).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1004).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1003).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (1002).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image001 (2149).jpg | 2025-11-21 06:51 | 36K | |
![[IMG]](/icons/image2.gif) | image001 (2148).jpg | 2025-11-21 06:51 | 36K | |
![[IMG]](/icons/image2.gif) | image001 (1137).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1136).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1135).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1134).png | 2025-11-21 06:51 | 14K | |
![[ ]](/icons/unknown.gif) | Memo For_E-Prescription Module _26 Sept_ 12.docx | 2025-11-21 06:51 | 36K | |
![[IMG]](/icons/image2.gif) | ATT00003 (17).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | ATT00002 (32).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | ATT00001 (87).png | 2025-11-21 06:51 | 13K | |
![[ ]](/icons/unknown.gif) | mediacion (Autosaved) - tata.docx | 2025-11-21 06:51 | 899K | |
![[IMG]](/icons/image2.gif) | image003 (388).jpg | 2025-11-21 06:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (387).jpg | 2025-11-21 06:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (1001).jpg | 2025-11-21 06:51 | 63K | |
![[IMG]](/icons/image2.gif) | image002 (1000).jpg | 2025-11-21 06:51 | 63K | |
![[IMG]](/icons/image2.gif) | image002 (999).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (998).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (997).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (996).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1133).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1132).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (1131).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (1130).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1129).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1128).png | 2025-11-21 06:51 | 11K | |
![[ ]](/icons/unknown.gif) | aft.xlsx | 2025-11-21 06:51 | 28K | |
![[ ]](/icons/unknown.gif) | TSK 02,10,2012.xlsx | 2025-11-21 06:51 | 16K | |
![[ ]](/icons/unknown.gif) | TSK.xlsx | 2025-11-21 06:51 | 17K | |
![[ ]](/icons/unknown.gif) | E Health Consultations.xlsx | 2025-11-21 06:51 | 114K | |
![[IMG]](/icons/image2.gif) | ATT00003 (16).jpg | 2025-11-21 06:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | ATT00002 (56).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (55).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (54).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (31).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | ATT00001 (86).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (85).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (84).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (83).png | 2025-11-21 06:51 | 11K | |
![[ ]](/icons/unknown.gif) | prefix.xlsx | 2025-11-21 06:51 | 8.8K | |
![[IMG]](/icons/image2.gif) | image002 (995).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (994).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image002 (993).jpg | 2025-11-21 06:51 | 802 | |
![[IMG]](/icons/image2.gif) | image001 (1127).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1126).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1125).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (1124).png | 2025-11-21 06:51 | 14K | |
![[ ]](/icons/unknown.gif) | Hot Line-and_Mediation 02 10 2012.docx | 2025-11-21 06:51 | 187K | |
![[ ]](/icons/unknown.gif) | recommendations_final_ENG.docx | 2025-11-21 06:51 | 137K | |
![[IMG]](/icons/image2.gif) | image005 (114).png | 2025-11-21 06:51 | 201 | |
![[IMG]](/icons/image2.gif) | image004 (175).png | 2025-11-21 06:51 | 210 | |
![[IMG]](/icons/image2.gif) | image003 (395).png | 2025-11-21 06:51 | 201 | |
![[IMG]](/icons/image2.gif) | image003 (386).jpg | 2025-11-21 06:51 | 29K | |
![[IMG]](/icons/image2.gif) | image002 (992).jpg | 2025-11-21 06:51 | 29K | |
![[IMG]](/icons/image2.gif) | image002 (439).png | 2025-11-21 06:51 | 209 | |
![[IMG]](/icons/image2.gif) | image001 (2147).jpg | 2025-11-21 06:51 | 37K | |
![[IMG]](/icons/image2.gif) | image001 (2146).jpg | 2025-11-21 06:51 | 37K | |
![[IMG]](/icons/image2.gif) | image001 (1123).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (1122).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1121).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1120).png | 2025-11-21 06:51 | 61K | |
![[ ]](/icons/unknown.gif) | fils.xlsx | 2025-11-21 06:51 | 14K | |
![[ ]](/icons/unknown.gif) | fils (1).xlsx | 2025-11-21 06:51 | 14K | |
![[ ]](/icons/unknown.gif) | files script.sql | 2025-11-21 06:51 | 17K | |
![[ ]](/icons/unknown.gif) | files script (1).sql | 2025-11-21 06:51 | 17K | |
![[ ]](/icons/unknown.gif) | e-health _GEO_all (2)- working on.pptx | 2025-11-21 06:51 | 3.5M | |
![[ ]](/icons/unknown.gif) | SSO Desk Drop - English.docx | 2025-11-21 06:51 | 87K | |
![[ ]](/icons/unknown.gif) | HIMS-Recommendations_ENG.pptx | 2025-11-21 06:51 | 1.2M | |
![[ ]](/icons/unknown.gif) | პრეზენტაციის გეგმა (3).docx | 2025-11-21 06:51 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (385).jpg | 2025-11-21 06:51 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (991).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2145).jpg | 2025-11-21 06:51 | 28K | |
![[IMG]](/icons/image2.gif) | eduard shevardnadze.jpg | 2025-11-21 06:51 | 80K | |
![[ ]](/icons/unknown.gif) | alekos (1).doc | 2025-11-21 06:51 | 218K | |
![[IMG]](/icons/image2.gif) | 533019_411042068920533_850389685_n.jpg | 2025-11-21 06:51 | 24K | |
![[IMG]](/icons/image2.gif) | 470_2519631.jpg | 2025-11-21 06:51 | 18K | |
![[IMG]](/icons/image2.gif) | 470_2519540.jpg | 2025-11-21 06:51 | 18K | |
![[ ]](/icons/unknown.gif) | (2).docx | 2025-11-21 06:51 | 56K | |
![[ ]](/icons/unknown.gif) | პრეზენტაციის გეგმა.docx | 2025-11-21 06:51 | 67K | |
![[ ]](/icons/unknown.gif) | პრეზენტაციის გეგმა (2)old wind_ version.doc | 2025-11-21 06:51 | 222K | |
![[ ]](/icons/unknown.gif) | პრეზენტაციის გეგმა (2).docx | 2025-11-21 06:51 | 57K | |
![[ ]](/icons/unknown.gif) | პრეზენტაციის გეგმა (1).docx | 2025-11-21 06:51 | 52K | |
![[ ]](/icons/layout.gif) | fizikuri piris qonebrivi deklaracia.pdf | 2025-11-21 06:51 | 141K | |
![[ ]](/icons/unknown.gif) | alekos.doc | 2025-11-21 06:51 | 232K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation_V3_Oct 17, 2012.pptx | 2025-11-21 06:51 | 7.0M | |
![[ ]](/icons/unknown.gif) | HMIS Presentation_V3_Oct 17, 2012 (1).pptx | 2025-11-21 06:51 | 7.0M | |
![[IMG]](/icons/image2.gif) | nastia.jpg | 2025-11-21 06:51 | 83K | |
![[IMG]](/icons/image2.gif) | image007 (55).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (73).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (113).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (174).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (384).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (383).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (382).jpg | 2025-11-21 06:51 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (990).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (989).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (438).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (437).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2144).jpg | 2025-11-21 06:51 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (1119).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1118).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1117).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1116).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | Untitled (63).png | 2025-11-21 06:51 | 44K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation-GEO-V4-Oct 19, 2012.pptx | 2025-11-21 06:51 | 7.0M | |
![[ ]](/icons/unknown.gif) | HMIS Presentation -ENG-V4-Oct 19, 2012.pptx | 2025-11-21 06:51 | 7.3M | |
![[IMG]](/icons/image2.gif) | ATT00002 (53).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (82).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | 32305_359606624127393_1387808145_n.jpg | 2025-11-21 06:51 | 62K | |
![[IMG]](/icons/image2.gif) | 13450_133748469984322_939178_n.jpg | 2025-11-21 06:51 | 25K | |
![[IMG]](/icons/image2.gif) | image003 (381).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (380).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (436).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (435).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2143).jpg | 2025-11-21 06:51 | 6.5K | |
![[IMG]](/icons/image2.gif) | image001 (1115).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1114).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | Resolution BUG.jpg | 2025-11-21 06:51 | 192K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation-GEO-V6-Oct 19 2012.pptx | 2025-11-21 06:51 | 7.2M | |
![[ ]](/icons/unknown.gif) | HMIS Presentation -ENG-V6-Oct 19, 2012.pptx | 2025-11-21 06:51 | 7.4M | |
![[IMG]](/icons/image2.gif) | ATT00003 (15).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (14).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (13).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (30).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00002 (29).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00002 (28).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (81).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00001 (80).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00001 (79).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | 22102012.jpg | 2025-11-21 06:51 | 41K | |
![[IMG]](/icons/image2.gif) | 22102012(005).jpg | 2025-11-21 06:51 | 50K | |
![[IMG]](/icons/image2.gif) | 22102012(003).jpg | 2025-11-21 06:51 | 37K | |
![[IMG]](/icons/image2.gif) | 22102012(002).jpg | 2025-11-21 06:51 | 43K | |
![[IMG]](/icons/image2.gif) | 22102012(001).jpg | 2025-11-21 06:51 | 46K | |
![[ ]](/icons/unknown.gif) | import-export.xlsx | 2025-11-21 06:51 | 9.5K | |
![[IMG]](/icons/image2.gif) | image004 (200).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (199).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (198).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (197).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (196).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (394).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (393).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (392).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (391).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (390).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (379).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (378).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (377).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (434).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (433).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (432).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (431).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (430).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (429).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (428).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (427).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1113).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1112).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1111).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1110).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1109).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1108).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1107).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1106).png | 2025-11-21 06:51 | 10K | |
![[ ]](/icons/unknown.gif) | Problem Identification Task (2).docx | 2025-11-21 06:51 | 52K | |
![[ ]](/icons/unknown.gif) | Pharmacy Inspection.xlsx | 2025-11-21 06:51 | 88K | |
![[ ]](/icons/unknown.gif) | თათა_საბეჭდი ვერსიები.xls | 2025-11-21 06:51 | 231K | |
![[IMG]](/icons/image2.gif) | image007 (54).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (53).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (52).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (51).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (72).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (71).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (70).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (69).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (112).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (111).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (110).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (109).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (173).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (172).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (171).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (170).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (376).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (375).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (374).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (373).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (426).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (425).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (424).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (423).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2142).jpg | 2025-11-21 06:51 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (1105).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1104).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1103).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1102).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (12).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (11).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (27).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00002 (26).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (78).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00001 (77).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image022 (1).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image021 (2).png | 2025-11-21 06:51 | 8.6K | |
![[IMG]](/icons/image2.gif) | image020 (2).png | 2025-11-21 06:51 | 6.8K | |
![[IMG]](/icons/image2.gif) | image019 (1).png | 2025-11-21 06:51 | 14K | |
![[IMG]](/icons/image2.gif) | image018 (4).png | 2025-11-21 06:51 | 24K | |
![[IMG]](/icons/image2.gif) | image017 (3).png | 2025-11-21 06:51 | 24K | |
![[IMG]](/icons/image2.gif) | image016 (3).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image015 (2).png | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image014 (3).png | 2025-11-21 06:51 | 9.3K | |
![[IMG]](/icons/image2.gif) | image013 (6).png | 2025-11-21 06:51 | 5.4K | |
![[IMG]](/icons/image2.gif) | image012 (11).png | 2025-11-21 06:51 | 1.6K | |
![[IMG]](/icons/image2.gif) | image011 (17).png | 2025-11-21 06:51 | 5.5K | |
![[IMG]](/icons/image2.gif) | image010 (17).png | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image009 (20).png | 2025-11-21 06:51 | 53K | |
![[IMG]](/icons/image2.gif) | image008 (24).png | 2025-11-21 06:51 | 62K | |
![[IMG]](/icons/image2.gif) | image007 (50).png | 2025-11-21 06:51 | 5.2K | |
![[IMG]](/icons/image2.gif) | image007 (50).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (49).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (48).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (68).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (67).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (66).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (65).png | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image005 (108).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (107).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (106).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (105).png | 2025-11-21 06:51 | 2.0K | |
![[IMG]](/icons/image2.gif) | image004 (195).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (169).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (168).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (167).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (166).png | 2025-11-21 06:51 | 6.1K | |
![[IMG]](/icons/image2.gif) | image003 (389).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (388).png | 2025-11-21 06:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | image003 (372).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (371).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (370).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (422).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (421).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (420).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (419).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (418).png | 2025-11-21 06:51 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (1101).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1100).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1099).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1098).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1097).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1096).png | 2025-11-21 06:51 | 6.5K | |
![[ ]](/icons/unknown.gif) | bugs.docx | 2025-11-21 06:51 | 31K | |
![[ ]](/icons/unknown.gif) | Problem Identification Task (1).docx | 2025-11-21 06:51 | 52K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation-GEO-V7 - 31 Oct 12.pptx | 2025-11-21 06:51 | 7.2M | |
![[ ]](/icons/unknown.gif) | რედაქტირება (1).docx | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (387).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (417).png | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image002 (416).png | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image002 (415).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1095).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1094).png | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (1093).png | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (1092).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1091).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1090).png | 2025-11-21 06:51 | 10K | |
![[ ]](/icons/layout.gif) | HMIS Presentation-GEO-FIN.pdf | 2025-11-21 06:51 | 5.0M | |
![[ ]](/icons/unknown.gif) | HMIS Presentation -ENG-FINII.pptx | 2025-11-21 06:51 | 9.7M | |
![[ ]](/icons/layout.gif) | HMIS Presentation -ENG-FIN.pdf | 2025-11-21 06:51 | 4.5M | |
![[ ]](/icons/unknown.gif) | რედაქტირება.docx | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image008 (23).png | 2025-11-21 06:51 | 32K | |
![[IMG]](/icons/image2.gif) | image007 (49).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image007 (48).png | 2025-11-21 06:51 | 32K | |
![[IMG]](/icons/image2.gif) | image006 (64).png | 2025-11-21 06:51 | 8.4K | |
![[IMG]](/icons/image2.gif) | image006 (63).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image005 (104).png | 2025-11-21 06:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | image005 (103).png | 2025-11-21 06:51 | 8.4K | |
![[IMG]](/icons/image2.gif) | image004 (165).png | 2025-11-21 06:51 | 20K | |
![[IMG]](/icons/image2.gif) | image004 (164).png | 2025-11-21 06:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | image003 (386).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (385).png | 2025-11-21 06:51 | 6.0K | |
![[IMG]](/icons/image2.gif) | image003 (384).png | 2025-11-21 06:51 | 20K | |
![[IMG]](/icons/image2.gif) | image002 (414).png | 2025-11-21 06:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | image002 (413).png | 2025-11-21 06:51 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (412).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (411).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1089).png | 2025-11-21 06:51 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (1088).png | 2025-11-21 06:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | image001 (1087).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1086).png | 2025-11-21 06:51 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (1085).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1084).png | 2025-11-21 06:51 | 10K | |
![[ ]](/icons/unknown.gif) | Tamta Kobakhidze referencecheck.doc | 2025-11-21 06:51 | 74K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation-GEO-FINAL.pptx | 2025-11-21 06:51 | 9.4M | |
![[ ]](/icons/layout.gif) | HMIS Presentation-GEO-FINAL.pdf | 2025-11-21 06:51 | 5.0M | |
![[ ]](/icons/unknown.gif) | HMIS Presentation -ENG-FINAL.pptx | 2025-11-21 06:51 | 9.7M | |
![[ ]](/icons/layout.gif) | HMIS Presentation -ENG-FINAL.pdf | 2025-11-21 06:51 | 4.6M | |
![[ ]](/icons/unknown.gif) | ExternalJobApp2008-07-16.doc | 2025-11-21 06:51 | 101K | |
![[ ]](/icons/layout.gif) | scan0005.pdf | 2025-11-21 06:51 | 182K | |
![[IMG]](/icons/image2.gif) | image007 (47).png | 2025-11-21 06:51 | 51K | |
![[IMG]](/icons/image2.gif) | image006 (62).png | 2025-11-21 06:51 | 51K | |
![[IMG]](/icons/image2.gif) | image006 (61).png | 2025-11-21 06:51 | 51K | |
![[IMG]](/icons/image2.gif) | image006 (60).png | 2025-11-21 06:51 | 51K | |
![[IMG]](/icons/image2.gif) | image006 (59).png | 2025-11-21 06:51 | 51K | |
![[IMG]](/icons/image2.gif) | image006 (58).png | 2025-11-21 06:51 | 51K | |
![[IMG]](/icons/image2.gif) | image005 (102).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image005 (101).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image005 (100).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image005 (99).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image005 (98).png | 2025-11-21 06:51 | 61K | |
![[IMG]](/icons/image2.gif) | image004 (163).png | 2025-11-21 06:51 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (162).png | 2025-11-21 06:51 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (161).png | 2025-11-21 06:51 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (160).png | 2025-11-21 06:51 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (159).png | 2025-11-21 06:51 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (383).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (382).png | 2025-11-21 06:51 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (381).png | 2025-11-21 06:51 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (380).png | 2025-11-21 06:51 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (379).png | 2025-11-21 06:51 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (378).png | 2025-11-21 06:51 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (410).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (409).png | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | image002 (408).png | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | image002 (407).png | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | image002 (406).png | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | image002 (405).png | 2025-11-21 06:51 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (1083).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1082).png | 2025-11-21 06:51 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (1081).png | 2025-11-21 06:51 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (1080).png | 2025-11-21 06:51 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (1079).png | 2025-11-21 06:51 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (1078).png | 2025-11-21 06:51 | 15K | |
![[ ]](/icons/unknown.gif) | Presentation12 - ketis edits.pptx | 2025-11-21 06:51 | 4.8M | |
![[ ]](/icons/unknown.gif) | HSSP Project and Team Hilight_ENG.docx | 2025-11-21 06:51 | 95K | |
![[IMG]](/icons/image2.gif) | ATT00002 (25).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00002 (24).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image012 (10).png | 2025-11-21 06:51 | 5.7K | |
![[IMG]](/icons/image2.gif) | image011 (16).png | 2025-11-21 06:51 | 6.1K | |
![[IMG]](/icons/image2.gif) | image010 (16).png | 2025-11-21 06:51 | 4.2K | |
![[IMG]](/icons/image2.gif) | image009 (19).png | 2025-11-21 06:51 | 6.0K | |
![[IMG]](/icons/image2.gif) | image008 (22).png | 2025-11-21 06:51 | 7.2K | |
![[IMG]](/icons/image2.gif) | image007 (46).png | 2025-11-21 06:51 | 9.4K | |
![[IMG]](/icons/image2.gif) | image006 (57).png | 2025-11-21 06:51 | 9.7K | |
![[IMG]](/icons/image2.gif) | image005 (97).png | 2025-11-21 06:51 | 5.1K | |
![[IMG]](/icons/image2.gif) | image004 (158).png | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | image004 (157).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (156).png | 2025-11-21 06:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | image003 (377).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (376).png | 2025-11-21 06:51 | 4.5K | |
![[IMG]](/icons/image2.gif) | image003 (375).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (374).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (404).png | 2025-11-21 06:51 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (403).png | 2025-11-21 06:51 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (402).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (401).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1077).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1076).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1075).png | 2025-11-21 06:51 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (1074).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1073).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1072).png | 2025-11-21 06:51 | 39K | |
![[IMG]](/icons/image2.gif) | image001 (1071).png | 2025-11-21 06:51 | 39K | |
![[IMG]](/icons/image2.gif) | hssp_logo_ge_bw.png | 2025-11-21 06:51 | 49K | |
![[IMG]](/icons/image2.gif) | hssp_logo_ge.png | 2025-11-21 06:51 | 124K | |
![[IMG]](/icons/image2.gif) | hssp_logo_en_bw.png | 2025-11-21 06:51 | 43K | |
![[IMG]](/icons/image2.gif) | hssp_logo_en.png | 2025-11-21 06:51 | 111K | |
![[ ]](/icons/unknown.gif) | eCTD საქართველო.docx | 2025-11-21 06:51 | 43K | |
![[ ]](/icons/unknown.gif) | GiTi _General Overview_draft.docx | 2025-11-21 06:51 | 22K | |
![[ ]](/icons/unknown.gif) | GiTi _General Overview_draft (1).docx | 2025-11-21 06:51 | 20K | |
![[IMG]](/icons/image2.gif) | ATT00002 (23).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00001 (76).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1070).png | 2025-11-21 06:51 | 39K | |
![[ ]](/icons/unknown.gif) | GiTi _General Overview.docx | 2025-11-21 06:51 | 23K | |
![[ ]](/icons/unknown.gif) | GITi Presentation_ENG.pptx | 2025-11-21 06:51 | 4.8M | |
![[ ]](/icons/unknown.gif) | GITI2012_2.docx | 2025-11-21 06:51 | 84K | |
![[ ]](/icons/unknown.gif) | GITI2012-Application_B.doc | 2025-11-21 06:51 | 212K | |
![[ ]](/icons/unknown.gif) | GITI2012-Application_A.doc | 2025-11-21 06:51 | 237K | |
![[IMG]](/icons/image2.gif) | ATT00002 (22).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (988).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (987).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1069).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1068).png | 2025-11-21 06:51 | 12K | |
![[ ]](/icons/unknown.gif) | References_GIS_Admin_forOA_v4_GG.xlsx | 2025-11-21 06:51 | 938K | |
![[ ]](/icons/unknown.gif) | HMIS - EIDSS Integration Action Items List, 14_11_2012.xls | 2025-11-21 06:51 | 28K | |
![[ ]](/icons/unknown.gif) | EIDSS Open Architechture Description.doc | 2025-11-21 06:51 | 180K | |
![[ ]](/icons/unknown.gif) | EIDSS OA Link and Methods.doc | 2025-11-21 06:51 | 30K | |
![[IMG]](/icons/image2.gif) | ATT00003 (10).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (52).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (21).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00001 (75).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (986).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (985).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (984).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1067).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1066).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1065).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00002 (51).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (50).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (49).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (74).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00001 (73).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00001 (72).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | 2012-11-19-666.jpg | 2025-11-21 06:51 | 1.5M | |
![[IMG]](/icons/image2.gif) | image003 (373).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (983).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1064).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00006 (3).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00005 (2).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00004 (9).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00004 (6).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (19).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00003 (9).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (48).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (20).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (71).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (372).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (371).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (370).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (982).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (981).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (980).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1063).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1062).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1061).png | 2025-11-21 06:51 | 11K | |
![[ ]](/icons/unknown.gif) | Technical Coordinator SOW.docx | 2025-11-21 06:51 | 24K | |
![[ ]](/icons/layout.gif) | GITI2012 Press Release_Nov 15_GEO.pdf | 2025-11-21 06:51 | 173K | |
![[ ]](/icons/unknown.gif) | Abt Associates Vacancy Announcement_Developer-Coder_doc.doc | 2025-11-21 06:51 | 34K | |
![[ ]](/icons/unknown.gif) | stock.xlsx | 2025-11-21 06:51 | 239K | |
![[IMG]](/icons/image2.gif) | image003 (369).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (979).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (400).png | 2025-11-21 06:51 | 615 | |
![[IMG]](/icons/image2.gif) | image001 (1060).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1059).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1058).png | 2025-11-21 06:51 | 530 | |
![[ ]](/icons/unknown.gif) | StockCards_v1_0.xls | 2025-11-21 06:51 | 22M | |
![[ ]](/icons/unknown.gif) | Immunization_standards_November_5_2012_V2.docx | 2025-11-21 06:51 | 25K | |
![[ ]](/icons/layout.gif) | ALB_Immunization Information System.pdf | 2025-11-21 06:51 | 1.5M | |
![[ ]](/icons/layout.gif) | ALB_IIS Albania leaflet 19Oct23.pdf | 2025-11-21 06:51 | 620K | |
![[IMG]](/icons/image2.gif) | 198293_457915340921644_1255334482_n.jpg | 2025-11-21 06:51 | 20K | |
![[IMG]](/icons/image2.gif) | image001 (1057).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1056).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00005 (3).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00004 (8).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00003 (18).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00002 (47).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (70).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image008 (21).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image007 (47).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (56).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (155).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (154).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (369).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (368).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (368).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (978).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (399).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (398).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1055).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1054).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1053).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1052).png | 2025-11-21 06:51 | 10K | |
![[IMG]](/icons/image2.gif) | __________.jpg | 2025-11-21 06:51 | 71K | |
![[ ]](/icons/unknown.gif) | Stock Management (4).docx | 2025-11-21 06:51 | 19K | |
![[IMG]](/icons/image2.gif) | ATT00005 (2).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00004 (7).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00003 (17).png | 2025-11-21 06:51 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00002 (46).jpg | 2025-11-21 06:51 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (69).png | 2025-11-21 06:51 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (367).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (397).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1051).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (140).gif | 2025-11-21 06:50 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (139).gif | 2025-11-21 06:50 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (138).gif | 2025-11-21 06:50 | 2.0K | |
![[ ]](/icons/layout.gif) | Tamta Kobakhidze Offer Letter Signed.pdf | 2025-11-21 06:50 | 407K | |
![[ ]](/icons/layout.gif) | New Employee Policies Acknowledgment.pdf | 2025-11-21 06:50 | 37K | |
![[ ]](/icons/layout.gif) | Kobakhidze Tamta Project Assist 9.pdf | 2025-11-21 06:50 | 29K | |
![[ ]](/icons/layout.gif) | INTERNATIONAL EMPLOYEE HANDBOOK 2009.pdf | 2025-11-21 06:50 | 72K | |
![[ ]](/icons/layout.gif) | Code of Conduct 2008.pdf | 2025-11-21 06:50 | 2.4M | |
![[IMG]](/icons/image2.gif) | image007 (45).png | 2025-11-21 06:50 | 5.3K | |
![[IMG]](/icons/image2.gif) | image007 (44).png | 2025-11-21 06:50 | 5.3K | |
![[IMG]](/icons/image2.gif) | image006 (81).jpg | 2025-11-21 06:50 | 411 | |
![[IMG]](/icons/image2.gif) | image006 (80).jpg | 2025-11-21 06:50 | 411 | |
![[IMG]](/icons/image2.gif) | image004 (194).jpg | 2025-11-21 06:50 | 423 | |
![[IMG]](/icons/image2.gif) | image004 (193).jpg | 2025-11-21 06:50 | 423 | |
![[IMG]](/icons/image2.gif) | image003 (367).jpg | 2025-11-21 06:50 | 406 | |
![[IMG]](/icons/image2.gif) | image003 (366).jpg | 2025-11-21 06:50 | 406 | |
![[IMG]](/icons/image2.gif) | image002 (977).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (976).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1050).png | 2025-11-21 06:50 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (137).gif | 2025-11-21 06:50 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (136).gif | 2025-11-21 06:50 | 2.0K | |
![[IMG]](/icons/image2.gif) | Tata Kobakhidze -signed doc_.bmp | 2025-11-21 06:50 | 11M | |
![[ ]](/icons/layout.gif) | Georgia Benefits Summary July 2009.pdf | 2025-11-21 06:50 | 38K | |
![[ ]](/icons/layout.gif) | Georgia Benefits Summary July 2009 (1).pdf | 2025-11-21 06:50 | 38K | |
![[ ]](/icons/unknown.gif) | imunizacia ადმინ.docx | 2025-11-21 06:50 | 840K | |
![[IMG]](/icons/image2.gif) | image004 (153).png | 2025-11-21 06:50 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (365).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (975).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (974).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (396).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1049).png | 2025-11-21 06:50 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (1048).png | 2025-11-21 06:50 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (1047).png | 2025-11-21 06:50 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1046).png | 2025-11-21 06:50 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1045).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | KITTIE IS LOOKING FOR A NEW HOME Geo.docx | 2025-11-21 06:50 | 2.7M | |
![[ ]](/icons/unknown.gif) | KITTIE IS LOOKING FOR A NEW HOME Geo (1).docx | 2025-11-21 06:50 | 2.7M | |
![[IMG]](/icons/image2.gif) | ATT00061.png | 2025-11-21 06:50 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00058.jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00055.png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00052.png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (364).jpg | 2025-11-21 06:50 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (363).jpg | 2025-11-21 06:50 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (973).jpg | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (972).jpg | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (971).jpg | 2025-11-21 06:50 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (970).jpg | 2025-11-21 06:50 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (2141).jpg | 2025-11-21 06:50 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (2140).jpg | 2025-11-21 06:50 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (2139).jpg | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2138).jpg | 2025-11-21 06:50 | 11K | |
![[ ]](/icons/unknown.gif) | Module Descriptions - revised- draft (1).docx | 2025-11-21 06:50 | 153K | |
![[IMG]](/icons/image2.gif) | image001 (1044).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | Questtionaire for Celebration New Year 2013_N_B_.xlsx | 2025-11-21 06:50 | 12K | |
![[ ]](/icons/unknown.gif) | Questtionaire for Celebration New Year 2013.xlsx | 2025-11-21 06:50 | 12K | |
![[ ]](/icons/unknown.gif) | Open Architechture_Data transmission_UPD.doc | 2025-11-21 06:50 | 194K | |
![[IMG]](/icons/image2.gif) | 403375_10151293828409025_2111785884_n.jpg | 2025-11-21 06:50 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (1043).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | Module Descriptions - revised- draft.docx | 2025-11-21 06:50 | 155K | |
![[IMG]](/icons/image2.gif) | ATT00001 (68).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (2137).jpg | 2025-11-21 06:50 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (2136).jpg | 2025-11-21 06:50 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (2135).jpg | 2025-11-21 06:50 | 29K | |
![[ ]](/icons/unknown.gif) | Stock Management (3).docx | 2025-11-21 06:50 | 19K | |
![[ ]](/icons/unknown.gif) | Country Codes.xls | 2025-11-21 06:50 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1042).png | 2025-11-21 06:50 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (1041).png | 2025-11-21 06:50 | 57K | |
![[ ]](/icons/unknown.gif) | Stock Management (2).docx | 2025-11-21 06:50 | 20K | |
![[ ]](/icons/layout.gif) | BTRP_UserGuide Eglish_pdf.pdf | 2025-11-21 06:50 | 2.9M | |
![[IMG]](/icons/image2.gif) | image003 (366).png | 2025-11-21 06:50 | 57K | |
![[IMG]](/icons/image2.gif) | image002 (969).jpg | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | Stock Management (1).docx | 2025-11-21 06:50 | 24K | |
![[IMG]](/icons/image2.gif) | IMAG0650.jpg | 2025-11-21 06:50 | 712K | |
![[IMG]](/icons/image2.gif) | IMAG0649.jpg | 2025-11-21 06:50 | 667K | |
![[IMG]](/icons/image2.gif) | IMAG0648.jpg | 2025-11-21 06:50 | 839K | |
![[IMG]](/icons/image2.gif) | IMAG0647.jpg | 2025-11-21 06:50 | 838K | |
![[IMG]](/icons/image2.gif) | IMAG0646.jpg | 2025-11-21 06:50 | 750K | |
![[IMG]](/icons/image2.gif) | 196186_377163435711856_1986535794_n.jpg | 2025-11-21 06:50 | 50K | |
![[ ]](/icons/unknown.gif) | imunizacia momxmarebeli.docx | 2025-11-21 06:50 | 1.6M | |
![[IMG]](/icons/image2.gif) | image003 (365).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (364).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (395).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (394).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (393).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (392).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (391).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1040).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1039).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1038).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | Questtionaire for Celebration New Year 2013-FIN.xlsx | 2025-11-21 06:50 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (2134).jpg | 2025-11-21 06:50 | 194K | |
![[IMG]](/icons/image2.gif) | image001 (2133).jpg | 2025-11-21 06:50 | 194K | |
![[IMG]](/icons/image2.gif) | image001 (2132).jpg | 2025-11-21 06:50 | 30K | |
![[IMG]](/icons/image2.gif) | image001 (1037).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1036).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | Stock Management.docx | 2025-11-21 06:50 | 29K | |
![[IMG]](/icons/image2.gif) | ATT00001 (67).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | sawyobi00.doc | 2025-11-21 06:50 | 96K | |
![[IMG]](/icons/image2.gif) | image001 (1035).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1034).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1033).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1032).png | 2025-11-21 06:50 | 20K | |
![[ ]](/icons/unknown.gif) | OrganizationsFull.xlsx | 2025-11-21 06:50 | 944K | |
![[ ]](/icons/unknown.gif) | Medical Facilities_Reporting Sheet_V2_Final_Dec 27 2012 (2).xls | 2025-11-21 06:50 | 537K | |
![[ ]](/icons/unknown.gif) | Medical Facilities-FINAL.xlsx | 2025-11-21 06:50 | 169K | |
![[ ]](/icons/unknown.gif) | Medical Facilities-FINAL (1).xlsx | 2025-11-21 06:50 | 35K | |
![[ ]](/icons/unknown.gif) | Financial_Model_for_PHC_in_Georgia_update_GEO_01(1)_12_06.xls | 2025-11-21 06:50 | 806K | |
![[ ]](/icons/unknown.gif) | Copy of პასპორტი დაწესებულება-27_12.xlsx | 2025-11-21 06:50 | 27K | |
![[ ]](/icons/unknown.gif) | საბოლოოო!!!!!.xlsx | 2025-11-21 06:50 | 286K | |
![[ ]](/icons/unknown.gif) | პასპორტი ამბულატორია-ცვლილებებით.xlsx | 2025-11-21 06:50 | 34K | |
![[ ]](/icons/unknown.gif) | ინსტრუქცია 1.docx | 2025-11-21 06:50 | 20K | |
![[ ]](/icons/unknown.gif) | Medical Facilities_Reporting Sheet_V2_Final_Dec 27 2012 (1).xls | 2025-11-21 06:50 | 533K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation - NCDC - FINAL_Dec 28.pptx | 2025-11-21 06:50 | 7.8M | |
![[ ]](/icons/unknown.gif) | Description of Modules - AHMAD - accapted TCs.docx | 2025-11-21 06:50 | 163K | |
![[ ]](/icons/unknown.gif) | Description of Modules - AHMAD - accapted TCs (2).docx | 2025-11-21 06:50 | 163K | |
![[ ]](/icons/unknown.gif) | Description of Modules - AHMAD - accapted TCs (1).docx | 2025-11-21 06:50 | 163K | |
![[IMG]](/icons/image2.gif) | image001 (2131).jpg | 2025-11-21 06:50 | 89K | |
![[IMG]](/icons/image2.gif) | image001 (2130).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2129).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2128).jpg | 2025-11-21 06:50 | 3.1K | |
![[ ]](/icons/layout.gif) | Tamta Kobakhidze offer Letter_updated_signed.pdf | 2025-11-21 06:50 | 398K | |
![[ ]](/icons/unknown.gif) | Medical Facilities_Reporting Sheet_V2_Final_Dec 27 2012.xls | 2025-11-21 06:50 | 533K | |
![[ ]](/icons/unknown.gif) | An action form has been processed for Tamta Kobakhidze | 2025-11-21 06:50 | 0 | |
![[IMG]](/icons/image2.gif) | image002 (968).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (967).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2127).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2126).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1031).png | 2025-11-21 06:50 | 16K | |
![[ ]](/icons/unknown.gif) | Stock Management.rar | 2025-11-21 06:50 | 844K | |
![[ ]](/icons/unknown.gif) | EmployeeOTL_timesheetInstructions.docx | 2025-11-21 06:50 | 74K | |
![[ ]](/icons/unknown.gif) | ATT37353 | 2025-11-21 06:50 | 0 | |
![[ ]](/icons/unknown.gif) | ATT25170 | 2025-11-21 06:50 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00001 (66).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00001 (65).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (966).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1030).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | error (31).png | 2025-11-21 06:50 | 75K | |
![[ ]](/icons/unknown.gif) | Birthday list_HSSP.doc | 2025-11-21 06:50 | 190K | |
![[ ]](/icons/unknown.gif) | ATT58204 | 2025-11-21 06:50 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00001 (64).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00001 (63).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (2125).jpg | 2025-11-21 06:50 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (1029).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | ATT28879 | 2025-11-21 06:50 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00002 (19).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image022 (1).jpg | 2025-11-21 06:50 | 21K | |
![[IMG]](/icons/image2.gif) | image020 (2).jpg | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image015 (10).jpg | 2025-11-21 06:50 | 1.5K | |
![[IMG]](/icons/image2.gif) | image014 (10).jpg | 2025-11-21 06:50 | 1.7K | |
![[IMG]](/icons/image2.gif) | image010 (15).png | 2025-11-21 06:50 | 1.8K | |
![[IMG]](/icons/image2.gif) | image008 (20).png | 2025-11-21 06:50 | 1.0K | |
![[IMG]](/icons/image2.gif) | image007 (43).png | 2025-11-21 06:50 | 1.4K | |
![[IMG]](/icons/image2.gif) | image006 (55).png | 2025-11-21 06:50 | 1.3K | |
![[IMG]](/icons/image2.gif) | image005 (96).png | 2025-11-21 06:50 | 1.3K | |
![[IMG]](/icons/image2.gif) | image005 (95).png | 2025-11-21 06:50 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (152).png | 2025-11-21 06:50 | 3.2K | |
![[IMG]](/icons/image2.gif) | image004 (151).png | 2025-11-21 06:50 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (362).jpg | 2025-11-21 06:50 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (361).jpg | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (965).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (390).png | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (389).png | 2025-11-21 06:50 | 1.2K | |
![[IMG]](/icons/image2.gif) | image001 (2124).jpg | 2025-11-21 06:50 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (2123).jpg | 2025-11-21 06:50 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (2122).jpg | 2025-11-21 06:50 | 2.8K | |
![[ ]](/icons/unknown.gif) | HSSP Monthly Report_December 2012.docx | 2025-11-21 06:50 | 116K | |
![[ ]](/icons/layout.gif) | FY14 Calendar.pdf | 2025-11-21 06:50 | 346K | |
![[IMG]](/icons/image2.gif) | image002 (964).jpg | 2025-11-21 06:50 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (388).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (387).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (386).png | 2025-11-21 06:50 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (1028).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | acharis axali faqtura.xls | 2025-11-21 06:50 | 187K | |
![[IMG]](/icons/image2.gif) | Violations.jpg | 2025-11-21 06:50 | 555K | |
![[IMG]](/icons/image2.gif) | Violations (1).jpg | 2025-11-21 06:50 | 555K | |
![[ ]](/icons/unknown.gif) | TaxCode.xlsx | 2025-11-21 06:50 | 9.5K | |
![[IMG]](/icons/image2.gif) | ATT01764.jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | ATT01764 (1).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | ATT01761.png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | ATT01761 (1).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00003 (8).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (7).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (18).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00002 (17).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (62).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00001 (61).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (360).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (359).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (385).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (384).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1027).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1026).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (115).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (192).jpg | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (358).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (963).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (383).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1025).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1024).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | Users 23-25.xlsx | 2025-11-21 06:50 | 9.0K | |
![[ ]](/icons/unknown.gif) | MedicalOrganizations (1).xls | 2025-11-21 06:50 | 450K | |
![[ ]](/icons/unknown.gif) | Medical Facilities_Reporting Sheet_V3_Jan 25, 2013.xls | 2025-11-21 06:50 | 547K | |
![[ ]](/icons/unknown.gif) | Hot Line-and_Mediation 24,01,2013 last.docx | 2025-11-21 06:50 | 183K | |
![[IMG]](/icons/image2.gif) | ATT00004 (5).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00004 (4).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (16).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00003 (15).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (60).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00001 (59).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | ბაგების სია, კრიტერიუმები.docx | 2025-11-21 06:50 | 27K | |
![[IMG]](/icons/image2.gif) | image007 (46).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (54).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (114).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image005 (94).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (191).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (190).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (189).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (188).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (187).jpg | 2025-11-21 06:50 | 7.1K | |
![[IMG]](/icons/image2.gif) | image004 (150).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (363).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (362).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (361).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (360).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (357).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (356).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (962).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (961).jpg | 2025-11-21 06:50 | 7.1K | |
![[IMG]](/icons/image2.gif) | image002 (382).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (381).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (380).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (379).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (378).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1023).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1022).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1021).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1020).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1019).png | 2025-11-21 06:50 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (1018).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1017).png | 2025-11-21 06:50 | 51K | |
![[ ]](/icons/unknown.gif) | MedicalOrganizations.xls | 2025-11-21 06:50 | 443K | |
![[ ]](/icons/unknown.gif) | sia.xlsx | 2025-11-21 06:50 | 23K | |
![[IMG]](/icons/image2.gif) | image007 (45).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (44).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (53).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (52).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (93).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (92).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (186).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (149).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (148).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (359).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (355).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (377).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (376).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1016).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1015).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | identificirda dargveva - problema.xlsx | 2025-11-21 06:50 | 31K | |
![[IMG]](/icons/image2.gif) | error (30).png | 2025-11-21 06:50 | 189K | |
![[ ]](/icons/layout.gif) | Tata ID.pdf | 2025-11-21 06:50 | 182K | |
![[ ]](/icons/unknown.gif) | ATT82961 | 2025-11-21 06:50 | 0 | |
![[IMG]](/icons/image2.gif) | image008 (32).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image008 (31).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (43).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (42).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (41).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (51).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (50).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image006 (49).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (91).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (147).png | 2025-11-21 06:50 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (146).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (358).png | 2025-11-21 06:50 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (354).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (353).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (960).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (375).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (374).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (31).gif | 2025-11-21 06:50 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (2121).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2120).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1014).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1013).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1012).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1011).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (135).gif | 2025-11-21 06:50 | 15K | |
![[ ]](/icons/unknown.gif) | gamoukenebeli shvebulebis dgeebi as of Feb 1 2013.xlsx | 2025-11-21 06:50 | 13K | |
![[ ]](/icons/unknown.gif) | Questtionaire for Choosing Health Insurance Company.xlsx | 2025-11-21 06:50 | 13K | |
![[ ]](/icons/unknown.gif) | Problem Identification Task.docx | 2025-11-21 06:50 | 36K | |
![[ ]](/icons/unknown.gif) | ATT76205 | 2025-11-21 06:50 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00004 (3).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (14).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00002 (16).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00001 (58).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (90).png | 2025-11-21 06:50 | 7.4K | |
![[IMG]](/icons/image2.gif) | image004 (185).jpg | 2025-11-21 06:50 | 4.4K | |
![[IMG]](/icons/image2.gif) | image003 (352).jpg | 2025-11-21 06:50 | 101K | |
![[IMG]](/icons/image2.gif) | image003 (351).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (959).jpg | 2025-11-21 06:50 | 9.7K | |
![[IMG]](/icons/image2.gif) | image002 (958).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (957).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (956).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (955).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (373).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2119).jpg | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2118).jpg | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2117).jpg | 2025-11-21 06:50 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1010).png | 2025-11-21 06:50 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1009).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1008).png | 2025-11-21 06:50 | 9.6K | |
![[ ]](/icons/unknown.gif) | ATT34946 | 2025-11-21 06:50 | 0 | |
![[IMG]](/icons/image2.gif) | image004 (184).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (350).jpg | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (349).jpg | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (348).jpg | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (347).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (346).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (345).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (954).jpg | 2025-11-21 06:50 | 16K | |
![[IMG]](/icons/image2.gif) | image002 (953).jpg | 2025-11-21 06:50 | 16K | |
![[IMG]](/icons/image2.gif) | image002 (952).jpg | 2025-11-21 06:50 | 16K | |
![[IMG]](/icons/image2.gif) | image002 (951).jpg | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (950).jpg | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (949).jpg | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (948).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2116).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2115).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2114).jpg | 2025-11-21 06:50 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (2113).jpg | 2025-11-21 06:50 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (2112).jpg | 2025-11-21 06:50 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (2111).jpg | 2025-11-21 06:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2110).jpg | 2025-11-21 06:50 | 12K | |
![[IMG]](/icons/image2.gif) | Image014-1.jpg | 2025-11-21 06:50 | 684K | |
![[ ]](/icons/unknown.gif) | sisxlis bankis da produktebis shesaxeb.doc | 2025-11-21 06:50 | 241K | |
![[IMG]](/icons/image2.gif) | image005 (113).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (145).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (357).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (356).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (355).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (344).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (947).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (946).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (372).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1007).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1006).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1005).png | 2025-11-21 06:50 | 10K | |
![[ ]](/icons/unknown.gif) | Product types.xlsx | 2025-11-21 06:50 | 9.3K | |
![[ ]](/icons/layout.gif) | PROVIDERS FULL - 2013.pdf | 2025-11-21 06:50 | 2.0M | |
![[IMG]](/icons/image2.gif) | Image015-1.jpg | 2025-11-21 06:50 | 716K | |
![[ ]](/icons/unknown.gif) | HSSP Monthly Progress Report_Jan 2013.docx | 2025-11-21 06:50 | 117K | |
![[IMG]](/icons/image2.gif) | ATT00003 (6).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (15).png | 2025-11-21 06:50 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (57).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | 20130130_152652.jpg | 2025-11-21 06:50 | 2.8M | |
![[ ]](/icons/unknown.gif) | აღიარებითის ქვეყნები.xlsx | 2025-11-21 06:50 | 12K | |
![[ ]](/icons/unknown.gif) | usernames and passwords.docx | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (945).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (371).png | 2025-11-21 06:50 | 7.8K | |
![[IMG]](/icons/image2.gif) | image002 (370).png | 2025-11-21 06:50 | 177 | |
![[IMG]](/icons/image2.gif) | image001 (2109).jpg | 2025-11-21 06:50 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (2108).jpg | 2025-11-21 06:50 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (1004).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1003).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1002).png | 2025-11-21 06:50 | 51K | |
![[ ]](/icons/unknown.gif) | CLOUD_KT comments.xlsx | 2025-11-21 06:50 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (354).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (369).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1001).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1000).png | 2025-11-21 06:50 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (999).png | 2025-11-21 06:50 | 51K | |
![[ ]](/icons/layout.gif) | New Corporate Offer MED - 2012.pdf | 2025-11-21 06:50 | 1.4M | |
![[ ]](/icons/unknown.gif) | ATT86115 | 2025-11-21 06:50 | 0 | |
![[IMG]](/icons/image2.gif) | image009 (17).jpg | 2025-11-21 06:50 | 7.2K | |
![[IMG]](/icons/image2.gif) | image009 (16).jpg | 2025-11-21 06:50 | 7.2K | |
![[IMG]](/icons/image2.gif) | image008 (30).jpg | 2025-11-21 06:50 | 4.5K | |
![[IMG]](/icons/image2.gif) | image008 (29).jpg | 2025-11-21 06:50 | 4.5K | |
![[IMG]](/icons/image2.gif) | image007 (42).jpg | 2025-11-21 06:50 | 7.7K | |
![[IMG]](/icons/image2.gif) | image007 (41).jpg | 2025-11-21 06:50 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (343).jpg | 2025-11-21 06:50 | 7.2K | |
![[IMG]](/icons/image2.gif) | image003 (342).jpg | 2025-11-21 06:50 | 7.2K | |
![[IMG]](/icons/image2.gif) | image002 (944).jpg | 2025-11-21 06:50 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (943).jpg | 2025-11-21 06:50 | 4.5K | |
![[IMG]](/icons/image2.gif) | image002 (942).jpg | 2025-11-21 06:50 | 4.5K | |
![[IMG]](/icons/image2.gif) | image001 (2107).jpg | 2025-11-21 06:50 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (2106).jpg | 2025-11-21 06:50 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (998).png | 2025-11-21 06:50 | 61K | |
![[ ]](/icons/unknown.gif) | ATT63248 | 2025-11-21 06:50 | 0 | |
![[IMG]](/icons/image2.gif) | image007 (40).jpg | 2025-11-21 06:49 | 7.2K | |
![[IMG]](/icons/image2.gif) | image007 (39).jpg | 2025-11-21 06:49 | 7.2K | |
![[IMG]](/icons/image2.gif) | image006 (79).jpg | 2025-11-21 06:49 | 7.7K | |
![[IMG]](/icons/image2.gif) | image006 (78).jpg | 2025-11-21 06:49 | 7.7K | |
![[IMG]](/icons/image2.gif) | image005 (112).jpg | 2025-11-21 06:49 | 7.2K | |
![[IMG]](/icons/image2.gif) | image004 (183).jpg | 2025-11-21 06:49 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (353).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (352).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (341).jpg | 2025-11-21 06:49 | 6.2K | |
![[IMG]](/icons/image2.gif) | image003 (340).jpg | 2025-11-21 06:49 | 6.2K | |
![[IMG]](/icons/image2.gif) | image003 (339).jpg | 2025-11-21 06:49 | 6.2K | |
![[IMG]](/icons/image2.gif) | image002 (941).jpg | 2025-11-21 06:49 | 4.5K | |
![[IMG]](/icons/image2.gif) | image002 (940).jpg | 2025-11-21 06:49 | 4.5K | |
![[IMG]](/icons/image2.gif) | image002 (939).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (938).jpg | 2025-11-21 06:49 | 4.5K | |
![[IMG]](/icons/image2.gif) | image002 (368).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (367).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (2105).jpg | 2025-11-21 06:49 | 118K | |
![[IMG]](/icons/image2.gif) | image001 (2104).jpg | 2025-11-21 06:49 | 8.1K | |
![[IMG]](/icons/image2.gif) | image001 (2103).jpg | 2025-11-21 06:49 | 8.1K | |
![[IMG]](/icons/image2.gif) | image001 (2102).jpg | 2025-11-21 06:49 | 8.1K | |
![[IMG]](/icons/image2.gif) | image001 (997).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (996).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (995).png | 2025-11-21 06:49 | 10K | |
![[ ]](/icons/unknown.gif) | Webinar_ Presentation_Preshared.pptx | 2025-11-21 06:49 | 1.7M | |
![[ ]](/icons/unknown.gif) | ATT67653 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | 577300_10151255871622821_1000177114_n.jpg | 2025-11-21 06:49 | 57K | |
![[IMG]](/icons/image2.gif) | image006 (48).png | 2025-11-21 06:49 | 771 | |
![[IMG]](/icons/image2.gif) | image002 (937).jpg | 2025-11-21 06:49 | 14K | |
![[IMG]](/icons/image2.gif) | image002 (936).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (2101).jpg | 2025-11-21 06:49 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (2100).jpg | 2025-11-21 06:49 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (994).png | 2025-11-21 06:49 | 61K | |
![[ ]](/icons/unknown.gif) | Stock management fields.docx | 2025-11-21 06:49 | 18K | |
![[ ]](/icons/unknown.gif) | STAFF NEW VIZITKEBI.docx | 2025-11-21 06:49 | 19K | |
![[ ]](/icons/unknown.gif) | STAFF NEW VIZITKEBI (2).docx | 2025-11-21 06:49 | 18K | |
![[ ]](/icons/unknown.gif) | STAFF NEW VIZITKEBI (1).docx | 2025-11-21 06:49 | 19K | |
![[ ]](/icons/unknown.gif) | ICD - Latest - 25_02_13.xlsx | 2025-11-21 06:49 | 109K | |
![[ ]](/icons/unknown.gif) | CLOUD_KT 25.xlsx | 2025-11-21 06:49 | 22K | |
![[ ]](/icons/unknown.gif) | CLOUD27.xlsx | 2025-11-21 06:49 | 22K | |
![[ ]](/icons/unknown.gif) | ATT23369 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | image019 (2).jpg | 2025-11-21 06:49 | 7.9K | |
![[IMG]](/icons/image2.gif) | image018 (1).jpg | 2025-11-21 06:49 | 8.0K | |
![[IMG]](/icons/image2.gif) | image014 (9).jpg | 2025-11-21 06:49 | 25K | |
![[IMG]](/icons/image2.gif) | image011 (6).jpg | 2025-11-21 06:49 | 7.2K | |
![[IMG]](/icons/image2.gif) | image010 (18).jpg | 2025-11-21 06:49 | 7.7K | |
![[IMG]](/icons/image2.gif) | image009 (15).jpg | 2025-11-21 06:49 | 6.2K | |
![[IMG]](/icons/image2.gif) | image008 (28).jpg | 2025-11-21 06:49 | 8.1K | |
![[IMG]](/icons/image2.gif) | image005 (111).jpg | 2025-11-21 06:49 | 23K | |
![[IMG]](/icons/image2.gif) | image003 (351).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (338).jpg | 2025-11-21 06:49 | 61K | |
![[IMG]](/icons/image2.gif) | image003 (337).jpg | 2025-11-21 06:49 | 5.4K | |
![[IMG]](/icons/image2.gif) | image002 (935).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (934).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (933).jpg | 2025-11-21 06:49 | 4.5K | |
![[IMG]](/icons/image2.gif) | image002 (366).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (2099).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (2098).jpg | 2025-11-21 06:49 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (2097).jpg | 2025-11-21 06:49 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (993).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/unknown.gif) | Statements 3-1-2013.xlsx | 2025-11-21 06:49 | 8.5M | |
![[ ]](/icons/layout.gif) | STAFF.pdf | 2025-11-21 06:49 | 2.7M | |
![[ ]](/icons/layout.gif) | STAFF (1).pdf | 2025-11-21 06:49 | 2.8M | |
![[ ]](/icons/unknown.gif) | ATT65652 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00004 (6).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00004 (5).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (13).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (12).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (11).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00002 (45).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (44).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (43).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (56).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (55).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (54).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (350).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (932).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2096).jpg | 2025-11-21 06:49 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (992).png | 2025-11-21 06:49 | 54K | |
![[IMG]](/icons/image2.gif) | image001 (991).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/unknown.gif) | MMIS Brief.docx | 2025-11-21 06:49 | 12K | |
![[ ]](/icons/unknown.gif) | ATT38681 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00006 (2).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00005 (1).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00004 (4).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00004 (3).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00004 (2).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (10).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (5).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (42).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (41).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (14).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (53).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (52).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/unknown.gif) | 615 (1).rtf | 2025-11-21 06:49 | 704K | |
![[IMG]](/icons/image2.gif) | image008 (19).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image008 (18).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image007 (38).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (37).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (47).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (46).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (144).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (336).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (365).png | 2025-11-21 06:49 | 2.9K | |
![[IMG]](/icons/image2.gif) | image002 (364).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (990).png | 2025-11-21 06:49 | 2.9K | |
![[IMG]](/icons/image2.gif) | image001 (989).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (988).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (987).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | efgbiiai.png | 2025-11-21 06:49 | 217K | |
![[IMG]](/icons/image2.gif) | efgbiiai (1).png | 2025-11-21 06:49 | 217K | |
![[ ]](/icons/unknown.gif) | Statements 6 March.xlsx | 2025-11-21 06:49 | 4.8M | |
![[ ]](/icons/unknown.gif) | Pricing Services - Pop-uptext[1].docx | 2025-11-21 06:49 | 15K | |
![[ ]](/icons/unknown.gif) | Pricing Services - Pop-uptext1 (2).docx | 2025-11-21 06:49 | 79K | |
![[IMG]](/icons/image2.gif) | ATT00004 (1).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (9).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (8).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (7).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (6).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (4).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (40).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (39).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (38).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (37).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (13).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (51).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (50).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (49).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (48).png | 2025-11-21 06:49 | 217K | |
![[IMG]](/icons/image2.gif) | ATT00001 (47).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (89).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (88).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (182).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (181).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (349).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (348).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (347).png | 2025-11-21 06:49 | 57K | |
![[IMG]](/icons/image2.gif) | image002 (931).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (363).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (362).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/unknown.gif) | image002 (1).emz | 2025-11-21 06:49 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (2095).jpg | 2025-11-21 06:49 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (2094).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2093).jpg | 2025-11-21 06:49 | 76K | |
![[IMG]](/icons/image2.gif) | bcaieici.png | 2025-11-21 06:49 | 210K | |
![[ ]](/icons/unknown.gif) | HSSP Monthly Progress Report_FEB 2013.docx | 2025-11-21 06:49 | 121K | |
![[IMG]](/icons/image2.gif) | ATT00010 (1).jpg | 2025-11-21 06:49 | 910 | |
![[IMG]](/icons/image2.gif) | ATT00009 (1).jpg | 2025-11-21 06:49 | 78K | |
![[IMG]](/icons/image2.gif) | ATT00008 (1).jpg | 2025-11-21 06:49 | 81K | |
![[IMG]](/icons/image2.gif) | ATT00007 (1).jpg | 2025-11-21 06:49 | 56K | |
![[IMG]](/icons/image2.gif) | ATT00006 (1).jpg | 2025-11-21 06:49 | 54K | |
![[IMG]](/icons/image2.gif) | ATT00005 (1).jpg | 2025-11-21 06:49 | 84K | |
![[IMG]](/icons/image2.gif) | ATT00004 (2).jpg | 2025-11-21 06:49 | 75K | |
![[IMG]](/icons/image2.gif) | ATT00003 (5).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (4).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (3).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003 (3).jpg | 2025-11-21 06:49 | 6.7K | |
![[IMG]](/icons/image2.gif) | ATT00002 (36).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (35).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (34).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (33).jpg | 2025-11-21 06:49 | 7.5K | |
![[IMG]](/icons/image2.gif) | ATT00001 (46).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (45).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (44).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (6).jpg | 2025-11-21 06:49 | 13K | |
![[ ]](/icons/unknown.gif) | scripts.docx | 2025-11-21 06:49 | 17K | |
![[IMG]](/icons/image2.gif) | image006 (77).jpg | 2025-11-21 06:49 | 411 | |
![[IMG]](/icons/image2.gif) | image005 (110).jpg | 2025-11-21 06:49 | 423 | |
![[IMG]](/icons/image2.gif) | image005 (109).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (180).jpg | 2025-11-21 06:49 | 406 | |
![[IMG]](/icons/image2.gif) | image004 (143).png | 2025-11-21 06:49 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (346).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (345).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (335).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (930).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (929).jpg | 2025-11-21 06:49 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (928).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2092).jpg | 2025-11-21 06:49 | 8.1K | |
![[IMG]](/icons/image2.gif) | image001 (2091).jpg | 2025-11-21 06:49 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (986).png | 2025-11-21 06:49 | 12K | |
![[IMG]](/icons/image2.gif) | doclink.gif | 2025-11-21 06:49 | 149 | |
![[IMG]](/icons/image2.gif) | doclink (1).gif | 2025-11-21 06:49 | 149 | |
![[ ]](/icons/unknown.gif) | Statistics (48).xlsx | 2025-11-21 06:49 | 12K | |
![[ ]](/icons/unknown.gif) | RosettaStoneApplication.doc | 2025-11-21 06:49 | 47K | |
![[IMG]](/icons/image2.gif) | 254737_389394611130888_1829336697_n.jpg | 2025-11-21 06:49 | 42K | |
![[ ]](/icons/unknown.gif) | რესურსები და ამოცანები.xlsx | 2025-11-21 06:49 | 61K | |
![[IMG]](/icons/image2.gif) | image004 (179).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (344).png | 2025-11-21 06:49 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (334).jpg | 2025-11-21 06:49 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (361).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2090).jpg | 2025-11-21 06:49 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (2089).jpg | 2025-11-21 06:49 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (2088).jpg | 2025-11-21 06:49 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (2087).jpg | 2025-11-21 06:49 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (2086).jpg | 2025-11-21 06:49 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (2085).jpg | 2025-11-21 06:49 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (2084).jpg | 2025-11-21 06:49 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (985).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | analitikosi.PNG | 2025-11-21 06:49 | 27K | |
![[ ]](/icons/unknown.gif) | Immunization module_tasks.docx | 2025-11-21 06:49 | 20K | |
![[ ]](/icons/unknown.gif) | AGI Install Instructions.docx | 2025-11-21 06:49 | 549K | |
![[IMG]](/icons/image2.gif) | image007 (40).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image006 (76).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image005 (87).png | 2025-11-21 06:49 | 167 | |
![[IMG]](/icons/image2.gif) | image005 (86).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (142).png | 2025-11-21 06:49 | 5.6K | |
![[IMG]](/icons/image2.gif) | image004 (141).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (333).jpg | 2025-11-21 06:49 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (332).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (927).jpg | 2025-11-21 06:49 | 6.4K | |
![[IMG]](/icons/image2.gif) | image002 (360).png | 2025-11-21 06:49 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (2083).jpg | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (2082).jpg | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (984).png | 2025-11-21 06:49 | 14K | |
![[ ]](/icons/unknown.gif) | gamoukenebeli shvebulebis dgeebi as of Apri 1 2013.xlsx | 2025-11-21 06:49 | 13K | |
![[ ]](/icons/unknown.gif) | Statistics (47).xlsx | 2025-11-21 06:49 | 15K | |
![[ ]](/icons/unknown.gif) | StaffNumber.xlsx | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/unknown.gif) | Georgia_HMIS_Recommendations_March_15_2013_V4.docx | 2025-11-21 06:49 | 670K | |
![[IMG]](/icons/image2.gif) | image009 (18).png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image008 (27).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (39).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (45).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (85).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (343).png | 2025-11-21 06:49 | 119K | |
![[IMG]](/icons/image2.gif) | image002 (926).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (359).png | 2025-11-21 06:49 | 728K | |
![[IMG]](/icons/image2.gif) | image001 (2081).jpg | 2025-11-21 06:49 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (2080).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (983).png | 2025-11-21 06:49 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (982).png | 2025-11-21 06:49 | 119K | |
![[IMG]](/icons/image2.gif) | image001 (134).gif | 2025-11-21 06:49 | 15K | |
![[ ]](/icons/layout.gif) | Photo 2nd Year Contest Poster English 2-27-2013 Final (1).pdf | 2025-11-21 06:49 | 2.6M | |
![[ ]](/icons/layout.gif) | Photo 2nd Year Contest Poster (Spanish) 3-18-2013 (1).pdf | 2025-11-21 06:49 | 655K | |
![[ ]](/icons/layout.gif) | Photo 2nd Year Contest Poster (Portugese) 3-18-2013 (1).pdf | 2025-11-21 06:49 | 612K | |
![[ ]](/icons/layout.gif) | Photo 2nd Year Contest Poster (French) 3-18-2013 (1).pdf | 2025-11-21 06:49 | 648K | |
![[ ]](/icons/unknown.gif) | ATT70038 | 2025-11-21 06:49 | 0 | |
![[ ]](/icons/unknown.gif) | ATT53984 | 2025-11-21 06:49 | 0 | |
![[ ]](/icons/unknown.gif) | ATT40743 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00010.jpg | 2025-11-21 06:49 | 910 | |
![[IMG]](/icons/image2.gif) | ATT00009.jpg | 2025-11-21 06:49 | 78K | |
![[IMG]](/icons/image2.gif) | ATT00008.jpg | 2025-11-21 06:49 | 81K | |
![[IMG]](/icons/image2.gif) | ATT00007.jpg | 2025-11-21 06:49 | 56K | |
![[IMG]](/icons/image2.gif) | ATT00006.jpg | 2025-11-21 06:49 | 54K | |
![[IMG]](/icons/image2.gif) | ATT00005.jpg | 2025-11-21 06:49 | 84K | |
![[IMG]](/icons/image2.gif) | ATT00004 (1).jpg | 2025-11-21 06:49 | 75K | |
![[IMG]](/icons/image2.gif) | ATT00003 (2).jpg | 2025-11-21 06:49 | 6.7K | |
![[IMG]](/icons/image2.gif) | ATT00002 (32).jpg | 2025-11-21 06:49 | 7.5K | |
![[IMG]](/icons/image2.gif) | ATT00001 (5).jpg | 2025-11-21 06:49 | 13K | |
![[ ]](/icons/unknown.gif) | 615.rtf | 2025-11-21 06:49 | 704K | |
![[IMG]](/icons/image2.gif) | image006 (75).jpg | 2025-11-21 06:49 | 3.4K | |
![[IMG]](/icons/image2.gif) | image005 (84).png | 2025-11-21 06:49 | 167 | |
![[IMG]](/icons/image2.gif) | image004 (140).png | 2025-11-21 06:49 | 5.6K | |
![[IMG]](/icons/image2.gif) | image003 (342).png | 2025-11-21 06:49 | 119K | |
![[IMG]](/icons/image2.gif) | image003 (341).png | 2025-11-21 06:49 | 119K | |
![[IMG]](/icons/image2.gif) | image003 (340).png | 2025-11-21 06:49 | 119K | |
![[IMG]](/icons/image2.gif) | image002 (925).jpg | 2025-11-21 06:49 | 6.4K | |
![[IMG]](/icons/image2.gif) | image002 (358).png | 2025-11-21 06:49 | 728K | |
![[IMG]](/icons/image2.gif) | image002 (357).png | 2025-11-21 06:49 | 728K | |
![[IMG]](/icons/image2.gif) | image002 (356).png | 2025-11-21 06:49 | 728K | |
![[IMG]](/icons/image2.gif) | image001 (2079).jpg | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (981).png | 2025-11-21 06:49 | 764K | |
![[IMG]](/icons/image2.gif) | image001 (980).png | 2025-11-21 06:49 | 764K | |
![[IMG]](/icons/image2.gif) | image001 (979).png | 2025-11-21 06:49 | 764K | |
![[ ]](/icons/unknown.gif) | Statistics (46).xlsx | 2025-11-21 06:49 | 15K | |
![[IMG]](/icons/image2.gif) | Screen-shot-2011-11-22-at-09_16_59.png | 2025-11-21 06:49 | 130K | |
![[ ]](/icons/unknown.gif) | imun_28_2_13.xlsx | 2025-11-21 06:49 | 23K | |
![[IMG]](/icons/image2.gif) | image005 (108).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (139).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (339).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (331).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (330).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (924).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (355).png | 2025-11-21 06:49 | 147K | |
![[IMG]](/icons/image2.gif) | image002 (354).png | 2025-11-21 06:49 | 147K | |
![[IMG]](/icons/image2.gif) | image001 (978).png | 2025-11-21 06:49 | 68K | |
![[IMG]](/icons/image2.gif) | image001 (977).png | 2025-11-21 06:49 | 14K | |
![[ ]](/icons/unknown.gif) | Birthday list_all staff (1).doc | 2025-11-21 06:49 | 190K | |
![[IMG]](/icons/image2.gif) | 7282_505135556216871_1139179356_n.jpg | 2025-11-21 06:49 | 77K | |
![[ ]](/icons/unknown.gif) | პასპორტიზაცია 1 -ბრძანება.docx | 2025-11-21 06:49 | 31K | |
![[ ]](/icons/unknown.gif) | პასპორტიზაცია 1 -ბრძანება-კომენტარებით (2).docx | 2025-11-21 06:49 | 38K | |
![[IMG]](/icons/image2.gif) | image002 (923).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (922).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (921).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (920).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (353).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (2078).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (2077).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2076).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (976).png | 2025-11-21 06:49 | 68K | |
![[IMG]](/icons/image2.gif) | image001 (975).png | 2025-11-21 06:49 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (974).png | 2025-11-21 06:49 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (973).png | 2025-11-21 06:49 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (972).png | 2025-11-21 06:49 | 42K | |
![[IMG]](/icons/image2.gif) | image001 (971).png | 2025-11-21 06:49 | 42K | |
![[ ]](/icons/unknown.gif) | Statistics (45).xlsx | 2025-11-21 06:49 | 16K | |
![[ ]](/icons/unknown.gif) | პრინტ სკრინი.docx | 2025-11-21 06:49 | 150K | |
![[ ]](/icons/unknown.gif) | პასპორტიზაცია 1 -ბრძანება-კომენტარებით.docx | 2025-11-21 06:49 | 40K | |
![[ ]](/icons/unknown.gif) | პასპორტიზაცია 1 -ბრძანება-კომენტარებით (1).docx | 2025-11-21 06:49 | 40K | |
![[IMG]](/icons/image2.gif) | image005 (107).jpg | 2025-11-21 06:49 | 156K | |
![[IMG]](/icons/image2.gif) | image004 (138).png | 2025-11-21 06:49 | 1.9K | |
![[IMG]](/icons/image2.gif) | image004 (137).png | 2025-11-21 06:49 | 10K | |
![[ ]](/icons/unknown.gif) | image003.emz | 2025-11-21 06:49 | 2.3K | |
![[IMG]](/icons/image2.gif) | image003 (329).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (919).jpg | 2025-11-21 06:49 | 15K | |
![[IMG]](/icons/image2.gif) | image002 (918).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (917).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (352).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2075).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (2074).jpg | 2025-11-21 06:49 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (2073).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (970).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (969).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/unknown.gif) | Stock managament -ENG.docx | 2025-11-21 06:49 | 14K | |
![[IMG]](/icons/image2.gif) | Earth Month _Spanish.jpg | 2025-11-21 06:49 | 216K | |
![[IMG]](/icons/image2.gif) | Earth Month_French.jpg | 2025-11-21 06:49 | 213K | |
![[IMG]](/icons/image2.gif) | Earth Month_Arabic.jpg | 2025-11-21 06:49 | 160K | |
![[IMG]](/icons/image2.gif) | Earth Month_Amharic.jpg | 2025-11-21 06:49 | 169K | |
![[ ]](/icons/unknown.gif) | ATT29331 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00005.png | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00004.jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00003 (2).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00002 (12).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/unknown.gif) | 0 Days.xlsx | 2025-11-21 06:49 | 4.0M | |
![[IMG]](/icons/image2.gif) | image007 (38).png | 2025-11-21 06:49 | 147K | |
![[IMG]](/icons/image2.gif) | image006 (44).png | 2025-11-21 06:49 | 691 | |
![[IMG]](/icons/image2.gif) | image005 (83).png | 2025-11-21 06:49 | 147K | |
![[ ]](/icons/unknown.gif) | image005 (1).emz | 2025-11-21 06:49 | 2.0K | |
![[IMG]](/icons/image2.gif) | image004 (136).png | 2025-11-21 06:49 | 48K | |
![[IMG]](/icons/image2.gif) | image004 (135).png | 2025-11-21 06:49 | 68K | |
![[IMG]](/icons/image2.gif) | image003 (338).png | 2025-11-21 06:49 | 342 | |
![[IMG]](/icons/image2.gif) | image003 (328).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (916).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (915).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (914).jpg | 2025-11-21 06:49 | 7.8K | |
![[IMG]](/icons/image2.gif) | image002 (351).png | 2025-11-21 06:49 | 210 | |
![[IMG]](/icons/image2.gif) | image001 (2072).jpg | 2025-11-21 06:49 | 20K | |
![[IMG]](/icons/image2.gif) | image001 (2071).jpg | 2025-11-21 06:49 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (2070).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (968).png | 2025-11-21 06:49 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (967).png | 2025-11-21 06:49 | 30K | |
![[ ]](/icons/unknown.gif) | eprescription short description.docx | 2025-11-21 06:49 | 302K | |
![[ ]](/icons/layout.gif) | Survey - ARDI GROUP.pdf | 2025-11-21 06:49 | 387K | |
![[ ]](/icons/unknown.gif) | Stock Managament Module_Short Summary.docx | 2025-11-21 06:49 | 15K | |
![[IMG]](/icons/image2.gif) | Stock Creation.PNG | 2025-11-21 06:49 | 52K | |
![[ ]](/icons/unknown.gif) | Statistics (44).xlsx | 2025-11-21 06:49 | 17K | |
![[IMG]](/icons/image2.gif) | Returns.PNG | 2025-11-21 06:49 | 72K | |
![[IMG]](/icons/image2.gif) | Dispatch of Goods.PNG | 2025-11-21 06:49 | 56K | |
![[IMG]](/icons/image2.gif) | Adding new stocks.PNG | 2025-11-21 06:49 | 78K | |
![[IMG]](/icons/image2.gif) | image004 (178).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (177).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (913).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (912).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (911).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (2069).jpg | 2025-11-21 06:49 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (2068).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (966).png | 2025-11-21 06:49 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (965).png | 2025-11-21 06:49 | 49K | |
![[ ]](/icons/unknown.gif) | Statistics (43).xlsx | 2025-11-21 06:49 | 17K | |
![[ ]](/icons/layout.gif) | Photo 2nd Year Contest Poster English 2-27-2013 Final.pdf | 2025-11-21 06:49 | 2.6M | |
![[ ]](/icons/layout.gif) | Photo 2nd Year Contest Poster (Spanish) 3-18-2013.pdf | 2025-11-21 06:49 | 655K | |
![[ ]](/icons/layout.gif) | Photo 2nd Year Contest Poster (Portugese) 3-18-2013.pdf | 2025-11-21 06:49 | 612K | |
![[ ]](/icons/layout.gif) | Photo 2nd Year Contest Poster (French) 3-18-2013.pdf | 2025-11-21 06:49 | 648K | |
![[ ]](/icons/layout.gif) | Photo 2nd Year Contest Poster (Amharic) 3-21-2013.pdf | 2025-11-21 06:49 | 1.0M | |
![[ ]](/icons/unknown.gif) | ATT48499 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | image004 (176).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (910).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (909).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (350).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image002 (349).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (2067).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (2066).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (964).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (963).png | 2025-11-21 06:49 | 210 | |
![[IMG]](/icons/image2.gif) | clip_image008.gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | clip_image006.jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | clip_image005.gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | clip_image002.gif | 2025-11-21 06:49 | 3.1K | |
![[ ]](/icons/unknown.gif) | NCDC Inventory.xls | 2025-11-21 06:49 | 28K | |
![[ ]](/icons/unknown.gif) | NCDC Inventory (1).xls | 2025-11-21 06:49 | 28K | |
![[ ]](/icons/unknown.gif) | ATT44216 | 2025-11-21 06:49 | 0 | |
![[ ]](/icons/unknown.gif) | ATT44147 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | image004 (175).jpg | 2025-11-21 06:49 | 41K | |
![[IMG]](/icons/image2.gif) | image004 (134).png | 2025-11-21 06:49 | 8.0K | |
![[IMG]](/icons/image2.gif) | image004 (22).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (21).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (337).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (327).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (326).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (908).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (907).jpg | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (906).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (30).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image002 (29).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001[1].jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (2065).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2064).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (2063).jpg | 2025-11-21 06:49 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (133).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (132).gif | 2025-11-21 06:49 | 3.1K | |
![[ ]](/icons/unknown.gif) | Statistics (42).xlsx | 2025-11-21 06:49 | 17K | |
![[IMG]](/icons/image2.gif) | ATT00004 (8).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | ATT00003 (1).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (1).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | ATT00001 (1).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image011 (16).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image011 (15).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image010 (17).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image010 (16).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image009 (15).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image009 (14).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image009 (13).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image008 (26).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image008 (13).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image008 (12).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image007 (37).png | 2025-11-21 06:49 | 147K | |
![[IMG]](/icons/image2.gif) | image007 (36).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (36).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (35).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (13).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image006 (43).png | 2025-11-21 06:49 | 48K | |
![[IMG]](/icons/image2.gif) | image006 (42).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (41).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (12).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image005 (82).png | 2025-11-21 06:49 | 364 | |
![[IMG]](/icons/image2.gif) | image005 (81).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (174).jpg | 2025-11-21 06:49 | 21K | |
![[IMG]](/icons/image2.gif) | image004 (133).png | 2025-11-21 06:49 | 210 | |
![[IMG]](/icons/image2.gif) | image003 (336).png | 2025-11-21 06:49 | 691 | |
![[IMG]](/icons/image2.gif) | image003 (325).jpg | 2025-11-21 06:49 | 80K | |
![[ ]](/icons/unknown.gif) | image002.emz | 2025-11-21 06:49 | 2.0K | |
![[IMG]](/icons/image2.gif) | image002 (905).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (904).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (348).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image002 (347).png | 2025-11-21 06:49 | 33K | |
![[IMG]](/icons/image2.gif) | image002 (346).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (2062).jpg | 2025-11-21 06:49 | 20K | |
![[IMG]](/icons/image2.gif) | image001 (2061).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2060).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2059).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2058).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2057).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (2056).jpg | 2025-11-21 06:49 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (2055).jpg | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (962).png | 2025-11-21 06:49 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (961).png | 2025-11-21 06:49 | 30K | |
![[IMG]](/icons/image2.gif) | image011 (14).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image011 (13).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image010 (15).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image010 (14).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image009 (12).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image009 (11).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image008 (11).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image008 (10).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image007 (34).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (33).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (40).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (39).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (24).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (173).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (324).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (323).jpg | 2025-11-21 06:49 | 5.4K | |
![[IMG]](/icons/image2.gif) | image003 (24).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image002 (903).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (902).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (345).png | 2025-11-21 06:49 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (28).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2054).jpg | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (960).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (959).png | 2025-11-21 06:49 | 51K | |
![[ ]](/icons/layout.gif) | Impact Typology graphic_ 3_6_13.pdf | 2025-11-21 06:49 | 303K | |
![[ ]](/icons/unknown.gif) | Impact Definition and Types_Final.docx | 2025-11-21 06:49 | 26K | |
![[ ]](/icons/unknown.gif) | Generic Logic Model_Final.pptx | 2025-11-21 06:49 | 65K | |
![[ ]](/icons/unknown.gif) | Clark Abt Prize for Social Impact_Final.docx | 2025-11-21 06:49 | 21K | |
![[ ]](/icons/unknown.gif) | Clark Abt Prize description 2013.docx | 2025-11-21 06:49 | 92K | |
![[ ]](/icons/unknown.gif) | ATT89680 | 2025-11-21 06:49 | 0 | |
![[ ]](/icons/unknown.gif) | ATT40684 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | image013 (5).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image012 (6).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image011 (12).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image011 (11).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image011 (10).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image010 (13).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image010 (12).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image010 (6).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image009 (17).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image009 (10).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image009 (9).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image008 (17).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image008 (9).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image008 (8).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image007 (32).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (31).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (30).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (38).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (37).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (23).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (172).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (132).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (322).jpg | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (23).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image002 (901).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (900).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (899).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (898).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (27).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2053).jpg | 2025-11-21 06:49 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (2052).jpg | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (958).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (957).png | 2025-11-21 06:49 | 50K | |
![[ ]](/icons/unknown.gif) | Statistics (41).xlsx | 2025-11-21 06:49 | 18K | |
![[ ]](/icons/unknown.gif) | HSSP Monthly Progress Report_March 2013.docx | 2025-11-21 06:49 | 119K | |
![[IMG]](/icons/image2.gif) | sos.PNG | 2025-11-21 06:49 | 27K | |
![[IMG]](/icons/image2.gif) | samedicino dawesebulebis ganacxadi.PNG | 2025-11-21 06:49 | 32K | |
![[IMG]](/icons/image2.gif) | image015 (9).jpg | 2025-11-21 06:49 | 1.4K | |
![[IMG]](/icons/image2.gif) | image014 (8).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image013 (5).png | 2025-11-21 06:49 | 2.9K | |
![[IMG]](/icons/image2.gif) | image013 (4).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image013 (3).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image012 (5).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image012 (4).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image011 (15).png | 2025-11-21 06:49 | 19K | |
![[IMG]](/icons/image2.gif) | image011 (9).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image011 (8).gif | 2025-11-21 06:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | image010 (14).png | 2025-11-21 06:49 | 1.0K | |
![[IMG]](/icons/image2.gif) | image010 (5).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image010 (4).gif | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image009 (16).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image009 (15).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image009 (14).jpg | 2025-11-21 06:49 | 956 | |
![[IMG]](/icons/image2.gif) | image008 (16).png | 2025-11-21 06:49 | 1.4K | |
![[IMG]](/icons/image2.gif) | image008 (15).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image008 (14).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (29).png | 2025-11-21 06:49 | 1.3K | |
![[IMG]](/icons/image2.gif) | image007 (28).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (27).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (26).png | 2025-11-21 06:49 | 147K | |
![[IMG]](/icons/image2.gif) | image006 (36).png | 2025-11-21 06:49 | 1.3K | |
![[IMG]](/icons/image2.gif) | image006 (35).png | 2025-11-21 06:49 | 691 | |
![[ ]](/icons/unknown.gif) | image005.emz | 2025-11-21 06:49 | 2.0K | |
![[IMG]](/icons/image2.gif) | image004 (171).jpg | 2025-11-21 06:49 | 2.0K | |
![[IMG]](/icons/image2.gif) | image004 (131).png | 2025-11-21 06:49 | 48K | |
![[IMG]](/icons/image2.gif) | image003 (335).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (334).png | 2025-11-21 06:49 | 366 | |
![[IMG]](/icons/image2.gif) | image002 (344).png | 2025-11-21 06:49 | 1.8K | |
![[IMG]](/icons/image2.gif) | image002 (343).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (342).png | 2025-11-21 06:49 | 210 | |
![[IMG]](/icons/image2.gif) | image001 (2051).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2050).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2049).jpg | 2025-11-21 06:49 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (2048).jpg | 2025-11-21 06:49 | 20K | |
![[IMG]](/icons/image2.gif) | image001 (956).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | cloud-search3.jpg | 2025-11-21 06:49 | 1.6M | |
![[IMG]](/icons/image2.gif) | cloud-search1.jpg | 2025-11-21 06:49 | 1.6M | |
![[IMG]](/icons/image2.gif) | cloud-search1 (1).jpg | 2025-11-21 06:49 | 1.6M | |
![[IMG]](/icons/image2.gif) | cloud-search.jpg | 2025-11-21 06:49 | 1.6M | |
![[ ]](/icons/unknown.gif) | Statistics (40).xlsx | 2025-11-21 06:49 | 18K | |
![[ ]](/icons/unknown.gif) | ATT97983 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | image004 (170).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (897).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (896).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (341).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (955).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (954).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/unknown.gif) | Stock BUGS_10-06-1013.docx | 2025-11-21 06:49 | 43K | |
![[IMG]](/icons/image2.gif) | image004 (169).jpg | 2025-11-21 06:49 | 43K | |
![[IMG]](/icons/image2.gif) | image004 (130).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (333).png | 2025-11-21 06:49 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (332).png | 2025-11-21 06:49 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (895).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (894).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (893).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (26).gif | 2025-11-21 06:49 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (2047).jpg | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (2046).jpg | 2025-11-21 06:49 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (953).png | 2025-11-21 06:49 | 104K | |
![[IMG]](/icons/image2.gif) | image001 (131).gif | 2025-11-21 06:49 | 15K | |
![[ ]](/icons/layout.gif) | InternalTransfers_Abt 2011Mar_S.pdf | 2025-11-21 06:49 | 86K | |
![[ ]](/icons/unknown.gif) | Birthday list_all staff.doc | 2025-11-21 06:49 | 216K | |
![[IMG]](/icons/image2.gif) | image004 (168).jpg | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (331).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (330).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (329).png | 2025-11-21 06:49 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (328).png | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (327).png | 2025-11-21 06:49 | 167 | |
![[IMG]](/icons/image2.gif) | image002 (892).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (891).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (340).png | 2025-11-21 06:49 | 301 | |
![[IMG]](/icons/image2.gif) | image002 (339).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (338).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (337).png | 2025-11-21 06:49 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (952).png | 2025-11-21 06:49 | 301 | |
![[IMG]](/icons/image2.gif) | image001 (951).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (950).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (949).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (130).gif | 2025-11-21 06:49 | 1.5K | |
![[ ]](/icons/unknown.gif) | Frequently Asked Questions - Abt JTA.docx | 2025-11-21 06:49 | 25K | |
![[IMG]](/icons/image2.gif) | 27052013.jpg | 2025-11-21 06:49 | 35K | |
![[IMG]](/icons/image2.gif) | 27052013(003).jpg | 2025-11-21 06:49 | 37K | |
![[IMG]](/icons/image2.gif) | 27052013(002).jpg | 2025-11-21 06:49 | 41K | |
![[IMG]](/icons/image2.gif) | 27052013(001).jpg | 2025-11-21 06:49 | 39K | |
![[ ]](/icons/unknown.gif) | მენიუ_რაჭა.docx | 2025-11-21 06:49 | 16K | |
![[IMG]](/icons/image2.gif) | image006 (34).png | 2025-11-21 06:49 | 42K | |
![[IMG]](/icons/image2.gif) | image005 (106).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image005 (105).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (129).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (128).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (326).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (325).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (321).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (890).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (889).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (888).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (887).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (886).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (336).png | 2025-11-21 06:49 | 2.2K | |
![[IMG]](/icons/image2.gif) | image002 (335).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (2045).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (948).png | 2025-11-21 06:49 | 42K | |
![[IMG]](/icons/image2.gif) | image001 (947).png | 2025-11-21 06:49 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (946).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (945).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (944).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/unknown.gif) | image001 (1).wmz | 2025-11-21 06:49 | 3.7K | |
![[IMG]](/icons/image2.gif) | IMG_0463.jpg | 2025-11-21 06:49 | 1.4M | |
![[IMG]](/icons/image2.gif) | IMG_0462.jpg | 2025-11-21 06:49 | 1.4M | |
![[IMG]](/icons/image2.gif) | IMG_0461.jpg | 2025-11-21 06:49 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_0460.jpg | 2025-11-21 06:49 | 1.2M | |
![[ ]](/icons/unknown.gif) | ATT07449 | 2025-11-21 06:49 | 0 | |
![[IMG]](/icons/image2.gif) | image006 (33).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (104).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image005 (80).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (167).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (166).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (324).png | 2025-11-21 06:49 | 21K | |
![[IMG]](/icons/image2.gif) | image003 (323).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (320).jpg | 2025-11-21 06:49 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (885).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (884).jpg | 2025-11-21 06:49 | 1.4K | |
![[IMG]](/icons/image2.gif) | image002 (334).png | 2025-11-21 06:49 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (2044).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2043).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2042).jpg | 2025-11-21 06:49 | 4.9K | |
![[IMG]](/icons/image2.gif) | image001 (943).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (942).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (941).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/layout.gif) | Stomatologia Providers List Full - ARDI GROUP.pdf | 2025-11-21 06:49 | 277K | |
![[ ]](/icons/unknown.gif) | Statistics (39).xlsx | 2025-11-21 06:49 | 19K | |
![[ ]](/icons/unknown.gif) | Response Delivery Control Panel.docx | 2025-11-21 06:49 | 318K | |
![[ ]](/icons/layout.gif) | Computer Requirements for Watching Broadcast Sessions.pdf | 2025-11-21 06:49 | 48K | |
![[ ]](/icons/layout.gif) | Computer Requirements for Watching Broadcast Sessions (1).pdf | 2025-11-21 06:49 | 48K | |
![[ ]](/icons/unknown.gif) | ATT97093 | 2025-11-21 06:49 | 0 | |
![[ ]](/icons/unknown.gif) | ATT78364 | 2025-11-21 06:49 | 0 | |
![[ ]](/icons/unknown.gif) | ATT43928 | 2025-11-21 06:49 | 0 | |
![[TXT]](/icons/text.gif) | ATT00002 (4).htm | 2025-11-21 06:49 | 131 | |
![[TXT]](/icons/text.gif) | ATT00001 (11).htm | 2025-11-21 06:49 | 342 | |
![[ ]](/icons/unknown.gif) | AGI Support - Go Live Checklist - International.docx | 2025-11-21 06:49 | 270K | |
![[ ]](/icons/unknown.gif) | AGI Support - Go Live Checklist - International (1).docx | 2025-11-21 06:49 | 270K | |
![[ ]](/icons/layout.gif) | AGI - Top 10 Destinations for International.pdf | 2025-11-21 06:49 | 409K | |
![[ ]](/icons/layout.gif) | AGI - Top 10 Destinations for International (1).pdf | 2025-11-21 06:49 | 409K | |
![[IMG]](/icons/image2.gif) | 05062013.JPG | 2025-11-21 06:49 | 125K | |
![[IMG]](/icons/image2.gif) | image005 (103).jpg | 2025-11-21 06:49 | 84K | |
![[IMG]](/icons/image2.gif) | image004 (165).jpg | 2025-11-21 06:49 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (883).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2041).jpg | 2025-11-21 06:49 | 3.1K | |
![[ ]](/icons/unknown.gif) | Statistics (38).xlsx | 2025-11-21 06:49 | 20K | |
![[IMG]](/icons/image2.gif) | 226602_460551867367835_815239355_n.jpg | 2025-11-21 06:49 | 61K | |
![[IMG]](/icons/image2.gif) | image007 (25).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image006 (74).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image005 (79).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (127).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (322).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (321).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (320).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (882).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (881).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (880).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (879).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (878).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (2040).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2039).jpg | 2025-11-21 06:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (940).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (939).png | 2025-11-21 06:49 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (938).png | 2025-11-21 06:49 | 11K | |
![[ ]](/icons/layout.gif) | H00010023.pdf | 2025-11-21 06:49 | 65K | |
![[IMG]](/icons/image2.gif) | DSCN3012.JPG | 2025-11-21 06:49 | 47K | |
![[IMG]](/icons/image2.gif) | DSCN3011.JPG | 2025-11-21 06:49 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN3010.JPG | 2025-11-21 06:49 | 47K | |
![[IMG]](/icons/image2.gif) | DSCN3009.JPG | 2025-11-21 06:49 | 39K | |
![[IMG]](/icons/image2.gif) | DSCN3008.JPG | 2025-11-21 06:49 | 49K | |
![[IMG]](/icons/image2.gif) | DSCN3007.JPG | 2025-11-21 06:49 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN3006.JPG | 2025-11-21 06:49 | 63K | |
![[IMG]](/icons/image2.gif) | DSCN3005.JPG | 2025-11-21 06:49 | 60K | |
![[IMG]](/icons/image2.gif) | DSCN3004.JPG | 2025-11-21 06:49 | 59K | |
![[IMG]](/icons/image2.gif) | DSCN3003.JPG | 2025-11-21 06:49 | 59K | |
![[IMG]](/icons/image2.gif) | DSCN3002.JPG | 2025-11-21 06:49 | 54K | |
![[IMG]](/icons/image2.gif) | DSCN3001.JPG | 2025-11-21 06:49 | 53K | |
![[IMG]](/icons/image2.gif) | DSCN3000.JPG | 2025-11-21 06:49 | 53K | |
![[IMG]](/icons/image2.gif) | DSCN2999.JPG | 2025-11-21 06:49 | 54K | |
![[IMG]](/icons/image2.gif) | DSCN2997.JPG | 2025-11-21 06:49 | 56K | |
![[IMG]](/icons/image2.gif) | DSCN2996.JPG | 2025-11-21 06:49 | 51K | |
![[IMG]](/icons/image2.gif) | DSCN2995.JPG | 2025-11-21 06:49 | 50K | |
![[IMG]](/icons/image2.gif) | DSCN2981.JPG | 2025-11-21 06:49 | 59K | |
![[IMG]](/icons/image2.gif) | DSCN2979.JPG | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | DSCN2977.JPG | 2025-11-21 06:49 | 50K | |
![[IMG]](/icons/image2.gif) | DSCN2976.JPG | 2025-11-21 06:49 | 44K | |
![[IMG]](/icons/image2.gif) | DSCN2975.JPG | 2025-11-21 06:49 | 36K | |
![[IMG]](/icons/image2.gif) | DSCN2974.JPG | 2025-11-21 06:49 | 62K | |
![[IMG]](/icons/image2.gif) | DSCN2973.JPG | 2025-11-21 06:49 | 60K | |
![[IMG]](/icons/image2.gif) | DSCN2972.JPG | 2025-11-21 06:49 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN2971.JPG | 2025-11-21 06:49 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN2970.JPG | 2025-11-21 06:49 | 51K | |
![[IMG]](/icons/image2.gif) | DSCN2969.JPG | 2025-11-21 06:49 | 53K | |
![[IMG]](/icons/image2.gif) | DSCN2968.JPG | 2025-11-21 06:49 | 48K | |
![[IMG]](/icons/image2.gif) | DSCN2967.JPG | 2025-11-21 06:49 | 53K | |
![[IMG]](/icons/image2.gif) | DSCN2966.JPG | 2025-11-21 06:49 | 45K | |
![[IMG]](/icons/image2.gif) | DSCN2965.JPG | 2025-11-21 06:49 | 55K | |
![[IMG]](/icons/image2.gif) | DSCN2964.JPG | 2025-11-21 06:49 | 53K | |
![[IMG]](/icons/image2.gif) | DSCN2963.JPG | 2025-11-21 06:49 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN2962.JPG | 2025-11-21 06:49 | 54K | |
![[IMG]](/icons/image2.gif) | DSCN2961.JPG | 2025-11-21 06:49 | 58K | |
![[IMG]](/icons/image2.gif) | DSCN2959.JPG | 2025-11-21 06:49 | 51K | |
![[IMG]](/icons/image2.gif) | image003 (319).png | 2025-11-21 06:49 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (877).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (876).jpg | 2025-11-21 06:49 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (333).png | 2025-11-21 06:49 | 8.2K | |
![[IMG]](/icons/image2.gif) | image001 (2038).jpg | 2025-11-21 06:49 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (2037).jpg | 2025-11-21 06:49 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (2036).jpg | 2025-11-21 06:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (937).png | 2025-11-21 06:49 | 3.7K | |
![[ ]](/icons/unknown.gif) | Statistics (37).xlsx | 2025-11-21 06:49 | 20K | |
![[ ]](/icons/unknown.gif) | prezentacia klientebistvis -Baratis Usaprtkhoebis Servisi_pptx.pptx | 2025-11-21 06:48 | 2.0M | |
![[IMG]](/icons/image2.gif) | image002 (875).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (874).jpg | 2025-11-21 06:48 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (2035).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2034).jpg | 2025-11-21 06:48 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (2033).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2032).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (936).png | 2025-11-21 06:48 | 16K | |
![[ ]](/icons/unknown.gif) | VACATION Summer 2013.xls | 2025-11-21 06:48 | 43K | |
![[ ]](/icons/unknown.gif) | Statistics (36).xlsx | 2025-11-21 06:48 | 21K | |
![[ ]](/icons/unknown.gif) | ATT46408 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image008 (25).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (319).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (318).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (873).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (872).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2031).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2030).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2029).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2028).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2027).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2026).jpg | 2025-11-21 06:48 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (2025).jpg | 2025-11-21 06:48 | 4.2K | |
![[ ]](/icons/unknown.gif) | Statistics (35).xlsx | 2025-11-21 06:48 | 21K | |
![[ ]](/icons/unknown.gif) | ATT63966 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT56997 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image006 (73).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (102).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (164).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (318).png | 2025-11-21 06:48 | 6.3K | |
![[IMG]](/icons/image2.gif) | image002 (871).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (870).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (869).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (868).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (867).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (866).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (865).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2024).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2023).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2022).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2021).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2020).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2019).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2018).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2017).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (935).png | 2025-11-21 06:48 | 51K | |
![[ ]](/icons/unknown.gif) | Statistics (34).xlsx | 2025-11-21 06:48 | 22K | |
![[ ]](/icons/unknown.gif) | ATT61583 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image001 (2016).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2015).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2014).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2013).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2012).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2011).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2010).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2009).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2008).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2007).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2006).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2005).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2004).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2003).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2002).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (2001).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (2000).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (29).jpg | 2025-11-21 06:48 | 823 | |
![[IMG]](/icons/image2.gif) | photo[1].JPG | 2025-11-21 06:48 | 40K | |
![[IMG]](/icons/image2.gif) | photo[1] (2).JPG | 2025-11-21 06:48 | 29K | |
![[IMG]](/icons/image2.gif) | photo[1] (1).JPG | 2025-11-21 06:48 | 40K | |
![[IMG]](/icons/image2.gif) | images (3).jpg | 2025-11-21 06:48 | 9.5K | |
![[IMG]](/icons/image2.gif) | image020 (1).jpg | 2025-11-21 06:48 | 1.5K | |
![[IMG]](/icons/image2.gif) | image019 (1).jpg | 2025-11-21 06:48 | 1.6K | |
![[IMG]](/icons/image2.gif) | image018.jpg | 2025-11-21 06:48 | 4.0K | |
![[IMG]](/icons/image2.gif) | image017 (1).jpg | 2025-11-21 06:48 | 2.2K | |
![[IMG]](/icons/image2.gif) | image016 (4).jpg | 2025-11-21 06:48 | 2.0K | |
![[IMG]](/icons/image2.gif) | image015 (8).jpg | 2025-11-21 06:48 | 1.8K | |
![[IMG]](/icons/image2.gif) | image014 (7).jpg | 2025-11-21 06:48 | 1.7K | |
![[IMG]](/icons/image2.gif) | image013 (8).jpg | 2025-11-21 06:48 | 1.4K | |
![[IMG]](/icons/image2.gif) | image012 (3).jpg | 2025-11-21 06:48 | 1.6K | |
![[IMG]](/icons/image2.gif) | image011 (5).jpg | 2025-11-21 06:48 | 1.7K | |
![[IMG]](/icons/image2.gif) | image002 (864).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (863).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (862).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (861).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (332).png | 2025-11-21 06:48 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (1999).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1998).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1997).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1996).jpg | 2025-11-21 06:48 | 9.5K | |
![[IMG]](/icons/image2.gif) | image001 (1995).jpg | 2025-11-21 06:48 | 9.5K | |
![[IMG]](/icons/image2.gif) | image001 (1994).jpg | 2025-11-21 06:48 | 9.5K | |
![[IMG]](/icons/image2.gif) | image003 (317).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (860).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (859).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (858).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1993).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1992).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1991).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1990).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1989).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1988).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1987).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1986).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1985).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1984).jpg | 2025-11-21 06:48 | 3.1K | |
![[ ]](/icons/unknown.gif) | Statistics (33).xlsx | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image003 (316).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1983).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1982).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1981).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1980).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1979).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1978).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1977).jpg | 2025-11-21 06:48 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1976).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (934).png | 2025-11-21 06:48 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (933).png | 2025-11-21 06:48 | 54K | |
![[IMG]](/icons/image2.gif) | image001 (932).png | 2025-11-21 06:48 | 54K | |
![[IMG]](/icons/image2.gif) | I Place.jpg | 2025-11-21 06:48 | 48K | |
![[IMG]](/icons/image2.gif) | II Place.jpg | 2025-11-21 06:48 | 211K | |
![[IMG]](/icons/image2.gif) | III place.jpg | 2025-11-21 06:48 | 370K | |
![[ ]](/icons/unknown.gif) | მორიგეობის გრაფიკი შეხვედრების ოთახში.docx | 2025-11-21 06:48 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (317).png | 2025-11-21 06:48 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (316).png | 2025-11-21 06:48 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (315).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (857).jpg | 2025-11-21 06:48 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (856).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (855).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (854).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1975).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1974).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1973).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1972).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1971).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1970).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1969).jpg | 2025-11-21 06:48 | 3.1K | |
![[ ]](/icons/unknown.gif) | Statistics (32).xlsx | 2025-11-21 06:48 | 23K | |
![[ ]](/icons/unknown.gif) | ATT71318 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image003 (315).png | 2025-11-21 06:48 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (853).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (852).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (851).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (850).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (849).jpg | 2025-11-21 06:48 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1968).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1967).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (931).png | 2025-11-21 06:48 | 513K | |
![[IMG]](/icons/image2.gif) | image001 (930).png | 2025-11-21 06:48 | 513K | |
![[IMG]](/icons/image2.gif) | image001 (929).png | 2025-11-21 06:48 | 513K | |
![[IMG]](/icons/image2.gif) | image001 (928).png | 2025-11-21 06:48 | 7.7K | |
![[ ]](/icons/layout.gif) | NORTHERN NIGERIA TRAVEL GUIDANCE_JULY 2013.pdf | 2025-11-21 06:48 | 88K | |
![[IMG]](/icons/image2.gif) | image016 (3).jpg | 2025-11-21 06:48 | 14K | |
![[IMG]](/icons/image2.gif) | image015 (7).jpg | 2025-11-21 06:48 | 3.3K | |
![[IMG]](/icons/image2.gif) | image014 (2).png | 2025-11-21 06:48 | 7.6K | |
![[IMG]](/icons/image2.gif) | image012 (2).jpg | 2025-11-21 06:48 | 77K | |
![[IMG]](/icons/image2.gif) | image010 (11).jpg | 2025-11-21 06:48 | 48K | |
![[IMG]](/icons/image2.gif) | image009 (13).jpg | 2025-11-21 06:48 | 792 | |
![[IMG]](/icons/image2.gif) | image008 (24).jpg | 2025-11-21 06:48 | 881 | |
![[IMG]](/icons/image2.gif) | image007 (35).jpg | 2025-11-21 06:48 | 855 | |
![[IMG]](/icons/image2.gif) | image006 (32).png | 2025-11-21 06:48 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (78).png | 2025-11-21 06:48 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (126).png | 2025-11-21 06:48 | 1.0K | |
![[IMG]](/icons/image2.gif) | image002 (848).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (331).png | 2025-11-21 06:48 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1966).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1965).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1964).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1963).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1962).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1961).jpg | 2025-11-21 06:48 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1960).jpg | 2025-11-21 06:48 | 6.3K | |
![[IMG]](/icons/image2.gif) | image001 (1959).jpg | 2025-11-21 06:48 | 6.3K | |
![[IMG]](/icons/image2.gif) | image002 (847).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (330).png | 2025-11-21 06:48 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1958).jpg | 2025-11-21 06:48 | 6.3K | |
![[IMG]](/icons/image2.gif) | image001 (1957).jpg | 2025-11-21 06:48 | 7.1K | |
![[IMG]](/icons/image2.gif) | image001 (1956).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1955).jpg | 2025-11-21 06:48 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (1954).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1953).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1952).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1951).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1950).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1949).jpg | 2025-11-21 06:48 | 7.1K | |
![[IMG]](/icons/image2.gif) | image001 (927).png | 2025-11-21 06:48 | 1.4M | |
![[IMG]](/icons/image2.gif) | image001 (926).png | 2025-11-21 06:48 | 54K | |
![[ ]](/icons/unknown.gif) | iProcurement POC List To Request Goods And Services.docx | 2025-11-21 06:48 | 39K | |
![[ ]](/icons/unknown.gif) | iProcurement POC List To Request Goods And Services (1).docx | 2025-11-21 06:48 | 39K | |
![[ ]](/icons/unknown.gif) | iProcurement-Request Form for Goods and Services.docx | 2025-11-21 06:48 | 62K | |
![[ ]](/icons/unknown.gif) | iProcurement-Request Form for Goods and Services (1).docx | 2025-11-21 06:48 | 62K | |
![[IMG]](/icons/image2.gif) | aadfgsd.jpg | 2025-11-21 06:48 | 43K | |
![[IMG]](/icons/image2.gif) | image006 (72).jpg | 2025-11-21 06:48 | 2.6K | |
![[IMG]](/icons/image2.gif) | image003 (314).png | 2025-11-21 06:48 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (314).jpg | 2025-11-21 06:48 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (1948).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1947).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1946).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1945).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (925).png | 2025-11-21 06:48 | 15K | |
![[ ]](/icons/unknown.gif) | Statistics (31).xlsx | 2025-11-21 06:48 | 24K | |
![[ ]](/icons/unknown.gif) | ATT83486 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT65911 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT62779 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT38217 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT37059 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | sharkwithinashark.jpg | 2025-11-21 06:48 | 85K | |
![[IMG]](/icons/image2.gif) | meore naxevari.jpg | 2025-11-21 06:48 | 56K | |
![[IMG]](/icons/image2.gif) | image002 (846).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (845).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1944).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1943).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1942).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1941).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1940).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (129).gif | 2025-11-21 06:48 | 32K | |
![[ ]](/icons/unknown.gif) | IHD Strategy Summary FINAL.PDF | 2025-11-21 06:48 | 112K | |
![[ ]](/icons/layout.gif) | Decree on Provider Passportization (1).pdf | 2025-11-21 06:48 | 44K | |
![[ ]](/icons/unknown.gif) | Annex # 2 (1).xls | 2025-11-21 06:48 | 92K | |
![[ ]](/icons/unknown.gif) | Annex # 1 (1).doc | 2025-11-21 06:48 | 24K | |
![[ ]](/icons/unknown.gif) | ATT34941 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT00888 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | 1173840_560763103959176_1332839815_n.jpg | 2025-11-21 06:48 | 48K | |
![[IMG]](/icons/image2.gif) | image004 (163).jpg | 2025-11-21 06:48 | 7.3K | |
![[IMG]](/icons/image2.gif) | image004 (162).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (313).png | 2025-11-21 06:48 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (313).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (844).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (843).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (842).jpg | 2025-11-21 06:48 | 8.5K | |
![[IMG]](/icons/image2.gif) | image002 (841).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (840).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1939).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (924).png | 2025-11-21 06:48 | 92K | |
![[IMG]](/icons/image2.gif) | image001 (923).png | 2025-11-21 06:48 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (922).png | 2025-11-21 06:48 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (128).gif | 2025-11-21 06:48 | 32K | |
![[IMG]](/icons/image2.gif) | i'm back.jpg | 2025-11-21 06:48 | 106K | |
![[ ]](/icons/unknown.gif) | ATT54739 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT07530 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image003 (312).png | 2025-11-21 06:48 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (312).jpg | 2025-11-21 06:48 | 8.5K | |
![[IMG]](/icons/image2.gif) | image002 (839).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (838).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (837).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1938).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1937).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1936).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1935).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (921).png | 2025-11-21 06:48 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (920).png | 2025-11-21 06:48 | 106K | |
![[IMG]](/icons/image2.gif) | image001 (919).png | 2025-11-21 06:48 | 106K | |
![[ ]](/icons/layout.gif) | TRAVELERS.pdf | 2025-11-21 06:48 | 155K | |
![[ ]](/icons/unknown.gif) | ATT46776 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT29805 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT06542 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image004 (161).jpg | 2025-11-21 06:48 | 8.4K | |
![[IMG]](/icons/image2.gif) | image003 (311).png | 2025-11-21 06:48 | 15K | |
![[IMG]](/icons/image2.gif) | image003 (311).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (836).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (329).png | 2025-11-21 06:48 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1934).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1933).jpg | 2025-11-21 06:48 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (1932).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1931).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1930).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1929).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1928).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1927).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1926).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (918).png | 2025-11-21 06:48 | 92K | |
![[IMG]](/icons/image2.gif) | image001 (917).png | 2025-11-21 06:48 | 51K | |
![[ ]](/icons/unknown.gif) | Statistics (30).xlsx | 2025-11-21 06:48 | 25K | |
![[ ]](/icons/unknown.gif) | ATT03474 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | images (2).jpg | 2025-11-21 06:48 | 5.8K | |
![[IMG]](/icons/image2.gif) | image005 (101).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (160).jpg | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image003 (310).png | 2025-11-21 06:48 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (310).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (309).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (308).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (307).jpg | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image003 (306).jpg | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image002 (835).jpg | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image002 (834).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (833).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (832).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (831).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (830).jpg | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image002 (829).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (828).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1925).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1924).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1923).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1922).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1921).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1920).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1919).jpg | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (1918).jpg | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (1917).jpg | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (1916).jpg | 2025-11-21 06:48 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (1915).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (305).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (304).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (827).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1914).jpg | 2025-11-21 06:48 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (1913).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1912).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1911).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1910).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1909).jpg | 2025-11-21 06:48 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (916).png | 2025-11-21 06:48 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (915).png | 2025-11-21 06:48 | 15K | |
![[ ]](/icons/layout.gif) | MARBURG FEVER.pdf | 2025-11-21 06:48 | 104K | |
![[ ]](/icons/unknown.gif) | ATT40945 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT39327 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image003 (309).png | 2025-11-21 06:48 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (303).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (328).png | 2025-11-21 06:48 | 8.4K | |
![[IMG]](/icons/image2.gif) | image001 (1908).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1907).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1906).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1905).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1904).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1903).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (914).png | 2025-11-21 06:48 | 37K | |
![[ ]](/icons/unknown.gif) | Statistics (29).xlsx | 2025-11-21 06:48 | 26K | |
![[ ]](/icons/unknown.gif) | ATT61887 | 2025-11-21 06:48 | 0 | |
![[ ]](/icons/unknown.gif) | ATT49496 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image004 (159).jpg | 2025-11-21 06:48 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (308).png | 2025-11-21 06:48 | 33K | |
![[IMG]](/icons/image2.gif) | image003 (302).jpg | 2025-11-21 06:48 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (826).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (327).png | 2025-11-21 06:48 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (326).png | 2025-11-21 06:48 | 75K | |
![[IMG]](/icons/image2.gif) | image001 (1902).jpg | 2025-11-21 06:48 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1901).jpg | 2025-11-21 06:48 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1900).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1899).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1898).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1897).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1896).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1895).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (913).png | 2025-11-21 06:48 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (912).png | 2025-11-21 06:48 | 51K | |
![[ ]](/icons/layout.gif) | MFL wesebi.pdf | 2025-11-21 06:48 | 86K | |
![[ ]](/icons/layout.gif) | MFL shetavazeba.pdf | 2025-11-21 06:48 | 258K | |
![[IMG]](/icons/image2.gif) | Joseph-Stalin-9491723-1-402.jpg | 2025-11-21 06:48 | 48K | |
![[ ]](/icons/unknown.gif) | ATT85241 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image003 (307).png | 2025-11-21 06:48 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (301).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (300).jpg | 2025-11-21 06:48 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (825).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (824).jpg | 2025-11-21 06:48 | 14K | |
![[IMG]](/icons/image2.gif) | image002 (823).jpg | 2025-11-21 06:48 | 14K | |
![[IMG]](/icons/image2.gif) | image002 (822).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1894).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1893).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1892).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1891).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1890).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1889).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1888).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1887).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (911).png | 2025-11-21 06:48 | 41K | |
![[ ]](/icons/unknown.gif) | calendar.xlsx | 2025-11-21 06:48 | 8.5K | |
![[ ]](/icons/unknown.gif) | Statistics (28).xlsx | 2025-11-21 06:48 | 27K | |
![[ ]](/icons/unknown.gif) | DAGVIANEBA.XLSX | 2025-11-21 06:48 | 13K | |
![[ ]](/icons/unknown.gif) | ATT59859 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image005 (100).jpg | 2025-11-21 06:48 | 31K | |
![[IMG]](/icons/image2.gif) | image003 (306).png | 2025-11-21 06:48 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (299).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (821).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (820).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (819).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (818).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (817).jpg | 2025-11-21 06:48 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (816).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (325).png | 2025-11-21 06:48 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1886).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1885).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1884).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1883).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1882).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (910).png | 2025-11-21 06:48 | 396K | |
![[IMG]](/icons/image2.gif) | image001 (909).png | 2025-11-21 06:48 | 396K | |
![[IMG]](/icons/image2.gif) | image001 (908).png | 2025-11-21 06:48 | 396K | |
![[IMG]](/icons/image2.gif) | image001 (907).png | 2025-11-21 06:48 | 396K | |
![[IMG]](/icons/image2.gif) | image001 (906).png | 2025-11-21 06:48 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (905).png | 2025-11-21 06:48 | 10K | |
![[IMG]](/icons/image2.gif) | You_don't_say.png | 2025-11-21 06:48 | 42K | |
![[ ]](/icons/unknown.gif) | ATT01588 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image001 (1881).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1880).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1879).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1878).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1877).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1876).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1875).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1874).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1873).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1872).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1871).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1870).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1869).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1868).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1867).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1866).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | naxva.png | 2025-11-21 06:48 | 283K | |
![[IMG]](/icons/image2.gif) | image004 (158).jpg | 2025-11-21 06:48 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (305).png | 2025-11-21 06:48 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (298).jpg | 2025-11-21 06:48 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1865).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1864).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1863).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1862).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1861).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1860).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (904).png | 2025-11-21 06:48 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (903).png | 2025-11-21 06:48 | 364K | |
![[IMG]](/icons/image2.gif) | gormedi2.png | 2025-11-21 06:48 | 272K | |
![[IMG]](/icons/image2.gif) | gormedi1.png | 2025-11-21 06:48 | 223K | |
![[IMG]](/icons/image2.gif) | gormedi.png | 2025-11-21 06:48 | 204K | |
![[ ]](/icons/unknown.gif) | Statistics (27).xlsx | 2025-11-21 06:48 | 27K | |
![[ ]](/icons/unknown.gif) | Shida Ganawesi (2).docx | 2025-11-21 06:48 | 20K | |
![[ ]](/icons/unknown.gif) | Shida Ganawesi (2) (1).docx | 2025-11-21 06:48 | 20K | |
![[ ]](/icons/unknown.gif) | SD TWG brownbag presentation Final post presentation edits 9-16-13.pptx | 2025-11-21 06:48 | 1.8M | |
![[ ]](/icons/unknown.gif) | new updated cases.xlsx | 2025-11-21 06:48 | 33K | |
![[IMG]](/icons/image2.gif) | image003 (304).png | 2025-11-21 06:48 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (297).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (815).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (814).jpg | 2025-11-21 06:48 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (324).png | 2025-11-21 06:48 | 9.3K | |
![[IMG]](/icons/image2.gif) | image002 (323).png | 2025-11-21 06:48 | 9.3K | |
![[IMG]](/icons/image2.gif) | image002 (322).png | 2025-11-21 06:48 | 9.3K | |
![[IMG]](/icons/image2.gif) | image001 (1859).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1858).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1857).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1856).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1855).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1854).jpg | 2025-11-21 06:48 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (902).png | 2025-11-21 06:48 | 9.3K | |
![[IMG]](/icons/image2.gif) | calenjixa.png | 2025-11-21 06:48 | 190K | |
![[IMG]](/icons/image2.gif) | Capture (26).PNG | 2025-11-21 06:48 | 92K | |
![[ ]](/icons/unknown.gif) | ATT85471 | 2025-11-21 06:48 | 0 | |
![[IMG]](/icons/image2.gif) | image003 (296).jpg | 2025-11-21 06:48 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (295).jpg | 2025-11-21 06:48 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (813).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (812).jpg | 2025-11-21 06:48 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (811).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (810).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (809).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1853).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1852).jpg | 2025-11-21 06:48 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (1851).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1850).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1849).jpg | 2025-11-21 06:48 | 6.3K | |
![[IMG]](/icons/image2.gif) | image001 (1848).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1847).jpg | 2025-11-21 06:48 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (1846).jpg | 2025-11-21 06:48 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (1845).jpg | 2025-11-21 06:48 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (1844).jpg | 2025-11-21 06:48 | 4.2K | |
![[ ]](/icons/unknown.gif) | Tamta Kobakhidze - SOW.docx | 2025-11-21 06:48 | 24K | |
![[ ]](/icons/unknown.gif) | Password 36 price cloud.xls | 2025-11-21 06:48 | 35K | |
![[ ]](/icons/layout.gif) | Letter Salary proof for Tamta Kobakhidze_ Eng.pdf | 2025-11-21 06:48 | 124K | |
![[ ]](/icons/layout.gif) | Letter Salary proof for Tamta Kobakhidze_ Eng (1).pdf | 2025-11-21 06:48 | 124K | |
![[IMG]](/icons/image2.gif) | 1000597_690528074292864_2125457592_n.jpg | 2025-11-21 06:48 | 119K | |
![[ ]](/icons/unknown.gif) | შპს რეგიონული ჯანდაცვის ცენტრი (1).xlsx | 2025-11-21 06:48 | 12K | |
![[ ]](/icons/unknown.gif) | ანალიტიკის მოდული (2).docx | 2025-11-21 06:48 | 170K | |
![[IMG]](/icons/image2.gif) | veteranebi.png | 2025-11-21 06:48 | 171K | |
![[IMG]](/icons/image2.gif) | image006 (71).jpg | 2025-11-21 06:48 | 6.3K | |
![[IMG]](/icons/image2.gif) | image005 (99).jpg | 2025-11-21 06:48 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (294).jpg | 2025-11-21 06:48 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (808).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (807).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (806).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (805).jpg | 2025-11-21 06:48 | 6.3K | |
![[IMG]](/icons/image2.gif) | image002 (804).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1843).jpg | 2025-11-21 06:48 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (1842).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1841).jpg | 2025-11-21 06:48 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (1840).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1839).jpg | 2025-11-21 06:48 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1838).jpg | 2025-11-21 06:48 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (901).png | 2025-11-21 06:48 | 90K | |
![[IMG]](/icons/image2.gif) | image001 (900).png | 2025-11-21 06:48 | 90K | |
![[IMG]](/icons/image2.gif) | image001 (899).png | 2025-11-21 06:48 | 90K | |
![[IMG]](/icons/image2.gif) | guli2.png | 2025-11-21 06:48 | 200K | |
![[IMG]](/icons/image2.gif) | guli (1).png | 2025-11-21 06:48 | 187K | |
![[ ]](/icons/unknown.gif) | ანალიტიკის მოდული (1).docx | 2025-11-21 06:48 | 170K | |
![[IMG]](/icons/image2.gif) | image004 (125).png | 2025-11-21 06:48 | 128K | |
![[IMG]](/icons/image2.gif) | image003 (303).png | 2025-11-21 06:48 | 90K | |
![[IMG]](/icons/image2.gif) | image003 (302).png | 2025-11-21 06:48 | 74K | |
![[IMG]](/icons/image2.gif) | image003 (293).jpg | 2025-11-21 06:48 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (803).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (802).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (801).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (800).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (799).jpg | 2025-11-21 06:48 | 6.3K | |
![[IMG]](/icons/image2.gif) | image002 (321).png | 2025-11-21 06:48 | 90K | |
![[IMG]](/icons/image2.gif) | image001 (1837).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1836).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1835).jpg | 2025-11-21 06:48 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (898).png | 2025-11-21 06:48 | 90K | |
![[IMG]](/icons/image2.gif) | image001 (897).png | 2025-11-21 06:48 | 90K | |
![[ ]](/icons/unknown.gif) | HSSP Tasks September.xlsx | 2025-11-21 06:48 | 21K | |
![[ ]](/icons/layout.gif) | 2013 AM Visa Letter-Shalamberidze.pdf | 2025-11-21 06:48 | 129K | |
![[ ]](/icons/layout.gif) | 2013 AM Visa Letter - Kobakhidze.pdf | 2025-11-21 06:48 | 130K | |
![[IMG]](/icons/image2.gif) | pediatria3.png | 2025-11-21 06:48 | 228K | |
![[IMG]](/icons/image2.gif) | pediatria2.png | 2025-11-21 06:48 | 233K | |
![[IMG]](/icons/image2.gif) | pediatria.png | 2025-11-21 06:48 | 206K | |
![[IMG]](/icons/image2.gif) | image002 (798).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (797).jpg | 2025-11-21 06:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (320).png | 2025-11-21 06:48 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (1834).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1833).jpg | 2025-11-21 06:48 | 54K | |
![[IMG]](/icons/image2.gif) | image001 (1832).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1831).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1830).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1829).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1828).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (896).png | 2025-11-21 06:48 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (895).png | 2025-11-21 06:48 | 51K | |
![[ ]](/icons/unknown.gif) | abelofis valdebuleba.docx | 2025-11-21 06:48 | 155K | |
![[ ]](/icons/unknown.gif) | ________ ____.xls | 2025-11-21 06:48 | 86K | |
![[IMG]](/icons/image2.gif) | Register Liability.PNG | 2025-11-21 06:48 | 31K | |
![[ ]](/icons/layout.gif) | IT Organization 09242013.pdf | 2025-11-21 06:48 | 434K | |
![[ ]](/icons/unknown.gif) | HBI პასპორტიზაცია.xls | 2025-11-21 06:48 | 72K | |
![[ ]](/icons/unknown.gif) | პასპორტი დენტალ-ლაინი.xls | 2025-11-21 06:48 | 88K | |
![[IMG]](/icons/image2.gif) | image003 (301).png | 2025-11-21 06:48 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (292).jpg | 2025-11-21 06:48 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (796).jpg | 2025-11-21 06:48 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1827).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1826).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1825).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1824).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1823).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1822).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1821).jpg | 2025-11-21 06:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1820).jpg | 2025-11-21 06:48 | 4.2K | |
![[ ]](/icons/unknown.gif) | ორთოდონტული ცენტრი.xls | 2025-11-21 06:48 | 88K | |
![[ ]](/icons/unknown.gif) | დენტექსი 95.xls | 2025-11-21 06:48 | 88K | |
![[IMG]](/icons/image2.gif) | image005 (77).png | 2025-11-21 06:47 | 32K | |
![[IMG]](/icons/image2.gif) | image004 (157).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (300).png | 2025-11-21 06:47 | 26K | |
![[IMG]](/icons/image2.gif) | image003 (299).png | 2025-11-21 06:47 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (795).jpg | 2025-11-21 06:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (794).jpg | 2025-11-21 06:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1819).jpg | 2025-11-21 06:47 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (1818).jpg | 2025-11-21 06:47 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (1817).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | gidmedi 202453987.png | 2025-11-21 06:47 | 205K | |
![[IMG]](/icons/image2.gif) | gidmedi 1.png | 2025-11-21 06:47 | 205K | |
![[IMG]](/icons/image2.gif) | gidmedi.png | 2025-11-21 06:47 | 209K | |
![[ ]](/icons/unknown.gif) | RE (3) | 2025-11-21 06:47 | 0 | |
![[ ]](/icons/unknown.gif) | RE (2) | 2025-11-21 06:47 | 0 | |
![[ ]](/icons/unknown.gif) | N18.xlsx | 2025-11-21 06:47 | 22K | |
![[ ]](/icons/unknown.gif) | N16-22_01-1.xls | 2025-11-21 06:47 | 23K | |
![[ ]](/icons/unknown.gif) | N15-22_01.xls | 2025-11-21 06:47 | 31K | |
![[ ]](/icons/unknown.gif) | N11-22_01-1.xlsx | 2025-11-21 06:47 | 13K | |
![[ ]](/icons/unknown.gif) | N7-22_01.xls | 2025-11-21 06:47 | 33K | |
![[ ]](/icons/unknown.gif) | All Referrals.xlsx | 2025-11-21 06:47 | 7.4M | |
![[IMG]](/icons/image2.gif) | გიდმედი 202453987.png | 2025-11-21 06:47 | 207K | |
![[IMG]](/icons/image2.gif) | image005 (98).jpg | 2025-11-21 06:47 | 20K | |
![[IMG]](/icons/image2.gif) | image004 (156).jpg | 2025-11-21 06:47 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (298).png | 2025-11-21 06:47 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (793).jpg | 2025-11-21 06:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (319).png | 2025-11-21 06:47 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1816).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1815).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1814).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1813).jpg | 2025-11-21 06:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1812).jpg | 2025-11-21 06:47 | 55K | |
![[ ]](/icons/unknown.gif) | Referrals Repeared Part 2.xls | 2025-11-21 06:47 | 809K | |
![[ ]](/icons/unknown.gif) | Referrals Repeared Part 1.xls | 2025-11-21 06:47 | 5.7M | |
![[ ]](/icons/unknown.gif) | 01-10-2013 მედიკამენტების სრული სია.xlsx | 2025-11-21 06:47 | 69K | |
![[ ]](/icons/unknown.gif) | დაუიმპორტირებელი მიმართვები.xlsx | 2025-11-21 06:47 | 20K | |
![[ ]](/icons/unknown.gif) | დაუიმპორტირებელი მიმართვები (1).xlsx | 2025-11-21 06:47 | 20K | |
![[ ]](/icons/unknown.gif) | გადათვლილი კომბინაციებინაციები 01-10-2013.xlsx | 2025-11-21 06:47 | 10K | |
![[ ]](/icons/unknown.gif) | ალფას მიმართვები.xlsx | 2025-11-21 06:47 | 137K | |
![[ ]](/icons/unknown.gif) | ალფას მიმართვები (1).xlsx | 2025-11-21 06:47 | 137K | |
![[IMG]](/icons/image2.gif) | image005 (76).png | 2025-11-21 06:47 | 198K | |
![[IMG]](/icons/image2.gif) | image004 (124).png | 2025-11-21 06:47 | 165K | |
![[IMG]](/icons/image2.gif) | image003 (291).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (792).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (791).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (790).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (789).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1811).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1810).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1809).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1808).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1807).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1806).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1805).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (894).png | 2025-11-21 06:47 | 44K | |
![[IMG]](/icons/image2.gif) | image001 (893).png | 2025-11-21 06:47 | 44K | |
![[IMG]](/icons/image2.gif) | image001 (892).png | 2025-11-21 06:47 | 38K | |
![[ ]](/icons/unknown.gif) | Referrals.xls | 2025-11-21 06:47 | 261K | |
![[IMG]](/icons/image2.gif) | junona.png | 2025-11-21 06:47 | 234K | |
![[IMG]](/icons/image2.gif) | image001 (1804).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1803).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1802).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1801).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1800).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1799).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1798).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1797).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (891).png | 2025-11-21 06:47 | 38K | |
![[ ]](/icons/unknown.gif) | gaukmebuli gadacemuliagansaxilvelad.docx | 2025-11-21 06:47 | 160K | |
![[ ]](/icons/unknown.gif) | Problem Referrals Recipe.xlsx | 2025-11-21 06:47 | 41K | |
![[ ]](/icons/unknown.gif) | Problem Referrals Others - Tbilisi.xlsx | 2025-11-21 06:47 | 73K | |
![[ ]](/icons/unknown.gif) | Problem Referrals Others - Region.xlsx | 2025-11-21 06:47 | 54K | |
![[ ]](/icons/unknown.gif) | Problem Referrals.xlsx | 2025-11-21 06:47 | 97K | |
![[ ]](/icons/unknown.gif) | ATT58322 | 2025-11-21 06:47 | 0 | |
![[IMG]](/icons/image2.gif) | image003 (290).jpg | 2025-11-21 06:47 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (788).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1796).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1795).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1794).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1793).jpg | 2025-11-21 06:47 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (1792).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1791).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1790).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | error analytic.png | 2025-11-21 06:47 | 235K | |
![[IMG]](/icons/image2.gif) | Untitled 1.png | 2025-11-21 06:47 | 177K | |
![[ ]](/icons/unknown.gif) | Doc11 (3).docx | 2025-11-21 06:47 | 226K | |
![[ ]](/icons/unknown.gif) | onko preparatebi.docx | 2025-11-21 06:47 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (1789).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1788).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1787).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1786).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1785).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (890).png | 2025-11-21 06:47 | 77K | |
![[IMG]](/icons/image2.gif) | OpenClose.jpg | 2025-11-21 06:47 | 367K | |
![[IMG]](/icons/image2.gif) | წაშლის ღილაკი.png | 2025-11-21 06:47 | 189K | |
![[IMG]](/icons/image2.gif) | image005 (97).jpg | 2025-11-21 06:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (155).jpg | 2025-11-21 06:47 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (297).png | 2025-11-21 06:47 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (787).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1784).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1783).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1782).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1781).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1780).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1779).jpg | 2025-11-21 06:47 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (296).png | 2025-11-21 06:47 | 25K | |
![[IMG]](/icons/image2.gif) | image003 (289).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (786).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1778).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1777).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1776).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1775).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1774).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1773).jpg | 2025-11-21 06:47 | 4.2K | |
![[ ]](/icons/unknown.gif) | Statistics (26).xlsx | 2025-11-21 06:47 | 28K | |
![[ ]](/icons/unknown.gif) | Referrals With Updated Statuses.xls | 2025-11-21 06:47 | 267K | |
![[ ]](/icons/unknown.gif) | Referrals - Duplicates To Cancel.xls | 2025-11-21 06:47 | 27K | |
![[IMG]](/icons/image2.gif) | image009 (12).jpg | 2025-11-21 06:47 | 6.3K | |
![[IMG]](/icons/image2.gif) | image008 (23).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image007 (34).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image006 (70).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image005 (96).jpg | 2025-11-21 06:47 | 6.3K | |
![[IMG]](/icons/image2.gif) | image005 (95).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (154).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (153).jpg | 2025-11-21 06:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (152).jpg | 2025-11-21 06:47 | 6.3K | |
![[IMG]](/icons/image2.gif) | image004 (123).png | 2025-11-21 06:47 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (295).png | 2025-11-21 06:47 | 15K | |
![[IMG]](/icons/image2.gif) | image003 (288).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (287).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (286).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (285).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (785).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (784).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (783).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (782).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (25).gif | 2025-11-21 06:47 | 133 | |
![[IMG]](/icons/image2.gif) | image001 (1772).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1771).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1770).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1769).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1768).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (889).png | 2025-11-21 06:47 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (888).png | 2025-11-21 06:47 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (887).png | 2025-11-21 06:47 | 81K | |
![[IMG]](/icons/image2.gif) | image001 (127).gif | 2025-11-21 06:47 | 473 | |
![[IMG]](/icons/image2.gif) | case (5).png | 2025-11-21 06:47 | 269K | |
![[IMG]](/icons/image2.gif) | case (4).png | 2025-11-21 06:47 | 269K | |
![[IMG]](/icons/image2.gif) | ingoroyva r.png | 2025-11-21 06:47 | 176K | |
![[IMG]](/icons/image2.gif) | ingoroyva.png | 2025-11-21 06:47 | 190K | |
![[IMG]](/icons/image2.gif) | image003 (294).png | 2025-11-21 06:47 | 81K | |
![[IMG]](/icons/image2.gif) | image002 (781).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (318).png | 2025-11-21 06:47 | 81K | |
![[IMG]](/icons/image2.gif) | image002 (317).png | 2025-11-21 06:47 | 81K | |
![[IMG]](/icons/image2.gif) | image001 (1767).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1766).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1765).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1764).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1763).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1762).jpg | 2025-11-21 06:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1761).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1760).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (886).png | 2025-11-21 06:47 | 234K | |
![[IMG]](/icons/image2.gif) | image001 (885).png | 2025-11-21 06:47 | 234K | |
![[IMG]](/icons/image2.gif) | image (15).png | 2025-11-21 06:47 | 130K | |
![[IMG]](/icons/image2.gif) | Untitled (62).png | 2025-11-21 06:47 | 212K | |
![[IMG]](/icons/image2.gif) | ენდოკრინოლოგიის ეროვნული ინსტიტუტი 200099384.png | 2025-11-21 06:47 | 228K | |
![[IMG]](/icons/image2.gif) | ენდოკრინოლოგიის ეროვნული ინსტიტუტი1.png | 2025-11-21 06:47 | 227K | |
![[IMG]](/icons/image2.gif) | ენდოკრინოლოგიის ეროვნული ინსტიტუტი.png | 2025-11-21 06:47 | 229K | |
![[IMG]](/icons/image2.gif) | image003 (293).png | 2025-11-21 06:47 | 234K | |
![[IMG]](/icons/image2.gif) | image002 (780).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (316).png | 2025-11-21 06:47 | 81K | |
![[IMG]](/icons/image2.gif) | image001 (1759).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1758).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1757).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1756).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (884).png | 2025-11-21 06:47 | 234K | |
![[ ]](/icons/unknown.gif) | goris araswori mimarTvebi.xlsx | 2025-11-21 06:47 | 50K | |
![[ ]](/icons/unknown.gif) | goris araswori mimarTvebi (2).xlsx | 2025-11-21 06:47 | 49K | |
![[ ]](/icons/unknown.gif) | goris araswori mimarTvebi (1).xlsx | 2025-11-21 06:47 | 50K | |
![[ ]](/icons/unknown.gif) | Referrals To Not Contracted Providers - v2 - Filtered Providers.xls | 2025-11-21 06:47 | 28K | |
![[ ]](/icons/unknown.gif) | Referrals To Not Contracted Providers - v2 - All Referrals.xls | 2025-11-21 06:47 | 2.8M | |
![[ ]](/icons/unknown.gif) | Referrals To Not Contracted Providers - v2 - All Providers.xls | 2025-11-21 06:47 | 58K | |
![[ ]](/icons/unknown.gif) | Problem Referrals Recipe(1).xlsx | 2025-11-21 06:47 | 43K | |
![[ ]](/icons/unknown.gif) | Problem Referrals Recipe(1) (2).xlsx | 2025-11-21 06:47 | 42K | |
![[ ]](/icons/unknown.gif) | Problem Referrals Recipe(1) (1).xlsx | 2025-11-21 06:47 | 43K | |
![[ ]](/icons/unknown.gif) | Problem Referrals Others -Tbilisi.xlsx | 2025-11-21 06:47 | 46K | |
![[ ]](/icons/unknown.gif) | Problem Referrals Others -Tbilisi (2).xlsx | 2025-11-21 06:47 | 46K | |
![[ ]](/icons/unknown.gif) | Problem Referrals Others -Tbilisi (1).xlsx | 2025-11-21 06:47 | 46K | |
![[IMG]](/icons/image2.gif) | 218_6_1.png | 2025-11-21 06:47 | 190K | |
![[ ]](/icons/unknown.gif) | კომბინაციის ლოგიკები - სექტემბერი.xlsx | 2025-11-21 06:47 | 14K | |
![[IMG]](/icons/image2.gif) | თინათინ!!!!!.PNG | 2025-11-21 06:47 | 116K | |
![[IMG]](/icons/image2.gif) | image004 (151).jpg | 2025-11-21 06:47 | 18K | |
![[IMG]](/icons/image2.gif) | image004 (150).jpg | 2025-11-21 06:47 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (284).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (283).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (779).jpg | 2025-11-21 06:47 | 32K | |
![[IMG]](/icons/image2.gif) | image002 (315).png | 2025-11-21 06:47 | 23K | |
![[IMG]](/icons/image2.gif) | image002 (314).png | 2025-11-21 06:47 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (1755).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1754).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1753).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1752).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1751).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (883).png | 2025-11-21 06:47 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (882).png | 2025-11-21 06:47 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (881).png | 2025-11-21 06:47 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (880).png | 2025-11-21 06:47 | 77K | |
![[IMG]](/icons/image2.gif) | 8 (5).png | 2025-11-21 06:47 | 208K | |
![[IMG]](/icons/image2.gif) | 6 (8).png | 2025-11-21 06:47 | 254K | |
![[IMG]](/icons/image2.gif) | 5 (5).png | 2025-11-21 06:47 | 226K | |
![[IMG]](/icons/image2.gif) | 4 (10).png | 2025-11-21 06:47 | 246K | |
![[IMG]](/icons/image2.gif) | 3 (13).png | 2025-11-21 06:47 | 241K | |
![[IMG]](/icons/image2.gif) | 2 (25).png | 2025-11-21 06:47 | 241K | |
![[IMG]](/icons/image2.gif) | 1 (29).png | 2025-11-21 06:47 | 244K | |
![[IMG]](/icons/image2.gif) | medulla.png | 2025-11-21 06:47 | 209K | |
![[IMG]](/icons/image2.gif) | image007 (33).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image006 (69).jpg | 2025-11-21 06:47 | 18K | |
![[IMG]](/icons/image2.gif) | image005 (75).png | 2025-11-21 06:47 | 2.6K | |
![[IMG]](/icons/image2.gif) | image004 (122).png | 2025-11-21 06:47 | 174K | |
![[IMG]](/icons/image2.gif) | image004 (121).png | 2025-11-21 06:47 | 174K | |
![[IMG]](/icons/image2.gif) | image003 (292).png | 2025-11-21 06:47 | 175K | |
![[IMG]](/icons/image2.gif) | image003 (291).png | 2025-11-21 06:47 | 175K | |
![[IMG]](/icons/image2.gif) | image002 (313).png | 2025-11-21 06:47 | 23K | |
![[IMG]](/icons/image2.gif) | image002 (312).png | 2025-11-21 06:47 | 186K | |
![[IMG]](/icons/image2.gif) | image002 (311).png | 2025-11-21 06:47 | 186K | |
![[IMG]](/icons/image2.gif) | image001 (879).png | 2025-11-21 06:47 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (878).png | 2025-11-21 06:47 | 205K | |
![[IMG]](/icons/image2.gif) | image001 (877).png | 2025-11-21 06:47 | 205K | |
![[ ]](/icons/layout.gif) | SWINE INFLUENZA.pdf | 2025-11-21 06:47 | 153K | |
![[ ]](/icons/compressed.gif) | Referrals (1).zip | 2025-11-21 06:47 | 9.4M | |
![[IMG]](/icons/image2.gif) | image005 (94).jpg | 2025-11-21 06:47 | 3.8K | |
![[IMG]](/icons/image2.gif) | image004 (149).jpg | 2025-11-21 06:47 | 4.1K | |
![[IMG]](/icons/image2.gif) | image003 (290).png | 2025-11-21 06:47 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (282).jpg | 2025-11-21 06:47 | 4.7K | |
![[IMG]](/icons/image2.gif) | image002 (310).png | 2025-11-21 06:47 | 201K | |
![[IMG]](/icons/image2.gif) | image001 (1750).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1749).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (876).png | 2025-11-21 06:47 | 196K | |
![[IMG]](/icons/image2.gif) | image001 (875).png | 2025-11-21 06:47 | 223K | |
![[ ]](/icons/unknown.gif) | errors (new version) (1).docx | 2025-11-21 06:47 | 767K | |
![[ ]](/icons/compressed.gif) | Referrals.zip | 2025-11-21 06:47 | 8.2M | |
![[ ]](/icons/unknown.gif) | GITI and Cyber Security Event 28-28 November 2013.doc | 2025-11-21 06:47 | 373K | |
![[IMG]](/icons/image2.gif) | image005 (74).png | 2025-11-21 06:47 | 201K | |
![[IMG]](/icons/image2.gif) | image004 (120).png | 2025-11-21 06:47 | 196K | |
![[IMG]](/icons/image2.gif) | image003 (281).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (309).png | 2025-11-21 06:47 | 201K | |
![[IMG]](/icons/image2.gif) | image001 (874).png | 2025-11-21 06:47 | 223K | |
![[IMG]](/icons/image2.gif) | image001 (873).png | 2025-11-21 06:47 | 196K | |
![[IMG]](/icons/image2.gif) | image001 (872).png | 2025-11-21 06:47 | 233K | |
![[ ]](/icons/unknown.gif) | errors (new version).docx | 2025-11-21 06:47 | 770K | |
![[ ]](/icons/unknown.gif) | done (1).docx | 2025-11-21 06:47 | 17K | |
![[IMG]](/icons/image2.gif) | ღუდუშაური.png | 2025-11-21 06:47 | 202K | |
![[IMG]](/icons/image2.gif) | image004 (148).jpg | 2025-11-21 06:47 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (289).png | 2025-11-21 06:47 | 233K | |
![[IMG]](/icons/image2.gif) | image002 (778).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (777).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1748).jpg | 2025-11-21 06:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1747).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1746).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (871).png | 2025-11-21 06:47 | 69K | |
![[ ]](/icons/layout.gif) | New Search Quick Tips.pdf | 2025-11-21 06:47 | 494K | |
![[ ]](/icons/unknown.gif) | Insured Cases.xlsx | 2025-11-21 06:47 | 18K | |
![[ ]](/icons/unknown.gif) | Insured Cases (1).xlsx | 2025-11-21 06:47 | 18K | |
![[IMG]](/icons/image2.gif) | 3_ (3).png | 2025-11-21 06:47 | 269K | |
![[IMG]](/icons/image2.gif) | 1 (28).png | 2025-11-21 06:47 | 283K | |
![[ ]](/icons/unknown.gif) | ანალიტიკის მოდული.docx | 2025-11-21 06:47 | 19K | |
![[IMG]](/icons/image2.gif) | tiff.djvu | 2025-11-21 06:47 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (288).png | 2025-11-21 06:47 | 15K | |
![[IMG]](/icons/image2.gif) | image002 (776).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (308).png | 2025-11-21 06:47 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (1745).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1744).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1743).jpg | 2025-11-21 06:47 | 4.2K | |
![[ ]](/icons/unknown.gif) | Statistics (25).xlsx | 2025-11-21 06:47 | 29K | |
![[ ]](/icons/unknown.gif) | Referrals - Insured Persons.xlsx | 2025-11-21 06:47 | 20K | |
![[ ]](/icons/unknown.gif) | Insured Cases 2.xlsx | 2025-11-21 06:47 | 20K | |
![[ ]](/icons/unknown.gif) | საინფორმაციო პორტალის დაწესებულებების, მომხმარებლთა სია.xlsx | 2025-11-21 06:47 | 252K | |
![[IMG]](/icons/image2.gif) | image005 (73).png | 2025-11-21 06:47 | 183K | |
![[IMG]](/icons/image2.gif) | image004 (119).png | 2025-11-21 06:47 | 181K | |
![[IMG]](/icons/image2.gif) | image003 (287).png | 2025-11-21 06:47 | 192K | |
![[IMG]](/icons/image2.gif) | image003 (286).png | 2025-11-21 06:47 | 192K | |
![[IMG]](/icons/image2.gif) | image003 (285).png | 2025-11-21 06:47 | 183K | |
![[IMG]](/icons/image2.gif) | image002 (307).png | 2025-11-21 06:47 | 183K | |
![[IMG]](/icons/image2.gif) | image002 (306).png | 2025-11-21 06:47 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (305).png | 2025-11-21 06:47 | 181K | |
![[IMG]](/icons/image2.gif) | image001 (1742).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1741).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1740).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (870).png | 2025-11-21 06:47 | 181K | |
![[IMG]](/icons/image2.gif) | image001 (869).png | 2025-11-21 06:47 | 192K | |
![[ ]](/icons/unknown.gif) | done.docx | 2025-11-21 06:47 | 19K | |
![[IMG]](/icons/image2.gif) | 3 (12).png | 2025-11-21 06:47 | 292K | |
![[IMG]](/icons/image2.gif) | 2 (24).png | 2025-11-21 06:47 | 283K | |
![[IMG]](/icons/image2.gif) | 1 (27).png | 2025-11-21 06:47 | 285K | |
![[ ]](/icons/unknown.gif) | მიმართვები (5).xlsx | 2025-11-21 06:47 | 8.5K | |
![[ ]](/icons/unknown.gif) | მიმართვები (4).xlsx | 2025-11-21 06:47 | 23K | |
![[ ]](/icons/unknown.gif) | მიმართვები (3).xlsx | 2025-11-21 06:47 | 24K | |
![[ ]](/icons/unknown.gif) | reporting Task.docx | 2025-11-21 06:47 | 15K | |
![[ ]](/icons/unknown.gif) | mimartvis tarigi.docx | 2025-11-21 06:47 | 188K | |
![[ ]](/icons/unknown.gif) | mimartvis tarigi (1).docx | 2025-11-21 06:47 | 188K | |
![[IMG]](/icons/image2.gif) | image003 (284).png | 2025-11-21 06:47 | 176K | |
![[IMG]](/icons/image2.gif) | image002 (775).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (304).png | 2025-11-21 06:47 | 173K | |
![[IMG]](/icons/image2.gif) | image001 (1739).jpg | 2025-11-21 06:47 | 8.8K | |
![[IMG]](/icons/image2.gif) | image001 (1738).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1737).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1736).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (868).png | 2025-11-21 06:47 | 213K | |
![[ ]](/icons/unknown.gif) | dazgvevis_zaralebis_formebi.xls | 2025-11-21 06:47 | 257K | |
![[ ]](/icons/unknown.gif) | carielze erori.docx | 2025-11-21 06:47 | 170K | |
![[ ]](/icons/unknown.gif) | carielze erori (1).docx | 2025-11-21 06:47 | 170K | |
![[ ]](/icons/unknown.gif) | bazisurze gamoitana miznobrivisqvekomponenti.docx | 2025-11-21 06:47 | 182K | |
![[ ]](/icons/unknown.gif) | bazisurze gamoitana miznobrivis_qvekomponenti.docx | 2025-11-21 06:47 | 182K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_personal (2).xlsx | 2025-11-21 06:47 | 13K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_capitation (2).xlsx | 2025-11-21 06:47 | 11K | |
![[ ]](/icons/unknown.gif) | Providers Without Contract.xls | 2025-11-21 06:47 | 28K | |
![[ ]](/icons/unknown.gif) | საინფორმაციო პორტალზე განთავსებული სამედიცინო დაწესებულებები.xlsx | 2025-11-21 06:47 | 278K | |
![[ ]](/icons/unknown.gif) | მიმართვები - Copy (1).xlsx | 2025-11-21 06:47 | 20K | |
![[IMG]](/icons/image2.gif) | image003 (283).png | 2025-11-21 06:47 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (1735).jpg | 2025-11-21 06:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | image001 (1734).jpg | 2025-11-21 06:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | image001 (1733).jpg | 2025-11-21 06:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | image001 (1732).jpg | 2025-11-21 06:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | image001 (1731).jpg | 2025-11-21 06:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | image001 (1730).jpg | 2025-11-21 06:47 | 2.9K | |
![[ ]](/icons/unknown.gif) | ATT94416 | 2025-11-21 06:47 | 0 | |
![[ ]](/icons/unknown.gif) | ATT80918 | 2025-11-21 06:47 | 0 | |
![[IMG]](/icons/image2.gif) | 1383732_1466109853613204_419268693_n.jpg | 2025-11-21 06:47 | 34K | |
![[IMG]](/icons/image2.gif) | 1376587_1456395447917978_1326248316_n.jpg | 2025-11-21 06:47 | 53K | |
![[IMG]](/icons/image2.gif) | 1374738_1454583001432556_1046335424_n.jpg | 2025-11-21 06:47 | 40K | |
![[IMG]](/icons/image2.gif) | 995179_157230414484972_1706117189_n.jpg | 2025-11-21 06:47 | 24K | |
![[IMG]](/icons/image2.gif) | image004 (118).png | 2025-11-21 06:47 | 6.7K | |
![[IMG]](/icons/image2.gif) | image003 (282).png | 2025-11-21 06:47 | 5.9K | |
![[IMG]](/icons/image2.gif) | image003 (280).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (774).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (773).jpg | 2025-11-21 06:47 | 40K | |
![[IMG]](/icons/image2.gif) | image002 (772).jpg | 2025-11-21 06:47 | 40K | |
![[IMG]](/icons/image2.gif) | image002 (303).png | 2025-11-21 06:47 | 6.2K | |
![[IMG]](/icons/image2.gif) | image001 (1729).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1728).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1727).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (867).png | 2025-11-21 06:47 | 179K | |
![[IMG]](/icons/image2.gif) | image001 (866).png | 2025-11-21 06:47 | 34K | |
![[ ]](/icons/unknown.gif) | Statistics (24).xlsx | 2025-11-21 06:47 | 29K | |
![[ ]](/icons/unknown.gif) | veteranis paketi.docx | 2025-11-21 06:47 | 192K | |
![[IMG]](/icons/image2.gif) | image003 (281).png | 2025-11-21 06:47 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (771).jpg | 2025-11-21 06:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (302).png | 2025-11-21 06:47 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1726).jpg | 2025-11-21 06:47 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (1725).jpg | 2025-11-21 06:47 | 3.9K | |
![[ ]](/icons/layout.gif) | Mid-Year FY14 Award Highlights 10-18-2013.pdf | 2025-11-21 06:47 | 247K | |
![[ ]](/icons/unknown.gif) | Combinations.rar | 2025-11-21 06:47 | 34M | |
![[IMG]](/icons/image2.gif) | image002 (770).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (769).jpg | 2025-11-21 06:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | image002 (768).jpg | 2025-11-21 06:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | image002 (301).png | 2025-11-21 06:47 | 25K | |
![[IMG]](/icons/image2.gif) | image002 (300).png | 2025-11-21 06:47 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (299).png | 2025-11-21 06:47 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (1724).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1723).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1722).jpg | 2025-11-21 06:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1721).jpg | 2025-11-21 06:47 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (1720).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1719).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (865).png | 2025-11-21 06:47 | 51K | |
![[ ]](/icons/unknown.gif) | combinationsV2.xlsx | 2025-11-21 06:47 | 598K | |
![[ ]](/icons/unknown.gif) | Letter to Noe- Insurance Statuses and Switching off the CRM andGMM.doc | 2025-11-21 06:47 | 70K | |
![[ ]](/icons/unknown.gif) | Guaranties from GMM (1).xlsx | 2025-11-21 06:47 | 21K | |
![[ ]](/icons/unknown.gif) | Cases from CRM (1).xlsx | 2025-11-21 06:47 | 23K | |
![[ ]](/icons/unknown.gif) | Book1 (7).xlsx | 2025-11-21 06:47 | 12K | |
![[ ]](/icons/unknown.gif) | ATT07427 | 2025-11-21 06:47 | 0 | |
![[ ]](/icons/unknown.gif) | პროვაიდერის ფასები რომლებიც ვერ მოხვდნენ კომბინაციებში__1_.xls | 2025-11-21 06:47 | 5.8M | |
![[ ]](/icons/unknown.gif) | მიმართვები - Copy.xlsx | 2025-11-21 06:47 | 20K | |
![[ ]](/icons/unknown.gif) | თერაპია ურგენტი (5).xlsx | 2025-11-21 06:47 | 11K | |
![[ ]](/icons/layout.gif) | rep (1).pdf | 2025-11-21 06:47 | 1.0M | |
![[ ]](/icons/unknown.gif) | referals-sergo.xlsx | 2025-11-21 06:47 | 15K | |
![[IMG]](/icons/image2.gif) | image005 (72).png | 2025-11-21 06:47 | 17K | |
![[IMG]](/icons/image2.gif) | image004 (147).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (279).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (298).png | 2025-11-21 06:47 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (297).png | 2025-11-21 06:47 | 182K | |
![[IMG]](/icons/image2.gif) | image002 (296).png | 2025-11-21 06:47 | 182K | |
![[IMG]](/icons/image2.gif) | image001 (1718).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1717).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1716).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1715).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1714).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1713).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1712).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (864).png | 2025-11-21 06:47 | 201K | |
![[IMG]](/icons/image2.gif) | image001 (863).png | 2025-11-21 06:47 | 201K | |
![[ ]](/icons/unknown.gif) | Vani Cases.xlsx | 2025-11-21 06:47 | 63K | |
![[ ]](/icons/unknown.gif) | SHALVA DAVIT KORIDZE.docx | 2025-11-21 06:47 | 193K | |
![[ ]](/icons/unknown.gif) | All Referrals With Prices.xls | 2025-11-21 06:47 | 11M | |
![[ ]](/icons/unknown.gif) | პრობლემური მიმართვები.xlsx | 2025-11-21 06:47 | 39K | |
![[ ]](/icons/unknown.gif) | თერაპია ურგენტი (4).xlsx | 2025-11-21 06:47 | 11K | |
![[ ]](/icons/unknown.gif) | ანალიტიკის მოდული-ახალი.docx | 2025-11-21 06:47 | 19K | |
![[ ]](/icons/layout.gif) | rep.pdf | 2025-11-21 06:47 | 1.0M | |
![[IMG]](/icons/image2.gif) | image003 (278).jpg | 2025-11-21 06:47 | 9.6K | |
![[IMG]](/icons/image2.gif) | image002 (295).png | 2025-11-21 06:47 | 182K | |
![[IMG]](/icons/image2.gif) | image002 (294).png | 2025-11-21 06:47 | 201K | |
![[IMG]](/icons/image2.gif) | image001 (862).png | 2025-11-21 06:47 | 179K | |
![[IMG]](/icons/image2.gif) | image001 (861).png | 2025-11-21 06:47 | 201K | |
![[IMG]](/icons/image2.gif) | image001 (860).png | 2025-11-21 06:47 | 179K | |
![[IMG]](/icons/image2.gif) | image001 (859).png | 2025-11-21 06:47 | 179K | |
![[IMG]](/icons/image2.gif) | image001 (858).png | 2025-11-21 06:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001 (857).png | 2025-11-21 06:47 | 164K | |
![[ ]](/icons/unknown.gif) | Server Error in.doc | 2025-11-21 06:47 | 30K | |
![[ ]](/icons/unknown.gif) | Reprints_Desk_Fast_Order_Form_Help_Guide.PDF | 2025-11-21 06:47 | 407K | |
![[ ]](/icons/unknown.gif) | N36 23_10_2013_272.PDF | 2025-11-21 06:47 | 1.8M | |
![[ ]](/icons/unknown.gif) | Medicament Statistic.rar | 2025-11-21 06:47 | 797K | |
![[ ]](/icons/unknown.gif) | How_to_Request_An Article_Through_Reprints_Desk.PDF | 2025-11-21 06:47 | 809K | |
![[ ]](/icons/unknown.gif) | DALI KAPANADZE 2659.docx | 2025-11-21 06:47 | 191K | |
![[ ]](/icons/unknown.gif) | პროვაიდერის ფასები რომლებიც ვერ მოხვდნენ კომბ.xls | 2025-11-21 06:47 | 5.8M | |
![[ ]](/icons/unknown.gif) | თერაპია ურგენტი.xlsx | 2025-11-21 06:47 | 11K | |
![[ ]](/icons/unknown.gif) | თერაპია ურგენტი (3).xlsx | 2025-11-21 06:47 | 11K | |
![[ ]](/icons/unknown.gif) | თერაპია ურგენტი (2).xlsx | 2025-11-21 06:47 | 11K | |
![[ ]](/icons/unknown.gif) | თერაპია ურგენტი (1).xlsx | 2025-11-21 06:47 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (71).png | 2025-11-21 06:47 | 201K | |
![[IMG]](/icons/image2.gif) | image004 (117).png | 2025-11-21 06:47 | 164K | |
![[IMG]](/icons/image2.gif) | image003 (280).png | 2025-11-21 06:47 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (277).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1711).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1710).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1709).jpg | 2025-11-21 06:47 | 4.2K | |
![[ ]](/icons/unknown.gif) | error (31).docx | 2025-11-21 06:47 | 131K | |
![[ ]](/icons/unknown.gif) | Iashvili Artificial Codes.xls | 2025-11-21 06:47 | 53K | |
![[ ]](/icons/unknown.gif) | ATT75487 | 2025-11-21 06:47 | 0 | |
![[ ]](/icons/unknown.gif) | ქლაუდში ხელოვნური კოდების ვიზუალი.xlsx | 2025-11-21 06:47 | 9.1K | |
![[IMG]](/icons/image2.gif) | ქვეკომპონენტის ჩამატება ლიმიტების გრაფაში.png | 2025-11-21 06:47 | 222K | |
![[IMG]](/icons/image2.gif) | ქვეკომპონენტის მდებარეობა.png | 2025-11-21 06:47 | 252K | |
![[ ]](/icons/unknown.gif) | ფინანსური მონიტორინგი.xlsx | 2025-11-21 06:47 | 11K | |
![[ ]](/icons/layout.gif) | მიმართვის ფორმა.pdf | 2025-11-21 06:47 | 707K | |
![[ ]](/icons/unknown.gif) | მიმართვების ლოგიკები 25_10_2013.docx | 2025-11-21 06:47 | 17K | |
![[ ]](/icons/unknown.gif) | მიმართვაზე ხელოვნური კოდის ვიზუალი.xlsx | 2025-11-21 06:47 | 8.6K | |
![[IMG]](/icons/image2.gif) | ინფორმაცია მიმართვაზე.png | 2025-11-21 06:47 | 214K | |
![[ ]](/icons/unknown.gif) | sakoveltao gegmiuri stac.xlsx | 2025-11-21 06:47 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (293).png | 2025-11-21 06:47 | 2.7K | |
![[IMG]](/icons/image2.gif) | image001 (1708).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1707).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (856).png | 2025-11-21 06:47 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (855).png | 2025-11-21 06:47 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (854).png | 2025-11-21 06:47 | 8.2K | |
![[ ]](/icons/unknown.gif) | Statistics (23).xlsx | 2025-11-21 06:47 | 30K | |
![[ ]](/icons/unknown.gif) | Doc11 (2).docx | 2025-11-21 06:47 | 178K | |
![[ ]](/icons/layout.gif) | DENTAL CLINICS (updated).pdf | 2025-11-21 06:47 | 370K | |
![[IMG]](/icons/image2.gif) | image003 (276).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (767).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (766).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1706).jpg | 2025-11-21 06:47 | 34K | |
![[IMG]](/icons/image2.gif) | image001 (1705).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1704).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1703).jpg | 2025-11-21 06:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1702).jpg | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1701).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | aOq0RX3_700b.jpg | 2025-11-21 06:47 | 53K | |
![[ ]](/icons/unknown.gif) | Doc2 (3).docx | 2025-11-21 06:47 | 171K | |
![[ ]](/icons/unknown.gif) | Doc2 (2).docx | 2025-11-21 06:47 | 171K | |
![[ ]](/icons/unknown.gif) | Case Registration Active Users v42.xls | 2025-11-21 06:47 | 382K | |
![[ ]](/icons/layout.gif) | სამედ_ შემთხვევების რეგისტრაციის მოდული - ოპერატორი (1).pdf | 2025-11-21 06:47 | 637K | |
![[ ]](/icons/layout.gif) | სამედ_ შემთხვევების რეგისტრაციის მოდული - ინსპექტორი (1).pdf | 2025-11-21 06:47 | 553K | |
![[ ]](/icons/layout.gif) | სამედ_ შემთხვევების რეგისტრაციის მოდული - ანალიტიკა (1).pdf | 2025-11-21 06:47 | 585K | |
![[ ]](/icons/unknown.gif) | პროვაიდერები კომპონენტების მიხედვით.xlsx | 2025-11-21 06:47 | 26K | |
![[IMG]](/icons/image2.gif) | მჭედლიძე ლალი.jpeg | 2025-11-21 06:47 | 469K | |
![[ ]](/icons/unknown.gif) | ახალი გეგმიური მიმართვების ანალკიტიკა კოდებით.xlsx | 2025-11-21 06:47 | 3.0M | |
![[IMG]](/icons/image2.gif) | pic2.png | 2025-11-21 06:47 | 164K | |
![[IMG]](/icons/image2.gif) | pic1.png | 2025-11-21 06:47 | 156K | |
![[IMG]](/icons/image2.gif) | image005 (93).jpg | 2025-11-21 06:47 | 9.1K | |
![[IMG]](/icons/image2.gif) | image003 (279).png | 2025-11-21 06:47 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (765).jpg | 2025-11-21 06:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1700).jpg | 2025-11-21 06:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1699).jpg | 2025-11-21 06:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (853).png | 2025-11-21 06:47 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (852).png | 2025-11-21 06:47 | 337K | |
![[ ]](/icons/unknown.gif) | SubmissionsReport_29-10-2013_16_07_57.xlsx | 2025-11-21 06:47 | 4.4M | |
![[ ]](/icons/unknown.gif) | Limits 2013-Sept-09.xlsx | 2025-11-21 06:47 | 13K | |
![[IMG]](/icons/image2.gif) | წულუკიძე 206063383.png | 2025-11-21 06:47 | 189K | |
![[ ]](/icons/unknown.gif) | გეგმიურების ანალიტიკა.xlsx | 2025-11-21 06:47 | 3.0M | |
![[ ]](/icons/unknown.gif) | გეგმიურების ანალიტიკა (2).xlsx | 2025-11-21 06:47 | 3.1M | |
![[ ]](/icons/unknown.gif) | გეგმიურების ანალიტიკა (1).xlsx | 2025-11-21 06:47 | 3.1M | |
![[ ]](/icons/unknown.gif) | ახალი გეგმიური მიმართვების ანალიტიკა კოდებით.xlsx | 2025-11-21 06:47 | 3.0M | |
![[ ]](/icons/unknown.gif) | treningi gaiares.xls | 2025-11-21 06:46 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (1698).jpg | 2025-11-21 06:46 | 13K | |
![[ ]](/icons/unknown.gif) | ATT76279 | 2025-11-21 06:46 | 0 | |
![[IMG]](/icons/image2.gif) | 17 (1).png | 2025-11-21 06:46 | 286K | |
![[IMG]](/icons/image2.gif) | 15 (1).png | 2025-11-21 06:46 | 291K | |
![[IMG]](/icons/image2.gif) | 13 (2).png | 2025-11-21 06:46 | 294K | |
![[IMG]](/icons/image2.gif) | 2_ (4).png | 2025-11-21 06:46 | 173K | |
![[IMG]](/icons/image2.gif) | 1_ (7).png | 2025-11-21 06:46 | 182K | |
![[ ]](/icons/unknown.gif) | გეგმიურგები ქვეკომპონენტებით მიმართვებიდან (1).xlsx | 2025-11-21 06:46 | 3.1M | |
![[ ]](/icons/unknown.gif) | ალფა-თაკო.xlsx | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1697).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | 20131031_145720_resized.jpg | 2025-11-21 06:46 | 1.4M | |
![[ ]](/icons/unknown.gif) | 218 -ე დადგენილებით.7z | 2025-11-21 06:46 | 5.8M | |
![[ ]](/icons/unknown.gif) | 36 -ე დადგენილებით.7z | 2025-11-21 06:46 | 31M | |
![[IMG]](/icons/image2.gif) | klinika rustavi.png | 2025-11-21 06:46 | 307K | |
![[IMG]](/icons/image2.gif) | image001 (1696).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1695).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1694).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1693).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1692).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1691).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1690).jpg | 2025-11-21 06:46 | 4.2K | |
![[ ]](/icons/unknown.gif) | ATT86682 | 2025-11-21 06:46 | 0 | |
![[IMG]](/icons/image2.gif) | image003 (278).png | 2025-11-21 06:46 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (764).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (292).png | 2025-11-21 06:46 | 87K | |
![[IMG]](/icons/image2.gif) | image001 (1689).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1688).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (851).png | 2025-11-21 06:46 | 223K | |
![[IMG]](/icons/image2.gif) | image001 (850).png | 2025-11-21 06:46 | 93K | |
![[IMG]](/icons/image2.gif) | IMG_20131101_091811.jpg | 2025-11-21 06:46 | 1.1M | |
![[IMG]](/icons/image2.gif) | IMG_20131101_091805.jpg | 2025-11-21 06:46 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_20131101_091756.jpg | 2025-11-21 06:46 | 965K | |
![[ ]](/icons/unknown.gif) | Doc11 (1).docx | 2025-11-21 06:46 | 138K | |
![[IMG]](/icons/image2.gif) | Capture (25).PNG | 2025-11-21 06:46 | 21K | |
![[IMG]](/icons/image2.gif) | 32A.png | 2025-11-21 06:46 | 630 | |
![[ ]](/icons/unknown.gif) | მიმართვები (2).xlsx | 2025-11-21 06:46 | 2.7M | |
![[ ]](/icons/unknown.gif) | არქიმედე N165 1.xlsx | 2025-11-21 06:46 | 225K | |
![[ ]](/icons/unknown.gif) | mimartvebi (1).xlsx | 2025-11-21 06:46 | 2.7M | |
![[IMG]](/icons/image2.gif) | image003 (275).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (274).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (763).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (762).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1687).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1686).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1685).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1684).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1683).jpg | 2025-11-21 06:46 | 4.2K | |
![[ ]](/icons/unknown.gif) | ღია ახალი ფასები 2013_11_04.xlsx | 2025-11-21 06:46 | 9.6K | |
![[ ]](/icons/unknown.gif) | ფინანსური მართვის მოდული (1).docx | 2025-11-21 06:46 | 1.7M | |
![[ ]](/icons/unknown.gif) | სმსების გასაგზავნად სიმბოლურად დარეგ_ მოთხოვნები.xlsx | 2025-11-21 06:46 | 9.1K | |
![[ ]](/icons/unknown.gif) | მიმართვები (1).xlsx | 2025-11-21 06:46 | 2.7M | |
![[ ]](/icons/unknown.gif) | გეგმიურგები ქვეკომპონენტებით მიმართვებიდან.xlsx | 2025-11-21 06:46 | 3.1M | |
![[IMG]](/icons/image2.gif) | image002 (761).jpg | 2025-11-21 06:46 | 9.4K | |
![[IMG]](/icons/image2.gif) | image002 (760).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (759).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1682).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1681).jpg | 2025-11-21 06:46 | 110K | |
![[IMG]](/icons/image2.gif) | image001 (1680).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1679).jpg | 2025-11-21 06:46 | 4.2K | |
![[ ]](/icons/unknown.gif) | Untitled (61) | 2025-11-21 06:46 | 0 | |
![[ ]](/icons/unknown.gif) | SubmissionsReport_N218_3 გადაუდებელი სტაციონარული მომსახურება.xlsx | 2025-11-21 06:46 | 1.8M | |
![[ ]](/icons/unknown.gif) | SubmissionsReport_36_4 gegmiuri qirurgiuli momsaxureba.xlsx | 2025-11-21 06:46 | 638K | |
![[ ]](/icons/unknown.gif) | SubmissionsReport_გადაუდებელი სტაციონარი 36.xlsx | 2025-11-21 06:46 | 3.4M | |
![[ ]](/icons/unknown.gif) | SubmissionsReport_გადაუდებელი სტაციონარი საბაზისო 36.xlsx | 2025-11-21 06:46 | 3.1M | |
![[IMG]](/icons/image2.gif) | Jimshitashvili.png | 2025-11-21 06:46 | 143K | |
![[IMG]](/icons/image2.gif) | Ivanishvili.png | 2025-11-21 06:46 | 156K | |
![[ ]](/icons/unknown.gif) | ATT46180 | 2025-11-21 06:46 | 0 | |
![[ ]](/icons/layout.gif) | ATLAS Goals - Quick Reference - Employee (1).pdf | 2025-11-21 06:46 | 198K | |
![[ ]](/icons/unknown.gif) | ფორმა.xls | 2025-11-21 06:46 | 26K | |
![[IMG]](/icons/image2.gif) | telavis bavSvTa jan centri.png | 2025-11-21 06:46 | 315K | |
![[IMG]](/icons/image2.gif) | regionaluri jandacvis centriqareli.png | 2025-11-21 06:46 | 312K | |
![[IMG]](/icons/image2.gif) | image001 (1678).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1677).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1676).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | arqimede lagodexi.png | 2025-11-21 06:46 | 315K | |
![[IMG]](/icons/image2.gif) | Capture (24).PNG | 2025-11-21 06:46 | 155K | |
![[IMG]](/icons/image2.gif) | ცარო გიორგაძე.jpg | 2025-11-21 06:46 | 804K | |
![[ ]](/icons/unknown.gif) | სამედიცინო დაწესებულებები-კოორდინატები.xlsx | 2025-11-21 06:46 | 206K | |
![[ ]](/icons/unknown.gif) | კომბინაციის ლოგიკები - სექტემბერი(2).xlsx | 2025-11-21 06:46 | 17K | |
![[IMG]](/icons/image2.gif) | medhausi (1).png | 2025-11-21 06:46 | 317K | |
![[IMG]](/icons/image2.gif) | janmrtelobis centri (1).png | 2025-11-21 06:46 | 308K | |
![[IMG]](/icons/image2.gif) | image002 (758).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1675).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1674).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1673).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1672).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1671).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1670).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (849).png | 2025-11-21 06:46 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (848).png | 2025-11-21 06:46 | 367K | |
![[IMG]](/icons/image2.gif) | image001 (847).png | 2025-11-21 06:46 | 8.9K | |
![[IMG]](/icons/image2.gif) | iashvili (2).png | 2025-11-21 06:46 | 322K | |
![[IMG]](/icons/image2.gif) | feromedi2 (1).png | 2025-11-21 06:46 | 285K | |
![[IMG]](/icons/image2.gif) | feromedi (1).png | 2025-11-21 06:46 | 202K | |
![[ ]](/icons/unknown.gif) | ATT22558 | 2025-11-21 06:46 | 0 | |
![[IMG]](/icons/image2.gif) | შ_პ_ს_ ბავშვთა ახალი კლინიკა 404904573 (1).png | 2025-11-21 06:46 | 200K | |
![[IMG]](/icons/image2.gif) | შპს “გადაუდებელი ქირურგიისა და ტრავმატოლოგიის ცენტრი“ 206047464 (1).png | 2025-11-21 06:46 | 203K | |
![[IMG]](/icons/image2.gif) | შპს ჯანმრთელობის ცენტრი (1).png | 2025-11-21 06:46 | 231K | |
![[IMG]](/icons/image2.gif) | image003 (277).png | 2025-11-21 06:46 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (276).png | 2025-11-21 06:46 | 4.5K | |
![[IMG]](/icons/image2.gif) | image002 (757).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (756).jpg | 2025-11-21 06:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1669).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1668).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (846).png | 2025-11-21 06:46 | 7.5K | |
![[IMG]](/icons/image2.gif) | iashvili (1).png | 2025-11-21 06:46 | 280K | |
![[IMG]](/icons/image2.gif) | IMG_20131107_150613.jpg | 2025-11-21 06:46 | 415K | |
![[ ]](/icons/unknown.gif) | ATT89587 | 2025-11-21 06:46 | 0 | |
![[IMG]](/icons/image2.gif) | შემთხვევები.djvu | 2025-11-21 06:46 | 26K | |
![[ ]](/icons/unknown.gif) | სტატისტიკის დანართი-165-218.xls | 2025-11-21 06:46 | 47K | |
![[ ]](/icons/unknown.gif) | მიმართვები(2013-11-01)-)2013-11-05).xlsx | 2025-11-21 06:46 | 46K | |
![[IMG]](/icons/image2.gif) | medhausi.png | 2025-11-21 06:46 | 317K | |
![[IMG]](/icons/image2.gif) | janmrtelobis centri.png | 2025-11-21 06:46 | 308K | |
![[IMG]](/icons/image2.gif) | images (1).jpg | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (70).png | 2025-11-21 06:46 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (146).jpg | 2025-11-21 06:46 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (275).png | 2025-11-21 06:46 | 1.2M | |
![[IMG]](/icons/image2.gif) | image002 (755).jpg | 2025-11-21 06:46 | 9.4K | |
![[IMG]](/icons/image2.gif) | image001 (1667).jpg | 2025-11-21 06:46 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1666).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1665).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1664).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | iashvili.png | 2025-11-21 06:46 | 322K | |
![[IMG]](/icons/image2.gif) | feromedi2.png | 2025-11-21 06:46 | 285K | |
![[IMG]](/icons/image2.gif) | feromedi.png | 2025-11-21 06:46 | 202K | |
![[ ]](/icons/unknown.gif) | Untitled (60) | 2025-11-21 06:46 | 0 | |
![[IMG]](/icons/image2.gif) | შ_პ_ს_ ბავშვთა ახალი კლინიკა 404904573.png | 2025-11-21 06:46 | 200K | |
![[IMG]](/icons/image2.gif) | შპს “გადაუდებელი ქირურგიისა და ტრავმატოლოგიის ცენტრი“ 206047464.png | 2025-11-21 06:46 | 203K | |
![[IMG]](/icons/image2.gif) | შპს ჯანმრთელობის ცენტრი.png | 2025-11-21 06:46 | 231K | |
![[IMG]](/icons/image2.gif) | image003 (274).png | 2025-11-21 06:46 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (754).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1663).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1662).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1661).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1660).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1659).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1658).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (845).png | 2025-11-21 06:46 | 55K | |
![[ ]](/icons/unknown.gif) | Untitled (59) | 2025-11-21 06:46 | 0 | |
![[IMG]](/icons/image2.gif) | Screenshot 2013-11-09 23_27_19.png | 2025-11-21 06:46 | 144K | |
![[IMG]](/icons/image2.gif) | ATT00002 (31).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (43).png | 2025-11-21 06:46 | 11K | |
![[ ]](/icons/unknown.gif) | 2014 Holidays - Georgia.doc | 2025-11-21 06:46 | 32K | |
![[IMG]](/icons/image2.gif) | image005 (92).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (145).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (273).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (272).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (753).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (752).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (751).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1657).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1656).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1655).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1654).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1653).jpg | 2025-11-21 06:46 | 9.4K | |
![[ ]](/icons/unknown.gif) | Referrals Without Diagnosis (1).xlsx | 2025-11-21 06:46 | 5.7M | |
![[ ]](/icons/unknown.gif) | Providers Without Contract (2).xlsx | 2025-11-21 06:46 | 10K | |
![[ ]](/icons/unknown.gif) | Providers Without Contract (1).xlsx | 2025-11-21 06:46 | 10K | |
![[IMG]](/icons/image2.gif) | view-s error.png | 2025-11-21 06:46 | 102K | |
![[IMG]](/icons/image2.gif) | image002 (750).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (291).png | 2025-11-21 06:46 | 97K | |
![[IMG]](/icons/image2.gif) | image001 (1652).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1651).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1650).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (844).png | 2025-11-21 06:46 | 51K | |
![[ ]](/icons/unknown.gif) | Referrals Without Diagnosis.xlsx | 2025-11-21 06:46 | 9.1M | |
![[IMG]](/icons/image2.gif) | 1470292_10202526689467237_2094759398_n.jpg | 2025-11-21 06:46 | 7.5K | |
![[ ]](/icons/unknown.gif) | 111.docx | 2025-11-21 06:46 | 132K | |
![[ ]](/icons/unknown.gif) | tanamshromlebis ganacilebaofisebshi.docx | 2025-11-21 06:46 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (116).png | 2025-11-21 06:46 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (273).png | 2025-11-21 06:46 | 30K | |
![[IMG]](/icons/image2.gif) | image003 (271).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (749).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (748).jpg | 2025-11-21 06:46 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (1649).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (843).png | 2025-11-21 06:46 | 55K | |
![[IMG]](/icons/image2.gif) | iashvili123.png | 2025-11-21 06:46 | 249K | |
![[IMG]](/icons/image2.gif) | bak.png | 2025-11-21 06:46 | 214K | |
![[ ]](/icons/unknown.gif) | Statistics (22).xlsx | 2025-11-21 06:46 | 31K | |
![[ ]](/icons/unknown.gif) | RE _ | 2025-11-21 06:46 | 0 | |
![[ ]](/icons/unknown.gif) | Joseph Wilson Bio.docx | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | Arqimede2.png | 2025-11-21 06:46 | 153K | |
![[IMG]](/icons/image2.gif) | Arqimede1.png | 2025-11-21 06:46 | 151K | |
![[IMG]](/icons/image2.gif) | Arqimede.png | 2025-11-21 06:46 | 176K | |
![[ ]](/icons/unknown.gif) | ATT74838 | 2025-11-21 06:46 | 0 | |
![[ ]](/icons/unknown.gif) | ATT48367 | 2025-11-21 06:46 | 0 | |
![[ ]](/icons/unknown.gif) | ATT35416 | 2025-11-21 06:46 | 0 | |
![[IMG]](/icons/image2.gif) | validacia ar aris.png | 2025-11-21 06:46 | 173K | |
![[IMG]](/icons/image2.gif) | image003 (272).png | 2025-11-21 06:46 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (1648).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1647).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1646).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | shefi.jpg | 2025-11-21 06:46 | 90K | |
![[IMG]](/icons/image2.gif) | medi club.png | 2025-11-21 06:46 | 123K | |
![[ ]](/icons/layout.gif) | letter from medgeorgia.pdf | 2025-11-21 06:46 | 72K | |
![[IMG]](/icons/image2.gif) | image004 (144).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (271).png | 2025-11-21 06:46 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (270).png | 2025-11-21 06:46 | 47K | |
![[IMG]](/icons/image2.gif) | image002 (747).jpg | 2025-11-21 06:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (290).png | 2025-11-21 06:46 | 48K | |
![[IMG]](/icons/image2.gif) | image001 (1645).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1644).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1643).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1642).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1641).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1640).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1639).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1638).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (842).png | 2025-11-21 06:46 | 70K | |
![[IMG]](/icons/image2.gif) | boss-vs-leader.jpg | 2025-11-21 06:46 | 78K | |
![[IMG]](/icons/image2.gif) | Untitled (61).png | 2025-11-21 06:46 | 215K | |
![[IMG]](/icons/image2.gif) | შპს ჯეო ჰოსპიტალს 404907730 დუშეთი, სტალინის ქ.png | 2025-11-21 06:46 | 206K | |
![[IMG]](/icons/image2.gif) | sms (6).png | 2025-11-21 06:46 | 196K | |
![[IMG]](/icons/image2.gif) | image011 (14).png | 2025-11-21 06:46 | 1.8K | |
![[IMG]](/icons/image2.gif) | image010 (10).jpg | 2025-11-21 06:46 | 8.6K | |
![[IMG]](/icons/image2.gif) | image009 (14).png | 2025-11-21 06:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | image008 (22).jpg | 2025-11-21 06:46 | 792 | |
![[IMG]](/icons/image2.gif) | image007 (32).jpg | 2025-11-21 06:46 | 881 | |
![[IMG]](/icons/image2.gif) | image006 (11).gif | 2025-11-21 06:46 | 220 | |
![[IMG]](/icons/image2.gif) | image005 (91).jpg | 2025-11-21 06:46 | 855 | |
![[IMG]](/icons/image2.gif) | image004 (20).gif | 2025-11-21 06:46 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (269).png | 2025-11-21 06:46 | 1.0K | |
![[IMG]](/icons/image2.gif) | image002 (746).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (289).png | 2025-11-21 06:46 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (1637).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1636).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1635).jpg | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1634).jpg | 2025-11-21 06:46 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (1633).jpg | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1632).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1631).jpg | 2025-11-21 06:46 | 4.2K | |
![[ ]](/icons/unknown.gif) | finansuri xe.xlsx | 2025-11-21 06:46 | 41K | |
![[IMG]](/icons/image2.gif) | damatebis Rilaki.png | 2025-11-21 06:46 | 240K | |
![[ ]](/icons/unknown.gif) | SubmissionsReport_gegmiuri ambulatoria statistikuri forma 36_1 01_08 - dan (1).xlsx | 2025-11-21 06:46 | 25M | |
![[IMG]](/icons/image2.gif) | JeoHospitals - Dusheti.PNG | 2025-11-21 06:46 | 58K | |
![[ ]](/icons/unknown.gif) | Cases.xlsx | 2025-11-21 06:46 | 12K | |
![[IMG]](/icons/image2.gif) | isev eror.png | 2025-11-21 06:46 | 211K | |
![[IMG]](/icons/image2.gif) | image002 (745).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (288).png | 2025-11-21 06:46 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1630).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1629).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1628).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1627).jpg | 2025-11-21 06:46 | 55K | |
![[ ]](/icons/unknown.gif) | კომბინაციის ლოგიკები - სექტემბერი(1) (1).xlsx | 2025-11-21 06:46 | 17K | |
![[IMG]](/icons/image2.gif) | sms (5).png | 2025-11-21 06:46 | 256K | |
![[IMG]](/icons/image2.gif) | image003 (268).png | 2025-11-21 06:46 | 189K | |
![[IMG]](/icons/image2.gif) | image002 (744).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (743).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (742).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1626).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1625).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1624).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1623).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (841).png | 2025-11-21 06:46 | 278K | |
![[IMG]](/icons/image2.gif) | image001 (840).png | 2025-11-21 06:46 | 189K | |
![[IMG]](/icons/image2.gif) | image001 (839).png | 2025-11-21 06:46 | 189K | |
![[IMG]](/icons/image2.gif) | casashleli sms.png | 2025-11-21 06:46 | 152K | |
![[ ]](/icons/unknown.gif) | SubmissionsReport_gegmiuri ambulatoria statistikuri forma 36_1 01_08 - dan.xlsx | 2025-11-21 06:46 | 25M | |
![[IMG]](/icons/image2.gif) | 6 (7).png | 2025-11-21 06:46 | 159K | |
![[IMG]](/icons/image2.gif) | 5 (4).png | 2025-11-21 06:46 | 181K | |
![[IMG]](/icons/image2.gif) | 4 (9).png | 2025-11-21 06:46 | 195K | |
![[ ]](/icons/unknown.gif) | 4 (1).docx | 2025-11-21 06:46 | 161K | |
![[IMG]](/icons/image2.gif) | image003 (270).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (741).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (740).jpg | 2025-11-21 06:46 | 9.4K | |
![[IMG]](/icons/image2.gif) | image001 (1622).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1621).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1620).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1619).jpg | 2025-11-21 06:46 | 110K | |
![[IMG]](/icons/image2.gif) | image001 (838).png | 2025-11-21 06:46 | 12K | |
![[ ]](/icons/unknown.gif) | Batches.xls | 2025-11-21 06:46 | 219K | |
![[ ]](/icons/layout.gif) | ATLAS Goals - Quick Reference - Employee.pdf | 2025-11-21 06:46 | 198K | |
![[IMG]](/icons/image2.gif) | 10 (4).png | 2025-11-21 06:46 | 164K | |
![[IMG]](/icons/image2.gif) | 9 (5).png | 2025-11-21 06:46 | 160K | |
![[IMG]](/icons/image2.gif) | 8 (4).png | 2025-11-21 06:46 | 158K | |
![[IMG]](/icons/image2.gif) | 7 (5).png | 2025-11-21 06:46 | 178K | |
![[IMG]](/icons/image2.gif) | 6 (6).png | 2025-11-21 06:46 | 162K | |
![[IMG]](/icons/image2.gif) | 5_.png | 2025-11-21 06:46 | 156K | |
![[IMG]](/icons/image2.gif) | 4_.png | 2025-11-21 06:46 | 156K | |
![[IMG]](/icons/image2.gif) | 3_ (2).png | 2025-11-21 06:46 | 170K | |
![[IMG]](/icons/image2.gif) | 2_ (3).png | 2025-11-21 06:46 | 179K | |
![[IMG]](/icons/image2.gif) | 1_ (6).png | 2025-11-21 06:46 | 141K | |
![[ ]](/icons/unknown.gif) | ფინანსური მართვის მოდული.docx | 2025-11-21 06:46 | 3.0M | |
![[IMG]](/icons/image2.gif) | image003 (267).png | 2025-11-21 06:46 | 278K | |
![[IMG]](/icons/image2.gif) | image003 (266).png | 2025-11-21 06:46 | 278K | |
![[IMG]](/icons/image2.gif) | image003 (265).png | 2025-11-21 06:46 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (739).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (738).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (737).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1618).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1617).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1616).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1615).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (837).png | 2025-11-21 06:46 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (836).png | 2025-11-21 06:46 | 278K | |
![[IMG]](/icons/image2.gif) | image001 (835).png | 2025-11-21 06:46 | 11K | |
![[ ]](/icons/unknown.gif) | dekas qvekomp.docx | 2025-11-21 06:46 | 178K | |
![[ ]](/icons/unknown.gif) | deka.docx | 2025-11-21 06:46 | 192K | |
![[ ]](/icons/unknown.gif) | MSTASKS 11_22_2013.docx | 2025-11-21 06:46 | 159K | |
![[IMG]](/icons/image2.gif) | ATT00002 (30).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (29).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (28).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (27).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (26).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (42).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (41).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (40).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (39).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (38).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (736).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (735).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (734).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (733).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (287).png | 2025-11-21 06:46 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (1614).jpg | 2025-11-21 06:46 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (1613).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1612).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (834).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (833).png | 2025-11-21 06:46 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (832).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (831).png | 2025-11-21 06:46 | 11K | |
![[TXT]](/icons/text.gif) | Object reference not set to an instance of an object.htm | 2025-11-21 06:46 | 5.9K | |
![[IMG]](/icons/image2.gif) | ATT00002 (25).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (24).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (23).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (22).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (37).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (36).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (35).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (34).png | 2025-11-21 06:46 | 11K | |
![[ ]](/icons/unknown.gif) | xarvezi (1).docx | 2025-11-21 06:46 | 181K | |
![[ ]](/icons/unknown.gif) | sms 02_12-16_12.docx | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (269).jpg | 2025-11-21 06:46 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (264).png | 2025-11-21 06:46 | 348K | |
![[IMG]](/icons/image2.gif) | image002 (732).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (731).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (730).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (729).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (728).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1611).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1610).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1609).jpg | 2025-11-21 06:46 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (830).png | 2025-11-21 06:46 | 348K | |
![[IMG]](/icons/image2.gif) | image001 (829).png | 2025-11-21 06:46 | 348K | |
![[IMG]](/icons/image2.gif) | image001 (828).png | 2025-11-21 06:46 | 348K | |
![[ ]](/icons/unknown.gif) | Medicaments.xlsx | 2025-11-21 06:46 | 26K | |
![[ ]](/icons/unknown.gif) | ATT60650 | 2025-11-21 06:46 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00002 (21).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (33).png | 2025-11-21 06:46 | 11K | |
![[ ]](/icons/unknown.gif) | სამედიცინო ბაზაში განსხვავებული პაკეტების მქონე პიროვნებები.xlsx | 2025-11-21 06:46 | 14K | |
![[ ]](/icons/unknown.gif) | მოთხოვნები გადაცემულია განსახილველად სტატუსით.xlsx | 2025-11-21 06:46 | 623K | |
![[IMG]](/icons/image2.gif) | image003 (268).jpg | 2025-11-21 06:46 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (267).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (727).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (726).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (725).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (724).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1608).jpg | 2025-11-21 06:46 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1607).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1606).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1605).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (827).png | 2025-11-21 06:46 | 35K | |
![[IMG]](/icons/image2.gif) | error (29).png | 2025-11-21 06:46 | 163K | |
![[ ]](/icons/unknown.gif) | Stock Management Module_WHO_Nov 27_Draft_ako.pptx | 2025-11-21 06:46 | 1.2M | |
![[ ]](/icons/unknown.gif) | Stock Management Module_WHO_Nov 27_Draft.pptx | 2025-11-21 06:46 | 1.1M | |
![[ ]](/icons/unknown.gif) | Stock Management Module_WHO_Nov 27_Draft (1).pptx | 2025-11-21 06:46 | 1.2M | |
![[ ]](/icons/unknown.gif) | Guaranties from GMM.xlsx | 2025-11-21 06:46 | 21K | |
![[ ]](/icons/unknown.gif) | GAUKMEBULSHI DATVALIEREBAZEERORI.docx | 2025-11-21 06:46 | 184K | |
![[ ]](/icons/unknown.gif) | ER-GANBLOKBA.docx | 2025-11-21 06:46 | 180K | |
![[ ]](/icons/unknown.gif) | Cases from CRM.xlsx | 2025-11-21 06:46 | 24K | |
![[IMG]](/icons/image2.gif) | ATT00002 (20).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (32).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | mimartva (1).png | 2025-11-21 06:46 | 116K | |
![[IMG]](/icons/image2.gif) | image003 (263).png | 2025-11-21 06:46 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (723).jpg | 2025-11-21 06:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (722).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1604).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1603).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | World AIDS Day.jpg | 2025-11-21 06:46 | 1.2M | |
![[ ]](/icons/unknown.gif) | TAKIDZE GIULI-GAUKMEBA.docx | 2025-11-21 06:46 | 212K | |
![[ ]](/icons/unknown.gif) | SHECDOMIT GAUKMEBULIGUGULASHVILI.docx | 2025-11-21 06:46 | 522K | |
![[IMG]](/icons/image2.gif) | Capture (23).PNG | 2025-11-21 06:46 | 30K | |
![[ ]](/icons/unknown.gif) | სამედიცინო დაწესებულებები-საინფორმაციო პორტალი.xlsx | 2025-11-21 06:46 | 579K | |
![[IMG]](/icons/image2.gif) | ზუგდიდის მრავალპროფილიანი კლინიკური საავადმყოფო რესპუბლიკა3.png | 2025-11-21 06:46 | 217K | |
![[IMG]](/icons/image2.gif) | ზუგდიდის მრავალპროფილიანი კლინიკური საავადმყოფო რესპუბლიკა2.png | 2025-11-21 06:46 | 215K | |
![[IMG]](/icons/image2.gif) | ზუგდიდის მრავალპროფილიანი კლინიკური საავადმყოფო რესპუბლიკა 1.png | 2025-11-21 06:46 | 218K | |
![[IMG]](/icons/image2.gif) | ზუგდიდის მრავალპროფილიანი კლინიკური საავადმყოფო რესპუბლიკა.png | 2025-11-21 06:46 | 202K | |
![[IMG]](/icons/image2.gif) | image003 (262).png | 2025-11-21 06:46 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (721).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (720).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1602).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1601).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (826).png | 2025-11-21 06:46 | 310K | |
![[IMG]](/icons/image2.gif) | eror Unable.png | 2025-11-21 06:46 | 227K | |
![[IMG]](/icons/image2.gif) | chachava.png | 2025-11-21 06:46 | 154K | |
![[IMG]](/icons/image2.gif) | abc.png | 2025-11-21 06:46 | 267K | |
![[IMG]](/icons/image2.gif) | 10 (3).png | 2025-11-21 06:46 | 161K | |
![[IMG]](/icons/image2.gif) | 9 (4).png | 2025-11-21 06:46 | 159K | |
![[IMG]](/icons/image2.gif) | 8 (3).png | 2025-11-21 06:46 | 151K | |
![[IMG]](/icons/image2.gif) | 7 (4).png | 2025-11-21 06:46 | 170K | |
![[IMG]](/icons/image2.gif) | 6 (5).png | 2025-11-21 06:46 | 176K | |
![[IMG]](/icons/image2.gif) | 5 (3).png | 2025-11-21 06:46 | 159K | |
![[IMG]](/icons/image2.gif) | 4 (8).png | 2025-11-21 06:46 | 149K | |
![[IMG]](/icons/image2.gif) | 3 (11).png | 2025-11-21 06:46 | 144K | |
![[IMG]](/icons/image2.gif) | 2 (23).png | 2025-11-21 06:46 | 151K | |
![[IMG]](/icons/image2.gif) | 1 (26).png | 2025-11-21 06:46 | 159K | |
![[IMG]](/icons/image2.gif) | ირმა კელბერაშვილის მიმართვა 41888.jpg | 2025-11-21 06:46 | 521K | |
![[IMG]](/icons/image2.gif) | reporting 36_8.png | 2025-11-21 06:46 | 151K | |
![[IMG]](/icons/image2.gif) | jemal todua vet.djvu | 2025-11-21 06:46 | 63K | |
![[IMG]](/icons/image2.gif) | image004 (143).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (719).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (718).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (717).jpg | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1600).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1599).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1598).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1597).jpg | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1596).jpg | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1595).jpg | 2025-11-21 06:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (825).png | 2025-11-21 06:46 | 112K | |
![[ ]](/icons/unknown.gif) | aravaliduri.PDF | 2025-11-21 06:46 | 802K | |
![[ ]](/icons/unknown.gif) | Statistics (21).xlsx | 2025-11-21 06:46 | 32K | |
![[ ]](/icons/unknown.gif) | Questionnaire for Winter 2013 Retreat.xlsx | 2025-11-21 06:46 | 75K | |
![[ ]](/icons/unknown.gif) | List of Partners and their emails for Christmas&NY.docx | 2025-11-21 06:46 | 48K | |
![[IMG]](/icons/image2.gif) | Khechinashvili.png | 2025-11-21 06:46 | 228K | |
![[ ]](/icons/unknown.gif) | ATT28480 | 2025-11-21 06:46 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00002 (19).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (31).png | 2025-11-21 06:46 | 11K | |
![[ ]](/icons/unknown.gif) | კომბინაციის ლოგიკები - სექტემბერი(1).xlsx | 2025-11-21 06:46 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (261).png | 2025-11-21 06:46 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (716).jpg | 2025-11-21 06:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1594).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1593).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1592).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (824).png | 2025-11-21 06:46 | 41K | |
![[IMG]](/icons/image2.gif) | error validaciis gatarebisas.png | 2025-11-21 06:46 | 128K | |
![[ ]](/icons/unknown.gif) | angarishgebashi svetebis cvlileba.xlsx | 2025-11-21 06:46 | 17K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_personal (1).xlsx | 2025-11-21 06:46 | 15K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_eRecipes (1).xlsx | 2025-11-21 06:46 | 8.8K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_capitation_personal (1).xlsx | 2025-11-21 06:46 | 10K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_capitation (1).xlsx | 2025-11-21 06:46 | 11K | |
![[ ]](/icons/unknown.gif) | Shemtxvevebis_Registracia_Analitika (1).xls | 2025-11-21 06:46 | 28K | |
![[ ]](/icons/unknown.gif) | Providers Without Contract.xlsx | 2025-11-21 06:46 | 9.5K | |
![[ ]](/icons/unknown.gif) | Mimartvebis_Analitika (2).xlsx | 2025-11-21 06:46 | 2.9M | |
![[ ]](/icons/unknown.gif) | International Support Services Functions Reassignment Plan.pptx | 2025-11-21 06:46 | 100K | |
![[IMG]](/icons/image2.gif) | ATT00002 (18).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (17).jpg | 2025-11-21 06:46 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (30).png | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (29).png | 2025-11-21 06:46 | 11K | |
![[ ]](/icons/layout.gif) | სამედ_ შემთხვევების რეგისტრაციის მოდული - ოპერატორი.pdf | 2025-11-21 06:46 | 609K | |
![[ ]](/icons/layout.gif) | სამედ_ შემთხვევების რეგისტრაციის მოდული - ინსპექტორი.pdf | 2025-11-21 06:46 | 534K | |
![[ ]](/icons/layout.gif) | სამედ_ შემთხვევების რეგისტრაციის მოდული - ანალიტიკა.pdf | 2025-11-21 06:46 | 551K | |
![[ ]](/icons/unknown.gif) | გასარკვევი კომბინაცია.xlsx | 2025-11-21 06:46 | 8.8K | |
![[ ]](/icons/unknown.gif) | usaid (1).xlsx | 2025-11-21 06:46 | 11K | |
![[IMG]](/icons/image2.gif) | oh-god-why.png | 2025-11-21 06:46 | 80K | |
![[IMG]](/icons/image2.gif) | image001 (1591).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1590).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1589).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1588).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1587).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1586).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1585).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1584).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1583).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (823).png | 2025-11-21 06:46 | 20K | |
![[IMG]](/icons/image2.gif) | 18.png | 2025-11-21 06:46 | 181K | |
![[IMG]](/icons/image2.gif) | 17.png | 2025-11-21 06:46 | 156K | |
![[IMG]](/icons/image2.gif) | 16.png | 2025-11-21 06:46 | 152K | |
![[IMG]](/icons/image2.gif) | 15.png | 2025-11-21 06:46 | 166K | |
![[IMG]](/icons/image2.gif) | 14 (1).png | 2025-11-21 06:46 | 165K | |
![[IMG]](/icons/image2.gif) | 13 (1).png | 2025-11-21 06:46 | 170K | |
![[IMG]](/icons/image2.gif) | 12 (2).png | 2025-11-21 06:46 | 174K | |
![[IMG]](/icons/image2.gif) | 11 (2).png | 2025-11-21 06:46 | 177K | |
![[IMG]](/icons/image2.gif) | 10 (2).png | 2025-11-21 06:46 | 152K | |
![[IMG]](/icons/image2.gif) | 9 (3).png | 2025-11-21 06:46 | 170K | |
![[IMG]](/icons/image2.gif) | 8 (2).png | 2025-11-21 06:46 | 185K | |
![[IMG]](/icons/image2.gif) | 7 (3).png | 2025-11-21 06:46 | 143K | |
![[IMG]](/icons/image2.gif) | 6 (4).png | 2025-11-21 06:46 | 158K | |
![[IMG]](/icons/image2.gif) | 5 (2).png | 2025-11-21 06:46 | 158K | |
![[IMG]](/icons/image2.gif) | 4 (7).png | 2025-11-21 06:46 | 159K | |
![[IMG]](/icons/image2.gif) | 3 (10).png | 2025-11-21 06:46 | 153K | |
![[IMG]](/icons/image2.gif) | 2 (22).png | 2025-11-21 06:46 | 159K | |
![[IMG]](/icons/image2.gif) | 1 (25).png | 2025-11-21 06:46 | 158K | |
![[IMG]](/icons/image2.gif) | statusebis minicheba.png | 2025-11-21 06:46 | 172K | |
![[IMG]](/icons/image2.gif) | image003 (266).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (715).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (714).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (713).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (712).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1582).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1581).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1580).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1579).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1578).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1577).jpg | 2025-11-21 06:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1576).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1575).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1574).jpg | 2025-11-21 06:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | error validaciisas.png | 2025-11-21 06:46 | 125K | |
![[ ]](/icons/unknown.gif) | error (30).docx | 2025-11-21 06:46 | 168K | |
![[ ]](/icons/unknown.gif) | BUGs in Vital Registration Module.xlsx | 2025-11-21 06:46 | 15K | |
![[IMG]](/icons/image2.gif) | sms (4).png | 2025-11-21 06:45 | 192K | |
![[ ]](/icons/layout.gif) | sagadasaxado.pdf | 2025-11-21 06:45 | 2.1M | |
![[IMG]](/icons/image2.gif) | ispeqtirebis vada.png | 2025-11-21 06:45 | 192K | |
![[IMG]](/icons/image2.gif) | image003 (260).png | 2025-11-21 06:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (1573).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1572).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1571).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1570).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1569).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1568).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1567).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | baikos.png | 2025-11-21 06:45 | 138K | |
![[ ]](/icons/unknown.gif) | Statistics (20).xlsx | 2025-11-21 06:45 | 33K | |
![[ ]](/icons/unknown.gif) | ATT09393 | 2025-11-21 06:45 | 0 | |
![[ ]](/icons/unknown.gif) | მიმართვები ლიმიტს გადაჭარბებული თანხებით.xlsx | 2025-11-21 06:45 | 13K | |
![[ ]](/icons/unknown.gif) | მიმართვები ლიმიტს გადაჭარბებული თანხებით (2).xlsx | 2025-11-21 06:45 | 13K | |
![[ ]](/icons/unknown.gif) | მიმართვები ლიმიტს გადაჭარბებული თანხებით (1).xlsx | 2025-11-21 06:45 | 13K | |
![[ ]](/icons/unknown.gif) | ლიმიტი არ დაებლოკა მიმართვები.xlsx | 2025-11-21 06:45 | 55K | |
![[ ]](/icons/unknown.gif) | ლიმიტი არ დაებლოკა მიმართვები (2).xlsx | 2025-11-21 06:45 | 55K | |
![[ ]](/icons/unknown.gif) | ლიმიტი არ დაებლოკა მიმართვები (1).xlsx | 2025-11-21 06:45 | 55K | |
![[IMG]](/icons/image2.gif) | jeo1.png | 2025-11-21 06:45 | 208K | |
![[IMG]](/icons/image2.gif) | image005 (69).png | 2025-11-21 06:45 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (115).png | 2025-11-21 06:45 | 1.9K | |
![[IMG]](/icons/image2.gif) | image003 (259).png | 2025-11-21 06:45 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (711).jpg | 2025-11-21 06:45 | 51K | |
![[IMG]](/icons/image2.gif) | image002 (710).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (709).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1566).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1565).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1564).jpg | 2025-11-21 06:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (822).png | 2025-11-21 06:45 | 11K | |
![[ ]](/icons/unknown.gif) | Case Registration Active Users v43.xls | 2025-11-21 06:45 | 392K | |
![[IMG]](/icons/image2.gif) | 12 (1).png | 2025-11-21 06:45 | 178K | |
![[IMG]](/icons/image2.gif) | 11 (1).png | 2025-11-21 06:45 | 180K | |
![[IMG]](/icons/image2.gif) | 10 (1).png | 2025-11-21 06:45 | 180K | |
![[IMG]](/icons/image2.gif) | 9 (2).png | 2025-11-21 06:45 | 181K | |
![[IMG]](/icons/image2.gif) | 8_.png | 2025-11-21 06:45 | 150K | |
![[IMG]](/icons/image2.gif) | 7 (2).png | 2025-11-21 06:45 | 162K | |
![[IMG]](/icons/image2.gif) | 6 (3).png | 2025-11-21 06:45 | 161K | |
![[IMG]](/icons/image2.gif) | 2 (21).png | 2025-11-21 06:45 | 144K | |
![[ ]](/icons/unknown.gif) | validuria.dib | 2025-11-21 06:45 | 195K | |
![[IMG]](/icons/image2.gif) | minimaluri.png | 2025-11-21 06:45 | 244K | |
![[IMG]](/icons/image2.gif) | image003 (265).jpg | 2025-11-21 06:45 | 20K | |
![[IMG]](/icons/image2.gif) | image001 (1563).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1562).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1561).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1560).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | gadmogzavnili reestri.png | 2025-11-21 06:45 | 136K | |
![[ ]](/icons/unknown.gif) | err (2).docx | 2025-11-21 06:45 | 170K | |
![[IMG]](/icons/image2.gif) | double-certificate.png | 2025-11-21 06:45 | 4.2K | |
![[ ]](/icons/unknown.gif) | cloud-ზე დასადები (1).docx | 2025-11-21 06:45 | 14K | |
![[IMG]](/icons/image2.gif) | Telavis raionuli saavadmyofo.png | 2025-11-21 06:45 | 141K | |
![[ ]](/icons/unknown.gif) | Financing Items - codes chart 13-Aug-2013 sergos versia.xlsx | 2025-11-21 06:45 | 72K | |
![[IMG]](/icons/image2.gif) | Capture (22).PNG | 2025-11-21 06:45 | 70K | |
![[IMG]](/icons/image2.gif) | ATT00002 (16).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (28).png | 2025-11-21 06:45 | 11K | |
![[ ]](/icons/unknown.gif) | naia.docx | 2025-11-21 06:45 | 137K | |
![[IMG]](/icons/image2.gif) | min_ sabaziso.png | 2025-11-21 06:45 | 146K | |
![[IMG]](/icons/image2.gif) | maisi ivnisi.png | 2025-11-21 06:45 | 147K | |
![[IMG]](/icons/image2.gif) | image003 (258).png | 2025-11-21 06:45 | 137K | |
![[IMG]](/icons/image2.gif) | image002 (708).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1559).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1558).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1557).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1556).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1555).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1554).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (821).png | 2025-11-21 06:45 | 137K | |
![[IMG]](/icons/image2.gif) | image001 (820).png | 2025-11-21 06:45 | 137K | |
![[ ]](/icons/unknown.gif) | danarti Ø N1.docx | 2025-11-21 06:45 | 100K | |
![[ ]](/icons/unknown.gif) | New Microsoft Word Document (2).docx | 2025-11-21 06:45 | 14K | |
![[IMG]](/icons/image2.gif) | 2013-12-13_105308.png | 2025-11-21 06:45 | 9.5K | |
![[ ]](/icons/unknown.gif) | 2 A_1 SACHKHERE 368-1367.xls | 2025-11-21 06:45 | 799K | |
![[ ]](/icons/layout.gif) | weekend highlights Dec 13 - 15.pdf | 2025-11-21 06:45 | 705K | |
![[ ]](/icons/unknown.gif) | vera.docx | 2025-11-21 06:45 | 136K | |
![[IMG]](/icons/image2.gif) | image003 (257).png | 2025-11-21 06:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (1553).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1552).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1551).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1550).jpg | 2025-11-21 06:45 | 4.2K | |
![[ ]](/icons/unknown.gif) | Statistics (19).xlsx | 2025-11-21 06:45 | 33K | |
![[ ]](/icons/unknown.gif) | Double Status.xlsx | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | ATT00002 (15).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (27).png | 2025-11-21 06:45 | 11K | |
![[ ]](/icons/unknown.gif) | პირადი ნომრები.docx | 2025-11-21 06:45 | 13K | |
![[ ]](/icons/unknown.gif) | მიმართვების ადმინისტრირების მოდული.docx | 2025-11-21 06:45 | 1.7M | |
![[IMG]](/icons/image2.gif) | image002 (707).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (706).jpg | 2025-11-21 06:45 | 4.9K | |
![[IMG]](/icons/image2.gif) | image002 (705).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (286).png | 2025-11-21 06:45 | 91K | |
![[IMG]](/icons/image2.gif) | image001 (1549).jpg | 2025-11-21 06:45 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1548).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (819).png | 2025-11-21 06:45 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (818).png | 2025-11-21 06:45 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (817).png | 2025-11-21 06:45 | 11K | |
![[IMG]](/icons/image2.gif) | dabrunebis erori.png | 2025-11-21 06:45 | 287K | |
![[ ]](/icons/unknown.gif) | RBNS template (1).xlsx | 2025-11-21 06:45 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00002 (14).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (13).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (26).png | 2025-11-21 06:45 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (25).png | 2025-11-21 06:45 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (90).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (114).png | 2025-11-21 06:45 | 91K | |
![[IMG]](/icons/image2.gif) | image003 (264).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (263).jpg | 2025-11-21 06:45 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (704).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1547).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1546).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1545).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (816).png | 2025-11-21 06:45 | 113K | |
![[IMG]](/icons/image2.gif) | image001 (815).png | 2025-11-21 06:45 | 42K | |
![[ ]](/icons/unknown.gif) | Cartu - Service Types (1).xlsx | 2025-11-21 06:45 | 12K | |
![[ ]](/icons/unknown.gif) | 2 (2).docx | 2025-11-21 06:45 | 319K | |
![[IMG]](/icons/image2.gif) | image006 (68).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image005 (89).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image005 (88).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image005 (87).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image005 (86).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image005 (85).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (142).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (141).jpg | 2025-11-21 06:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | image004 (140).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (139).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (138).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (262).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (261).jpg | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | image003 (260).jpg | 2025-11-21 06:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | image003 (259).jpg | 2025-11-21 06:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | image003 (258).jpg | 2025-11-21 06:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | image003 (256).png | 2025-11-21 06:45 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (703).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (702).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (701).jpg | 2025-11-21 06:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (700).jpg | 2025-11-21 06:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | image002 (699).jpg | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | image002 (698).jpg | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | image002 (697).jpg | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1544).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1543).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1542).jpg | 2025-11-21 06:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (1541).jpg | 2025-11-21 06:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (1540).jpg | 2025-11-21 06:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | error naxvis dros.png | 2025-11-21 06:45 | 106K | |
![[ ]](/icons/unknown.gif) | დაწესებულების პასპორტი (1).xls | 2025-11-21 06:45 | 99K | |
![[IMG]](/icons/image2.gif) | image005 (84).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (137).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (257).jpg | 2025-11-21 06:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | image003 (256).jpg | 2025-11-21 06:45 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (255).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (254).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (696).jpg | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1539).jpg | 2025-11-21 06:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (1538).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1537).jpg | 2025-11-21 06:45 | 119K | |
![[IMG]](/icons/image2.gif) | Untitled (60).png | 2025-11-21 06:45 | 160K | |
![[ ]](/icons/unknown.gif) | RBNS template.xlsx | 2025-11-21 06:45 | 11K | |
![[ ]](/icons/unknown.gif) | Immunization Data by Providers_Dec 20,2013.xlsx | 2025-11-21 06:45 | 13K | |
![[ ]](/icons/unknown.gif) | Doc1 (12).docx | 2025-11-21 06:45 | 196K | |
![[ ]](/icons/layout.gif) | Claims by contracts and dates_1.pdf | 2025-11-21 06:45 | 601K | |
![[IMG]](/icons/image2.gif) | 3_ (1).png | 2025-11-21 06:45 | 276K | |
![[IMG]](/icons/image2.gif) | 2_ (2).png | 2025-11-21 06:45 | 162K | |
![[IMG]](/icons/image2.gif) | 1_ (5).png | 2025-11-21 06:45 | 274K | |
![[IMG]](/icons/image2.gif) | image003 (255).png | 2025-11-21 06:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (254).png | 2025-11-21 06:45 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (695).jpg | 2025-11-21 06:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1536).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1535).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1534).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1533).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1532).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (814).png | 2025-11-21 06:45 | 2.6K | |
![[ ]](/icons/unknown.gif) | Statistics (18).xlsx | 2025-11-21 06:45 | 34K | |
![[ ]](/icons/unknown.gif) | ExportedMessages (2).xlsx | 2025-11-21 06:45 | 476K | |
![[ ]](/icons/layout.gif) | AIDS2014_Abstract_Submission_Guidelines[1].pdf | 2025-11-21 06:45 | 206K | |
![[IMG]](/icons/image2.gif) | 1524039_799806043379654_1979347441_o.jpg | 2025-11-21 06:45 | 179K | |
![[ ]](/icons/unknown.gif) | შესრულებები (1).xls | 2025-11-21 06:45 | 791K | |
![[ ]](/icons/unknown.gif) | მიმართვები.xlsx | 2025-11-21 06:45 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (83).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (136).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (253).png | 2025-11-21 06:45 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (253).jpg | 2025-11-21 06:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | image002 (694).jpg | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | image002 (693).jpg | 2025-11-21 06:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1531).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1530).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1529).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1528).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1527).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1526).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1525).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1524).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1523).jpg | 2025-11-21 06:45 | 34K | |
![[IMG]](/icons/image2.gif) | image001 (1522).jpg | 2025-11-21 06:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (126).gif | 2025-11-21 06:45 | 32K | |
![[ ]](/icons/unknown.gif) | finansuri xe saboloo.xlsx | 2025-11-21 06:45 | 73K | |
![[ ]](/icons/unknown.gif) | error (29).docx | 2025-11-21 06:45 | 18K | |
![[IMG]](/icons/image2.gif) | chirstmas card 2014.jpg | 2025-11-21 06:45 | 182K | |
![[ ]](/icons/unknown.gif) | Cartu - Service Types.xlsx | 2025-11-21 06:45 | 15K | |
![[ ]](/icons/unknown.gif) | შესრულებები.xls | 2025-11-21 06:45 | 787K | |
![[ ]](/icons/unknown.gif) | მიმართვები-2.xlsx | 2025-11-21 06:45 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (692).jpg | 2025-11-21 06:45 | 81K | |
![[IMG]](/icons/image2.gif) | image002 (691).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (690).jpg | 2025-11-21 06:45 | 81K | |
![[IMG]](/icons/image2.gif) | image002 (689).jpg | 2025-11-21 06:45 | 1.3K | |
![[IMG]](/icons/image2.gif) | image001 (1521).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1520).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1519).jpg | 2025-11-21 06:45 | 48K | |
![[IMG]](/icons/image2.gif) | image001 (1518).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1517).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1516).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1515).jpg | 2025-11-21 06:45 | 5.8K | |
![[ ]](/icons/unknown.gif) | SubmissionsReport_25-12-2013_10_34_56.xlsx | 2025-11-21 06:45 | 12K | |
![[IMG]](/icons/image2.gif) | 4 poliklinika.djvu | 2025-11-21 06:45 | 22K | |
![[IMG]](/icons/image2.gif) | 2 samkurnalo prof centri.djvu | 2025-11-21 06:45 | 26K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (28).jpg | 2025-11-21 06:45 | 823 | |
![[ ]](/icons/unknown.gif) | urgentuli kodebi (4).xlsx | 2025-11-21 06:45 | 71K | |
![[IMG]](/icons/image2.gif) | image005 (68).png | 2025-11-21 06:45 | 24K | |
![[IMG]](/icons/image2.gif) | image004 (113).png | 2025-11-21 06:45 | 40K | |
![[IMG]](/icons/image2.gif) | image003 (252).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (251).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (250).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (249).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (248).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (688).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (687).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (686).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (685).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (684).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (285).png | 2025-11-21 06:45 | 24K | |
![[IMG]](/icons/image2.gif) | image002 (284).png | 2025-11-21 06:45 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (1514).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1513).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (813).png | 2025-11-21 06:45 | 40K | |
![[IMG]](/icons/image2.gif) | image001 (812).png | 2025-11-21 06:45 | 40K | |
![[ ]](/icons/unknown.gif) | codes chart.xls | 2025-11-21 06:45 | 29K | |
![[ ]](/icons/unknown.gif) | Untitled (58) | 2025-11-21 06:45 | 0 | |
![[ ]](/icons/unknown.gif) | Recommendations for Vital Registration Module (2).docx | 2025-11-21 06:45 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (252).png | 2025-11-21 06:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (683).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1512).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1511).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1510).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1509).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1508).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1507).jpg | 2025-11-21 06:45 | 4.2K | |
![[ ]](/icons/unknown.gif) | cloud-ზე დასადები.docx | 2025-11-21 06:45 | 13K | |
![[ ]](/icons/unknown.gif) | Statistics (17).xlsx | 2025-11-21 06:45 | 34K | |
![[ ]](/icons/unknown.gif) | Immunization Data as of Dec 27 2013.xlsx | 2025-11-21 06:45 | 14K | |
![[ ]](/icons/unknown.gif) | საინფორმაციო პორტალის დაწესებულებების მომხმარებელები.xlsx | 2025-11-21 06:45 | 142K | |
![[IMG]](/icons/image2.gif) | sxivuri.png | 2025-11-21 06:45 | 143K | |
![[IMG]](/icons/image2.gif) | kardio.png | 2025-11-21 06:45 | 144K | |
![[IMG]](/icons/image2.gif) | image005 (82).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image005 (81).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (135).jpg | 2025-11-21 06:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | image004 (134).jpg | 2025-11-21 06:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | image003 (247).jpg | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | image003 (246).jpg | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | image002 (682).jpg | 2025-11-21 06:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | image002 (681).jpg | 2025-11-21 06:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | image002 (680).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1506).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1505).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1504).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1503).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1502).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | error__.png | 2025-11-21 06:45 | 93K | |
![[IMG]](/icons/image2.gif) | Happy-New-Year-With-Christmas-2014-HD-Wallpapers (1).jpg | 2025-11-21 06:45 | 244K | |
![[IMG]](/icons/image2.gif) | 218 (2).png | 2025-11-21 06:45 | 136K | |
![[ ]](/icons/unknown.gif) | 165-218.xlsx | 2025-11-21 06:45 | 119K | |
![[ ]](/icons/unknown.gif) | სტატისტიკის დანართი-165-218, ვეტერანები (1).xls | 2025-11-21 06:45 | 53K | |
![[ ]](/icons/unknown.gif) | მომსახურეობების სახე.xlsx | 2025-11-21 06:45 | 10K | |
![[ ]](/icons/unknown.gif) | დაწესებულების პასპორტი.xls | 2025-11-21 06:45 | 99K | |
![[ ]](/icons/unknown.gif) | არქიმედეს მომსახურეობების სახე.xlsx | 2025-11-21 06:45 | 10K | |
![[ ]](/icons/unknown.gif) | tamar gaxutishvili.docx | 2025-11-21 06:45 | 315K | |
![[IMG]](/icons/image2.gif) | image004 (133).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (251).png | 2025-11-21 06:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (245).jpg | 2025-11-21 06:45 | 8.9K | |
![[IMG]](/icons/image2.gif) | image003 (244).jpg | 2025-11-21 06:45 | 411 | |
![[IMG]](/icons/image2.gif) | image002 (679).jpg | 2025-11-21 06:45 | 423 | |
![[IMG]](/icons/image2.gif) | image002 (678).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (677).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1501).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1500).jpg | 2025-11-21 06:45 | 406 | |
![[IMG]](/icons/image2.gif) | image001 (1499).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1498).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (811).png | 2025-11-21 06:45 | 808K | |
![[IMG]](/icons/image2.gif) | Happy-New-Year-With-Christmas-2014-HD-Wallpapers.jpg | 2025-11-21 06:45 | 244K | |
![[IMG]](/icons/image2.gif) | Capture (2).JPG | 2025-11-21 06:45 | 73K | |
![[ ]](/icons/unknown.gif) | urgentuli kodebi (3).xlsx | 2025-11-21 06:45 | 71K | |
![[IMG]](/icons/image2.gif) | image008 (21).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image005 (80).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image004 (132).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image003 (243).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image003 (242).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (676).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (675).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (674).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (673).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (672).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (671).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1497).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1496).jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1495).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1494).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1493).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (810).png | 2025-11-21 06:45 | 2.6K | |
![[IMG]](/icons/image2.gif) | alfa erori 08_01_2014.png | 2025-11-21 06:45 | 131K | |
![[IMG]](/icons/image2.gif) | alas erori 08_01_2014 1.png | 2025-11-21 06:45 | 260K | |
![[ ]](/icons/unknown.gif) | Statistics (16).xlsx | 2025-11-21 06:45 | 35K | |
![[ ]](/icons/unknown.gif) | Recommendations for Vital Registration Module (1).docx | 2025-11-21 06:45 | 22K | |
![[ ]](/icons/unknown.gif) | RE 70%- (1) | 2025-11-21 06:45 | 0 | |
![[ ]](/icons/unknown.gif) | RE 70%- | 2025-11-21 06:45 | 0 | |
![[ ]](/icons/unknown.gif) | NotValidData.xlsx | 2025-11-21 06:45 | 160K | |
![[ ]](/icons/unknown.gif) | ATT71652 | 2025-11-21 06:45 | 0 | |
![[ ]](/icons/unknown.gif) | ATT13598 | 2025-11-21 06:45 | 0 | |
![[ ]](/icons/unknown.gif) | 70%- | 2025-11-21 06:45 | 0 | |
![[ ]](/icons/unknown.gif) | სტატისტიკის დანართი-165-218, ვეტერანები.xls | 2025-11-21 06:45 | 55K | |
![[ ]](/icons/unknown.gif) | პროგრამები (2).xlsx | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | კ_ ერისთავის სახ_ ექსპერიმენტული და კლინიკური ქირურგიის ეროვნული ცენტრი.png | 2025-11-21 06:45 | 265K | |
![[IMG]](/icons/image2.gif) | image005 (79).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image005 (78).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (131).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (130).jpg | 2025-11-21 06:45 | 253K | |
![[IMG]](/icons/image2.gif) | image003 (250).png | 2025-11-21 06:45 | 39K | |
![[IMG]](/icons/image2.gif) | image003 (249).png | 2025-11-21 06:45 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (670).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (669).jpg | 2025-11-21 06:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1492).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1491).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1490).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1489).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1488).jpg | 2025-11-21 06:45 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (1487).jpg | 2025-11-21 06:45 | 3.9K | |
![[ ]](/icons/unknown.gif) | error (28).docx | 2025-11-21 06:45 | 159K | |
![[ ]](/icons/unknown.gif) | User ManualVideo Tutorial Statuses.xlsx | 2025-11-21 06:45 | 123K | |
![[ ]](/icons/unknown.gif) | Hesperus Synchronizer.rar | 2025-11-21 06:45 | 574K | |
![[ ]](/icons/unknown.gif) | veterani bostoganashvili.docx | 2025-11-21 06:45 | 186K | |
![[ ]](/icons/unknown.gif) | sabaziso saldastanishviligpi.docx | 2025-11-21 06:45 | 184K | |
![[IMG]](/icons/image2.gif) | image006 (67).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image005 (77).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (76).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (129).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (241).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (240).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (668).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (667).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (666).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1486).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1485).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1484).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1483).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1482).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image011 (4).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image010 (9).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image009 (11).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image008 (20).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image007 (31).jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image006 (66).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image006 (65).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image005 (75).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image005 (74).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (128).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (127).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (239).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image003 (238).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (237).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (236).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (235).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (665).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (664).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (663).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (662).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (661).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1481).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1480).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1479).jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1478).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1477).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1476).jpg | 2025-11-21 06:45 | 13K | |
![[ ]](/icons/unknown.gif) | Recommendations for Vital Registration Module.docx | 2025-11-21 06:45 | 52K | |
![[ ]](/icons/unknown.gif) | Immunization Statistics_Jan 10, 2014.xlsx | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (234).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (233).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (660).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (659).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (658).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1475).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1474).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1473).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (809).png | 2025-11-21 06:45 | 571K | |
![[IMG]](/icons/image2.gif) | image001 (808).png | 2025-11-21 06:45 | 571K | |
![[IMG]](/icons/image2.gif) | image001 (807).png | 2025-11-21 06:45 | 571K | |
![[IMG]](/icons/image2.gif) | image001 (806).png | 2025-11-21 06:45 | 571K | |
![[IMG]](/icons/image2.gif) | image001 (805).png | 2025-11-21 06:45 | 571K | |
![[IMG]](/icons/image2.gif) | bianka.jpg | 2025-11-21 06:45 | 44K | |
![[IMG]](/icons/image2.gif) | bianka-5.jpg | 2025-11-21 06:45 | 24K | |
![[IMG]](/icons/image2.gif) | bianka-4.jpg | 2025-11-21 06:45 | 86K | |
![[IMG]](/icons/image2.gif) | bianka-3.png | 2025-11-21 06:45 | 611K | |
![[IMG]](/icons/image2.gif) | bianka-2.jpg | 2025-11-21 06:45 | 62K | |
![[IMG]](/icons/image2.gif) | bianka-1.jpg | 2025-11-21 06:45 | 52K | |
![[IMG]](/icons/image2.gif) | Untitled (59).png | 2025-11-21 06:45 | 217K | |
![[ ]](/icons/unknown.gif) | urgentuli kodebi (2).xlsx | 2025-11-21 06:45 | 71K | |
![[IMG]](/icons/image2.gif) | stalin.jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image005 (73).jpg | 2025-11-21 06:45 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (126).jpg | 2025-11-21 06:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | image003 (248).png | 2025-11-21 06:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (232).jpg | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | image002 (657).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (656).jpg | 2025-11-21 06:45 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (1472).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1471).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1470).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1469).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1468).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (804).png | 2025-11-21 06:45 | 11K | |
![[IMG]](/icons/image2.gif) | Rastrelyat'.jpg | 2025-11-21 06:45 | 25K | |
![[ ]](/icons/unknown.gif) | პროგრამები (1).xlsx | 2025-11-21 06:45 | 9.6K | |
![[ ]](/icons/layout.gif) | მარაგების მართვის მოდული (2).pdf | 2025-11-21 06:45 | 1.8M | |
![[ ]](/icons/unknown.gif) | urgentuli kodebi (1).xlsx | 2025-11-21 06:45 | 71K | |
![[ ]](/icons/unknown.gif) | tABLE.DOC | 2025-11-21 06:45 | 38K | |
![[IMG]](/icons/image2.gif) | image006 (64).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image006 (63).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image005 (72).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image005 (71).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image004 (125).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (124).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (231).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image003 (230).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (655).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (654).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image001 (1467).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1466).jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1465).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1464).jpg | 2025-11-21 06:45 | 5.9K | |
![[ ]](/icons/unknown.gif) | Double coding.doc | 2025-11-21 06:45 | 51K | |
![[ ]](/icons/unknown.gif) | პროგრამები.xlsx | 2025-11-21 06:45 | 9.6K | |
![[IMG]](/icons/image2.gif) | server error error error error.PNG | 2025-11-21 06:45 | 126K | |
![[IMG]](/icons/image2.gif) | image002 (653).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1463).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1462).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1461).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1460).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1459).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1458).jpg | 2025-11-21 06:45 | 4.2K | |
![[ ]](/icons/unknown.gif) | Doc11.docx | 2025-11-21 06:45 | 177K | |
![[ ]](/icons/unknown.gif) | Bakuriani Hotel Victoria Rooming list (1).xlsx | 2025-11-21 06:45 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (247).png | 2025-11-21 06:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (1457).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1456).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1455).jpg | 2025-11-21 06:45 | 4.2K | |
![[ ]](/icons/unknown.gif) | Immunization Statistics_Jan 17, 2014.xlsx | 2025-11-21 06:45 | 17K | |
![[ ]](/icons/unknown.gif) | Doc (1).docx | 2025-11-21 06:45 | 187K | |
![[IMG]](/icons/image2.gif) | image008 (19).jpg | 2025-11-21 06:45 | 641 | |
![[IMG]](/icons/image2.gif) | image007 (30).jpg | 2025-11-21 06:45 | 647 | |
![[IMG]](/icons/image2.gif) | image006 (62).jpg | 2025-11-21 06:45 | 647 | |
![[IMG]](/icons/image2.gif) | image006 (61).jpg | 2025-11-21 06:45 | 647 | |
![[IMG]](/icons/image2.gif) | image006 (60).jpg | 2025-11-21 06:45 | 647 | |
![[IMG]](/icons/image2.gif) | image006 (31).png | 2025-11-21 06:45 | 92K | |
![[IMG]](/icons/image2.gif) | image005 (70).jpg | 2025-11-21 06:45 | 641 | |
![[IMG]](/icons/image2.gif) | image005 (69).jpg | 2025-11-21 06:45 | 641 | |
![[IMG]](/icons/image2.gif) | image005 (68).jpg | 2025-11-21 06:45 | 641 | |
![[IMG]](/icons/image2.gif) | image005 (67).png | 2025-11-21 06:45 | 134K | |
![[IMG]](/icons/image2.gif) | image004 (123).jpg | 2025-11-21 06:45 | 647 | |
![[IMG]](/icons/image2.gif) | image004 (122).jpg | 2025-11-21 06:45 | 647 | |
![[IMG]](/icons/image2.gif) | image004 (121).jpg | 2025-11-21 06:45 | 647 | |
![[IMG]](/icons/image2.gif) | image004 (112).png | 2025-11-21 06:45 | 98K | |
![[IMG]](/icons/image2.gif) | image003 (246).png | 2025-11-21 06:45 | 92K | |
![[IMG]](/icons/image2.gif) | image003 (245).png | 2025-11-21 06:45 | 92K | |
![[IMG]](/icons/image2.gif) | image003 (244).png | 2025-11-21 06:45 | 92K | |
![[IMG]](/icons/image2.gif) | image002 (283).png | 2025-11-21 06:45 | 134K | |
![[IMG]](/icons/image2.gif) | image002 (282).png | 2025-11-21 06:45 | 134K | |
![[IMG]](/icons/image2.gif) | image002 (281).png | 2025-11-21 06:45 | 134K | |
![[IMG]](/icons/image2.gif) | image001 (1454).jpg | 2025-11-21 06:45 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (1453).jpg | 2025-11-21 06:45 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (1452).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (803).png | 2025-11-21 06:45 | 98K | |
![[IMG]](/icons/image2.gif) | image001 (802).png | 2025-11-21 06:45 | 98K | |
![[IMG]](/icons/image2.gif) | image001 (801).png | 2025-11-21 06:45 | 98K | |
![[ ]](/icons/unknown.gif) | Giorgis Contract.doc | 2025-11-21 06:45 | 199K | |
![[ ]](/icons/layout.gif) | 2629 zestafoni 36 gad stac.pdf | 2025-11-21 06:45 | 70K | |
![[ ]](/icons/layout.gif) | 2629 zestafoni 36 gad stac (1).pdf | 2025-11-21 06:45 | 70K | |
![[ ]](/icons/unknown.gif) | 1-14 AGI Workspaces FAQ.docx | 2025-11-21 06:45 | 30K | |
![[IMG]](/icons/image2.gif) | regionuli jandacvis centri.djvu | 2025-11-21 06:45 | 15K | |
![[IMG]](/icons/image2.gif) | image013 (7).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image012 (1).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image011 (3).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image010 (8).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image009 (10).jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image008 (18).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image006 (59).jpg | 2025-11-21 06:45 | 647 | |
![[IMG]](/icons/image2.gif) | image005 (67).jpg | 2025-11-21 06:45 | 641 | |
![[IMG]](/icons/image2.gif) | image004 (120).jpg | 2025-11-21 06:45 | 647 | |
![[IMG]](/icons/image2.gif) | image003 (243).png | 2025-11-21 06:45 | 92K | |
![[IMG]](/icons/image2.gif) | image002 (280).png | 2025-11-21 06:45 | 134K | |
![[IMG]](/icons/image2.gif) | image001 (1451).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1450).jpg | 2025-11-21 06:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1449).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (800).png | 2025-11-21 06:45 | 98K | |
![[IMG]](/icons/image2.gif) | image001 (799).png | 2025-11-21 06:45 | 2.6K | |
![[IMG]](/icons/image2.gif) | Untitled (58).png | 2025-11-21 06:45 | 80K | |
![[ ]](/icons/unknown.gif) | Statistics (15).xlsx | 2025-11-21 06:45 | 36K | |
![[ ]](/icons/unknown.gif) | ICD10 Codes for Vital Registration Module (1).xlsx | 2025-11-21 06:45 | 152K | |
![[ ]](/icons/unknown.gif) | Contracted Providers - Sayoveltao.xlsx | 2025-11-21 06:45 | 629K | |
![[IMG]](/icons/image2.gif) | image010 (7).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image009 (9).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image009 (8).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image008 (17).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image008 (16).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image007 (29).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image007 (28).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image006 (58).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image006 (57).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image005 (66).jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image005 (65).jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image004 (119).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (118).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (229).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (228).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (227).jpg | 2025-11-21 06:45 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (652).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (651).jpg | 2025-11-21 06:45 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (650).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (649).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1448).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (798).png | 2025-11-21 06:45 | 56K | |
![[IMG]](/icons/image2.gif) | image001 (797).png | 2025-11-21 06:45 | 56K | |
![[ ]](/icons/unknown.gif) | Prefixes.xlsx | 2025-11-21 06:45 | 13K | |
![[ ]](/icons/unknown.gif) | ICD10 Codes for Vital Registration Module.xlsx | 2025-11-21 06:45 | 423K | |
![[ ]](/icons/unknown.gif) | urgentuli kodebi.xlsx | 2025-11-21 06:45 | 71K | |
![[IMG]](/icons/image2.gif) | pertenava erori.png | 2025-11-21 06:45 | 191K | |
![[IMG]](/icons/image2.gif) | image004 (117).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (116).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (242).png | 2025-11-21 06:45 | 73K | |
![[IMG]](/icons/image2.gif) | image003 (241).png | 2025-11-21 06:45 | 73K | |
![[IMG]](/icons/image2.gif) | image002 (279).png | 2025-11-21 06:45 | 63K | |
![[IMG]](/icons/image2.gif) | image002 (278).png | 2025-11-21 06:45 | 63K | |
![[IMG]](/icons/image2.gif) | image001 (1447).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1446).jpg | 2025-11-21 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (796).png | 2025-11-21 06:45 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (795).png | 2025-11-21 06:45 | 14K | |
![[ ]](/icons/layout.gif) | broSura-1-nawili.pdf | 2025-11-21 06:45 | 13M | |
![[ ]](/icons/layout.gif) | broSura-1-nawili (1).pdf | 2025-11-21 06:45 | 13M | |
![[ ]](/icons/unknown.gif) | Bakuriani Hotel Victoria Rooming list.xlsx | 2025-11-21 06:45 | 10K | |
![[ ]](/icons/unknown.gif) | 2 (1).docx | 2025-11-21 06:45 | 344K | |
![[ ]](/icons/unknown.gif) | nika billing.docx | 2025-11-21 06:45 | 273K | |
![[IMG]](/icons/image2.gif) | image006 (56).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image006 (55).jpg | 2025-11-21 06:45 | 839 | |
![[IMG]](/icons/image2.gif) | image005 (64).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image005 (63).jpg | 2025-11-21 06:45 | 912 | |
![[IMG]](/icons/image2.gif) | image004 (115).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (114).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (113).jpg | 2025-11-21 06:45 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (240).png | 2025-11-21 06:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (226).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image003 (225).jpg | 2025-11-21 06:45 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (648).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (647).jpg | 2025-11-21 06:45 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (646).jpg | 2025-11-21 06:45 | 5.2K | |
![[IMG]](/icons/image2.gif) | image001 (1445).jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1444).jpg | 2025-11-21 06:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1443).jpg | 2025-11-21 06:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1442).jpg | 2025-11-21 06:45 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1441).jpg | 2025-11-21 06:45 | 3.1K | |
![[ ]](/icons/unknown.gif) | HFG Vietnam SOW Health Financing Advisor Final Jan22.docx | 2025-11-21 06:45 | 23K | |
![[ ]](/icons/unknown.gif) | მარაგების მართვის მოდული (2).docx | 2025-11-21 06:45 | 1.9M | |
![[IMG]](/icons/image2.gif) | image003 (224).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (645).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (644).jpg | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (643).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1440).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1439).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1438).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1437).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1436).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1435).jpg | 2025-11-21 06:44 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (1434).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1433).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (794).png | 2025-11-21 06:44 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (793).png | 2025-11-21 06:44 | 121K | |
![[ ]](/icons/unknown.gif) | Statistics (14).xlsx | 2025-11-21 06:44 | 36K | |
![[IMG]](/icons/image2.gif) | DSCN3834.JPG | 2025-11-21 06:44 | 5.8M | |
![[IMG]](/icons/image2.gif) | image003 (223).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (642).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1432).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1431).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1430).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | Untitled (57).png | 2025-11-21 06:44 | 249K | |
![[ ]](/icons/unknown.gif) | Billing Tasks (2).docx | 2025-11-21 06:44 | 33K | |
![[IMG]](/icons/image2.gif) | 165 interface (1).png | 2025-11-21 06:44 | 261K | |
![[IMG]](/icons/image2.gif) | 165-4 gegmiuri qirurgia (1).png | 2025-11-21 06:44 | 243K | |
![[IMG]](/icons/image2.gif) | 123 (6).png | 2025-11-21 06:44 | 249K | |
![[IMG]](/icons/image2.gif) | rusiko2.png | 2025-11-21 06:44 | 132K | |
![[IMG]](/icons/image2.gif) | rusiko2 (1).png | 2025-11-21 06:44 | 132K | |
![[IMG]](/icons/image2.gif) | rusiko.bmp | 2025-11-21 06:44 | 3.8M | |
![[IMG]](/icons/image2.gif) | rusiko (1).bmp | 2025-11-21 06:44 | 3.8M | |
![[IMG]](/icons/image2.gif) | image003 (222).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (221).jpg | 2025-11-21 06:44 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (641).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (640).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (277).png | 2025-11-21 06:44 | 4.5K | |
![[IMG]](/icons/image2.gif) | image001 (1429).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1428).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1427).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1426).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1425).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1424).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1423).jpg | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (792).png | 2025-11-21 06:44 | 51K | |
![[ ]](/icons/layout.gif) | Tuition-Assistance-Policy.pdf | 2025-11-21 06:44 | 407K | |
![[ ]](/icons/unknown.gif) | Billing Tasks (1).docx | 2025-11-21 06:44 | 33K | |
![[IMG]](/icons/image2.gif) | 165 interface.png | 2025-11-21 06:44 | 261K | |
![[IMG]](/icons/image2.gif) | 165-4 gegmiuri qirurgia.png | 2025-11-21 06:44 | 243K | |
![[ ]](/icons/unknown.gif) | მარაგების მართვის მოდული (1).docx | 2025-11-21 06:44 | 1.9M | |
![[IMG]](/icons/image2.gif) | salaro qvitris #, forma100#.png | 2025-11-21 06:44 | 119K | |
![[IMG]](/icons/image2.gif) | rekvizitebi.png | 2025-11-21 06:44 | 133K | |
![[IMG]](/icons/image2.gif) | image006 (54).jpg | 2025-11-21 06:44 | 839 | |
![[IMG]](/icons/image2.gif) | image005 (62).jpg | 2025-11-21 06:44 | 912 | |
![[IMG]](/icons/image2.gif) | image004 (112).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (220).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (639).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image001 (1422).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1421).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1420).jpg | 2025-11-21 06:44 | 4.2K | |
![[ ]](/icons/unknown.gif) | Untitled (57) | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (56) | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | Billing Tasks.docx | 2025-11-21 06:44 | 33K | |
![[ ]](/icons/unknown.gif) | 165 გეგმიურები.docx | 2025-11-21 06:44 | 15K | |
![[ ]](/icons/unknown.gif) | kodebi ----.xlsx | 2025-11-21 06:44 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (219).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (218).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (638).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (637).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (636).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image001 (1419).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1418).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1417).jpg | 2025-11-21 06:44 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (1416).jpg | 2025-11-21 06:44 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (1415).jpg | 2025-11-21 06:44 | 5.8K | |
![[ ]](/icons/layout.gif) | Irakli0001 (1).pdf | 2025-11-21 06:44 | 2.2M | |
![[IMG]](/icons/image2.gif) | Error (28).png | 2025-11-21 06:44 | 107K | |
![[ ]](/icons/layout.gif) | Decree on Provider Passportization.pdf | 2025-11-21 06:44 | 44K | |
![[ ]](/icons/unknown.gif) | BillingTasks (7).docx | 2025-11-21 06:44 | 36K | |
![[ ]](/icons/unknown.gif) | Annex # 2.xls | 2025-11-21 06:44 | 92K | |
![[ ]](/icons/unknown.gif) | Annex # 1.doc | 2025-11-21 06:44 | 24K | |
![[ ]](/icons/unknown.gif) | ATT51185 | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | 218_2 გად_ ამბ_.docx | 2025-11-21 06:44 | 12K | |
![[ ]](/icons/unknown.gif) | 165_2 გად_ ამბ_.docx | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | 165 სურ_ 1.png | 2025-11-21 06:44 | 130K | |
![[IMG]](/icons/image2.gif) | რუსთავის ცენტრალური საავადმყოფო.png | 2025-11-21 06:44 | 218K | |
![[IMG]](/icons/image2.gif) | ნინი მელაძე-ბენდაძე.djvu | 2025-11-21 06:44 | 22K | |
![[IMG]](/icons/image2.gif) | იაშვილი.png | 2025-11-21 06:44 | 226K | |
![[IMG]](/icons/image2.gif) | image003 (239).png | 2025-11-21 06:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (217).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (216).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (215).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (214).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (213).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (635).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (634).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (633).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (632).jpg | 2025-11-21 06:44 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (631).jpg | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (630).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image001 (1414).jpg | 2025-11-21 06:44 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (1413).jpg | 2025-11-21 06:44 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (1412).jpg | 2025-11-21 06:44 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (1411).jpg | 2025-11-21 06:44 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (1410).jpg | 2025-11-21 06:44 | 5.9K | |
![[ ]](/icons/unknown.gif) | Portalis Parolebi - Copy.xlsx | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | Error_2.png | 2025-11-21 06:44 | 100K | |
![[ ]](/icons/unknown.gif) | 33- danarti.doc | 2025-11-21 06:44 | 326K | |
![[IMG]](/icons/image2.gif) | sms (3).png | 2025-11-21 06:44 | 337K | |
![[IMG]](/icons/image2.gif) | image007 (27).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image006 (53).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image005 (61).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image004 (111).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (212).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (211).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (210).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (629).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (628).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (627).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1409).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1408).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1407).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1406).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1405).jpg | 2025-11-21 06:44 | 4.2K | |
![[ ]](/icons/unknown.gif) | Statistics (13).xlsx | 2025-11-21 06:44 | 37K | |
![[ ]](/icons/unknown.gif) | BillingTasks (6).docx | 2025-11-21 06:44 | 38K | |
![[ ]](/icons/layout.gif) | მარაგების მართვის მოდული (1).pdf | 2025-11-21 06:44 | 1.7M | |
![[IMG]](/icons/image2.gif) | image003 (209).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (626).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (625).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image001 (1404).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1403).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | Screen.png | 2025-11-21 06:44 | 50K | |
![[IMG]](/icons/image2.gif) | Capture (21).PNG | 2025-11-21 06:44 | 98K | |
![[IMG]](/icons/image2.gif) | BUG.png | 2025-11-21 06:44 | 17K | |
![[ ]](/icons/unknown.gif) | ATT78437 | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | ATT18172 | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/layout.gif) | რეგულირება სერტიფიცირება.pdf | 2025-11-21 06:44 | 698K | |
![[ ]](/icons/layout.gif) | რეგულირება ლიცენზირება.pdf | 2025-11-21 06:44 | 742K | |
![[ ]](/icons/layout.gif) | მარაგების მართვის მოდული.pdf | 2025-11-21 06:44 | 1.7M | |
![[IMG]](/icons/image2.gif) | image010 (6).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image009 (7).jpg | 2025-11-21 06:44 | 839 | |
![[IMG]](/icons/image2.gif) | image008 (15).jpg | 2025-11-21 06:44 | 912 | |
![[IMG]](/icons/image2.gif) | image007 (26).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image006 (52).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image005 (60).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image004 (110).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (208).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image003 (207).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (624).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image001 (1402).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1401).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1400).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1399).jpg | 2025-11-21 06:44 | 4.2K | |
![[ ]](/icons/unknown.gif) | Not Valid List - 04_02_2014.xlsx | 2025-11-21 06:44 | 147K | |
![[ ]](/icons/unknown.gif) | BillingTasks (5).docx | 2025-11-21 06:44 | 32K | |
![[ ]](/icons/unknown.gif) | BillingTasks (4).docx | 2025-11-21 06:44 | 31K | |
![[ ]](/icons/unknown.gif) | BUGs in Vital Registration Module - 2_xlsx.docx | 2025-11-21 06:44 | 150K | |
![[ ]](/icons/layout.gif) | world skill.pdf | 2025-11-21 06:44 | 9.5M | |
![[ ]](/icons/unknown.gif) | server (1).docx | 2025-11-21 06:44 | 14K | |
![[IMG]](/icons/image2.gif) | image008 (14).jpg | 2025-11-21 06:44 | 839 | |
![[IMG]](/icons/image2.gif) | image007 (25).jpg | 2025-11-21 06:44 | 912 | |
![[IMG]](/icons/image2.gif) | image006 (51).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image005 (59).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image004 (109).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image003 (206).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (623).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1398).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1397).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1396).jpg | 2025-11-21 06:44 | 480 | |
![[IMG]](/icons/image2.gif) | image001 (1395).jpg | 2025-11-21 06:44 | 4.2K | |
![[ ]](/icons/unknown.gif) | Recommendations for Vital Registration Module - 2.docx | 2025-11-21 06:44 | 33K | |
![[ ]](/icons/unknown.gif) | Doc1 (11).docx | 2025-11-21 06:44 | 171K | |
![[ ]](/icons/unknown.gif) | BillingTasks (3).docx | 2025-11-21 06:44 | 31K | |
![[ ]](/icons/unknown.gif) | გადასაგზავნი დაწესებულებები.xlsx | 2025-11-21 06:44 | 12K | |
![[ ]](/icons/unknown.gif) | immunization Statistic (1).xlsx | 2025-11-21 06:44 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (1394).jpg | 2025-11-21 06:44 | 480 | |
![[IMG]](/icons/image2.gif) | image001 (1393).jpg | 2025-11-21 06:44 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (1392).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1391).jpg | 2025-11-21 06:44 | 3.9K | |
![[ ]](/icons/unknown.gif) | Untitled (55) | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (54) | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | New Price Changes Sent.xlsx | 2025-11-21 06:44 | 3.1M | |
![[ ]](/icons/unknown.gif) | BillingTasks (2).docx | 2025-11-21 06:44 | 27K | |
![[ ]](/icons/unknown.gif) | BillingDone.docx | 2025-11-21 06:44 | 25K | |
![[ ]](/icons/unknown.gif) | sms error.docx | 2025-11-21 06:44 | 178K | |
![[IMG]](/icons/image2.gif) | image003 (238).png | 2025-11-21 06:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (237).png | 2025-11-21 06:44 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (205).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (622).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (621).jpg | 2025-11-21 06:44 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1390).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1389).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1388).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1387).jpg | 2025-11-21 06:44 | 3.9K | |
![[ ]](/icons/unknown.gif) | Old Prices Not Sent.xlsx | 2025-11-21 06:44 | 14K | |
![[ ]](/icons/unknown.gif) | List of fields in Vital Registration (2).xlsx | 2025-11-21 06:44 | 22K | |
![[ ]](/icons/unknown.gif) | Diagrams and fields of neccessasy fields - Vital Registration (2).vsd | 2025-11-21 06:44 | 706K | |
![[ ]](/icons/unknown.gif) | Diagrams and fields of neccessasy fields - Vital Registration (1).vsd | 2025-11-21 06:44 | 706K | |
![[ ]](/icons/unknown.gif) | Alignment Review Powerpoint For Board.pptx | 2025-11-21 06:44 | 695K | |
![[ ]](/icons/unknown.gif) | ATT70935 | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | ახალი ფასების ახალი ჩანაწერები 2014-15-01-დან__1_.xls | 2025-11-21 06:44 | 6.7M | |
![[IMG]](/icons/image2.gif) | image002 (620).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1386).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1385).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1384).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1383).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1382).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1381).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1380).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1379).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (791).png | 2025-11-21 06:44 | 232K | |
![[ ]](/icons/unknown.gif) | Statistics (12).xlsx | 2025-11-21 06:44 | 38K | |
![[ ]](/icons/unknown.gif) | BillingTasks (1).docx | 2025-11-21 06:44 | 22K | |
![[IMG]](/icons/image2.gif) | image003 (204).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (619).jpg | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (618).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image001 (1378).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1377).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1376).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1375).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1374).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1373).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1372).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1371).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1370).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (790).png | 2025-11-21 06:44 | 208K | |
![[IMG]](/icons/image2.gif) | image001 (789).png | 2025-11-21 06:44 | 208K | |
![[ ]](/icons/unknown.gif) | WHO_Providers.xlsx | 2025-11-21 06:44 | 582K | |
![[IMG]](/icons/image2.gif) | Untitled (56).png | 2025-11-21 06:44 | 189K | |
![[ ]](/icons/unknown.gif) | BillingTasks.docx | 2025-11-21 06:44 | 19K | |
![[IMG]](/icons/image2.gif) | 2 (20).png | 2025-11-21 06:44 | 148K | |
![[IMG]](/icons/image2.gif) | image003 (203).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image003 (202).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image003 (201).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (617).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (616).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (615).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image001 (1369).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1368).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1367).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1366).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1365).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1364).jpg | 2025-11-21 06:44 | 4.2K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew (4).docx | 2025-11-21 06:44 | 19K | |
![[ ]](/icons/unknown.gif) | mesakutris tanxmoba.docx | 2025-11-21 06:44 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (200).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image003 (199).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image003 (198).jpg | 2025-11-21 06:44 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (614).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (613).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image002 (612).jpg | 2025-11-21 06:44 | 910 | |
![[IMG]](/icons/image2.gif) | image001 (1363).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1362).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1361).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1360).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1359).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1358).jpg | 2025-11-21 06:44 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1357).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1356).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1355).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1354).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1353).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1352).jpg | 2025-11-21 06:44 | 4.2K | |
![[ ]](/icons/unknown.gif) | financing items veteran.xlsx | 2025-11-21 06:44 | 20K | |
![[ ]](/icons/unknown.gif) | financing items veteran (1).xlsx | 2025-11-21 06:44 | 20K | |
![[ ]](/icons/unknown.gif) | Immunization Statistics_Feb 14, 2014.xlsx | 2025-11-21 06:44 | 23K | |
![[ ]](/icons/layout.gif) | BillingTasksNew (6).pdf | 2025-11-21 06:44 | 206K | |
![[ ]](/icons/layout.gif) | BillingTasksNew (5).pdf | 2025-11-21 06:44 | 207K | |
![[ ]](/icons/unknown.gif) | ATT65212 | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/layout.gif) | საყოველთაო ჯანდაცვა - გეგმიური ამბულატორია.pdf | 2025-11-21 06:44 | 619K | |
![[ ]](/icons/layout.gif) | სამ_ სერვისებით მოსარგებლეთა რეგისტრაციის მოდული - ფსიქიატრია.pdf | 2025-11-21 06:44 | 493K | |
![[IMG]](/icons/image2.gif) | დაწუნებული.png | 2025-11-21 06:44 | 157K | |
![[IMG]](/icons/image2.gif) | image004 (108).jpg | 2025-11-21 06:44 | 30K | |
![[IMG]](/icons/image2.gif) | image004 (107).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (236).png | 2025-11-21 06:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (197).jpg | 2025-11-21 06:44 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (611).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1351).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1350).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1349).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1348).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1347).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1346).jpg | 2025-11-21 06:44 | 4.2K | |
![[ ]](/icons/unknown.gif) | VaccinationList.xlsx | 2025-11-21 06:44 | 33K | |
![[ ]](/icons/unknown.gif) | Untitled (53) | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | Statistics (11).xlsx | 2025-11-21 06:44 | 39K | |
![[ ]](/icons/unknown.gif) | List of fields in Vital Registration (1).xlsx | 2025-11-21 06:44 | 23K | |
![[ ]](/icons/layout.gif) | BillingTasksNew (4).pdf | 2025-11-21 06:44 | 215K | |
![[IMG]](/icons/image2.gif) | image003 (196).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (276).png | 2025-11-21 06:44 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1345).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1344).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1343).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1342).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1341).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1340).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1339).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (788).png | 2025-11-21 06:44 | 35K | |
![[ ]](/icons/layout.gif) | N IV-66 „სტაციონარიდან გასული პაციენტის აღრიცხვა“.pdf | 2025-11-21 06:44 | 644K | |
![[ ]](/icons/layout.gif) | BillingTasksNew (3).pdf | 2025-11-21 06:44 | 209K | |
![[ ]](/icons/unknown.gif) | ArtificialCodesNew.xlsx | 2025-11-21 06:44 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (610).jpg | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (609).jpg | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1338).jpg | 2025-11-21 06:44 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (1337).jpg | 2025-11-21 06:44 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (1336).jpg | 2025-11-21 06:44 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1335).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1334).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1333).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (787).png | 2025-11-21 06:44 | 11K | |
![[ ]](/icons/layout.gif) | PRH CAs meeting 1-30-14 slides for distribution.pdf | 2025-11-21 06:44 | 5.5M | |
![[ ]](/icons/unknown.gif) | Logging Interface_ Description.docx | 2025-11-21 06:44 | 48K | |
![[ ]](/icons/layout.gif) | BillingTasksNew (2).pdf | 2025-11-21 06:44 | 189K | |
![[IMG]](/icons/image2.gif) | 20.png | 2025-11-21 06:44 | 192K | |
![[ ]](/icons/unknown.gif) | პრობლემები არქიმედე_.xlsx | 2025-11-21 06:44 | 37K | |
![[IMG]](/icons/image2.gif) | laboratoriis kodebi.png | 2025-11-21 06:44 | 201K | |
![[IMG]](/icons/image2.gif) | image003 (195).jpg | 2025-11-21 06:44 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (1332).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1331).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1330).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1329).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | ar modis laboratoria.png | 2025-11-21 06:44 | 195K | |
![[ ]](/icons/unknown.gif) | List of fields in Vital Registration.xlsx | 2025-11-21 06:44 | 24K | |
![[ ]](/icons/unknown.gif) | Immunization Statistics_Feb 21, 2014.xlsx | 2025-11-21 06:44 | 22K | |
![[ ]](/icons/layout.gif) | Georgia Benefits Summary Feb 2014.pdf | 2025-11-21 06:44 | 46K | |
![[ ]](/icons/unknown.gif) | ATT77966 | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | ATT60810 | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | ATT40709 | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/unknown.gif) | 2.docx | 2025-11-21 06:44 | 393K | |
![[ ]](/icons/unknown.gif) | იმუნიზაცია_მომხმარებლის სახელმძღვანელო.docx | 2025-11-21 06:44 | 1.2M | |
![[IMG]](/icons/image2.gif) | image003 (235).png | 2025-11-21 06:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (194).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (193).jpg | 2025-11-21 06:44 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (608).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1328).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1327).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1326).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1325).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1324).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1323).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1322).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1321).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1320).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1319).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (192).jpg | 2025-11-21 06:44 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (607).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (606).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (605).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1318).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1317).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1316).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1315).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1314).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1313).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1312).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (786).png | 2025-11-21 06:44 | 77K | |
![[IMG]](/icons/image2.gif) | image001 (785).png | 2025-11-21 06:44 | 77K | |
![[IMG]](/icons/image2.gif) | image001 (784).png | 2025-11-21 06:44 | 77K | |
![[ ]](/icons/unknown.gif) | Statistics (10).xlsx | 2025-11-21 06:44 | 39K | |
![[ ]](/icons/layout.gif) | BillingTasksNew (1).pdf | 2025-11-21 06:44 | 201K | |
![[IMG]](/icons/image2.gif) | 165 გად_ სტაციონარი, წერს ლიმიტს 15 000 ლარი.png | 2025-11-21 06:44 | 190K | |
![[IMG]](/icons/image2.gif) | image002 (604).jpg | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (275).png | 2025-11-21 06:44 | 16K | |
![[IMG]](/icons/image2.gif) | image002 (274).png | 2025-11-21 06:44 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1311).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1310).jpg | 2025-11-21 06:44 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (1309).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1308).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1307).jpg | 2025-11-21 06:44 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (1306).jpg | 2025-11-21 06:44 | 3.1K | |
![[ ]](/icons/unknown.gif) | gaukmeba gadacemulstatusianis.docx | 2025-11-21 06:44 | 215K | |
![[ ]](/icons/layout.gif) | BillingTasksNew.pdf | 2025-11-21 06:44 | 189K | |
![[ ]](/icons/unknown.gif) | veteranis kalkulacia.docx | 2025-11-21 06:44 | 148K | |
![[ ]](/icons/unknown.gif) | shemm.xlsx | 2025-11-21 06:44 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (191).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (190).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1305).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (783).png | 2025-11-21 06:44 | 51K | |
![[ ]](/icons/layout.gif) | ICD10 Vol 2 - 27 07 2012.pdf | 2025-11-21 06:44 | 2.4M | |
![[ ]](/icons/unknown.gif) | Doc1 (10).docx | 2025-11-21 06:44 | 178K | |
![[ ]](/icons/layout.gif) | BillingTasksNew 2-26.pdf | 2025-11-21 06:44 | 184K | |
![[ ]](/icons/unknown.gif) | ATT63224 | 2025-11-21 06:44 | 0 | |
![[ ]](/icons/layout.gif) | ელექტრონული რეცეპტის მოდული.pdf | 2025-11-21 06:44 | 844K | |
![[IMG]](/icons/image2.gif) | image003 (189).jpg | 2025-11-21 06:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (188).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (187).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (603).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (602).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1304).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1303).jpg | 2025-11-21 06:44 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1302).jpg | 2025-11-21 06:44 | 4.2K | |
![[ ]](/icons/unknown.gif) | Provider List.xls | 2025-11-21 06:44 | 370K | |
![[IMG]](/icons/image2.gif) | Capture (20).PNG | 2025-11-21 06:44 | 5.8K | |
![[ ]](/icons/layout.gif) | BillingTasksNew 27-02.pdf | 2025-11-21 06:44 | 188K | |
![[ ]](/icons/unknown.gif) | A_1 CARTU 218+165 - 2013, 2014ianvari 20511.xls | 2025-11-21 06:44 | 15M | |
![[IMG]](/icons/image2.gif) | ბავშვთა ახალი კლინიკა.png | 2025-11-21 06:44 | 265K | |
![[IMG]](/icons/image2.gif) | region xaragauli.png | 2025-11-21 06:44 | 244K | |
![[IMG]](/icons/image2.gif) | lanchxuti regionaluri.png | 2025-11-21 06:44 | 244K | |
![[IMG]](/icons/image2.gif) | image003 (234).png | 2025-11-21 06:44 | 8.1K | |
![[IMG]](/icons/image2.gif) | image002 (601).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (600).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1301).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1300).jpg | 2025-11-21 06:44 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (1299).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1298).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1297).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1296).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (782).png | 2025-11-21 06:44 | 33K | |
![[IMG]](/icons/image2.gif) | Untitled (55).png | 2025-11-21 06:44 | 117K | |
![[ ]](/icons/unknown.gif) | Subcontracts Team Division Assignments.pptx | 2025-11-21 06:44 | 167K | |
![[ ]](/icons/unknown.gif) | Prescription List.xlsx | 2025-11-21 06:44 | 19K | |
![[IMG]](/icons/image2.gif) | Liabilities (1).PNG | 2025-11-21 06:44 | 47K | |
![[ ]](/icons/unknown.gif) | Immunization Statistics_Feb 28, 2014.xlsx | 2025-11-21 06:44 | 21K | |
![[ ]](/icons/unknown.gif) | Duplicated Data.xlsx | 2025-11-21 06:44 | 19K | |
![[ ]](/icons/unknown.gif) | Duplicated Data (1).xlsx | 2025-11-21 06:44 | 11K | |
![[ ]](/icons/layout.gif) | BillingTasksNew 28-02.pdf | 2025-11-21 06:44 | 183K | |
![[IMG]](/icons/image2.gif) | AcceptanceActs.PNG | 2025-11-21 06:44 | 47K | |
![[IMG]](/icons/image2.gif) | ~WRD155.jpg | 2025-11-21 06:44 | 823 | |
![[IMG]](/icons/image2.gif) | ~WRD000 (27).jpg | 2025-11-21 06:44 | 823 | |
![[IMG]](/icons/image2.gif) | portali.png | 2025-11-21 06:44 | 247K | |
![[IMG]](/icons/image2.gif) | image031.jpg | 2025-11-21 06:44 | 3.8K | |
![[IMG]](/icons/image2.gif) | image030.jpg | 2025-11-21 06:44 | 4.0K | |
![[IMG]](/icons/image2.gif) | image029 (1).jpg | 2025-11-21 06:44 | 3.2K | |
![[IMG]](/icons/image2.gif) | image028 (1).jpg | 2025-11-21 06:44 | 3.8K | |
![[IMG]](/icons/image2.gif) | image027 (1).jpg | 2025-11-21 06:44 | 10K | |
![[IMG]](/icons/image2.gif) | image026 (1).jpg | 2025-11-21 06:44 | 11K | |
![[IMG]](/icons/image2.gif) | image025 (2).jpg | 2025-11-21 06:44 | 12K | |
![[IMG]](/icons/image2.gif) | image024 (1).png | 2025-11-21 06:44 | 167 | |
![[IMG]](/icons/image2.gif) | image023 (1).jpg | 2025-11-21 06:44 | 24K | |
![[IMG]](/icons/image2.gif) | image022.png | 2025-11-21 06:44 | 1.2K | |
![[IMG]](/icons/image2.gif) | image021 (1).png | 2025-11-21 06:44 | 2.5K | |
![[IMG]](/icons/image2.gif) | image020 (1).png | 2025-11-21 06:44 | 612 | |
![[IMG]](/icons/image2.gif) | image019.png | 2025-11-21 06:44 | 1.8K | |
![[IMG]](/icons/image2.gif) | image018 (3).png | 2025-11-21 06:44 | 557 | |
![[IMG]](/icons/image2.gif) | image013 (6).jpg | 2025-11-21 06:44 | 37K | |
![[IMG]](/icons/image2.gif) | image010 (5).jpg | 2025-11-21 06:44 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (233).png | 2025-11-21 06:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (599).jpg | 2025-11-21 06:44 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (598).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (24).gif | 2025-11-21 06:44 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (1295).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1294).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1293).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1292).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1291).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1290).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (781).png | 2025-11-21 06:44 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (125).gif | 2025-11-21 06:44 | 43 | |
![[IMG]](/icons/image2.gif) | ~WRD159.jpg | 2025-11-21 06:44 | 823 | |
![[IMG]](/icons/image2.gif) | referali 2013 (1).png | 2025-11-21 06:44 | 285K | |
![[IMG]](/icons/image2.gif) | image003 (186).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (597).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (596).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (595).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1289).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1288).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1287).jpg | 2025-11-21 06:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1286).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1285).jpg | 2025-11-21 06:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | Untitled (54).png | 2025-11-21 06:44 | 197K | |
![[ ]](/icons/unknown.gif) | Statistics (9).xlsx | 2025-11-21 06:44 | 40K | |
![[ ]](/icons/unknown.gif) | All - Users list for NCDC (2).xlsx | 2025-11-21 06:44 | 38K | |
![[ ]](/icons/unknown.gif) | 04_03_2014 - Users list (1).xlsx | 2025-11-21 06:44 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (594).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1284).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1283).jpg | 2025-11-21 06:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (780).png | 2025-11-21 06:44 | 46K | |
![[IMG]](/icons/image2.gif) | aversi,rustavi mesxishvilis3.png | 2025-11-21 06:44 | 165K | |
![[ ]](/icons/unknown.gif) | Provideri_Organizaciebi.xlsx | 2025-11-21 06:44 | 9.7K | |
![[ ]](/icons/unknown.gif) | Gegmiuri_Ambulatoria_Registrirebuli_Beneficiarebi.xlsx | 2025-11-21 06:44 | 9.6K | |
![[ ]](/icons/unknown.gif) | CaseUsers.xlsx | 2025-11-21 06:44 | 13K | |
![[ ]](/icons/layout.gif) | BillingTasksNew 05-03.pdf | 2025-11-21 06:44 | 214K | |
![[ ]](/icons/unknown.gif) | All - Users list for NCDC (1).xlsx | 2025-11-21 06:44 | 38K | |
![[ ]](/icons/unknown.gif) | 04_03_2014 - Users list.xlsx | 2025-11-21 06:44 | 10K | |
![[ ]](/icons/unknown.gif) | დუბლირებული კოდები ჩარევის რაოდენობის გადაკეთების შემდეგ.xlsx | 2025-11-21 06:44 | 2.0M | |
![[IMG]](/icons/image2.gif) | referali 2013.png | 2025-11-21 06:43 | 266K | |
![[IMG]](/icons/image2.gif) | image003 (185).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (593).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (592).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (591).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1282).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1281).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1280).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1279).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1278).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (779).png | 2025-11-21 06:43 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (778).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (777).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (776).png | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/layout.gif) | იმუნიზაცია_მომხმარებლის სახელმძღვანელო-ბოლო.pdf | 2025-11-21 06:43 | 918K | |
![[ ]](/icons/unknown.gif) | userebis misamartiscvlileba (1).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | immunization Statistic.xlsx | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (590).jpg | 2025-11-21 06:43 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (1277).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1276).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1275).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1274).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1273).jpg | 2025-11-21 06:43 | 16K | |
![[IMG]](/icons/image2.gif) | erori.png | 2025-11-21 06:43 | 266K | |
![[ ]](/icons/unknown.gif) | MFC-klinikebis kodebi da shemoertebebi-d19-220114.xlsx | 2025-11-21 06:43 | 30K | |
![[ ]](/icons/unknown.gif) | Immunization Statistics_March 7, 2014.xlsx | 2025-11-21 06:43 | 21K | |
![[ ]](/icons/layout.gif) | BillingTasksNew 07-03.pdf | 2025-11-21 06:43 | 217K | |
![[ ]](/icons/layout.gif) | BillingTasksNew 06-03.pdf | 2025-11-21 06:43 | 228K | |
![[TXT]](/icons/text.gif) | ATT00001 (10).htm | 2025-11-21 06:43 | 168 | |
![[IMG]](/icons/image2.gif) | image007 (24).jpg | 2025-11-21 06:43 | 837 | |
![[IMG]](/icons/image2.gif) | image006 (50).jpg | 2025-11-21 06:43 | 910 | |
![[IMG]](/icons/image2.gif) | image005 (58).jpg | 2025-11-21 06:43 | 839 | |
![[IMG]](/icons/image2.gif) | image004 (106).jpg | 2025-11-21 06:43 | 912 | |
![[IMG]](/icons/image2.gif) | image003 (184).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (183).jpg | 2025-11-21 06:43 | 837 | |
![[IMG]](/icons/image2.gif) | image002 (589).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (588).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (587).jpg | 2025-11-21 06:43 | 910 | |
![[IMG]](/icons/image2.gif) | image001 (1272).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1271).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1270).jpg | 2025-11-21 06:43 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1269).jpg | 2025-11-21 06:43 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (775).png | 2025-11-21 06:43 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (774).png | 2025-11-21 06:43 | 110K | |
![[IMG]](/icons/image2.gif) | image001 (124).gif | 2025-11-21 06:43 | 1.5K | |
![[ ]](/icons/unknown.gif) | final Samedicino dawesebulebebi da mati wvdoma modulebtan GP070314 (1).xlsx | 2025-11-21 06:43 | 20K | |
![[ ]](/icons/unknown.gif) | f066-qirurg gamosavali forma.xlsx | 2025-11-21 06:43 | 14K | |
![[ ]](/icons/unknown.gif) | f066-qirurg gamosavali forma (1).xlsx | 2025-11-21 06:43 | 14K | |
![[ ]](/icons/unknown.gif) | Case Registration Active Users New.xlsx | 2025-11-21 06:43 | 234K | |
![[ ]](/icons/unknown.gif) | Birth&Death Certificates - Migration v 2_0.xlsx | 2025-11-21 06:43 | 47K | |
![[ ]](/icons/unknown.gif) | Agreement_90035_URC.doc | 2025-11-21 06:43 | 79K | |
![[ ]](/icons/unknown.gif) | userebis misamartiscvlileba.xlsx | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | monacemebi.png | 2025-11-21 06:43 | 120K | |
![[IMG]](/icons/image2.gif) | image003 (232).png | 2025-11-21 06:43 | 73K | |
![[IMG]](/icons/image2.gif) | image002 (586).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (585).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (584).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1268).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1267).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (773).png | 2025-11-21 06:43 | 53K | |
![[IMG]](/icons/image2.gif) | image001 (772).png | 2025-11-21 06:43 | 110K | |
![[IMG]](/icons/image2.gif) | image001 (771).png | 2025-11-21 06:43 | 73K | |
![[IMG]](/icons/image2.gif) | image001 (770).png | 2025-11-21 06:43 | 73K | |
![[IMG]](/icons/image2.gif) | image001 (123).gif | 2025-11-21 06:43 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (122).gif | 2025-11-21 06:43 | 1.5K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 11-03.docx | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | 14.png | 2025-11-21 06:43 | 209K | |
![[IMG]](/icons/image2.gif) | 13.png | 2025-11-21 06:43 | 159K | |
![[IMG]](/icons/image2.gif) | 12.png | 2025-11-21 06:43 | 146K | |
![[IMG]](/icons/image2.gif) | 11.png | 2025-11-21 06:43 | 181K | |
![[IMG]](/icons/image2.gif) | 10.png | 2025-11-21 06:43 | 163K | |
![[IMG]](/icons/image2.gif) | 9 (1).png | 2025-11-21 06:43 | 178K | |
![[IMG]](/icons/image2.gif) | 8 (1).png | 2025-11-21 06:43 | 169K | |
![[IMG]](/icons/image2.gif) | 7 (1).png | 2025-11-21 06:43 | 143K | |
![[IMG]](/icons/image2.gif) | 6 (2).png | 2025-11-21 06:43 | 182K | |
![[IMG]](/icons/image2.gif) | 5 (1).png | 2025-11-21 06:43 | 156K | |
![[IMG]](/icons/image2.gif) | 2 (19).png | 2025-11-21 06:43 | 137K | |
![[IMG]](/icons/image2.gif) | image002 (583).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (582).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (581).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (580).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (273).png | 2025-11-21 06:43 | 73K | |
![[IMG]](/icons/image2.gif) | image002 (272).png | 2025-11-21 06:43 | 73K | |
![[IMG]](/icons/image2.gif) | image002 (271).png | 2025-11-21 06:43 | 73K | |
![[IMG]](/icons/image2.gif) | image002 (270).png | 2025-11-21 06:43 | 73K | |
![[IMG]](/icons/image2.gif) | image001 (1266).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1265).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1264).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1263).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1262).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (769).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (768).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (767).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (766).png | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/unknown.gif) | final Samedicino dawesebulebebi da mati wvdoma modulebtan GP070314.xlsx | 2025-11-21 06:43 | 21K | |
![[ ]](/icons/unknown.gif) | List of Modules.xls | 2025-11-21 06:43 | 27K | |
![[IMG]](/icons/image2.gif) | 218_3.png | 2025-11-21 06:43 | 111K | |
![[IMG]](/icons/image2.gif) | 0.jpg | 2025-11-21 06:43 | 206K | |
![[ ]](/icons/unknown.gif) | სისტემის არქიტექტურის დიზაინის აღწერა v1_3.docx | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (269).png | 2025-11-21 06:43 | 73K | |
![[IMG]](/icons/image2.gif) | image001 (1261).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1260).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1259).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1258).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1257).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (765).png | 2025-11-21 06:43 | 21K | |
![[ ]](/icons/unknown.gif) | Tasks distribution by person for Docs.xls | 2025-11-21 06:43 | 39K | |
![[ ]](/icons/unknown.gif) | Table of Content with Persons - v1 4.docx | 2025-11-21 06:43 | 20K | |
![[IMG]](/icons/image2.gif) | Liabilities.PNG | 2025-11-21 06:43 | 47K | |
![[IMG]](/icons/image2.gif) | 1.jpeg | 2025-11-21 06:43 | 516K | |
![[ ]](/icons/unknown.gif) | სისტემის არქიტექტურის დიზაინის აღწერა - v1_4.docx | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (579).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1256).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1255).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1254).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1253).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1252).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1251).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1250).jpg | 2025-11-21 06:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1249).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1248).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1247).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1246).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1245).jpg | 2025-11-21 06:43 | 3.1K | |
![[ ]](/icons/unknown.gif) | Teona- Brief Descriptions for Case and Beneficiary Reg_ Modules.docx | 2025-11-21 06:43 | 21K | |
![[IMG]](/icons/image2.gif) | Gurjaanis Dublireba.jpg | 2025-11-21 06:43 | 284K | |
![[ ]](/icons/unknown.gif) | EVEX Medical Facilities_Usernames_Passwords_Access to Modules (1).xlsx | 2025-11-21 06:43 | 23K | |
![[ ]](/icons/unknown.gif) | Copy of final Samedicino dawesebulebebi da mati wvdoma modulebtan GP070314 (2).xlsx | 2025-11-21 06:43 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (1244).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1243).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1242).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1241).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1240).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1239).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1238).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1237).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1236).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1235).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | error tea.png | 2025-11-21 06:43 | 251K | |
![[ ]](/icons/unknown.gif) | Unimedi Telavi Referaluri 1.xls | 2025-11-21 06:43 | 51K | |
![[ ]](/icons/unknown.gif) | Unimedi Telavi Referaluri.xls | 2025-11-21 06:43 | 49K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 12-03.docx | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (268).png | 2025-11-21 06:43 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (1234).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1233).jpg | 2025-11-21 06:43 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (1232).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1231).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1230).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (764).png | 2025-11-21 06:43 | 62K | |
![[ ]](/icons/unknown.gif) | Payed Amounts All.xls | 2025-11-21 06:43 | 4.3M | |
![[ ]](/icons/unknown.gif) | ExportedMessages 04_03 - 11_03.xlsx | 2025-11-21 06:43 | 5.6M | |
![[ ]](/icons/unknown.gif) | Doc1 (9).docx | 2025-11-21 06:43 | 189K | |
![[ ]](/icons/unknown.gif) | ATT81065 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | სატესტო.xlsx | 2025-11-21 06:43 | 9.4K | |
![[IMG]](/icons/image2.gif) | გრიგოლ მატევოსიანი.png | 2025-11-21 06:43 | 221K | |
![[ ]](/icons/unknown.gif) | naerTi soflis eqimebi da eqtnebisergos.xlsx | 2025-11-21 06:43 | 254K | |
![[ ]](/icons/unknown.gif) | immunization comments.xlsx | 2025-11-21 06:43 | 9.9K | |
![[IMG]](/icons/image2.gif) | image001 (1229).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1228).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1227).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1226).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1225).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1224).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1223).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1222).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1221).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1220).jpg | 2025-11-21 06:43 | 4.2K | |
![[ ]](/icons/unknown.gif) | error (27).docx | 2025-11-21 06:43 | 200K | |
![[ ]](/icons/unknown.gif) | SubmissionsReport.xlsx | 2025-11-21 06:43 | 3.5M | |
![[ ]](/icons/unknown.gif) | MFC-klinikebis monacemebi-130314.xlsx | 2025-11-21 06:43 | 28K | |
![[ ]](/icons/unknown.gif) | EVEX Medical Facilities_Usernames_Passwords_Access to Modules.xlsx | 2025-11-21 06:43 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (1219).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1218).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1217).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1216).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1215).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1214).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1213).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1212).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1211).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1210).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1209).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1208).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (763).png | 2025-11-21 06:43 | 7.7K | |
![[ ]](/icons/unknown.gif) | eqimebi da eqtnebi - sergos.xlsx | 2025-11-21 06:43 | 252K | |
![[ ]](/icons/layout.gif) | Crisis in Ukraine.pdf | 2025-11-21 06:43 | 172K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 13-03.docx | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (578).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (577).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (267).png | 2025-11-21 06:43 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (1207).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1206).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1205).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1204).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1203).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1202).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1201).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1200).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1199).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (762).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (761).png | 2025-11-21 06:43 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (760).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | contract.png | 2025-11-21 06:43 | 132K | |
![[ ]](/icons/unknown.gif) | Immunization_Statistic.xlsx | 2025-11-21 06:43 | 8.6K | |
![[ ]](/icons/unknown.gif) | Immunization Statistics_March 14, 2014.xlsx | 2025-11-21 06:43 | 23K | |
![[ ]](/icons/unknown.gif) | Cloud-დაწესებულებები.xlsx | 2025-11-21 06:43 | 18K | |
![[IMG]](/icons/image2.gif) | sms (2).png | 2025-11-21 06:43 | 356K | |
![[IMG]](/icons/image2.gif) | problema.JPG | 2025-11-21 06:43 | 127K | |
![[IMG]](/icons/image2.gif) | image002 (576).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1198).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1197).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1196).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1195).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1194).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1193).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (759).png | 2025-11-21 06:43 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (758).png | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/unknown.gif) | ePrescription Service Documentation (Reporting side) v1_1 (1).docx | 2025-11-21 06:43 | 21K | |
![[ ]](/icons/unknown.gif) | Statistics (8).xlsx | 2025-11-21 06:43 | 41K | |
![[ ]](/icons/unknown.gif) | Financing Item Deactivation Dates Corrected.xls | 2025-11-21 06:43 | 7.0M | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 17-03.docx | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (231).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (182).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (181).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (575).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (574).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (573).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (266).png | 2025-11-21 06:43 | 53K | |
![[IMG]](/icons/image2.gif) | image002 (265).png | 2025-11-21 06:43 | 53K | |
![[IMG]](/icons/image2.gif) | image001 (1192).jpg | 2025-11-21 06:43 | 7.3K | |
![[IMG]](/icons/image2.gif) | image001 (1191).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (757).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (756).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (755).png | 2025-11-21 06:43 | 46K | |
![[IMG]](/icons/image2.gif) | image001 (754).png | 2025-11-21 06:43 | 46K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 18-03.docx | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (572).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1190).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1189).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1188).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1187).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1186).jpg | 2025-11-21 06:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (753).png | 2025-11-21 06:43 | 80K | |
![[IMG]](/icons/image2.gif) | image001 (752).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (751).png | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/unknown.gif) | GURGEN PETROSIA.rar | 2025-11-21 06:43 | 3.4M | |
![[ ]](/icons/unknown.gif) | ATT74627 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | ATT62000 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | ATT55757 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | ATT55404 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | ATT51600 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | ATT32967 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | ATT26705 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | ATT22787 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | ATT22395 | 2025-11-21 06:43 | 0 | |
![[ ]](/icons/unknown.gif) | მოდულებზე წვდომა (1).xlsx | 2025-11-21 06:43 | 15K | |
![[IMG]](/icons/image2.gif) | image003 (230).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (229).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (264).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (263).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (262).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1185).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1184).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1183).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (750).png | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 19-03.docx | 2025-11-21 06:43 | 20K | |
![[VID]](/icons/movie.gif) | video.mpeg | 2025-11-21 06:43 | 19M | |
![[IMG]](/icons/image2.gif) | image005 (66).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (57).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (56).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (111).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (110).png | 2025-11-21 06:43 | 568K | |
![[IMG]](/icons/image2.gif) | image004 (109).png | 2025-11-21 06:43 | 568K | |
![[IMG]](/icons/image2.gif) | image003 (228).png | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (180).jpg | 2025-11-21 06:43 | 5.1K | |
![[IMG]](/icons/image2.gif) | image003 (179).jpg | 2025-11-21 06:43 | 5.1K | |
![[IMG]](/icons/image2.gif) | image003 (178).jpg | 2025-11-21 06:43 | 5.1K | |
![[IMG]](/icons/image2.gif) | image003 (177).jpg | 2025-11-21 06:43 | 5.1K | |
![[IMG]](/icons/image2.gif) | image002 (571).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (570).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (569).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (568).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1182).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (749).png | 2025-11-21 06:43 | 568K | |
![[IMG]](/icons/image2.gif) | image001 (748).png | 2025-11-21 06:43 | 568K | |
![[IMG]](/icons/image2.gif) | image001 (747).png | 2025-11-21 06:43 | 568K | |
![[IMG]](/icons/image2.gif) | image001 (746).png | 2025-11-21 06:43 | 568K | |
![[ ]](/icons/unknown.gif) | parolebi.xlsx | 2025-11-21 06:43 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (567).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1181).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1180).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1179).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1178).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1177).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1176).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (745).png | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 20-03.docx | 2025-11-21 06:43 | 20K | |
![[ ]](/icons/unknown.gif) | ფორმატი.xlsx | 2025-11-21 06:43 | 9.3K | |
![[IMG]](/icons/image2.gif) | image001 (1175).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1174).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1173).jpg | 2025-11-21 06:43 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (744).png | 2025-11-21 06:43 | 7.7K | |
![[ ]](/icons/unknown.gif) | SubmissionsReport_21-03-2014_11_29_52.xlsx | 2025-11-21 06:43 | 12K | |
![[ ]](/icons/unknown.gif) | NotValidList_UNISON.xlsx | 2025-11-21 06:43 | 15K | |
![[ ]](/icons/unknown.gif) | NotValidList_ALDAGI.xlsx | 2025-11-21 06:43 | 871K | |
![[ ]](/icons/layout.gif) | Abt Third Annual Photo Contest Posters (French, Spanish, Portugese, English).pdf | 2025-11-21 06:43 | 17M | |
![[ ]](/icons/unknown.gif) | რეგისტრაციის პროგრესი.xlsx | 2025-11-21 06:43 | 20K | |
![[ ]](/icons/unknown.gif) | nino modebadze (3).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | kuca-1.xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | kuca-1-1.xlsx | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (105).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image003 (176).jpg | 2025-11-21 06:43 | 31K | |
![[IMG]](/icons/image2.gif) | image003 (175).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1172).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1171).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1170).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1169).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1168).jpg | 2025-11-21 06:43 | 3.9K | |
![[ ]](/icons/unknown.gif) | Statistics (7).xlsx | 2025-11-21 06:43 | 42K | |
![[ ]](/icons/unknown.gif) | Hesperus Not Imported Or Not Synch-ed Providers.xlsx | 2025-11-21 06:43 | 14K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 24-03.docx | 2025-11-21 06:43 | 21K | |
![[ ]](/icons/unknown.gif) | დანართი 1 (2).xls | 2025-11-21 06:43 | 55K | |
![[IMG]](/icons/image2.gif) | image018 (2).png | 2025-11-21 06:43 | 3.8K | |
![[IMG]](/icons/image2.gif) | image017 (2).png | 2025-11-21 06:43 | 3.8K | |
![[IMG]](/icons/image2.gif) | image016 (2).png | 2025-11-21 06:43 | 5.4K | |
![[IMG]](/icons/image2.gif) | image014 (1).png | 2025-11-21 06:43 | 1.8K | |
![[IMG]](/icons/image2.gif) | image013 (5).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image011 (13).png | 2025-11-21 06:43 | 5.6K | |
![[IMG]](/icons/image2.gif) | image009 (13).png | 2025-11-21 06:43 | 3.8K | |
![[IMG]](/icons/image2.gif) | image008 (13).jpg | 2025-11-21 06:43 | 792 | |
![[IMG]](/icons/image2.gif) | image007 (23).jpg | 2025-11-21 06:43 | 881 | |
![[IMG]](/icons/image2.gif) | image006 (10).gif | 2025-11-21 06:43 | 220 | |
![[IMG]](/icons/image2.gif) | image005 (65).png | 2025-11-21 06:43 | 211K | |
![[IMG]](/icons/image2.gif) | image005 (55).jpg | 2025-11-21 06:43 | 855 | |
![[IMG]](/icons/image2.gif) | image004 (19).gif | 2025-11-21 06:43 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (227).png | 2025-11-21 06:43 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (226).png | 2025-11-21 06:43 | 1.0K | |
![[IMG]](/icons/image2.gif) | image002 (566).jpg | 2025-11-21 06:43 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (565).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (261).png | 2025-11-21 06:43 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (1167).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1166).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1165).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1164).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1163).jpg | 2025-11-21 06:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1162).jpg | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (743).png | 2025-11-21 06:43 | 560K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 25-03.docx | 2025-11-21 06:43 | 20K | |
![[ ]](/icons/unknown.gif) | rp_PaymentOrdersByComponents.xls | 2025-11-21 06:43 | 209K | |
![[IMG]](/icons/image2.gif) | image039.jpg | 2025-11-21 06:43 | 1.7K | |
![[IMG]](/icons/image2.gif) | image037.jpg | 2025-11-21 06:43 | 3.3K | |
![[IMG]](/icons/image2.gif) | image035.jpg | 2025-11-21 06:43 | 1.7K | |
![[IMG]](/icons/image2.gif) | image034.png | 2025-11-21 06:43 | 1.2K | |
![[IMG]](/icons/image2.gif) | image033.png | 2025-11-21 06:43 | 2.5K | |
![[IMG]](/icons/image2.gif) | image032 (1).png | 2025-11-21 06:43 | 612 | |
![[IMG]](/icons/image2.gif) | image031 (1).png | 2025-11-21 06:43 | 1.8K | |
![[IMG]](/icons/image2.gif) | image030 (1).png | 2025-11-21 06:43 | 557 | |
![[IMG]](/icons/image2.gif) | image029.jpg | 2025-11-21 06:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | image028.jpg | 2025-11-21 06:43 | 1.7K | |
![[IMG]](/icons/image2.gif) | image027.jpg | 2025-11-21 06:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | image026.jpg | 2025-11-21 06:43 | 5.1K | |
![[IMG]](/icons/image2.gif) | image025 (1).jpg | 2025-11-21 06:43 | 16K | |
![[IMG]](/icons/image2.gif) | image024.jpg | 2025-11-21 06:43 | 4.7K | |
![[IMG]](/icons/image2.gif) | image023.jpg | 2025-11-21 06:43 | 17K | |
![[IMG]](/icons/image2.gif) | image021.jpg | 2025-11-21 06:43 | 3.6K | |
![[IMG]](/icons/image2.gif) | image020.jpg | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image019.jpg | 2025-11-21 06:43 | 4.5K | |
![[IMG]](/icons/image2.gif) | image017.jpg | 2025-11-21 06:43 | 16K | |
![[IMG]](/icons/image2.gif) | image016 (2).jpg | 2025-11-21 06:43 | 4.8K | |
![[IMG]](/icons/image2.gif) | image015 (6).jpg | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image013 (4).png | 2025-11-21 06:43 | 167 | |
![[IMG]](/icons/image2.gif) | image011 (2).jpg | 2025-11-21 06:43 | 75K | |
![[IMG]](/icons/image2.gif) | image010 (3).gif | 2025-11-21 06:43 | 43 | |
![[IMG]](/icons/image2.gif) | image009 (12).png | 2025-11-21 06:43 | 1.5K | |
![[IMG]](/icons/image2.gif) | image008 (13).png | 2025-11-21 06:43 | 1.1K | |
![[IMG]](/icons/image2.gif) | image007 (24).png | 2025-11-21 06:43 | 1.4K | |
![[IMG]](/icons/image2.gif) | image006 (30).png | 2025-11-21 06:43 | 1.1K | |
![[IMG]](/icons/image2.gif) | image005 (64).png | 2025-11-21 06:43 | 1.5K | |
![[IMG]](/icons/image2.gif) | image004 (108).png | 2025-11-21 06:43 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (225).png | 2025-11-21 06:43 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (174).jpg | 2025-11-21 06:43 | 21K | |
![[IMG]](/icons/image2.gif) | image003 (173).jpg | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (260).png | 2025-11-21 06:43 | 1.1K | |
![[IMG]](/icons/image2.gif) | image001 (1161).jpg | 2025-11-21 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1160).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1159).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1158).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1157).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (742).png | 2025-11-21 06:43 | 21K | |
![[ ]](/icons/unknown.gif) | tamar imedadze (3).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | tamar imedadze (2).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | tamar imedadze (1).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | nino modebadze (2).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | nino modebadze (1).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | nemsadze keti (3).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | nemsadze keti (2).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | nemsadze keti (1).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | nana dvalishvili (5).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | nana dvalishvili (4).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | nana dvalishvili (3).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | larisa robaqidze (3).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | larisa robaqidze (2).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | larisa robaqidze (1).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | kuca xomasuridze.xlsx | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (107).png | 2025-11-21 06:43 | 15K | |
![[IMG]](/icons/image2.gif) | image003 (172).jpg | 2025-11-21 06:43 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (1156).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1155).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1154).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1153).jpg | 2025-11-21 06:43 | 726K | |
![[IMG]](/icons/image2.gif) | image001 (1152).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (741).png | 2025-11-21 06:43 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (740).png | 2025-11-21 06:43 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (739).png | 2025-11-21 06:43 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (738).png | 2025-11-21 06:43 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (737).png | 2025-11-21 06:43 | 35K | |
![[ ]](/icons/unknown.gif) | gaukmebis erori-vasadze.docx | 2025-11-21 06:43 | 212K | |
![[ ]](/icons/unknown.gif) | chelidze nunu (3).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | chelidze nunu (2).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | chelidze nunu (1).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | Providers (9).xlsx | 2025-11-21 06:43 | 26K | |
![[ ]](/icons/unknown.gif) | Providers (8).xlsx | 2025-11-21 06:43 | 34K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 26-03.docx | 2025-11-21 06:43 | 20K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 26-03 (1).docx | 2025-11-21 06:43 | 20K | |
![[ ]](/icons/unknown.gif) | 4.xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 4 (2).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 4 (1).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 3 (3).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 3 (2).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 3 (1).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 2 (6).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 2 (5).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 2 (4).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 1 (5).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 1 (4).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | 1 (3).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | tamar imedadze.xlsx | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/unknown.gif) | nino modebadze.xlsx | 2025-11-21 06:43 | 12K | |
![[ ]](/icons/unknown.gif) | nemsadze keti.xlsx | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/unknown.gif) | nana dvalishvili (2).xlsx | 2025-11-21 06:43 | 12K | |
![[ ]](/icons/unknown.gif) | larisa robaqidze.xlsx | 2025-11-21 06:43 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (259).png | 2025-11-21 06:43 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (736).png | 2025-11-21 06:43 | 16K | |
![[ ]](/icons/unknown.gif) | gaukmebis erori-gumberidze.docx | 2025-11-21 06:43 | 208K | |
![[ ]](/icons/unknown.gif) | chelidze nunu.xlsx | 2025-11-21 06:43 | 12K | |
![[ ]](/icons/unknown.gif) | UserFormTsira.xls | 2025-11-21 06:43 | 23K | |
![[ ]](/icons/unknown.gif) | UserFormTea.xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | UserFormKhatuna.xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | UserFormImeda.xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 27-03.docx | 2025-11-21 06:43 | 20K | |
![[ ]](/icons/unknown.gif) | 3.xlsx | 2025-11-21 06:43 | 12K | |
![[ ]](/icons/unknown.gif) | 2 (3).xlsx | 2025-11-21 06:43 | 12K | |
![[ ]](/icons/unknown.gif) | 1 (2).xlsx | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/unknown.gif) | მოდულები, მოხმარებლები და მათი როლები (1).docx | 2025-11-21 06:43 | 37K | |
![[ ]](/icons/unknown.gif) | მოდულებზე წვდომა.xlsx | 2025-11-21 06:43 | 15K | |
![[IMG]](/icons/image2.gif) | ინფო პორტალზე.png | 2025-11-21 06:43 | 349K | |
![[IMG]](/icons/image2.gif) | image002 (564).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (563).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1151).jpg | 2025-11-21 06:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1150).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1149).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1148).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1147).jpg | 2025-11-21 06:43 | 3.9K | |
![[ ]](/icons/unknown.gif) | UserForm -Khatuna.xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | Statistics (6).xlsx | 2025-11-21 06:43 | 43K | |
![[IMG]](/icons/image2.gif) | Capture2 (1).PNG | 2025-11-21 06:43 | 48K | |
![[IMG]](/icons/image2.gif) | Capture (19).PNG | 2025-11-21 06:43 | 84K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 31-03.docx | 2025-11-21 06:43 | 20K | |
![[ ]](/icons/unknown.gif) | 23.xlsx | 2025-11-21 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (106).png | 2025-11-21 06:43 | 38K | |
![[IMG]](/icons/image2.gif) | image003 (171).jpg | 2025-11-21 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (562).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1146).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1145).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1144).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1143).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1142).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1141).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1140).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1139).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1138).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1137).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1136).jpg | 2025-11-21 06:43 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (1135).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1134).jpg | 2025-11-21 06:43 | 4.2K | |
![[ ]](/icons/layout.gif) | o mes da Terra 2014_PT(PT).pdf | 2025-11-21 06:43 | 315K | |
![[ ]](/icons/layout.gif) | le Mois de la Terre 2014_FR(FR).pdf | 2025-11-21 06:43 | 291K | |
![[IMG]](/icons/image2.gif) | image008 (12).png | 2025-11-21 06:43 | 8.0K | |
![[IMG]](/icons/image2.gif) | image006 (49).jpg | 2025-11-21 06:43 | 6.8K | |
![[IMG]](/icons/image2.gif) | image005 (63).png | 2025-11-21 06:43 | 8.5K | |
![[IMG]](/icons/image2.gif) | image005 (54).jpg | 2025-11-21 06:43 | 194K | |
![[IMG]](/icons/image2.gif) | image004 (104).jpg | 2025-11-21 06:43 | 27K | |
![[IMG]](/icons/image2.gif) | image004 (103).jpg | 2025-11-21 06:43 | 7.3K | |
![[IMG]](/icons/image2.gif) | image003 (224).png | 2025-11-21 06:43 | 158K | |
![[IMG]](/icons/image2.gif) | image002 (561).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (560).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (559).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (558).jpg | 2025-11-21 06:43 | 88K | |
![[IMG]](/icons/image2.gif) | image002 (258).png | 2025-11-21 06:43 | 158K | |
![[IMG]](/icons/image2.gif) | image002 (257).png | 2025-11-21 06:43 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1133).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1132).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1131).jpg | 2025-11-21 06:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1130).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1129).jpg | 2025-11-21 06:43 | 9.9K | |
![[IMG]](/icons/image2.gif) | image001 (735).png | 2025-11-21 06:43 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (734).png | 2025-11-21 06:43 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (733).png | 2025-11-21 06:43 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (732).png | 2025-11-21 06:43 | 21K | |
![[ ]](/icons/layout.gif) | el Mes de la Tierra 2014_ES(ES).pdf | 2025-11-21 06:43 | 312K | |
![[ ]](/icons/layout.gif) | Earth Month 2014_AM (AM).pdf | 2025-11-21 06:43 | 376K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 01-04.docx | 2025-11-21 06:43 | 20K | |
![[IMG]](/icons/image2.gif) | image003 (223).png | 2025-11-21 06:43 | 57K | |
![[IMG]](/icons/image2.gif) | image002 (557).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1128).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1127).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1126).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1125).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1124).jpg | 2025-11-21 06:43 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (1123).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1122).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (731).png | 2025-11-21 06:43 | 11K | |
![[ ]](/icons/unknown.gif) | gauqmebiserori-pridonashvili.docx | 2025-11-21 06:43 | 169K | |
![[IMG]](/icons/image2.gif) | XuciSvili Malxaz.bmp | 2025-11-21 06:43 | 3.7M | |
![[IMG]](/icons/image2.gif) | Untitled (53).png | 2025-11-21 06:43 | 180K | |
![[ ]](/icons/layout.gif) | Tamta Kobakhidze_Diploma.pdf | 2025-11-21 06:43 | 514K | |
![[ ]](/icons/unknown.gif) | New Microsoft Word Document (1).docx | 2025-11-21 06:43 | 395K | |
![[ ]](/icons/unknown.gif) | Mamqoli.xlsx | 2025-11-21 06:43 | 8.8K | |
![[ ]](/icons/unknown.gif) | All - Users list for NCDC.xlsx | 2025-11-21 06:43 | 38K | |
![[ ]](/icons/unknown.gif) | ATT32865 | 2025-11-21 06:43 | 0 | |
![[IMG]](/icons/image2.gif) | 001.jpg | 2025-11-21 06:43 | 905K | |
![[ ]](/icons/unknown.gif) | რეფერალები სრული სია15_01_14 - 28_01_14.xlsx | 2025-11-21 06:43 | 50K | |
![[ ]](/icons/unknown.gif) | ნინოწმინდის შემთხვევა.xlsx | 2025-11-21 06:43 | 9.6K | |
![[ ]](/icons/unknown.gif) | მხოლოდ დაკავშირებული რეფერალები სია15_01_14 - 28_01_14.xlsx | 2025-11-21 06:43 | 24K | |
![[ ]](/icons/unknown.gif) | მოდულები, მოხმარებლები და მათი როლები.docx | 2025-11-21 06:43 | 44K | |
![[ ]](/icons/unknown.gif) | მოდულები მოხმარებლები და მათი როლები (2).docx | 2025-11-21 06:43 | 37K | |
![[ ]](/icons/unknown.gif) | intensiurs iTvlis naxevars.dib | 2025-11-21 06:43 | 205K | |
![[IMG]](/icons/image2.gif) | image008 (12).jpg | 2025-11-21 06:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | image007 (22).jpg | 2025-11-21 06:43 | 8.4K | |
![[IMG]](/icons/image2.gif) | image006 (48).jpg | 2025-11-21 06:43 | 17K | |
![[IMG]](/icons/image2.gif) | image005 (53).jpg | 2025-11-21 06:43 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (1121).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1120).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (730).png | 2025-11-21 06:43 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (729).png | 2025-11-21 06:43 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (728).png | 2025-11-21 06:43 | 14K | |
![[ ]](/icons/unknown.gif) | error-dadg.docx | 2025-11-21 06:43 | 165K | |
![[ ]](/icons/unknown.gif) | _LB.docx | 2025-11-21 06:43 | 51K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 03-04.docx | 2025-11-21 06:43 | 21K | |
![[ ]](/icons/layout.gif) | ARDI - Gadaxda avto dazgveva.pdf | 2025-11-21 06:43 | 343K | |
![[ ]](/icons/unknown.gif) | 6 wlis.xlsx | 2025-11-21 06:43 | 2.9M | |
![[ ]](/icons/unknown.gif) | 2 wlis.xlsx | 2025-11-21 06:43 | 3.4M | |
![[ ]](/icons/unknown.gif) | 1 wlis.xlsx | 2025-11-21 06:43 | 3.3M | |
![[IMG]](/icons/image2.gif) | image002 (556).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (555).jpg | 2025-11-21 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1119).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1118).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1117).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1116).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1115).jpg | 2025-11-21 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (727).png | 2025-11-21 06:43 | 7.7K | |
![[IMG]](/icons/image2.gif) | foti.png | 2025-11-21 06:43 | 147K | |
![[ ]](/icons/unknown.gif) | WrongContingentBeneficiaries__1_.xls | 2025-11-21 06:43 | 48K | |
![[ ]](/icons/unknown.gif) | WrongContingentBeneficiariesByProvider_xls.xlsx | 2025-11-21 06:43 | 839K | |
![[ ]](/icons/unknown.gif) | TamTas (1).xlsx | 2025-11-21 06:43 | 10K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 04-04.docx | 2025-11-21 06:43 | 21K | |
![[IMG]](/icons/image2.gif) | ბრძანების ცვლილება_27_03_14_.djvu | 2025-11-21 06:43 | 24K | |
![[IMG]](/icons/image2.gif) | sms (1).png | 2025-11-21 06:42 | 329K | |
![[IMG]](/icons/image2.gif) | server error.PNG | 2025-11-21 06:42 | 162K | |
![[IMG]](/icons/image2.gif) | image005 (62).png | 2025-11-21 06:42 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (102).jpg | 2025-11-21 06:42 | 27K | |
![[IMG]](/icons/image2.gif) | image003 (170).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (554).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (553).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (552).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (551).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (256).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (255).png | 2025-11-21 06:42 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1114).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1113).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1112).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1111).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (726).png | 2025-11-21 06:42 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (725).png | 2025-11-21 06:42 | 79K | |
![[IMG]](/icons/image2.gif) | image001 (724).png | 2025-11-21 06:42 | 80K | |
![[IMG]](/icons/image2.gif) | image001 (723).png | 2025-11-21 06:42 | 80K | |
![[ ]](/icons/unknown.gif) | Doc11111 (3).docx | 2025-11-21 06:42 | 213K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 07-04.docx | 2025-11-21 06:42 | 22K | |
![[ ]](/icons/unknown.gif) | ATT46765 | 2025-11-21 06:42 | 0 | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ_ (4).xlsx | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (101).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (222).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (550).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (549).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (548).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (547).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (546).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (545).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (544).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (254).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1110).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1109).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1108).jpg | 2025-11-21 06:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1107).jpg | 2025-11-21 06:42 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (722).png | 2025-11-21 06:42 | 80K | |
![[IMG]](/icons/image2.gif) | image001 (721).png | 2025-11-21 06:42 | 80K | |
![[IMG]](/icons/image2.gif) | image001 (720).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (719).png | 2025-11-21 06:42 | 79K | |
![[IMG]](/icons/image2.gif) | image001 (718).png | 2025-11-21 06:42 | 79K | |
![[IMG]](/icons/image2.gif) | image001 (717).png | 2025-11-21 06:42 | 79K | |
![[IMG]](/icons/image2.gif) | image001 (716).png | 2025-11-21 06:42 | 79K | |
![[IMG]](/icons/image2.gif) | image001 (715).png | 2025-11-21 06:42 | 79K | |
![[ ]](/icons/unknown.gif) | TubUsers.xls | 2025-11-21 06:42 | 28K | |
![[IMG]](/icons/image2.gif) | Capture2.PNG | 2025-11-21 06:42 | 80K | |
![[IMG]](/icons/image2.gif) | Capture (18).PNG | 2025-11-21 06:42 | 132K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 08-04.docx | 2025-11-21 06:42 | 22K | |
![[ ]](/icons/unknown.gif) | ATT89790 | 2025-11-21 06:42 | 0 | |
![[ ]](/icons/unknown.gif) | misha.doc | 2025-11-21 06:42 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (1106).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1105).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1104).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1103).jpg | 2025-11-21 06:42 | 4.2K | |
![[ ]](/icons/unknown.gif) | danarti#.xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | Inasaridze Neli.docx | 2025-11-21 06:42 | 245K | |
![[ ]](/icons/unknown.gif) | ERROR (26).docx | 2025-11-21 06:42 | 182K | |
![[ ]](/icons/unknown.gif) | Doc11111 (2).docx | 2025-11-21 06:42 | 200K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 10-04.docx | 2025-11-21 06:42 | 22K | |
![[ ]](/icons/unknown.gif) | ATT68084 | 2025-11-21 06:42 | 0 | |
![[ ]](/icons/unknown.gif) | პრეფიქსების სქემა (1).xlsx | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | trav.png | 2025-11-21 06:42 | 206K | |
![[IMG]](/icons/image2.gif) | image001 (1102).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1101).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1100).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1099).jpg | 2025-11-21 06:42 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (1098).jpg | 2025-11-21 06:42 | 3.1K | |
![[ ]](/icons/unknown.gif) | http.docx | 2025-11-21 06:42 | 132K | |
![[ ]](/icons/unknown.gif) | dauarebis erorebi.docx | 2025-11-21 06:42 | 446K | |
![[ ]](/icons/unknown.gif) | axali error.docx | 2025-11-21 06:42 | 148K | |
![[ ]](/icons/unknown.gif) | Letter of Health Dep - 10_Apr_14.doc | 2025-11-21 06:42 | 90K | |
![[ ]](/icons/unknown.gif) | ERROR 2 (1).docx | 2025-11-21 06:42 | 134K | |
![[ ]](/icons/unknown.gif) | Doc11111 (1).docx | 2025-11-21 06:42 | 283K | |
![[ ]](/icons/unknown.gif) | ჯანმრთელი მომავალი (1).xls | 2025-11-21 06:42 | 26K | |
![[ ]](/icons/unknown.gif) | შობადობა-2013.xlsx | 2025-11-21 06:42 | 25K | |
![[ ]](/icons/unknown.gif) | პრეფიქსების სქემა.xlsx | 2025-11-21 06:42 | 14K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ_ - копия (1).xlsx | 2025-11-21 06:42 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (1097).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1096).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (714).png | 2025-11-21 06:42 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (713).png | 2025-11-21 06:42 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (712).png | 2025-11-21 06:42 | 191K | |
![[IMG]](/icons/image2.gif) | image001 (711).png | 2025-11-21 06:42 | 191K | |
![[IMG]](/icons/image2.gif) | image001 (710).png | 2025-11-21 06:42 | 191K | |
![[IMG]](/icons/image2.gif) | image001 (709).png | 2025-11-21 06:42 | 1.1M | |
![[IMG]](/icons/image2.gif) | ambulatoria.png | 2025-11-21 06:42 | 96K | |
![[ ]](/icons/unknown.gif) | Doc11111.docx | 2025-11-21 06:42 | 144K | |
![[ ]](/icons/unknown.gif) | Doc1 (8).docx | 2025-11-21 06:42 | 190K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 11-04.docx | 2025-11-21 06:42 | 21K | |
![[IMG]](/icons/image2.gif) | 218_1.png | 2025-11-21 06:42 | 194K | |
![[ ]](/icons/unknown.gif) | რიტა (1).xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | limitebis cxrili.xlsx | 2025-11-21 06:42 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (100).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (543).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1095).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (708).png | 2025-11-21 06:42 | 7.7K | |
![[IMG]](/icons/image2.gif) | asd.jpg | 2025-11-21 06:42 | 85K | |
![[ ]](/icons/unknown.gif) | New Microsoft Office Word Document (3).docx | 2025-11-21 06:42 | 186K | |
![[ ]](/icons/unknown.gif) | Doc1 (7).docx | 2025-11-21 06:42 | 124K | |
![[ ]](/icons/unknown.gif) | Doc1 (6).docx | 2025-11-21 06:42 | 134K | |
![[IMG]](/icons/image2.gif) | Capture (17).PNG | 2025-11-21 06:42 | 119K | |
![[IMG]](/icons/image2.gif) | 36 cvlileba 08_04_14_ (1).djvu | 2025-11-21 06:42 | 302K | |
![[ ]](/icons/unknown.gif) | რეგისტრაციის დინამიკა.pptx | 2025-11-21 06:42 | 65K | |
![[IMG]](/icons/image2.gif) | image008 (11).jpg | 2025-11-21 06:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | image006 (47).jpg | 2025-11-21 06:42 | 17K | |
![[IMG]](/icons/image2.gif) | image006 (29).png | 2025-11-21 06:42 | 2.5K | |
![[IMG]](/icons/image2.gif) | image006 (28).png | 2025-11-21 06:42 | 2.5K | |
![[IMG]](/icons/image2.gif) | image005 (61).png | 2025-11-21 06:42 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (60).png | 2025-11-21 06:42 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (52).jpg | 2025-11-21 06:42 | 9.6K | |
![[IMG]](/icons/image2.gif) | image004 (105).png | 2025-11-21 06:42 | 1.3K | |
![[IMG]](/icons/image2.gif) | image004 (104).png | 2025-11-21 06:42 | 1.3K | |
![[IMG]](/icons/image2.gif) | image004 (99).jpg | 2025-11-21 06:42 | 33K | |
![[IMG]](/icons/image2.gif) | image003 (221).png | 2025-11-21 06:42 | 83K | |
![[IMG]](/icons/image2.gif) | image003 (220).png | 2025-11-21 06:42 | 83K | |
![[IMG]](/icons/image2.gif) | image003 (219).png | 2025-11-21 06:42 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (542).jpg | 2025-11-21 06:42 | 2.8K | |
![[IMG]](/icons/image2.gif) | image002 (541).jpg | 2025-11-21 06:42 | 8.4K | |
![[IMG]](/icons/image2.gif) | image002 (540).jpg | 2025-11-21 06:42 | 2.8K | |
![[IMG]](/icons/image2.gif) | image002 (253).png | 2025-11-21 06:42 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1094).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1093).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1092).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (707).png | 2025-11-21 06:42 | 113K | |
![[IMG]](/icons/image2.gif) | image001 (706).png | 2025-11-21 06:42 | 113K | |
![[IMG]](/icons/image2.gif) | image001 (705).png | 2025-11-21 06:42 | 21K | |
![[ ]](/icons/unknown.gif) | UserForm-gvanca (1).xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | UserForm-Medea.xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Samegrelo (2).xls | 2025-11-21 06:42 | 28K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Imereti (3).xlsx | 2025-11-21 06:42 | 14K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Guria, Achara (1).xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | Statistics (5).xlsx | 2025-11-21 06:42 | 44K | |
![[ ]](/icons/unknown.gif) | რიტა.xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | თამთას.xlsx | 2025-11-21 06:42 | 9.8K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ_ (1) - Copy.xlsx | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (98).jpg | 2025-11-21 06:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (218).png | 2025-11-21 06:42 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (169).jpg | 2025-11-21 06:42 | 8.4K | |
![[IMG]](/icons/image2.gif) | image002 (539).jpg | 2025-11-21 06:42 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (538).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (537).jpg | 2025-11-21 06:42 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (1091).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1090).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1089).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1088).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1087).jpg | 2025-11-21 06:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1086).jpg | 2025-11-21 06:42 | 9.6K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities_TB Center (2).xls | 2025-11-21 06:42 | 22K | |
![[IMG]](/icons/image2.gif) | rs_634x1024-140310184722-634_Nicki-Minaj-Butt-Mexico-Cabo_ms_031014.jpg | 2025-11-21 06:42 | 149K | |
![[ ]](/icons/unknown.gif) | nora filia.docx | 2025-11-21 06:42 | 183K | |
![[IMG]](/icons/image2.gif) | images.jpg | 2025-11-21 06:42 | 7.2K | |
![[IMG]](/icons/image2.gif) | image002 (536).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1085).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1084).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (704).png | 2025-11-21 06:42 | 86K | |
![[IMG]](/icons/image2.gif) | Reanimobile.jpg | 2025-11-21 06:42 | 50K | |
![[ ]](/icons/unknown.gif) | New_HSSP_Modules.xlsx | 2025-11-21 06:42 | 14K | |
![[ ]](/icons/unknown.gif) | HSSP Modules (1).xlsx | 2025-11-21 06:42 | 15K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 16-04.docx | 2025-11-21 06:42 | 23K | |
![[IMG]](/icons/image2.gif) | სასწარფო.png | 2025-11-21 06:42 | 274K | |
![[IMG]](/icons/image2.gif) | image007 (23).png | 2025-11-21 06:42 | 77K | |
![[IMG]](/icons/image2.gif) | image006 (46).jpg | 2025-11-21 06:42 | 38K | |
![[IMG]](/icons/image2.gif) | image005 (59).png | 2025-11-21 06:42 | 15K | |
![[IMG]](/icons/image2.gif) | image005 (51).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (103).png | 2025-11-21 06:42 | 74K | |
![[IMG]](/icons/image2.gif) | image004 (97).jpg | 2025-11-21 06:42 | 23K | |
![[IMG]](/icons/image2.gif) | image003 (168).jpg | 2025-11-21 06:42 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (1083).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1082).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1081).jpg | 2025-11-21 06:42 | 8.3K | |
![[IMG]](/icons/image2.gif) | image001 (1080).jpg | 2025-11-21 06:42 | 726K | |
![[IMG]](/icons/image2.gif) | image001 (703).png | 2025-11-21 06:42 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (702).png | 2025-11-21 06:42 | 62K | |
![[IMG]](/icons/image2.gif) | image001 (701).png | 2025-11-21 06:42 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (700).png | 2025-11-21 06:42 | 23K | |
![[IMG]](/icons/image2.gif) | Untitled (52).png | 2025-11-21 06:42 | 195K | |
![[ ]](/icons/unknown.gif) | Rosetta-Stone-Application.doc | 2025-11-21 06:42 | 97K | |
![[IMG]](/icons/image2.gif) | image004 (96).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (95).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (535).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1079).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1078).jpg | 2025-11-21 06:42 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (1077).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (699).png | 2025-11-21 06:42 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (698).png | 2025-11-21 06:42 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (121).gif | 2025-11-21 06:42 | 32K | |
![[IMG]](/icons/image2.gif) | firosmani.jpg | 2025-11-21 06:42 | 55K | |
![[IMG]](/icons/image2.gif) | Untitled (51).png | 2025-11-21 06:42 | 195K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Kakheti (2).xlsx | 2025-11-21 06:42 | 12K | |
![[IMG]](/icons/image2.gif) | 1 (24).png | 2025-11-21 06:42 | 73K | |
![[ ]](/icons/unknown.gif) | urgentuli kodebistvis cxrilis-shabloni.xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | urgentuli kodebistvis cxrilis-shabloni (1).xlsx | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (22).png | 2025-11-21 06:42 | 8.0K | |
![[IMG]](/icons/image2.gif) | image004 (94).jpg | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (217).png | 2025-11-21 06:42 | 8.0K | |
![[IMG]](/icons/image2.gif) | image002 (534).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1076).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (697).png | 2025-11-21 06:42 | 28K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Kakheti (1).xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | Statistics (4).xlsx | 2025-11-21 06:42 | 46K | |
![[ ]](/icons/unknown.gif) | 27.xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | 26.xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | 25.xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | 24.xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | 22_04_2014 - Users list.xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | ჯანმრთელი მომავალი.xls | 2025-11-21 06:42 | 26K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ_ - копия.xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ - копия.xlsx | 2025-11-21 06:42 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (102).png | 2025-11-21 06:42 | 195K | |
![[IMG]](/icons/image2.gif) | image002 (252).png | 2025-11-21 06:42 | 6.6K | |
![[IMG]](/icons/image2.gif) | image001 (1075).jpg | 2025-11-21 06:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1074).jpg | 2025-11-21 06:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (696).png | 2025-11-21 06:42 | 21K | |
![[ ]](/icons/unknown.gif) | gasaukmebeli elisodzamukashvili.docx | 2025-11-21 06:42 | 216K | |
![[ ]](/icons/unknown.gif) | New Microsoft Word Document.docx | 2025-11-21 06:42 | 180K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 24-04.docx | 2025-11-21 06:42 | 24K | |
![[IMG]](/icons/image2.gif) | 111.jpg | 2025-11-21 06:42 | 28K | |
![[ ]](/icons/unknown.gif) | რეფერალები სრული სია 29_03_2014 - 20_04_2014.xlsx | 2025-11-21 06:42 | 96K | |
![[ ]](/icons/unknown.gif) | მხოლოდ დაკავშირებული რეფერალები სია 29_03_2014 - 20_04_2014 - Copy.xlsx | 2025-11-21 06:42 | 36K | |
![[IMG]](/icons/image2.gif) | image002 (251).png | 2025-11-21 06:42 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (1073).jpg | 2025-11-21 06:42 | 2.4K | |
![[IMG]](/icons/image2.gif) | image001 (1072).jpg | 2025-11-21 06:42 | 2.4K | |
![[IMG]](/icons/image2.gif) | image001 (1071).jpg | 2025-11-21 06:42 | 2.4K | |
![[IMG]](/icons/image2.gif) | image001 (1070).jpg | 2025-11-21 06:42 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (1069).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1068).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1067).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (695).png | 2025-11-21 06:42 | 7.7K | |
![[ ]](/icons/unknown.gif) | el_ moduli (1).xls | 2025-11-21 06:42 | 28K | |
![[ ]](/icons/unknown.gif) | კლინიკა (1).xlsx | 2025-11-21 06:42 | 9.5K | |
![[IMG]](/icons/image2.gif) | image003 (216).png | 2025-11-21 06:42 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (533).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (532).jpg | 2025-11-21 06:42 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (531).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1066).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1065).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1064).jpg | 2025-11-21 06:42 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (694).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (693).png | 2025-11-21 06:42 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (692).png | 2025-11-21 06:42 | 2.6K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Kakheti.xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | Statistics (3).xlsx | 2025-11-21 06:42 | 47K | |
![[ ]](/icons/layout.gif) | Investment Quadrant_As of April 1 2014.pdf | 2025-11-21 06:42 | 83K | |
![[ ]](/icons/unknown.gif) | 1 (3).docx | 2025-11-21 06:42 | 0 | |
![[ ]](/icons/unknown.gif) | კლინიკა.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | загружено.xlsx | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | tata1.png | 2025-11-21 06:42 | 136K | |
![[IMG]](/icons/image2.gif) | tata.png | 2025-11-21 06:42 | 238K | |
![[ ]](/icons/unknown.gif) | import and sync result.xlsx | 2025-11-21 06:42 | 28K | |
![[IMG]](/icons/image2.gif) | image007 (21).jpg | 2025-11-21 06:42 | 839 | |
![[IMG]](/icons/image2.gif) | image006 (45).jpg | 2025-11-21 06:42 | 912 | |
![[IMG]](/icons/image2.gif) | image002 (530).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1063).jpg | 2025-11-21 06:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (1062).jpg | 2025-11-21 06:42 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (1061).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (691).png | 2025-11-21 06:42 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (690).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | Untitled (50).png | 2025-11-21 06:42 | 270K | |
![[IMG]](/icons/image2.gif) | Untitled (49).png | 2025-11-21 06:42 | 126K | |
![[ ]](/icons/unknown.gif) | RE (1) | 2025-11-21 06:42 | 0 | |
![[ ]](/icons/unknown.gif) | Doc2 (1).docx | 2025-11-21 06:42 | 224K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew (3).docx | 2025-11-21 06:42 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (1060).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1059).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1058).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1057).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1056).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1055).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (689).png | 2025-11-21 06:42 | 185K | |
![[IMG]](/icons/image2.gif) | image001 (688).png | 2025-11-21 06:42 | 185K | |
![[IMG]](/icons/image2.gif) | image001 (687).png | 2025-11-21 06:42 | 185K | |
![[IMG]](/icons/image2.gif) | image001 (686).png | 2025-11-21 06:42 | 185K | |
![[ ]](/icons/unknown.gif) | el_ moduli.xls | 2025-11-21 06:42 | 28K | |
![[ ]](/icons/unknown.gif) | CEACAA00422BV4.PDF | 2025-11-21 06:42 | 76K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew (1).docx | 2025-11-21 06:42 | 25K | |
![[ ]](/icons/unknown.gif) | 29.xlsx | 2025-11-21 06:42 | 9.0K | |
![[ ]](/icons/unknown.gif) | დუბლები.xlsx | 2025-11-21 06:42 | 10K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (26).jpg | 2025-11-21 06:42 | 823 | |
![[ ]](/icons/unknown.gif) | invalid.docx | 2025-11-21 06:42 | 196K | |
![[IMG]](/icons/image2.gif) | image003 (215).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (250).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (685).png | 2025-11-21 06:42 | 185K | |
![[IMG]](/icons/image2.gif) | image001 (684).png | 2025-11-21 06:42 | 9.7K | |
![[IMG]](/icons/image2.gif) | erori manchos.png | 2025-11-21 06:42 | 217K | |
![[ ]](/icons/unknown.gif) | UserForm-gvanca.xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | Tamtas.xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/layout.gif) | Report.pdf | 2025-11-21 06:42 | 603K | |
![[ ]](/icons/layout.gif) | Irakli 10001.pdf | 2025-11-21 06:42 | 415K | |
![[ ]](/icons/layout.gif) | Irakli0001.pdf | 2025-11-21 06:42 | 514K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 02-05.docx | 2025-11-21 06:42 | 25K | |
![[ ]](/icons/unknown.gif) | 31.xlsx | 2025-11-21 06:42 | 9.7K | |
![[ ]](/icons/unknown.gif) | 30.xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | 28.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | 1 (2).docx | 2025-11-21 06:42 | 138K | |
![[ ]](/icons/unknown.gif) | 01_05_2014 - Users list.xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | sajaia mariami.rar | 2025-11-21 06:42 | 2.3M | |
![[IMG]](/icons/image2.gif) | image005 (58).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (101).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (214).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (213).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (529).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (249).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (683).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (682).png | 2025-11-21 06:42 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (681).png | 2025-11-21 06:42 | 41K | |
![[ ]](/icons/unknown.gif) | WIQARISHVILI.docx | 2025-11-21 06:42 | 184K | |
![[ ]](/icons/unknown.gif) | 32.xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | 1 (1).docx | 2025-11-21 06:42 | 141K | |
![[IMG]](/icons/image2.gif) | tatas2.png | 2025-11-21 06:42 | 122K | |
![[ ]](/icons/unknown.gif) | saministros erori.docx | 2025-11-21 06:42 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (93).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (528).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (527).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1054).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (680).png | 2025-11-21 06:42 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (679).png | 2025-11-21 06:42 | 306K | |
![[IMG]](/icons/image2.gif) | image-05-05-14-02-43.jpeg | 2025-11-21 06:42 | 267K | |
![[ ]](/icons/unknown.gif) | error portal.docx | 2025-11-21 06:42 | 165K | |
![[IMG]](/icons/image2.gif) | erori 05_05_2014.png | 2025-11-21 06:42 | 328K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities_TB Center.xls | 2025-11-21 06:42 | 29K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities_TB Center (1).xls | 2025-11-21 06:42 | 22K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Samegrelo.xls | 2025-11-21 06:42 | 29K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Samegrelo (1).xls | 2025-11-21 06:42 | 28K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Imereti.xlsx | 2025-11-21 06:42 | 15K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Imereti (2).xlsx | 2025-11-21 06:42 | 14K | |
![[ ]](/icons/layout.gif) | Registration Confirmation Letter.pdf | 2025-11-21 06:42 | 22K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 05-05.docx | 2025-11-21 06:42 | 25K | |
![[ ]](/icons/unknown.gif) | ATT57463 | 2025-11-21 06:42 | 0 | |
![[IMG]](/icons/image2.gif) | 10174965_815392621815084_6990605482166832854_n.jpg | 2025-11-21 06:42 | 16K | |
![[IMG]](/icons/image2.gif) | 1 (23).png | 2025-11-21 06:42 | 176K | |
![[ ]](/icons/unknown.gif) | 05_05_2014.xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | saministros erori 06_05_2014.docx | 2025-11-21 06:42 | 15K | |
![[IMG]](/icons/image2.gif) | image003 (167).jpg | 2025-11-21 06:42 | 8.4K | |
![[IMG]](/icons/image2.gif) | image002 (248).png | 2025-11-21 06:42 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (1053).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1052).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1051).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1050).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1049).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1048).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1047).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1046).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1045).jpg | 2025-11-21 06:42 | 4.2K | |
![[ ]](/icons/unknown.gif) | erori 06_05 axali.docx | 2025-11-21 06:42 | 16K | |
![[ ]](/icons/unknown.gif) | ePrescription Service Documentation (Reporting side) v1_1.docx | 2025-11-21 06:42 | 25K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Imereti (1).xlsx | 2025-11-21 06:42 | 15K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Imereti (1) (1).xlsx | 2025-11-21 06:42 | 15K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-Guria, Achara.xlsx | 2025-11-21 06:42 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (526).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (525).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (678).png | 2025-11-21 06:42 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (677).png | 2025-11-21 06:42 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (676).png | 2025-11-21 06:42 | 2.1M | |
![[IMG]](/icons/image2.gif) | image001 (675).png | 2025-11-21 06:42 | 2.1M | |
![[IMG]](/icons/image2.gif) | image (14).png | 2025-11-21 06:42 | 391K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-abastumani.xls | 2025-11-21 06:42 | 21K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-EastGeorgia (1).xls | 2025-11-21 06:42 | 28K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew07-05.docx | 2025-11-21 06:42 | 26K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ_ (3).xlsx | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (524).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1044).jpg | 2025-11-21 06:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (674).png | 2025-11-21 06:42 | 7.7K | |
![[IMG]](/icons/image2.gif) | Untitled (48).png | 2025-11-21 06:42 | 232K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 13-05.docx | 2025-11-21 06:42 | 26K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ_ (2).xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | limiti.docx | 2025-11-21 06:42 | 184K | |
![[IMG]](/icons/image2.gif) | image001 (1043).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1042).jpg | 2025-11-21 06:42 | 2.4K | |
![[IMG]](/icons/image2.gif) | image001 (1041).jpg | 2025-11-21 06:42 | 2.4K | |
![[ ]](/icons/unknown.gif) | darejan chutlashvili.rar | 2025-11-21 06:42 | 415K | |
![[IMG]](/icons/image2.gif) | JALALI.jpeg | 2025-11-21 06:42 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1897818_771200512913564_1821861175614136516_n.jpg | 2025-11-21 06:42 | 16K | |
![[ ]](/icons/unknown.gif) | 13_05_2014 - Users list.xlsx | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | რამაზი მუჯირი.png | 2025-11-21 06:42 | 195K | |
![[ ]](/icons/unknown.gif) | provaiderebi (2).xlsx | 2025-11-21 06:42 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (166).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1040).jpg | 2025-11-21 06:42 | 2.4K | |
![[IMG]](/icons/image2.gif) | image001 (1039).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1038).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | cloud (4).PNG | 2025-11-21 06:42 | 190K | |
![[IMG]](/icons/image2.gif) | Image.jpg | 2025-11-21 06:42 | 682K | |
![[IMG]](/icons/image2.gif) | Image (4).jpg | 2025-11-21 06:42 | 591K | |
![[IMG]](/icons/image2.gif) | Image (3).jpg | 2025-11-21 06:42 | 464K | |
![[IMG]](/icons/image2.gif) | Image (2).jpg | 2025-11-21 06:42 | 607K | |
![[ ]](/icons/unknown.gif) | ATT05688 | 2025-11-21 06:42 | 0 | |
![[IMG]](/icons/image2.gif) | 123 (5).png | 2025-11-21 06:42 | 290K | |
![[ ]](/icons/unknown.gif) | რეფერალები 20_04_2014 - 10_05_2013 სრული სია.xlsx | 2025-11-21 06:42 | 94K | |
![[ ]](/icons/unknown.gif) | რეფერალები 20_04_2014 - 10_05_2013 სრული სია (1).xlsx | 2025-11-21 06:42 | 94K | |
![[ ]](/icons/unknown.gif) | რეფერალები 20_04_2014 - 10_05_2013 დაკავშირებული რეფერალები.xlsx | 2025-11-21 06:42 | 34K | |
![[ ]](/icons/unknown.gif) | რეფერალები 20_04_2014 - 10_05_2013 დაკავშირებული რეფერალები (1).xlsx | 2025-11-21 06:42 | 41K | |
![[IMG]](/icons/image2.gif) | მარინე ოგანიანი2.png | 2025-11-21 06:42 | 199K | |
![[IMG]](/icons/image2.gif) | მარინე ოგანიანი1.png | 2025-11-21 06:42 | 235K | |
![[IMG]](/icons/image2.gif) | მარინე ოგანიანი.jpeg | 2025-11-21 06:42 | 434K | |
![[ ]](/icons/unknown.gif) | tatas (2).docx | 2025-11-21 06:42 | 182K | |
![[IMG]](/icons/image2.gif) | oftalmijis cerili.djvu | 2025-11-21 06:42 | 22K | |
![[IMG]](/icons/image2.gif) | image003 (165).jpg | 2025-11-21 06:42 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (523).jpg | 2025-11-21 06:42 | 50K | |
![[IMG]](/icons/image2.gif) | image002 (522).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (521).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (247).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1037).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1036).jpg | 2025-11-21 06:42 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1035).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1034).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (673).png | 2025-11-21 06:42 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (672).png | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | g a m o r c e n i l i fiz piri (1).xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | Users -Aspindza-16_05_14 (1).xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-EastGeorgia.xls | 2025-11-21 06:42 | 36K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-EastGeorgia-addresses (2).xls | 2025-11-21 06:42 | 31K | |
![[ ]](/icons/unknown.gif) | On-Site Monitoring V_1_1.docx | 2025-11-21 06:42 | 32K | |
![[ ]](/icons/unknown.gif) | Dubles (1).xlsx | 2025-11-21 06:42 | 8.7K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 16-05.docx | 2025-11-21 06:42 | 35K | |
![[ ]](/icons/unknown.gif) | ATT29376 | 2025-11-21 06:42 | 0 | |
![[ ]](/icons/unknown.gif) | ვერტიკალურის პროვაიდერები.xlsx | 2025-11-21 06:42 | 16K | |
![[ ]](/icons/unknown.gif) | გასაგზავნი თამთას (6).xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | გასაგზავნი თამთას (5).xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | user.xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | sos.xlsx | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (164).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (520).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (246).png | 2025-11-21 06:42 | 199K | |
![[IMG]](/icons/image2.gif) | image001 (1033).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (671).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (670).png | 2025-11-21 06:42 | 204K | |
![[IMG]](/icons/image2.gif) | image001 (669).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (668).png | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | g a m o r c e n i l i fiz piri.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | Users -Aspindza-16_05_14.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | Users -Aspindza-16 05 14.xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | Statistics (2).xlsx | 2025-11-21 06:42 | 48K | |
![[ ]](/icons/unknown.gif) | Statistics (1).xlsx | 2025-11-21 06:42 | 53K | |
![[ ]](/icons/unknown.gif) | NCDC MOH modules (1).xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | Irao_baza_cxveta.rar | 2025-11-21 06:42 | 302K | |
![[ ]](/icons/unknown.gif) | IRAO-Phase2.xlsx | 2025-11-21 06:42 | 4.1M | |
![[ ]](/icons/unknown.gif) | 33.xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | 19_05_2014 - Users list.xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | 2 (2).xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | 1.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | 1 (1).xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | კახეთი.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | იორამაშვილი.xlsx | 2025-11-21 06:42 | 11K | |
![[ ]](/icons/unknown.gif) | გასაგზავნი თამთას (4).xlsx | 2025-11-21 06:42 | 13K | |
![[ ]](/icons/unknown.gif) | ახალი.xlsx | 2025-11-21 06:42 | 9.6K | |
![[ ]](/icons/unknown.gif) | tata (9).docx | 2025-11-21 06:42 | 272K | |
![[IMG]](/icons/image2.gif) | image003 (163).jpg | 2025-11-21 06:42 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (519).jpg | 2025-11-21 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1032).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1031).jpg | 2025-11-21 06:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (667).png | 2025-11-21 06:42 | 193K | |
![[IMG]](/icons/image2.gif) | image001 (666).png | 2025-11-21 06:42 | 40K | |
![[ ]](/icons/unknown.gif) | erori tanxis dablokv.docx | 2025-11-21 06:42 | 175K | |
![[ ]](/icons/unknown.gif) | cvdoma modulze.xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | cvdoma modulze-1.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | cvdoma modulze-1 (1).xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | cvdoma modulze (1).xlsx | 2025-11-21 06:42 | 12K | |
![[ ]](/icons/unknown.gif) | axali (4).xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | Dubles.xlsx | 2025-11-21 06:42 | 8.7K | |
![[ ]](/icons/unknown.gif) | Doc1 (5).docx | 2025-11-21 06:42 | 178K | |
![[ ]](/icons/unknown.gif) | 2 (1).xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | კევლიშვილი.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | კევლიშვილი (1).xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | tata (8).docx | 2025-11-21 06:42 | 136K | |
![[ ]](/icons/unknown.gif) | samxedro.xlsx | 2025-11-21 06:42 | 9.5K | |
![[IMG]](/icons/image2.gif) | image003 (162).jpg | 2025-11-21 06:42 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1030).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1029).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (665).png | 2025-11-21 06:42 | 40K | |
![[IMG]](/icons/image2.gif) | image001 (664).png | 2025-11-21 06:42 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (663).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (662).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | erroor 111.png | 2025-11-21 06:42 | 285K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-EastGeorgia-addresses (1).xls | 2025-11-21 06:42 | 31K | |
![[IMG]](/icons/image2.gif) | LIPARTELIANI 2.jpeg | 2025-11-21 06:42 | 647K | |
![[IMG]](/icons/image2.gif) | LIPARTELIANI 1.jpeg | 2025-11-21 06:42 | 537K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 21-5.docx | 2025-11-21 06:42 | 35K | |
![[ ]](/icons/unknown.gif) | 2.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | 2-2.xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | 2-2 (1).xlsx | 2025-11-21 06:42 | 10K | |
![[ ]](/icons/unknown.gif) | ხამხაძე.xlsx | 2025-11-21 06:42 | 9.3K | |
![[ ]](/icons/unknown.gif) | ხამხაძე (1).xlsx | 2025-11-21 06:42 | 9.3K | |
![[ ]](/icons/unknown.gif) | ანტენატალური.xlsx | 2025-11-21 06:42 | 22K | |
![[IMG]](/icons/image2.gif) | image003 (212).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (161).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (245).png | 2025-11-21 06:42 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1028).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1027).jpg | 2025-11-21 06:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1026).jpg | 2025-11-21 06:42 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1025).jpg | 2025-11-21 06:42 | 8.3K | |
![[ ]](/icons/unknown.gif) | სამედიცინო მედიაცია-სუპერმედიატორი.docx | 2025-11-21 06:42 | 516K | |
![[ ]](/icons/unknown.gif) | სამედიცინო მედიაცია-ოპერატორი.docx | 2025-11-21 06:42 | 645K | |
![[ ]](/icons/unknown.gif) | სამედიცინო მედიაცია-აუდიტი.docx | 2025-11-21 06:42 | 544K | |
![[ ]](/icons/unknown.gif) | სამედიცინო მედიაცია-ანალიტიკოსი.docx | 2025-11-21 06:42 | 519K | |
![[IMG]](/icons/image2.gif) | image002 (518).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (1024).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (661).png | 2025-11-21 06:41 | 193K | |
![[IMG]](/icons/image2.gif) | image001 (660).png | 2025-11-21 06:41 | 193K | |
![[IMG]](/icons/image2.gif) | image001 (659).png | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (658).png | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (657).png | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (656).png | 2025-11-21 06:41 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (655).png | 2025-11-21 06:41 | 7.7K | |
![[ ]](/icons/unknown.gif) | Untitled (52) | 2025-11-21 06:41 | 0 | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 23-05.docx | 2025-11-21 06:41 | 36K | |
![[ ]](/icons/unknown.gif) | ATT33158 | 2025-11-21 06:41 | 0 | |
![[IMG]](/icons/image2.gif) | 1234.png | 2025-11-21 06:41 | 274K | |
![[ ]](/icons/unknown.gif) | tata (7).docx | 2025-11-21 06:41 | 432K | |
![[IMG]](/icons/image2.gif) | image001 (1023).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1022).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1021).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1020).jpg | 2025-11-21 06:41 | 3.1K | |
![[ ]](/icons/unknown.gif) | Statistics.xlsx | 2025-11-21 06:41 | 54K | |
![[ ]](/icons/unknown.gif) | Doc1111.docx | 2025-11-21 06:41 | 238K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 27-05.docx | 2025-11-21 06:41 | 37K | |
![[ ]](/icons/unknown.gif) | 27_05_2014 - Users list (1).xlsx | 2025-11-21 06:41 | 9.8K | |
![[IMG]](/icons/image2.gif) | ჯეო-ჰოსპიტალს.djvu | 2025-11-21 06:41 | 28K | |
![[IMG]](/icons/image2.gif) | ჯეო-ჰოსპიტალს (1).djvu | 2025-11-21 06:41 | 28K | |
![[IMG]](/icons/image2.gif) | sabaxt.png | 2025-11-21 06:41 | 189K | |
![[IMG]](/icons/image2.gif) | image002 (517).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (516).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1019).jpg | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1018).jpg | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (1017).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1016).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1015).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1014).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (654).png | 2025-11-21 06:41 | 118K | |
![[IMG]](/icons/image2.gif) | image001 (653).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (652).png | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 28-05.docx | 2025-11-21 06:41 | 37K | |
![[ ]](/icons/unknown.gif) | Billing Tasks - მრავალდონიანი აგენტი.docx | 2025-11-21 06:41 | 9.5K | |
![[IMG]](/icons/image2.gif) | ATT00002 (12).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | ATT00002 (11).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | ATT00001 (24).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (23).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | 1 (1).jpg | 2025-11-21 06:41 | 155K | |
![[ ]](/icons/unknown.gif) | ფარმაცევტული საქმიანობის დეპარტამენტი (1).xlsx | 2025-11-21 06:41 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (160).jpg | 2025-11-21 06:41 | 7.0K | |
![[IMG]](/icons/image2.gif) | image002 (515).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (514).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1013).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1012).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (651).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (650).png | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | axali2.xlsx | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | TubUsersByFacilities-EastGeorgia-addresses.xls | 2025-11-21 06:41 | 31K | |
![[ ]](/icons/unknown.gif) | ATT89498 | 2025-11-21 06:41 | 0 | |
![[ ]](/icons/unknown.gif) | ATT77933 | 2025-11-21 06:41 | 0 | |
![[ ]](/icons/unknown.gif) | ATT74934 | 2025-11-21 06:41 | 0 | |
![[ ]](/icons/unknown.gif) | ATT33055 | 2025-11-21 06:41 | 0 | |
![[ ]](/icons/unknown.gif) | ATT00540 | 2025-11-21 06:41 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00002 (10).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | ATT00002 (9).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | ATT00001 (22).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (21).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (4).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | ATT00001 (3).jpg | 2025-11-21 06:41 | 21K | |
![[ ]](/icons/unknown.gif) | 27_05_2014 - Users list.xlsx | 2025-11-21 06:41 | 9.8K | |
![[ ]](/icons/unknown.gif) | საწყობის მოდულზე წვდომაავტორიზაციაGF.xlsx | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | საწყობის მოდულზე წვდომაავტორიზაციაGF (3).xlsx | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (211).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (159).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (513).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (1011).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1010).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1009).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1008).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1007).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1006).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1005).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1004).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1003).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1002).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (649).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (648).png | 2025-11-21 06:41 | 102K | |
![[IMG]](/icons/image2.gif) | image001 (647).png | 2025-11-21 06:41 | 194K | |
![[IMG]](/icons/image2.gif) | image001 (646).png | 2025-11-21 06:41 | 102K | |
![[IMG]](/icons/image2.gif) | image001 (645).png | 2025-11-21 06:41 | 193K | |
![[ ]](/icons/unknown.gif) | Users-ნინოწმ (3).xlsx | 2025-11-21 06:41 | 10K | |
![[ ]](/icons/unknown.gif) | Users-ნინოწმ (2).xlsx | 2025-11-21 06:41 | 10K | |
![[IMG]](/icons/image2.gif) | Untitled (1).jpg | 2025-11-21 06:41 | 124K | |
![[VID]](/icons/movie.gif) | IMG_0035.MOV | 2025-11-21 06:41 | 4.9M | |
![[ ]](/icons/layout.gif) | სამედიცინო მედიაცია-ქვემედიატორი.pdf | 2025-11-21 06:41 | 839K | |
![[ ]](/icons/layout.gif) | სამედიცინო მედიაცია-სუპერმედიატორი.pdf | 2025-11-21 06:41 | 465K | |
![[ ]](/icons/layout.gif) | სამედიცინო მედიაცია-ოპერატორი.pdf | 2025-11-21 06:41 | 664K | |
![[ ]](/icons/layout.gif) | სამედიცინო მედიაცია-აუდიტი.pdf | 2025-11-21 06:41 | 459K | |
![[ ]](/icons/layout.gif) | სამედიცინო მედიაცია-ანალიტიკოსი.pdf | 2025-11-21 06:41 | 467K | |
![[IMG]](/icons/image2.gif) | image003 (158).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (512).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image002 (511).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1001).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (1000).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (999).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (998).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (997).jpg | 2025-11-21 06:41 | 7.0K | |
![[IMG]](/icons/image2.gif) | image001 (996).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (995).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (644).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (643).png | 2025-11-21 06:41 | 93K | |
![[IMG]](/icons/image2.gif) | image001 (642).png | 2025-11-21 06:41 | 93K | |
![[IMG]](/icons/image2.gif) | image001 (641).png | 2025-11-21 06:41 | 93K | |
![[ ]](/icons/unknown.gif) | danarti N1 sakvartelize.xls | 2025-11-21 06:41 | 32K | |
![[IMG]](/icons/image2.gif) | Capture (1).JPG | 2025-11-21 06:41 | 7.9K | |
![[IMG]](/icons/image2.gif) | image003 (210).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (510).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (509).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (508).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (244).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (243).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (994).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (640).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (639).png | 2025-11-21 06:41 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (638).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (637).png | 2025-11-21 06:41 | 61K | |
![[ ]](/icons/unknown.gif) | axali provaiderebi (1).xlsx | 2025-11-21 06:41 | 10K | |
![[IMG]](/icons/image2.gif) | Untitled (47).png | 2025-11-21 06:41 | 256K | |
![[ ]](/icons/unknown.gif) | ალეკოს მაგალითები.xls | 2025-11-21 06:41 | 42K | |
![[IMG]](/icons/image2.gif) | image006 (27).png | 2025-11-21 06:41 | 77K | |
![[IMG]](/icons/image2.gif) | image006 (26).png | 2025-11-21 06:41 | 77K | |
![[IMG]](/icons/image2.gif) | image005 (50).jpg | 2025-11-21 06:41 | 38K | |
![[IMG]](/icons/image2.gif) | image005 (49).jpg | 2025-11-21 06:41 | 38K | |
![[IMG]](/icons/image2.gif) | image004 (92).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (91).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (157).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image003 (156).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (507).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (506).jpg | 2025-11-21 06:41 | 9.6K | |
![[IMG]](/icons/image2.gif) | image002 (505).jpg | 2025-11-21 06:41 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (993).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (992).jpg | 2025-11-21 06:41 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (991).jpg | 2025-11-21 06:41 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (636).png | 2025-11-21 06:41 | 109K | |
![[ ]](/icons/unknown.gif) | axali provaiderebi.xlsx | 2025-11-21 06:41 | 12K | |
![[IMG]](/icons/image2.gif) | Untitled3.png | 2025-11-21 06:41 | 134K | |
![[IMG]](/icons/image2.gif) | Untitled2 (1).png | 2025-11-21 06:41 | 180K | |
![[IMG]](/icons/image2.gif) | Untitled (46).png | 2025-11-21 06:41 | 222K | |
![[ ]](/icons/unknown.gif) | Statistics for May 26 - June 1.xlsx | 2025-11-21 06:41 | 55K | |
![[ ]](/icons/unknown.gif) | Copy of ფორმატი თანამშრომლები.xlsx | 2025-11-21 06:41 | 13K | |
![[ ]](/icons/unknown.gif) | Copy of ფორმატი თანამშრომლები (1).xlsx | 2025-11-21 06:41 | 13K | |
![[ ]](/icons/unknown.gif) | ფორმატი თანამშრომლები (2).xlsx | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | tatas (1).docx | 2025-11-21 06:41 | 187K | |
![[ ]](/icons/unknown.gif) | tata (6).docx | 2025-11-21 06:41 | 169K | |
![[ ]](/icons/unknown.gif) | ncdc (1).xlsx | 2025-11-21 06:41 | 9.5M | |
![[ ]](/icons/unknown.gif) | danarti N1 sakvartelize (2).xls | 2025-11-21 06:41 | 34K | |
![[ ]](/icons/unknown.gif) | Users-ნინოწმ.xlsx | 2025-11-21 06:41 | 10K | |
![[ ]](/icons/unknown.gif) | Users-ნინოწმ (1).xlsx | 2025-11-21 06:41 | 10K | |
![[ ]](/icons/unknown.gif) | ReportsTablesDescription.xlsx | 2025-11-21 06:41 | 15K | |
![[ ]](/icons/unknown.gif) | No Name (2).docx | 2025-11-21 06:41 | 34K | |
![[IMG]](/icons/image2.gif) | 1 (22).png | 2025-11-21 06:41 | 196K | |
![[ ]](/icons/unknown.gif) | ფორმატი თანამშრომლები (1).xlsx | 2025-11-21 06:41 | 9.5M | |
![[ ]](/icons/unknown.gif) | ncdc.xlsx | 2025-11-21 06:41 | 9.6M | |
![[IMG]](/icons/image2.gif) | image001 (990).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | forma 100 diagnozis damatebisdros.png | 2025-11-21 06:41 | 161K | |
![[IMG]](/icons/image2.gif) | forma 100_ diagnozis damatebisdros.png | 2025-11-21 06:41 | 166K | |
![[ ]](/icons/unknown.gif) | Tamta Kobakhidze Cover Letter - Team Leader.docx | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | 2 (18).png | 2025-11-21 06:41 | 185K | |
![[ ]](/icons/unknown.gif) | 04_06_2014 - Users list.xlsx | 2025-11-21 06:41 | 10K | |
![[ ]](/icons/unknown.gif) | 03_06_2014 - Users list.xlsx | 2025-11-21 06:41 | 9.8K | |
![[ ]](/icons/unknown.gif) | დაწესებულებების რეკვიზიტები.xlsx | 2025-11-21 06:41 | 10K | |
![[ ]](/icons/unknown.gif) | დაწესებულებების რეკვიზიტები (1).xlsx | 2025-11-21 06:41 | 10K | |
![[IMG]](/icons/image2.gif) | გამოყენების ბოლო ვადის გარეშე მიმართვის ბეჭდვა.png | 2025-11-21 06:41 | 179K | |
![[IMG]](/icons/image2.gif) | image001 (989).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (635).png | 2025-11-21 06:41 | 183K | |
![[IMG]](/icons/image2.gif) | image001 (634).png | 2025-11-21 06:41 | 85K | |
![[ ]](/icons/unknown.gif) | error (25).docx | 2025-11-21 06:41 | 194K | |
![[ ]](/icons/unknown.gif) | error (24).docx | 2025-11-21 06:41 | 188K | |
![[IMG]](/icons/image2.gif) | error (2).jpg | 2025-11-21 06:41 | 99K | |
![[ ]](/icons/unknown.gif) | Imm_Amb_Excel.xlsx | 2025-11-21 06:41 | 59K | |
![[IMG]](/icons/image2.gif) | 123 (4).png | 2025-11-21 06:41 | 192K | |
![[ ]](/icons/unknown.gif) | 11_05_2014 - 31_05_2014 ყველა შემთხვევა.xlsx | 2025-11-21 06:41 | 111K | |
![[ ]](/icons/unknown.gif) | 11_05_2014 - 31_05_2013 დაკავშირებული შემთხვევები.xlsx | 2025-11-21 06:41 | 44K | |
![[ ]](/icons/unknown.gif) | probl (1).docx | 2025-11-21 06:41 | 136K | |
![[IMG]](/icons/image2.gif) | image001 (988).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (987).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (986).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (633).png | 2025-11-21 06:41 | 147K | |
![[IMG]](/icons/image2.gif) | image001 (632).png | 2025-11-21 06:41 | 7.0K | |
![[IMG]](/icons/image2.gif) | image001 (631).png | 2025-11-21 06:41 | 147K | |
![[IMG]](/icons/image2.gif) | image001 (630).png | 2025-11-21 06:41 | 147K | |
![[IMG]](/icons/image2.gif) | image001 (629).png | 2025-11-21 06:41 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (628).png | 2025-11-21 06:41 | 7.0K | |
![[ ]](/icons/unknown.gif) | goliadze.docx | 2025-11-21 06:41 | 16K | |
![[ ]](/icons/compressed.gif) | 05-06-2014_14-33-58.zip | 2025-11-21 06:41 | 410K | |
![[ ]](/icons/unknown.gif) | ვერტიკალურების ფორმების ცვლილებები და რეესტრები.docx | 2025-11-21 06:41 | 17K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (25).jpg | 2025-11-21 06:41 | 823 | |
![[ ]](/icons/unknown.gif) | travma.xlsx | 2025-11-21 06:41 | 9.7K | |
![[ ]](/icons/unknown.gif) | probl.docx | 2025-11-21 06:41 | 152K | |
![[IMG]](/icons/image2.gif) | image001 (985).jpg | 2025-11-21 06:41 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (627).png | 2025-11-21 06:41 | 7.0K | |
![[IMG]](/icons/image2.gif) | image001 (626).png | 2025-11-21 06:41 | 7.0K | |
![[IMG]](/icons/image2.gif) | error (27).png | 2025-11-21 06:41 | 223K | |
![[ ]](/icons/unknown.gif) | er.docx | 2025-11-21 06:41 | 157K | |
![[ ]](/icons/unknown.gif) | axali (3).xlsx | 2025-11-21 06:41 | 9.7K | |
![[ ]](/icons/unknown.gif) | axali (2).xlsx | 2025-11-21 06:41 | 9.7K | |
![[ ]](/icons/unknown.gif) | 1.docx | 2025-11-21 06:41 | 150K | |
![[IMG]](/icons/image2.gif) | sagarantio (1).jpg | 2025-11-21 06:41 | 138K | |
![[IMG]](/icons/image2.gif) | image001 (984).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (983).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (982).jpg | 2025-11-21 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | guli.png | 2025-11-21 06:41 | 283K | |
![[IMG]](/icons/image2.gif) | erori 1.png | 2025-11-21 06:41 | 123K | |
![[ ]](/icons/unknown.gif) | Statistics for June 2 - June 8.xlsx | 2025-11-21 06:41 | 56K | |
![[ ]](/icons/unknown.gif) | Server Error (2).docx | 2025-11-21 06:41 | 167K | |
![[ ]](/icons/unknown.gif) | SJC-ები და მათი სამოქმედო არეალები_4_06_14_TG_.xlsx | 2025-11-21 06:41 | 22K | |
![[IMG]](/icons/image2.gif) | Capture (16).PNG | 2025-11-21 06:41 | 66K | |
![[ ]](/icons/binary.gif) | ATT00001 (3).bin | 2025-11-21 06:41 | 0 | |
![[IMG]](/icons/image2.gif) | 1 (21).PNG | 2025-11-21 06:41 | 55K | |
![[ ]](/icons/unknown.gif) | motxovna 69759.docx | 2025-11-21 06:41 | 1.4M | |
![[IMG]](/icons/image2.gif) | image002 (504).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (981).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (980).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (979).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (978).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (977).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (976).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (975).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (974).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (625).png | 2025-11-21 06:41 | 116K | |
![[IMG]](/icons/image2.gif) | image001 (624).png | 2025-11-21 06:41 | 116K | |
![[IMG]](/icons/image2.gif) | image001 (623).png | 2025-11-21 06:41 | 209K | |
![[IMG]](/icons/image2.gif) | Untitled (45).png | 2025-11-21 06:41 | 225K | |
![[ ]](/icons/unknown.gif) | Server Error in.docx | 2025-11-21 06:41 | 14K | |
![[IMG]](/icons/image2.gif) | mash_hammer.jpg | 2025-11-21 06:41 | 23K | |
![[IMG]](/icons/image2.gif) | image002 (503).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (973).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (972).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (971).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (970).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (969).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (622).png | 2025-11-21 06:41 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (621).png | 2025-11-21 06:41 | 101K | |
![[ ]](/icons/unknown.gif) | form 025 (1).xls | 2025-11-21 06:41 | 21K | |
![[ ]](/icons/unknown.gif) | axali-2.xlsx | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | axali (1).xlsx | 2025-11-21 06:41 | 9.7K | |
![[ ]](/icons/layout.gif) | OSB14 Nikoloz Ivanauri Invitation Letter.pdf | 2025-11-21 06:41 | 51K | |
![[ ]](/icons/layout.gif) | Booking.pdf | 2025-11-21 06:41 | 228K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew.docx | 2025-11-21 06:41 | 37K | |
![[ ]](/icons/unknown.gif) | tata (5).docx | 2025-11-21 06:41 | 144K | |
![[IMG]](/icons/image2.gif) | image002 (242).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (968).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (967).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (966).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (620).png | 2025-11-21 06:41 | 101K | |
![[IMG]](/icons/image2.gif) | image001 (619).png | 2025-11-21 06:41 | 175K | |
![[IMG]](/icons/image2.gif) | image001 (618).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | forma 100 diag damateba.png | 2025-11-21 06:41 | 164K | |
![[IMG]](/icons/image2.gif) | fasis damateba da Senaxva.png | 2025-11-21 06:41 | 183K | |
![[IMG]](/icons/image2.gif) | error (26).png | 2025-11-21 06:41 | 258K | |
![[ ]](/icons/unknown.gif) | error (23).docx | 2025-11-21 06:41 | 213K | |
![[ ]](/icons/unknown.gif) | error (22).docx | 2025-11-21 06:41 | 213K | |
![[IMG]](/icons/image2.gif) | Untitled (44).png | 2025-11-21 06:41 | 151K | |
![[IMG]](/icons/image2.gif) | Reporting problem.png | 2025-11-21 06:41 | 125K | |
![[ ]](/icons/unknown.gif) | Klinikebis Dasakhelebebi da Kodebi EVEX GP05062014.xlsx | 2025-11-21 06:41 | 26K | |
![[IMG]](/icons/image2.gif) | sagarantio.jpg | 2025-11-21 06:41 | 138K | |
![[IMG]](/icons/image2.gif) | image002 (502).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (965).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (964).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (963).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (962).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (961).jpg | 2025-11-21 06:41 | 4.2K | |
![[ ]](/icons/unknown.gif) | SSA - საფინანსო (3).xlsx | 2025-11-21 06:41 | 10K | |
![[ ]](/icons/unknown.gif) | 444.xlsx | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | 36 cvlileba 08_04_14_.djvu | 2025-11-21 06:41 | 302K | |
![[ ]](/icons/unknown.gif) | ახალშობილთა და ბავშვთა სკრინინგი (1).xlsx | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | statusis agdgena.png | 2025-11-21 06:41 | 187K | |
![[ ]](/icons/unknown.gif) | nana dvalishvili (1).xlsx | 2025-11-21 06:41 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (501).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (617).png | 2025-11-21 06:41 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (616).png | 2025-11-21 06:41 | 185K | |
![[IMG]](/icons/image2.gif) | image001 (615).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (120).gif | 2025-11-21 06:41 | 32K | |
![[IMG]](/icons/image2.gif) | gauqmeba.png | 2025-11-21 06:41 | 172K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 13 ivnisi.docx | 2025-11-21 06:41 | 23K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_ (3).xlsx | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_ (2).xlsx | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | list.jpg | 2025-11-21 06:41 | 124K | |
![[IMG]](/icons/image2.gif) | image003 (209).png | 2025-11-21 06:41 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (500).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (499).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (498).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (497).jpg | 2025-11-21 06:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (960).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (614).png | 2025-11-21 06:41 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (613).png | 2025-11-21 06:41 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (612).png | 2025-11-21 06:41 | 164K | |
![[IMG]](/icons/image2.gif) | image001 (611).png | 2025-11-21 06:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (610).png | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (119).gif | 2025-11-21 06:41 | 3.5K | |
![[TXT]](/icons/text.gif) | Value cannot benull_(br)Parameter name source.htm | 2025-11-21 06:41 | 5.0K | |
![[ ]](/icons/unknown.gif) | New Technical Structure of the International Health Division | 2025-11-21 06:41 | 0 | |
![[ ]](/icons/unknown.gif) | Data Security Plan Training_June 2014.pptm | 2025-11-21 06:41 | 797K | |
![[ ]](/icons/unknown.gif) | Abt-IRB-201-Workshop-June 2014 Final.pptx | 2025-11-21 06:41 | 287K | |
![[ ]](/icons/unknown.gif) | Abt-IRB-101-Workshop-May14.pptx | 2025-11-21 06:41 | 191K | |
![[ ]](/icons/unknown.gif) | mary.docx | 2025-11-21 06:41 | 136K | |
![[IMG]](/icons/image2.gif) | image003 (155).jpg | 2025-11-21 06:41 | 20K | |
![[IMG]](/icons/image2.gif) | image003 (154).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (959).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (958).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (957).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (956).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | error (25).png | 2025-11-21 06:41 | 218K | |
![[ ]](/icons/unknown.gif) | Presentation1 (3).pptx | 2025-11-21 06:41 | 150K | |
![[ ]](/icons/unknown.gif) | Presentation1 (2).pptx | 2025-11-21 06:41 | 159K | |
![[ ]](/icons/layout.gif) | Platiojka_immobilliari.pdf | 2025-11-21 06:41 | 293K | |
![[ ]](/icons/unknown.gif) | ნანი მეგერლიძე.xlsx | 2025-11-21 06:41 | 9.4K | |
![[IMG]](/icons/image2.gif) | დავით მელაძე2.png | 2025-11-21 06:41 | 139K | |
![[IMG]](/icons/image2.gif) | დავით მელაძე1.png | 2025-11-21 06:41 | 135K | |
![[IMG]](/icons/image2.gif) | დავით მელაძე.png | 2025-11-21 06:41 | 188K | |
![[IMG]](/icons/image2.gif) | rehospitalizatoin.jpg | 2025-11-21 06:41 | 53K | |
![[IMG]](/icons/image2.gif) | image007 (20).jpg | 2025-11-21 06:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | image006 (44).jpg | 2025-11-21 06:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | image004 (90).jpg | 2025-11-21 06:41 | 15K | |
![[IMG]](/icons/image2.gif) | image002 (496).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (495).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (609).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (118).gif | 2025-11-21 06:41 | 32K | |
![[IMG]](/icons/image2.gif) | eror registracia.png | 2025-11-21 06:41 | 211K | |
![[ ]](/icons/unknown.gif) | avadmyofTa Semadgenloba stacion.xlsx | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 19-06.docx | 2025-11-21 06:41 | 23K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 19-06 (1).docx | 2025-11-21 06:41 | 15K | |
![[IMG]](/icons/image2.gif) | winning team.jpg | 2025-11-21 06:41 | 76K | |
![[IMG]](/icons/image2.gif) | image002 (494).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (955).jpg | 2025-11-21 06:41 | 6.8K | |
![[IMG]](/icons/image2.gif) | image001 (954).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (608).png | 2025-11-21 06:41 | 7.7K | |
![[IMG]](/icons/image2.gif) | error (1).jpg | 2025-11-21 06:41 | 182K | |
![[IMG]](/icons/image2.gif) | image011 (12).png | 2025-11-21 06:41 | 77K | |
![[IMG]](/icons/image2.gif) | image011 (11).png | 2025-11-21 06:41 | 77K | |
![[IMG]](/icons/image2.gif) | image010 (4).jpg | 2025-11-21 06:41 | 38K | |
![[IMG]](/icons/image2.gif) | image010 (3).jpg | 2025-11-21 06:41 | 38K | |
![[IMG]](/icons/image2.gif) | image009 (6).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image009 (5).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image008 (10).jpg | 2025-11-21 06:41 | 9.6K | |
![[IMG]](/icons/image2.gif) | image008 (9).jpg | 2025-11-21 06:41 | 9.6K | |
![[IMG]](/icons/image2.gif) | image007 (19).jpg | 2025-11-21 06:41 | 7.5K | |
![[IMG]](/icons/image2.gif) | image007 (18).jpg | 2025-11-21 06:41 | 7.5K | |
![[IMG]](/icons/image2.gif) | image004 (89).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (88).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (953).jpg | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (952).jpg | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (951).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (950).jpg | 2025-11-21 06:41 | 13K | |
![[ ]](/icons/unknown.gif) | PROGRAMULI XARVEZI.docx | 2025-11-21 06:41 | 351K | |
![[ ]](/icons/unknown.gif) | ATT43209 | 2025-11-21 06:41 | 0 | |
![[IMG]](/icons/image2.gif) | 123 (3).png | 2025-11-21 06:41 | 229K | |
![[IMG]](/icons/image2.gif) | image008 (11).png | 2025-11-21 06:41 | 77K | |
![[IMG]](/icons/image2.gif) | image008 (10).png | 2025-11-21 06:41 | 77K | |
![[IMG]](/icons/image2.gif) | image007 (21).png | 2025-11-21 06:41 | 77K | |
![[IMG]](/icons/image2.gif) | image007 (17).jpg | 2025-11-21 06:41 | 38K | |
![[IMG]](/icons/image2.gif) | image007 (16).jpg | 2025-11-21 06:41 | 38K | |
![[IMG]](/icons/image2.gif) | image006 (43).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image006 (42).jpg | 2025-11-21 06:41 | 38K | |
![[IMG]](/icons/image2.gif) | image006 (41).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image005 (48).jpg | 2025-11-21 06:41 | 9.6K | |
![[IMG]](/icons/image2.gif) | image005 (47).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image005 (46).jpg | 2025-11-21 06:41 | 9.6K | |
![[IMG]](/icons/image2.gif) | image004 (87).jpg | 2025-11-21 06:41 | 7.5K | |
![[IMG]](/icons/image2.gif) | image004 (86).jpg | 2025-11-21 06:41 | 9.6K | |
![[IMG]](/icons/image2.gif) | image004 (85).jpg | 2025-11-21 06:41 | 7.5K | |
![[IMG]](/icons/image2.gif) | image003 (153).jpg | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image003 (152).jpg | 2025-11-21 06:41 | 7.5K | |
![[IMG]](/icons/image2.gif) | image003 (151).jpg | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image002 (493).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (492).jpg | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image002 (491).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (241).png | 2025-11-21 06:41 | 8.1K | |
![[IMG]](/icons/image2.gif) | image001 (949).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (607).png | 2025-11-21 06:41 | 33K | |
![[ ]](/icons/unknown.gif) | Ncdc Contracts.xlsx | 2025-11-21 06:41 | 91K | |
![[IMG]](/icons/image2.gif) | May.jpg | 2025-11-21 06:41 | 93K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew 24-06.docx | 2025-11-21 06:41 | 23K | |
![[IMG]](/icons/image2.gif) | image007 (20).png | 2025-11-21 06:41 | 77K | |
![[IMG]](/icons/image2.gif) | image006 (40).jpg | 2025-11-21 06:41 | 38K | |
![[IMG]](/icons/image2.gif) | image005 (45).jpg | 2025-11-21 06:41 | 21K | |
![[IMG]](/icons/image2.gif) | image004 (84).jpg | 2025-11-21 06:41 | 9.6K | |
![[IMG]](/icons/image2.gif) | image003 (150).jpg | 2025-11-21 06:41 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (490).jpg | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image002 (489).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (948).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (947).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (946).jpg | 2025-11-21 06:41 | 3.1K | |
![[ ]](/icons/unknown.gif) | error (21).docx | 2025-11-21 06:41 | 198K | |
![[ ]](/icons/unknown.gif) | er Error in.docx | 2025-11-21 06:41 | 10K | |
![[ ]](/icons/unknown.gif) | Presentation1 (1).pptx | 2025-11-21 06:41 | 181K | |
![[IMG]](/icons/image2.gif) | კუჭუაშვილი.jpeg | 2025-11-21 06:41 | 443K | |
![[IMG]](/icons/image2.gif) | კუჭუაშვილი (1).jpeg | 2025-11-21 06:41 | 443K | |
![[ ]](/icons/unknown.gif) | validation-samxedro,onkohematologia15_05_ 2014.xls | 2025-11-21 06:41 | 81K | |
![[IMG]](/icons/image2.gif) | onkologia new.png | 2025-11-21 06:41 | 126K | |
![[IMG]](/icons/image2.gif) | image002 (488).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (945).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (944).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (943).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (942).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (941).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (606).png | 2025-11-21 06:41 | 583K | |
![[IMG]](/icons/image2.gif) | error (24).png | 2025-11-21 06:41 | 225K | |
![[ ]](/icons/unknown.gif) | Result(1).xls | 2025-11-21 06:41 | 19K | |
![[ ]](/icons/unknown.gif) | Letter of Health Dep - 25 06 2014.doc | 2025-11-21 06:41 | 71K | |
![[IMG]](/icons/image2.gif) | Lab old.png | 2025-11-21 06:41 | 130K | |
![[ ]](/icons/unknown.gif) | BillingTasksNew (2).docx | 2025-11-21 06:41 | 24K | |
![[ ]](/icons/unknown.gif) | 3.docx | 2025-11-21 06:41 | 253K | |
![[IMG]](/icons/image2.gif) | shablo.png | 2025-11-21 06:41 | 198K | |
![[ ]](/icons/unknown.gif) | nana dvalishvili.xlsx | 2025-11-21 06:41 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (487).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (940).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (605).png | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | User management fields 1 (4).xlsx | 2025-11-21 06:41 | 12K | |
![[ ]](/icons/unknown.gif) | Online Global Health Courses.docx | 2025-11-21 06:41 | 37K | |
![[IMG]](/icons/image2.gif) | N3.jpg | 2025-11-21 06:41 | 202K | |
![[IMG]](/icons/image2.gif) | N2.jpg | 2025-11-21 06:41 | 226K | |
![[IMG]](/icons/image2.gif) | N1.png | 2025-11-21 06:41 | 77K | |
![[ ]](/icons/unknown.gif) | ATT99931 | 2025-11-21 06:41 | 0 | |
![[ ]](/icons/unknown.gif) | 5.docx | 2025-11-21 06:41 | 366K | |
![[ ]](/icons/unknown.gif) | ახალშობილთა და ბავშვთა სკრინინგი.xlsx | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (24).jpg | 2025-11-21 06:41 | 823 | |
![[IMG]](/icons/image2.gif) | image002 (486).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (485).jpg | 2025-11-21 06:41 | 823 | |
![[IMG]](/icons/image2.gif) | image002 (484).jpg | 2025-11-21 06:41 | 823 | |
![[IMG]](/icons/image2.gif) | image002 (483).jpg | 2025-11-21 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (939).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (938).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (937).jpg | 2025-11-21 06:41 | 6.8K | |
![[IMG]](/icons/image2.gif) | image001 (936).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (935).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (934).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (933).jpg | 2025-11-21 06:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (604).png | 2025-11-21 06:41 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (603).png | 2025-11-21 06:41 | 7.7K | |
![[ ]](/icons/unknown.gif) | ERROR SAKEISRO.docx | 2025-11-21 06:41 | 131K | |
![[TXT]](/icons/text.gif) | ATT00001 (9).htm | 2025-11-21 06:41 | 168 | |
![[IMG]](/icons/image2.gif) | პორტალი (1).png | 2025-11-21 06:41 | 359K | |
![[ ]](/icons/unknown.gif) | გასაგზავნი თამთას (3).xlsx | 2025-11-21 06:41 | 12K | |
![[ ]](/icons/unknown.gif) | tatas.docx | 2025-11-21 06:41 | 167K | |
![[ ]](/icons/unknown.gif) | server error (1).docx | 2025-11-21 06:41 | 141K | |
![[IMG]](/icons/image2.gif) | image002 (482).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (481).jpg | 2025-11-21 06:41 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (602).png | 2025-11-21 06:41 | 188K | |
![[IMG]](/icons/image2.gif) | image001 (601).png | 2025-11-21 06:41 | 186K | |
![[IMG]](/icons/image2.gif) | image001 (600).png | 2025-11-21 06:41 | 11K | |
![[ ]](/icons/unknown.gif) | error 3.docx | 2025-11-21 06:41 | 133K | |
![[ ]](/icons/unknown.gif) | error 2.docx | 2025-11-21 06:41 | 149K | |
![[ ]](/icons/unknown.gif) | error (20).docx | 2025-11-21 06:41 | 223K | |
![[ ]](/icons/unknown.gif) | error (19).docx | 2025-11-21 06:41 | 189K | |
![[ ]](/icons/unknown.gif) | error (18).docx | 2025-11-21 06:41 | 176K | |
![[IMG]](/icons/image2.gif) | Untitled (43).png | 2025-11-21 06:41 | 115K | |
![[ ]](/icons/unknown.gif) | Letter to SSA_KT edits.doc | 2025-11-21 06:41 | 81K | |
![[ ]](/icons/unknown.gif) | Letter to SSA_KT edits (1).doc | 2025-11-21 06:41 | 86K | |
![[ ]](/icons/unknown.gif) | Error შეტყობინებაში.docx | 2025-11-21 06:41 | 191K | |
![[ ]](/icons/unknown.gif) | Error ანგარიშგებაში.docx | 2025-11-21 06:41 | 192K | |
![[ ]](/icons/unknown.gif) | Erorr.docx | 2025-11-21 06:41 | 200K | |
![[ ]](/icons/unknown.gif) | Drawing2.vsd | 2025-11-21 06:41 | 747K | |
![[ ]](/icons/unknown.gif) | Doc1 (4).docx | 2025-11-21 06:41 | 144K | |
![[ ]](/icons/unknown.gif) | Diagrams and fields of neccessasy fields - Vital Registration.vsd | 2025-11-21 06:41 | 706K | |
![[ ]](/icons/unknown.gif) | 17723 Kenya NHIS.docx | 2025-11-21 06:41 | 24K | |
![[IMG]](/icons/image2.gif) | image002 (480).jpg | 2025-11-21 06:40 | 8.6K | |
![[IMG]](/icons/image2.gif) | image001 (932).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (931).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (930).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (929).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (928).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (927).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (926).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (925).jpg | 2025-11-21 06:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (924).jpg | 2025-11-21 06:40 | 4.2K | |
![[ ]](/icons/unknown.gif) | hosts | 2025-11-21 06:40 | 2.5K | |
![[ ]](/icons/unknown.gif) | error_.docx | 2025-11-21 06:40 | 12K | |
![[ ]](/icons/layout.gif) | Vital Registration.pdf | 2025-11-21 06:40 | 326K | |
![[ ]](/icons/unknown.gif) | Presentation1.pptx | 2025-11-21 06:40 | 228K | |
![[ ]](/icons/unknown.gif) | Book3.xlsx | 2025-11-21 06:40 | 117K | |
![[ ]](/icons/unknown.gif) | Book2 (2).xlsx | 2025-11-21 06:40 | 119K | |
![[ ]](/icons/unknown.gif) | Book1 (6).xlsx | 2025-11-21 06:40 | 132K | |
![[IMG]](/icons/image2.gif) | region_June (1).jpg | 2025-11-21 06:40 | 71K | |
![[IMG]](/icons/image2.gif) | image002 (479).jpg | 2025-11-21 06:40 | 52K | |
![[IMG]](/icons/image2.gif) | image001 (923).jpg | 2025-11-21 06:40 | 35K | |
![[IMG]](/icons/image2.gif) | facilities (1).jpg | 2025-11-21 06:40 | 63K | |
![[ ]](/icons/unknown.gif) | error (1) (1).docx | 2025-11-21 06:40 | 105K | |
![[IMG]](/icons/image2.gif) | Screenshot 2014-07-02 13_36_29.png | 2025-11-21 06:40 | 92K | |
![[ ]](/icons/unknown.gif) | AbtKnowledge screenshots.docx | 2025-11-21 06:40 | 937K | |
![[IMG]](/icons/image2.gif) | 10434220_732590996783989_4629008425352017283_n.jpg | 2025-11-21 06:40 | 52K | |
![[IMG]](/icons/image2.gif) | ფპ ლელა ხუმარაშვილი.png | 2025-11-21 06:40 | 159K | |
![[IMG]](/icons/image2.gif) | დდ.png | 2025-11-21 06:40 | 116K | |
![[IMG]](/icons/image2.gif) | region_June.jpg | 2025-11-21 06:40 | 71K | |
![[IMG]](/icons/image2.gif) | image004 (100).png | 2025-11-21 06:40 | 202K | |
![[IMG]](/icons/image2.gif) | image003 (208).png | 2025-11-21 06:40 | 337K | |
![[IMG]](/icons/image2.gif) | image003 (207).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image003 (149).jpg | 2025-11-21 06:40 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (478).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (240).png | 2025-11-21 06:40 | 199K | |
![[IMG]](/icons/image2.gif) | image001 (922).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (599).png | 2025-11-21 06:40 | 186K | |
![[IMG]](/icons/image2.gif) | image001 (598).png | 2025-11-21 06:40 | 91K | |
![[IMG]](/icons/image2.gif) | image001 (597).png | 2025-11-21 06:40 | 82K | |
![[IMG]](/icons/image2.gif) | image001 (596).png | 2025-11-21 06:40 | 82K | |
![[IMG]](/icons/image2.gif) | image001 (595).png | 2025-11-21 06:40 | 185K | |
![[IMG]](/icons/image2.gif) | image001 (594).png | 2025-11-21 06:40 | 57K | |
![[IMG]](/icons/image2.gif) | facilities.jpg | 2025-11-21 06:40 | 63K | |
![[ ]](/icons/unknown.gif) | error (16).docx | 2025-11-21 06:40 | 159K | |
![[ ]](/icons/unknown.gif) | axali.xlsx | 2025-11-21 06:40 | 10K | |
![[ ]](/icons/unknown.gif) | Error (17).docx | 2025-11-21 06:40 | 139K | |
![[ ]](/icons/unknown.gif) | ATT72296 | 2025-11-21 06:40 | 0 | |
![[ ]](/icons/unknown.gif) | ATT46857 | 2025-11-21 06:40 | 0 | |
![[ ]](/icons/unknown.gif) | 01_06_2014 - 30_06_2014 ყველა შემთხვევა.xlsx | 2025-11-21 06:40 | 138K | |
![[ ]](/icons/unknown.gif) | 01_06_2014 - 30_06_2014 დაკავშირებული შემთხვევები.xlsx | 2025-11-21 06:40 | 48K | |
![[ ]](/icons/unknown.gif) | იუზერები.xlsx | 2025-11-21 06:40 | 12K | |
![[ ]](/icons/unknown.gif) | იუზერები (1).xlsx | 2025-11-21 06:40 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (83).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (477).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (921).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (593).png | 2025-11-21 06:40 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (592).png | 2025-11-21 06:40 | 138K | |
![[ ]](/icons/unknown.gif) | form 025.xls | 2025-11-21 06:40 | 21K | |
![[ ]](/icons/unknown.gif) | error (15).docx | 2025-11-21 06:40 | 159K | |
![[ ]](/icons/unknown.gif) | Copy of SJC-ები და მათი სამოქმედო არეალები_4 06 14_TG_.xlsx | 2025-11-21 06:40 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (920).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (919).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (918).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (917).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (916).jpg | 2025-11-21 06:40 | 4.2K | |
![[ ]](/icons/unknown.gif) | form 025_Control.xls | 2025-11-21 06:40 | 36K | |
![[ ]](/icons/unknown.gif) | form 025_Control (1).xls | 2025-11-21 06:40 | 36K | |
![[ ]](/icons/unknown.gif) | Book2 (1).xlsx | 2025-11-21 06:40 | 7.3M | |
![[ ]](/icons/unknown.gif) | სჯც.xlsx | 2025-11-21 06:40 | 30K | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალების მოდული - Version 1 2.docx | 2025-11-21 06:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | image006 (25).png | 2025-11-21 06:40 | 77K | |
![[IMG]](/icons/image2.gif) | image005 (44).jpg | 2025-11-21 06:40 | 38K | |
![[IMG]](/icons/image2.gif) | image004 (82).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (148).jpg | 2025-11-21 06:40 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (476).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (475).jpg | 2025-11-21 06:40 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (915).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (914).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (913).jpg | 2025-11-21 06:40 | 7.5K | |
![[ ]](/icons/unknown.gif) | eqimi - eqtani.xlsx | 2025-11-21 06:40 | 13K | |
![[ ]](/icons/unknown.gif) | N10-11_12_13_xlsx-4 - დიაბეტის მართვა.xlsx | 2025-11-21 06:40 | 13K | |
![[ ]](/icons/unknown.gif) | N10-11_12_13_xlsx-2 - ფსიქიკური ჯანმრთელოაბ.xlsx | 2025-11-21 06:40 | 13K | |
![[ ]](/icons/unknown.gif) | N10-11_12_13_xlsx - ნარკომანია.xlsx | 2025-11-21 06:40 | 12K | |
![[ ]](/icons/unknown.gif) | HSSP Monthly Progress Report_June 2014.docx | 2025-11-21 06:40 | 24K | |
![[ ]](/icons/unknown.gif) | Book1 (5).xlsx | 2025-11-21 06:40 | 13K | |
![[ ]](/icons/unknown.gif) | ATT00428 | 2025-11-21 06:40 | 0 | |
![[IMG]](/icons/image2.gif) | ხელთუფლიშვილი ფორმა100.JPG | 2025-11-21 06:40 | 25K | |
![[IMG]](/icons/image2.gif) | ხელთუფლიშვილი რეკვიზიტი.JPG | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | მამულაშვილი ფორმა100.JPG | 2025-11-21 06:40 | 50K | |
![[IMG]](/icons/image2.gif) | მამულაშვილი რეკვიზიტ_.JPG | 2025-11-21 06:40 | 65K | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალების მოდული - Tatas Revision.docx | 2025-11-21 06:40 | 1.6M | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალების მოდული - ბოლო.docx | 2025-11-21 06:40 | 1.0M | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალების მოდული - ბოლო-ქეთის კომენტარებით.docx | 2025-11-21 06:40 | 1.1M | |
![[IMG]](/icons/image2.gif) | გუნიავა ფორმა 100.JPG | 2025-11-21 06:40 | 42K | |
![[IMG]](/icons/image2.gif) | გუნიავა რეკვიზიტ.JPG | 2025-11-21 06:40 | 63K | |
![[ ]](/icons/unknown.gif) | tubis xelshewyobis forma (1).xlsx | 2025-11-21 06:40 | 12K | |
![[IMG]](/icons/image2.gif) | image015 (5).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image014 (6).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image013 (4).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image012 (9).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image011 (10).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image010 (13).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image009 (11).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image008 (8).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image007 (15).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image006 (39).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image006 (24).png | 2025-11-21 06:40 | 77K | |
![[IMG]](/icons/image2.gif) | image005 (57).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image005 (43).jpg | 2025-11-21 06:40 | 38K | |
![[IMG]](/icons/image2.gif) | image004 (99).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image004 (81).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (206).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (147).jpg | 2025-11-21 06:40 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (474).jpg | 2025-11-21 06:40 | 9.6K | |
![[IMG]](/icons/image2.gif) | image002 (239).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image001 (912).jpg | 2025-11-21 06:40 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (911).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (910).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (909).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (591).png | 2025-11-21 06:40 | 54K | |
![[IMG]](/icons/image2.gif) | image001 (117).gif | 2025-11-21 06:40 | 96 | |
![[ ]](/icons/unknown.gif) | err (1).docx | 2025-11-21 06:40 | 184K | |
![[ ]](/icons/unknown.gif) | Screens for Vital Registration.rar | 2025-11-21 06:40 | 486K | |
![[ ]](/icons/unknown.gif) | N25-sh_qartlis soflebisganvitarebis forma (1).xlsx | 2025-11-21 06:40 | 17K | |
![[IMG]](/icons/image2.gif) | ~WRD102.jpg | 2025-11-21 06:40 | 823 | |
![[IMG]](/icons/image2.gif) | probl_.jpeg | 2025-11-21 06:40 | 574K | |
![[IMG]](/icons/image2.gif) | image007 (14).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image006 (38).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image005 (56).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (98).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image003 (205).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (238).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image001 (908).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (907).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (906).jpg | 2025-11-21 06:40 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (116).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (115).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (114).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (113).gif | 2025-11-21 06:40 | 96 | |
![[ ]](/icons/unknown.gif) | err 2.docx | 2025-11-21 06:40 | 176K | |
![[ ]](/icons/unknown.gif) | Sachkhere.xlsx | 2025-11-21 06:40 | 10K | |
![[ ]](/icons/unknown.gif) | Patch - Template (1).sql | 2025-11-21 06:40 | 3.8K | |
![[ ]](/icons/unknown.gif) | Patch - Patch 1.sql | 2025-11-21 06:40 | 3.9K | |
![[ ]](/icons/unknown.gif) | ImunoPack - SJC (2).xlsx | 2025-11-21 06:40 | 25K | |
![[ ]](/icons/unknown.gif) | ImunoPack - SJC (1).xlsx | 2025-11-21 06:40 | 25K | |
![[ ]](/icons/unknown.gif) | ვერტიკალური პროვაიდერების მომხარებლები პროგრამის მიხედვით.xlsx | 2025-11-21 06:40 | 243K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (23).jpg | 2025-11-21 06:40 | 823 | |
![[ ]](/icons/unknown.gif) | indicators.xlsx | 2025-11-21 06:40 | 23K | |
![[ ]](/icons/unknown.gif) | immunopack.rar | 2025-11-21 06:40 | 4.3M | |
![[IMG]](/icons/image2.gif) | image004 (80).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (204).png | 2025-11-21 06:40 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (203).png | 2025-11-21 06:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | image002 (473).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (472).jpg | 2025-11-21 06:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (471).jpg | 2025-11-21 06:40 | 15K | |
![[IMG]](/icons/image2.gif) | image002 (237).png | 2025-11-21 06:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (905).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (904).jpg | 2025-11-21 06:40 | 99K | |
![[IMG]](/icons/image2.gif) | image001 (903).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (590).png | 2025-11-21 06:40 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (589).png | 2025-11-21 06:40 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (588).png | 2025-11-21 06:40 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (587).png | 2025-11-21 06:40 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (112).gif | 2025-11-21 06:40 | 32K | |
![[ ]](/icons/unknown.gif) | ReferalsTransactions.xlsx | 2025-11-21 06:40 | 11K | |
![[ ]](/icons/unknown.gif) | Patch - Template.sql | 2025-11-21 06:40 | 3.9K | |
![[ ]](/icons/unknown.gif) | ImunoPack - SJC.xlsx | 2025-11-21 06:40 | 24K | |
![[IMG]](/icons/image2.gif) | 20140709_100952.jpg | 2025-11-21 06:40 | 5.1M | |
![[ ]](/icons/unknown.gif) | ფინანსური მოდული (5).xlsx | 2025-11-21 06:40 | 9.6M | |
![[ ]](/icons/unknown.gif) | სპეციალობები ბოლო ახალ.doc | 2025-11-21 06:40 | 151K | |
![[ ]](/icons/unknown.gif) | სპეციალობები ბოლო ახალ (1).doc | 2025-11-21 06:40 | 151K | |
![[ ]](/icons/unknown.gif) | სპეციალობათა ნუსხა 2014.rtf | 2025-11-21 06:40 | 567K | |
![[ ]](/icons/unknown.gif) | სპეციალობათა ნუსხა 2014 (1).rtf | 2025-11-21 06:40 | 567K | |
![[IMG]](/icons/image2.gif) | ssssssss.jpg | 2025-11-21 06:40 | 161K | |
![[IMG]](/icons/image2.gif) | server error.psd | 2025-11-21 06:40 | 870K | |
![[ ]](/icons/unknown.gif) | info2.xlsx | 2025-11-21 06:40 | 10K | |
![[ ]](/icons/unknown.gif) | info1.xlsx | 2025-11-21 06:40 | 26K | |
![[IMG]](/icons/image2.gif) | image003 (202).png | 2025-11-21 06:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (902).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (586).png | 2025-11-21 06:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (585).png | 2025-11-21 06:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (584).png | 2025-11-21 06:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (583).png | 2025-11-21 06:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (582).png | 2025-11-21 06:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (581).png | 2025-11-21 06:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (580).png | 2025-11-21 06:40 | 8.5K | |
![[ ]](/icons/unknown.gif) | Vital Registration Module-ENG_KT edits.docx | 2025-11-21 06:40 | 744K | |
![[ ]](/icons/unknown.gif) | Doc1 (3).docx | 2025-11-21 06:40 | 96K | |
![[ ]](/icons/unknown.gif) | DHIS 2.docx | 2025-11-21 06:40 | 17K | |
![[ ]](/icons/unknown.gif) | Copy of ფორმა#1-8.xlsx | 2025-11-21 06:40 | 16K | |
![[ ]](/icons/unknown.gif) | აცრების ბარათი - 2 ნაწილი.xlsx | 2025-11-21 06:40 | 16K | |
![[ ]](/icons/unknown.gif) | აცრების ბარათი - 1 ნაწილი.xlsx | 2025-11-21 06:40 | 15K | |
![[ ]](/icons/unknown.gif) | toxycology analysis - A05_9, T61, T62 და T64.xlsx | 2025-11-21 06:40 | 33K | |
![[IMG]](/icons/image2.gif) | image015 (4).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image014 (5).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image013 (3).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image012 (8).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image011 (9).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image010 (12).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image009 (10).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image008 (7).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image007 (13).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image007 (12).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image006 (37).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image006 (36).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image005 (55).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image005 (54).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (97).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image004 (96).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image003 (201).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (200).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (236).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image002 (235).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image001 (901).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (900).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (899).jpg | 2025-11-21 06:40 | 2.8K | |
![[ ]](/icons/unknown.gif) | User management fields 1 (3).xlsx | 2025-11-21 06:40 | 12K | |
![[ ]](/icons/unknown.gif) | Untitled (51) | 2025-11-21 06:40 | 2 | |
![[ ]](/icons/unknown.gif) | Toxycology Analysis.xlsx | 2025-11-21 06:40 | 21K | |
![[IMG]](/icons/image2.gif) | Tarigi.bmp | 2025-11-21 06:40 | 1.7M | |
![[ ]](/icons/unknown.gif) | ფინანსური მოდული (4).xlsx | 2025-11-21 06:40 | 9.6M | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_.xlsx | 2025-11-21 06:40 | 13K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_ (1).xlsx | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image015 (3).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image014 (4).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image013 (2).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image012 (7).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image011 (8).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image010 (11).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image009 (9).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image008 (6).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image002 (470).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (898).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (897).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (896).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (895).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (579).png | 2025-11-21 06:40 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (111).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (110).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (109).gif | 2025-11-21 06:40 | 96 | |
![[ ]](/icons/unknown.gif) | User management fields 1 (2).xlsx | 2025-11-21 06:40 | 12K | |
![[ ]](/icons/unknown.gif) | User management fields 1 (1).xlsx | 2025-11-21 06:40 | 12K | |
![[ ]](/icons/unknown.gif) | Problem Contracts (2).xlsx | 2025-11-21 06:40 | 8.9K | |
![[ ]](/icons/unknown.gif) | ExportedValidaData.xlsx | 2025-11-21 06:40 | 173K | |
![[ ]](/icons/unknown.gif) | ExportedInvalidPatients.xlsx | 2025-11-21 06:40 | 66K | |
![[ ]](/icons/unknown.gif) | ფსიქიატრია სტაციონარი - ხელოვნური კოდები.xlsx | 2025-11-21 06:40 | 12K | |
![[ ]](/icons/unknown.gif) | ფინანსური მოდული (3).xlsx | 2025-11-21 06:40 | 9.0M | |
![[IMG]](/icons/image2.gif) | image001 (894).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (893).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (892).jpg | 2025-11-21 06:40 | 4.2K | |
![[ ]](/icons/unknown.gif) | Task Checklist (2).xlsx | 2025-11-21 06:40 | 14K | |
![[ ]](/icons/unknown.gif) | Task Checklist (1).xlsx | 2025-11-21 06:40 | 14K | |
![[ ]](/icons/unknown.gif) | Book2.xlsx | 2025-11-21 06:40 | 7.7M | |
![[ ]](/icons/unknown.gif) | tubis xelshewyobis forma.xlsx | 2025-11-21 06:40 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (146).jpg | 2025-11-21 06:40 | 22K | |
![[IMG]](/icons/image2.gif) | image002 (469).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (468).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (891).jpg | 2025-11-21 06:40 | 3.9K | |
![[IMG]](/icons/image2.gif) | image001 (890).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (578).png | 2025-11-21 06:40 | 188K | |
![[IMG]](/icons/image2.gif) | image001 (577).png | 2025-11-21 06:40 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (576).png | 2025-11-21 06:40 | 32K | |
![[ ]](/icons/unknown.gif) | User management fields 2 -Copy.xlsx | 2025-11-21 06:40 | 12K | |
![[ ]](/icons/unknown.gif) | User management fields 1.xlsx | 2025-11-21 06:40 | 12K | |
![[ ]](/icons/unknown.gif) | Untitled (50) | 2025-11-21 06:40 | 2 | |
![[ ]](/icons/unknown.gif) | Statistics for July 7 - July 13.xlsx | 2025-11-21 06:40 | 57K | |
![[ ]](/icons/unknown.gif) | SJC list for TATA.xlsx | 2025-11-21 06:40 | 13K | |
![[ ]](/icons/unknown.gif) | SJC list for NCDC.xlsx | 2025-11-21 06:40 | 11K | |
![[ ]](/icons/unknown.gif) | Problem Contracts (1).xlsx | 2025-11-21 06:40 | 8.9K | |
![[ ]](/icons/unknown.gif) | N26 _ სასწრაფოს ფორმა (საჭირო ღონისძიებები).xlsx | 2025-11-21 06:40 | 17K | |
![[ ]](/icons/unknown.gif) | N25-sh_qartlis soflebisganvitarebis forma.xlsx | 2025-11-21 06:40 | 19K | |
![[ ]](/icons/unknown.gif) | AddrGetRootNodeResponse.xml | 2025-11-21 06:40 | 2.3K | |
![[ ]](/icons/unknown.gif) | AddrGetRootNode.xml | 2025-11-21 06:40 | 1.9K | |
![[ ]](/icons/unknown.gif) | AddrGetNodesByParentIDResponse.xml | 2025-11-21 06:40 | 6.6K | |
![[ ]](/icons/unknown.gif) | AddrGetNodesByParentID.xml | 2025-11-21 06:40 | 1.9K | |
![[ ]](/icons/unknown.gif) | AddrGetAddressInfoByIDResponse.xml | 2025-11-21 06:40 | 960 | |
![[ ]](/icons/unknown.gif) | AddrGetAddressInfoByID.xml | 2025-11-21 06:40 | 1.9K | |
![[ ]](/icons/unknown.gif) | AddrGetAddressByIDResponse.xml | 2025-11-21 06:40 | 693 | |
![[ ]](/icons/unknown.gif) | AddrGetAddressByID.xml | 2025-11-21 06:40 | 1.9K | |
![[ ]](/icons/unknown.gif) | AddrFindeAddressByNameResponse.xml | 2025-11-21 06:40 | 1.3K | |
![[ ]](/icons/unknown.gif) | AddrFindeAddressByName.xml | 2025-11-21 06:40 | 2.0K | |
![[IMG]](/icons/image2.gif) | 10547443_308001066036083_8107418752672089100_n.jpg | 2025-11-21 06:40 | 158K | |
![[ ]](/icons/unknown.gif) | დიალიზის მომხმარებლები.docx | 2025-11-21 06:40 | 15K | |
![[IMG]](/icons/image2.gif) | image015 (2).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image014 (3).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image013 (1).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image012 (6).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image011 (7).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image010 (10).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image009 (8).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image008 (5).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (889).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (888).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (887).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (886).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (575).png | 2025-11-21 06:40 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (574).png | 2025-11-21 06:40 | 191K | |
![[IMG]](/icons/image2.gif) | image001 (573).png | 2025-11-21 06:40 | 182K | |
![[ ]](/icons/unknown.gif) | User management fields 3 -Copy.xlsx | 2025-11-21 06:40 | 12K | |
![[IMG]](/icons/image2.gif) | Untitled (42).png | 2025-11-21 06:40 | 179K | |
![[ ]](/icons/unknown.gif) | Copy of Xl0000165.xls | 2025-11-21 06:40 | 34K | |
![[ ]](/icons/unknown.gif) | სჯც(User-Pass).xlsx | 2025-11-21 06:40 | 33K | |
![[ ]](/icons/unknown.gif) | დიალიზის მომხმარებლები 1.docx | 2025-11-21 06:40 | 13K | |
![[ ]](/icons/unknown.gif) | web services - სამედიცინო შემთხვევების რეგისტრაციის მოდული (CRM) v1_0 (1).docx | 2025-11-21 06:40 | 132K | |
![[IMG]](/icons/image2.gif) | image007 (11).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image006 (35).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image005 (53).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (95).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image003 (199).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (234).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image001 (885).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (884).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (883).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (882).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (881).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (880).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (879).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | error 1.PNG | 2025-11-21 06:40 | 81K | |
![[ ]](/icons/unknown.gif) | User management fields (19).xlsx | 2025-11-21 06:40 | 10K | |
![[ ]](/icons/unknown.gif) | User management fields (2) (1).xlsx | 2025-11-21 06:40 | 11K | |
![[ ]](/icons/unknown.gif) | List of SJCs users and pass.xlsx | 2025-11-21 06:40 | 24K | |
![[ ]](/icons/unknown.gif) | სანიმუშო დოკუმენტი (1).docx | 2025-11-21 06:40 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (878).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (877).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (876).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (875).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (874).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (873).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (872).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (871).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (870).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (869).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (572).png | 2025-11-21 06:40 | 134K | |
![[IMG]](/icons/image2.gif) | image001 (571).png | 2025-11-21 06:40 | 191K | |
![[ ]](/icons/unknown.gif) | Untitled (49) | 2025-11-21 06:40 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (48) | 2025-11-21 06:40 | 0 | |
![[IMG]](/icons/image2.gif) | Hitler-car.jpg | 2025-11-21 06:40 | 379K | |
![[IMG]](/icons/image2.gif) | image003 (198).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image003 (145).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (144).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (467).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (466).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (233).png | 2025-11-21 06:40 | 451K | |
![[IMG]](/icons/image2.gif) | image002 (232).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image002 (231).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image002 (230).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image002 (229).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image001 (868).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (867).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (866).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (865).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (864).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (863).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (862).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (861).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (570).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | 10494585_4309101062696_1211880583616147264_n.jpg | 2025-11-21 06:40 | 70K | |
![[IMG]](/icons/image2.gif) | image005 (52).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image004 (79).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (197).png | 2025-11-21 06:40 | 287K | |
![[IMG]](/icons/image2.gif) | image003 (196).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image002 (465).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (228).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image002 (227).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image002 (226).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image002 (225).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image002 (224).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image001 (860).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (859).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (858).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (857).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (856).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (569).png | 2025-11-21 06:40 | 287K | |
![[IMG]](/icons/image2.gif) | Sigmund_Freud_LIFE.jpg | 2025-11-21 06:40 | 27K | |
![[ ]](/icons/unknown.gif) | tata (4).docx | 2025-11-21 06:40 | 145K | |
![[IMG]](/icons/image2.gif) | kaklulaciaze diagnozisredaqtirebis dros-axali diagnozis damatebis dros.png | 2025-11-21 06:40 | 167K | |
![[IMG]](/icons/image2.gif) | image002 (464).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (223).png | 2025-11-21 06:40 | 948K | |
![[IMG]](/icons/image2.gif) | image001 (855).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (568).png | 2025-11-21 06:40 | 7.7K | |
![[IMG]](/icons/image2.gif) | dublikatshi rekvizitebis gverdisshenaxvis dros.png | 2025-11-21 06:40 | 181K | |
![[ ]](/icons/layout.gif) | broshura_3.pdf | 2025-11-21 06:40 | 4.2M | |
![[ ]](/icons/unknown.gif) | N7 specialuri forma.xls | 2025-11-21 06:40 | 28K | |
![[IMG]](/icons/image2.gif) | FORMA100-SHENAXVA.png | 2025-11-21 06:40 | 184K | |
![[ ]](/icons/unknown.gif) | ATT33276 | 2025-11-21 06:40 | 0 | |
![[ ]](/icons/unknown.gif) | subspecialistebi.xls | 2025-11-21 06:40 | 32M | |
![[IMG]](/icons/image2.gif) | kalkulaciis gverdze icddamatebis dros.png | 2025-11-21 06:40 | 172K | |
![[IMG]](/icons/image2.gif) | kalkulaciaze shevcvaleklinika.png | 2025-11-21 06:40 | 186K | |
![[IMG]](/icons/image2.gif) | image016 (1).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image015 (1).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image014 (2).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image013 (3).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image012 (5).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image011 (6).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image010 (9).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image002 (463).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (854).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | forma 100 shenaxva.png | 2025-11-21 06:40 | 181K | |
![[IMG]](/icons/image2.gif) | ar aris saqartvelos moqalaqe.png | 2025-11-21 06:40 | 251K | |
![[IMG]](/icons/image2.gif) | 3 icd10.png | 2025-11-21 06:40 | 185K | |
![[ ]](/icons/unknown.gif) | სენსიტიური 60 კაცი, ვისაც პირადობა არასწორად ჰქონდა მითითებული.xls | 2025-11-21 06:40 | 49K | |
![[ ]](/icons/unknown.gif) | რეზისტენტული გასწორებულები 78 კაცის სია 85-დან რაც გამოაგზავნეთ.xls | 2025-11-21 06:40 | 62K | |
![[ ]](/icons/unknown.gif) | tata (3).docx | 2025-11-21 06:40 | 182K | |
![[IMG]](/icons/image2.gif) | image015.jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image014 (1).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image013.jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image012 (4).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image011 (5).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image010 (8).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image009 (7).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image008 (4).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image007 (10).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image006 (34).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image005 (51).png | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image004 (94).png | 2025-11-21 06:40 | 1.9K | |
![[IMG]](/icons/image2.gif) | image003 (195).png | 2025-11-21 06:40 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (462).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (222).png | 2025-11-21 06:40 | 64K | |
![[IMG]](/icons/image2.gif) | image001 (853).jpg | 2025-11-21 06:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | image001 (852).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (851).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (567).png | 2025-11-21 06:40 | 736K | |
![[IMG]](/icons/image2.gif) | Error (23).png | 2025-11-21 06:40 | 168K | |
![[IMG]](/icons/image2.gif) | 6 (1).png | 2025-11-21 06:40 | 183K | |
![[IMG]](/icons/image2.gif) | 5.png | 2025-11-21 06:40 | 235K | |
![[IMG]](/icons/image2.gif) | 4 (6).png | 2025-11-21 06:40 | 189K | |
![[IMG]](/icons/image2.gif) | 3 (9).png | 2025-11-21 06:40 | 194K | |
![[IMG]](/icons/image2.gif) | 2 (17).png | 2025-11-21 06:40 | 181K | |
![[IMG]](/icons/image2.gif) | 1 (20).png | 2025-11-21 06:40 | 195K | |
![[ ]](/icons/unknown.gif) | ივლისის თვის რეზისტენტულები 8 პირის მონაცემების გამოკლებით.xls | 2025-11-21 06:40 | 55K | |
![[IMG]](/icons/image2.gif) | image005 (42).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (93).png | 2025-11-21 06:40 | 736K | |
![[IMG]](/icons/image2.gif) | image003 (194).png | 2025-11-21 06:40 | 243K | |
![[IMG]](/icons/image2.gif) | image003 (193).png | 2025-11-21 06:40 | 49K | |
![[IMG]](/icons/image2.gif) | image003 (192).png | 2025-11-21 06:40 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (143).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (461).jpg | 2025-11-21 06:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (460).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (221).png | 2025-11-21 06:40 | 736K | |
![[IMG]](/icons/image2.gif) | image002 (220).png | 2025-11-21 06:40 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (219).png | 2025-11-21 06:40 | 49K | |
![[IMG]](/icons/image2.gif) | image001 (850).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (566).png | 2025-11-21 06:40 | 243K | |
![[IMG]](/icons/image2.gif) | image001 (565).png | 2025-11-21 06:40 | 30K | |
![[ ]](/icons/unknown.gif) | Task Checklist.xlsx | 2025-11-21 06:40 | 14K | |
![[ ]](/icons/unknown.gif) | ATT76579 | 2025-11-21 06:40 | 0 | |
![[TXT]](/icons/text.gif) | ATT00001 (8).htm | 2025-11-21 06:40 | 92 | |
![[IMG]](/icons/image2.gif) | 10013642_10201123241282551_2094232802421058342_n.jpg | 2025-11-21 06:40 | 23K | |
![[ ]](/icons/unknown.gif) | ჩარიცხვის რეკვიზიტები_ EUR.doc | 2025-11-21 06:40 | 104K | |
![[ ]](/icons/unknown.gif) | სენსიტიური თელი ქვეყანა, გადამოწმებული ივლისი21,07,2014.xls | 2025-11-21 06:40 | 176K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (22).jpg | 2025-11-21 06:40 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (849).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (848).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (564).png | 2025-11-21 06:40 | 204K | |
![[IMG]](/icons/image2.gif) | image001 (108).gif | 2025-11-21 06:40 | 96 | |
![[ ]](/icons/unknown.gif) | error (14).docx | 2025-11-21 06:40 | 210K | |
![[ ]](/icons/unknown.gif) | Doc1 (2).docx | 2025-11-21 06:40 | 162K | |
![[IMG]](/icons/image2.gif) | 330 (3).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | 330 (2).gif | 2025-11-21 06:40 | 96 | |
![[ ]](/icons/unknown.gif) | 01_07_2014 - 20_07_2014 ყველა შემთხვევა.xlsx | 2025-11-21 06:40 | 102K | |
![[ ]](/icons/unknown.gif) | 01_07_2014 - 20_07_2014 დაკავშირებული შემთხვევები.xlsx | 2025-11-21 06:40 | 37K | |
![[ ]](/icons/unknown.gif) | კომენტარი მიმართვაზე.docx | 2025-11-21 06:40 | 13K | |
![[ ]](/icons/unknown.gif) | იმუნიზაციის ელოქტრონული მოდული.xlsx | 2025-11-21 06:40 | 13K | |
![[ ]](/icons/unknown.gif) | ბაზაში დაიმპორტებული მონაცემების ექსპორტი (1).xlsx | 2025-11-21 06:40 | 193K | |
![[ ]](/icons/unknown.gif) | არავალიდური და დასარედაქტირებელი მონაცემები.xlsx | 2025-11-21 06:40 | 16K | |
![[ ]](/icons/unknown.gif) | reestri (1).xlsx | 2025-11-21 06:40 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (107).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (106).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (105).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (104).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (103).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | err (1).png | 2025-11-21 06:40 | 170K | |
![[IMG]](/icons/image2.gif) | 330 (1).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | 0.png | 2025-11-21 06:40 | 246K | |
![[ ]](/icons/unknown.gif) | ბაზაში დაიმპორტებული მონაცემების ექსპორტი.xlsx | 2025-11-21 06:40 | 201K | |
![[ ]](/icons/unknown.gif) | tata (2).docx | 2025-11-21 06:40 | 190K | |
![[IMG]](/icons/image2.gif) | image002 (459).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (458).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (563).png | 2025-11-21 06:40 | 62K | |
![[IMG]](/icons/image2.gif) | image001 (562).png | 2025-11-21 06:40 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (561).png | 2025-11-21 06:40 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (560).png | 2025-11-21 06:40 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (102).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (101).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (100).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (99).gif | 2025-11-21 06:40 | 96 | |
![[ ]](/icons/unknown.gif) | რეზისტენტული პაციენტები_28_07_2014.xlsx | 2025-11-21 06:40 | 37K | |
![[ ]](/icons/unknown.gif) | მონაცემების ექსპორტი.xlsx | 2025-11-21 06:40 | 233K | |
![[ ]](/icons/unknown.gif) | არავალიდური მონაცემები.xlsx | 2025-11-21 06:40 | 11K | |
![[IMG]](/icons/image2.gif) | image008 (3).jpg | 2025-11-21 06:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | image007 (9).jpg | 2025-11-21 06:40 | 2.3K | |
![[IMG]](/icons/image2.gif) | image006 (33).jpg | 2025-11-21 06:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | image006 (32).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (41).jpg | 2025-11-21 06:40 | 1.6K | |
![[IMG]](/icons/image2.gif) | image004 (78).jpg | 2025-11-21 06:40 | 2.3K | |
![[IMG]](/icons/image2.gif) | image003 (142).jpg | 2025-11-21 06:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | image002 (457).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (456).jpg | 2025-11-21 06:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (847).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (846).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (845).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (844).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (843).jpg | 2025-11-21 06:40 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (842).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (841).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (840).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (839).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (559).png | 2025-11-21 06:40 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (98).gif | 2025-11-21 06:40 | 96 | |
![[ ]](/icons/unknown.gif) | err.docx | 2025-11-21 06:40 | 182K | |
![[ ]](/icons/unknown.gif) | ATT89396 | 2025-11-21 06:40 | 0 | |
![[ ]](/icons/unknown.gif) | სკრინინგი - ხელოვნური კოდები (1).xlsx | 2025-11-21 06:40 | 9.8K | |
![[ ]](/icons/unknown.gif) | დუბლები იაშვილი.xlsx | 2025-11-21 06:40 | 11K | |
![[ ]](/icons/unknown.gif) | validation-infeqciuri,07_2014.xls | 2025-11-21 06:40 | 43K | |
![[IMG]](/icons/image2.gif) | image002 (218).png | 2025-11-21 06:40 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (838).jpg | 2025-11-21 06:40 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (837).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (836).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (835).jpg | 2025-11-21 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (97).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (96).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (95).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (94).gif | 2025-11-21 06:40 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (93).gif | 2025-11-21 06:40 | 96 | |
![[ ]](/icons/unknown.gif) | ReportPayment.xlsx | 2025-11-21 06:40 | 41K | |
![[ ]](/icons/unknown.gif) | ReportExecution.xlsx | 2025-11-21 06:40 | 37K | |
![[IMG]](/icons/image2.gif) | 2 (16).png | 2025-11-21 06:40 | 183K | |
![[IMG]](/icons/image2.gif) | 1 (19).png | 2025-11-21 06:40 | 178K | |
![[IMG]](/icons/image2.gif) | პორტალი.png | 2025-11-21 06:40 | 268K | |
![[ ]](/icons/unknown.gif) | დიაბეტის მართვა - ივლისი 2014 -validation.xls | 2025-11-21 06:40 | 86K | |
![[ ]](/icons/unknown.gif) | tata (1).docx | 2025-11-21 06:40 | 185K | |
![[IMG]](/icons/image2.gif) | image002 (455).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (834).jpg | 2025-11-21 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (558).png | 2025-11-21 06:40 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (557).png | 2025-11-21 06:40 | 172K | |
![[IMG]](/icons/image2.gif) | image001 (556).png | 2025-11-21 06:40 | 172K | |
![[IMG]](/icons/image2.gif) | image001 (92).gif | 2025-11-21 06:40 | 96 | |
![[ ]](/icons/unknown.gif) | error (13).docx | 2025-11-21 06:40 | 207K | |
![[ ]](/icons/unknown.gif) | Copy of List of SJCs users and pass_თკ (1).xlsx | 2025-11-21 06:40 | 24K | |
![[IMG]](/icons/image2.gif) | 8.png | 2025-11-21 06:40 | 193K | |
![[IMG]](/icons/image2.gif) | 7.png | 2025-11-21 06:40 | 236K | |
![[IMG]](/icons/image2.gif) | 6.png | 2025-11-21 06:40 | 184K | |
![[IMG]](/icons/image2.gif) | 4 (5).png | 2025-11-21 06:40 | 177K | |
![[IMG]](/icons/image2.gif) | 3 (8).png | 2025-11-21 06:40 | 189K | |
![[IMG]](/icons/image2.gif) | 3 (7).png | 2025-11-21 06:40 | 173K | |
![[IMG]](/icons/image2.gif) | 2_ (1).png | 2025-11-21 06:40 | 175K | |
![[IMG]](/icons/image2.gif) | 2 (15).png | 2025-11-21 06:40 | 227K | |
![[IMG]](/icons/image2.gif) | 1 (18).png | 2025-11-21 06:40 | 173K | |
![[IMG]](/icons/image2.gif) | москвицш.jpg | 2025-11-21 06:40 | 210K | |
![[IMG]](/icons/image2.gif) | info (1).png | 2025-11-21 06:40 | 206K | |
![[IMG]](/icons/image2.gif) | image003 (191).png | 2025-11-21 06:40 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (141).jpg | 2025-11-21 06:40 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (454).jpg | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (453).jpg | 2025-11-21 06:40 | 8.4K | |
![[IMG]](/icons/image2.gif) | image002 (452).jpg | 2025-11-21 06:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (833).jpg | 2025-11-21 06:40 | 8.4K | |
![[IMG]](/icons/image2.gif) | image001 (555).png | 2025-11-21 06:40 | 51K | |
![[ ]](/icons/unknown.gif) | eror.docx | 2025-11-21 06:40 | 207K | |
![[ ]](/icons/unknown.gif) | Error (12).docx | 2025-11-21 06:40 | 196K | |
![[ ]](/icons/unknown.gif) | EBOLA FACTS.docx | 2025-11-21 06:40 | 16K | |
![[ ]](/icons/unknown.gif) | Document3.docx | 2025-11-21 06:40 | 60K | |
![[ ]](/icons/unknown.gif) | Copy of List of SJCs users and pass_თკ.xlsx | 2025-11-21 06:40 | 24K | |
![[ ]](/icons/unknown.gif) | Copy of ვერტიკალურები - ფორმების გამართვა.xlsx | 2025-11-21 06:40 | 33K | |
![[IMG]](/icons/image2.gif) | 9.png | 2025-11-21 06:40 | 241K | |
![[ ]](/icons/unknown.gif) | -Patch 4.sql | 2025-11-21 06:40 | 780 | |
![[ ]](/icons/unknown.gif) | #Patch 3.sql | 2025-11-21 06:40 | 1.1K | |
![[ ]](/icons/unknown.gif) | ვინ რაზე მუშაობს_1 აგვისტო, 2014.xlsx | 2025-11-21 06:40 | 73K | |
![[ ]](/icons/unknown.gif) | ვერტიკალურები - ფორმების გამართვა.xlsx | 2025-11-21 06:40 | 83K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ_ (1).xlsx | 2025-11-21 06:40 | 13K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (21).jpg | 2025-11-21 06:39 | 823 | |
![[IMG]](/icons/image2.gif) | submitting (1).png | 2025-11-21 06:39 | 163K | |
![[IMG]](/icons/image2.gif) | image001 (832).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (831).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (830).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (829).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (828).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (827).jpg | 2025-11-21 06:39 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (554).png | 2025-11-21 06:39 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (553).png | 2025-11-21 06:39 | 192K | |
![[IMG]](/icons/image2.gif) | image001 (552).png | 2025-11-21 06:39 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (551).png | 2025-11-21 06:39 | 192K | |
![[ ]](/icons/unknown.gif) | Untitled (47) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | Teqnical Task (4).docx | 2025-11-21 06:39 | 63K | |
![[ ]](/icons/unknown.gif) | Patch 6.sql | 2025-11-21 06:39 | 2.1K | |
![[ ]](/icons/unknown.gif) | Patch 5.sql | 2025-11-21 06:39 | 2.1K | |
![[ ]](/icons/unknown.gif) | Patch 4.sql | 2025-11-21 06:39 | 2.1K | |
![[ ]](/icons/unknown.gif) | Patch 3.sql | 2025-11-21 06:39 | 2.1K | |
![[ ]](/icons/unknown.gif) | Patch 2.sql | 2025-11-21 06:39 | 2.1K | |
![[ ]](/icons/unknown.gif) | Patch 1 (3).sql | 2025-11-21 06:39 | 2.0K | |
![[ ]](/icons/unknown.gif) | Copy of #1 -.xls | 2025-11-21 06:39 | 34K | |
![[ ]](/icons/unknown.gif) | Access to E-health (3).xlsx | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | -Patch 2.sql | 2025-11-21 06:39 | 682 | |
![[ ]](/icons/unknown.gif) | -Patch 1.sql | 2025-11-21 06:39 | 682 | |
![[ ]](/icons/unknown.gif) | #1 - _.xls | 2025-11-21 06:39 | 20K | |
![[ ]](/icons/unknown.gif) | #-Patch 6.sql | 2025-11-21 06:39 | 837 | |
![[ ]](/icons/unknown.gif) | #-Patch 5.sql | 2025-11-21 06:39 | 837 | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება.docx | 2025-11-21 06:39 | 37K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ_.xlsx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | rezistentulebi- ivnisis tve arasrulad aris shevsebuli.xlsx | 2025-11-21 06:39 | 9.5K | |
![[ ]](/icons/unknown.gif) | rezistentulebi- ivnisis tve ar aris shevsebuli.xlsx | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | jarimebi - Copy - Copy - Copy.xlsx | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (826).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (825).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (824).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (550).png | 2025-11-21 06:39 | 175K | |
![[IMG]](/icons/image2.gif) | image001 (549).png | 2025-11-21 06:39 | 175K | |
![[IMG]](/icons/image2.gif) | image001 (548).png | 2025-11-21 06:39 | 175K | |
![[IMG]](/icons/image2.gif) | image001 (91).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (90).gif | 2025-11-21 06:39 | 96 | |
![[ ]](/icons/unknown.gif) | error (11).docx | 2025-11-21 06:39 | 216K | |
![[ ]](/icons/unknown.gif) | Untitled (46) | 2025-11-21 06:39 | 0 | |
![[IMG]](/icons/image2.gif) | Untitled (41).png | 2025-11-21 06:39 | 198K | |
![[ ]](/icons/unknown.gif) | SjcP.xlsx | 2025-11-21 06:39 | 25K | |
![[ ]](/icons/unknown.gif) | ICD.docx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/compressed.gif) | F025.zip | 2025-11-21 06:39 | 72K | |
![[ ]](/icons/unknown.gif) | ფასები ძველ კოდებზე.xlsx | 2025-11-21 06:39 | 2.4M | |
![[ ]](/icons/unknown.gif) | თანხები (დარჩენილი თარიღები 0-ზე მეტი).xlsx | 2025-11-21 06:39 | 88K | |
![[ ]](/icons/unknown.gif) | თანხები (დარჩენილი თარიღები 0).xlsx | 2025-11-21 06:39 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (190).png | 2025-11-21 06:39 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (451).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (450).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (547).png | 2025-11-21 06:39 | 48K | |
![[IMG]](/icons/image2.gif) | image001 (89).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (88).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (87).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (86).gif | 2025-11-21 06:39 | 96 | |
![[ ]](/icons/unknown.gif) | Untitled (45) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (44) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (43) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | Teqnical Task (3).docx | 2025-11-21 06:39 | 65K | |
![[ ]](/icons/unknown.gif) | EBOLA FACTS (en francaise).docx | 2025-11-21 06:39 | 18K | |
![[ ]](/icons/unknown.gif) | ATT21171 | 2025-11-21 06:39 | 0 | |
![[IMG]](/icons/image2.gif) | image006 (23).png | 2025-11-21 06:39 | 8.8K | |
![[IMG]](/icons/image2.gif) | image004 (92).png | 2025-11-21 06:39 | 5.6K | |
![[IMG]](/icons/image2.gif) | image002 (449).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (217).png | 2025-11-21 06:39 | 2.7K | |
![[IMG]](/icons/image2.gif) | image001 (546).png | 2025-11-21 06:39 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (545).png | 2025-11-21 06:39 | 9.5K | |
![[IMG]](/icons/image2.gif) | error (22).png | 2025-11-21 06:39 | 176K | |
![[IMG]](/icons/image2.gif) | case (3).png | 2025-11-21 06:39 | 116K | |
![[ ]](/icons/unknown.gif) | Teqnical Task (2).docx | 2025-11-21 06:39 | 69K | |
![[ ]](/icons/unknown.gif) | Teqnical Task (1).docx | 2025-11-21 06:39 | 69K | |
![[ ]](/icons/unknown.gif) | Sjc (2).xlsx | 2025-11-21 06:39 | 8.5K | |
![[ ]](/icons/unknown.gif) | NCDCHesperus_Billing.xlsx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | Immunization Sjc.xlsx | 2025-11-21 06:39 | 11K | |
![[IMG]](/icons/image2.gif) | Capture (15).PNG | 2025-11-21 06:39 | 76K | |
![[ ]](/icons/unknown.gif) | Calculations (3).xlsx | 2025-11-21 06:39 | 53K | |
![[IMG]](/icons/image2.gif) | provaidershi misamartis cvlileba.png | 2025-11-21 06:39 | 99K | |
![[IMG]](/icons/image2.gif) | image002 (448).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (544).png | 2025-11-21 06:39 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (543).png | 2025-11-21 06:39 | 186K | |
![[IMG]](/icons/image2.gif) | image001 (85).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (84).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (83).gif | 2025-11-21 06:39 | 3.4K | |
![[IMG]](/icons/image2.gif) | image001 (82).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (81).gif | 2025-11-21 06:39 | 3.4K | |
![[IMG]](/icons/image2.gif) | image001 (80).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (79).gif | 2025-11-21 06:39 | 3.4K | |
![[ ]](/icons/unknown.gif) | filialebs modultan wvdoma.xlsx | 2025-11-21 06:39 | 12K | |
![[IMG]](/icons/image2.gif) | cloud (3).png | 2025-11-21 06:39 | 200K | |
![[ ]](/icons/unknown.gif) | Untitled (42) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | Payable Patients start Ambulatory Treatment from 1 April 2014.xlsx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | Patients start Ambulatory Treatment from 1 April 2014.xlsx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/unknown.gif) | Calculations (2).xlsx | 2025-11-21 06:39 | 2.5M | |
![[ ]](/icons/unknown.gif) | იუზერ.xlsx | 2025-11-21 06:39 | 10K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (20).jpg | 2025-11-21 06:39 | 823 | |
![[IMG]](/icons/image2.gif) | ~WRD000 (19).jpg | 2025-11-21 06:39 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (823).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (822).jpg | 2025-11-21 06:39 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (821).jpg | 2025-11-21 06:39 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (78).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (77).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (76).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (75).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (74).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (73).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (72).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | errrorr.png | 2025-11-21 06:39 | 217K | |
![[ ]](/icons/unknown.gif) | error (10).docx | 2025-11-21 06:39 | 199K | |
![[ ]](/icons/unknown.gif) | error (9).docx | 2025-11-21 06:39 | 202K | |
![[ ]](/icons/unknown.gif) | error (8).docx | 2025-11-21 06:39 | 238K | |
![[IMG]](/icons/image2.gif) | errooor.png | 2025-11-21 06:39 | 245K | |
![[ ]](/icons/unknown.gif) | Untitled (41) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | Teqnical Task.docx | 2025-11-21 06:39 | 78K | |
![[ ]](/icons/unknown.gif) | Patients without parentID.xlsx | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | Patients- Treatment end date is less than Intensive phase end date.xlsx | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | N218_ე დადგენილების ქიმიოთერაპია და ჰორმონოთერაპია.xlsx | 2025-11-21 06:39 | 24K | |
![[ ]](/icons/unknown.gif) | N165_ე დადგენილების ქიმიოთერაპია და ჰორმონოთერაპია.xlsx | 2025-11-21 06:39 | 23K | |
![[ ]](/icons/unknown.gif) | N36_ე დადგენილების ქიმიოთერაპია და ჰორმონოთერაპია.xlsx | 2025-11-21 06:39 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (542).png | 2025-11-21 06:39 | 188K | |
![[IMG]](/icons/image2.gif) | image001 (541).png | 2025-11-21 06:39 | 184K | |
![[IMG]](/icons/image2.gif) | image001 (540).png | 2025-11-21 06:39 | 183K | |
![[IMG]](/icons/image2.gif) | image001 (539).png | 2025-11-21 06:39 | 182K | |
![[IMG]](/icons/image2.gif) | image001 (538).png | 2025-11-21 06:39 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (537).png | 2025-11-21 06:39 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (71).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (70).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (69).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (68).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (67).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (66).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (65).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (64).gif | 2025-11-21 06:39 | 96 | |
![[ ]](/icons/unknown.gif) | Payable 24 resistant patients.xls | 2025-11-21 06:39 | 31K | |
![[ ]](/icons/unknown.gif) | ნათიას.xls | 2025-11-21 06:39 | 21K | |
![[ ]](/icons/unknown.gif) | tikos.docx | 2025-11-21 06:39 | 186K | |
![[ ]](/icons/unknown.gif) | soflis eqimebis modultanwvdoma.xlsx | 2025-11-21 06:39 | 12K | |
![[IMG]](/icons/image2.gif) | info.png | 2025-11-21 06:39 | 193K | |
![[IMG]](/icons/image2.gif) | image003 (189).png | 2025-11-21 06:39 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (447).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (446).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (445).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (444).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (820).jpg | 2025-11-21 06:39 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (536).png | 2025-11-21 06:39 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (535).png | 2025-11-21 06:39 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (534).png | 2025-11-21 06:39 | 11K | |
![[IMG]](/icons/image2.gif) | analitic.png | 2025-11-21 06:39 | 191K | |
![[IMG]](/icons/image2.gif) | Untitled (40).png | 2025-11-21 06:39 | 175K | |
![[ ]](/icons/unknown.gif) | Ebola - Frequently Asked Questions.docx | 2025-11-21 06:39 | 19K | |
![[ ]](/icons/unknown.gif) | 28_02_2014-01_05_2014.xlsx | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | 28_02_2013-01_05_2014.xlsx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/unknown.gif) | საყოველთაოში ჩართული პროვაიდერების სია.xlsx | 2025-11-21 06:39 | 55K | |
![[ ]](/icons/unknown.gif) | დუბლი ტატიშვილი.xlsx | 2025-11-21 06:39 | 9.9K | |
![[ ]](/icons/unknown.gif) | iuzerebi (1).xlsx | 2025-11-21 06:39 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (140).jpg | 2025-11-21 06:39 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (443).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (819).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (818).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (817).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (63).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (62).gif | 2025-11-21 06:39 | 96 | |
![[ ]](/icons/unknown.gif) | el versia.docx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields 15_08_14 -Copy - Copy.xlsx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/unknown.gif) | User management fields 01_08_14 -Copy - Copy.xlsx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/unknown.gif) | Providers (7).xlsx | 2025-11-21 06:39 | 431K | |
![[ ]](/icons/unknown.gif) | IHD Strategy FY15-16 (8-18-14).pptx | 2025-11-21 06:39 | 251K | |
![[ ]](/icons/unknown.gif) | Calculations (1).xlsx | 2025-11-21 06:39 | 2.7M | |
![[ ]](/icons/unknown.gif) | Book1 (4).xlsx | 2025-11-21 06:39 | 11K | |
![[ ]](/icons/unknown.gif) | ATT31766 | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | 28_02_2013-01_05_2014 (Misagebi).xlsx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | დანართ1.xlsx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | დანართ1 (1).xlsx | 2025-11-21 06:39 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (139).jpg | 2025-11-21 06:39 | 158K | |
![[IMG]](/icons/image2.gif) | image002 (442).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (441).jpg | 2025-11-21 06:39 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (816).jpg | 2025-11-21 06:39 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (815).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (814).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (813).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (812).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (811).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (810).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (809).jpg | 2025-11-21 06:39 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (808).jpg | 2025-11-21 06:39 | 4.2K | |
![[ ]](/icons/unknown.gif) | dublirebuli Canawerebi.docx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/unknown.gif) | No Name (4).xlsx | 2025-11-21 06:39 | 282K | |
![[ ]](/icons/unknown.gif) | No Name (3).xlsx | 2025-11-21 06:39 | 1.0M | |
![[ ]](/icons/unknown.gif) | Calculations.xlsx | 2025-11-21 06:39 | 2.7M | |
![[ ]](/icons/unknown.gif) | ურგენტულ შემთხვევათა სია.xlsx | 2025-11-21 06:39 | 571K | |
![[ ]](/icons/unknown.gif) | ექიმ ნარკოლოგთა სია, დაწესებულებებით.xlsx | 2025-11-21 06:39 | 23K | |
![[ ]](/icons/unknown.gif) | nimuSi velebisTvis.xls | 2025-11-21 06:39 | 27K | |
![[ ]](/icons/unknown.gif) | nimuSi velebisTvis (1).xls | 2025-11-21 06:39 | 16K | |
![[ ]](/icons/unknown.gif) | iuzerebi_ soso jakhia.xlsx | 2025-11-21 06:39 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (188).png | 2025-11-21 06:39 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (440).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (807).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (806).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (533).png | 2025-11-21 06:39 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (532).png | 2025-11-21 06:39 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (61).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (60).gif | 2025-11-21 06:39 | 96 | |
![[ ]](/icons/unknown.gif) | User management fields 21_08_14 -Copy - Copy.xlsx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | Document1.docx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | სპეციალობები, კოდები-თათას (1).xlsx | 2025-11-21 06:39 | 22K | |
![[ ]](/icons/unknown.gif) | იუზერები (ყოფილი თანამშრომლები).xlsx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | ზუგდიდის სერვის ცენტრი.xlsx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | saregistracio_lezhava (1).xlsx | 2025-11-21 06:39 | 9.9K | |
![[IMG]](/icons/image2.gif) | image005 (40).jpg | 2025-11-21 06:39 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (187).png | 2025-11-21 06:39 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (186).png | 2025-11-21 06:39 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (439).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (438).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (805).jpg | 2025-11-21 06:39 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (59).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (58).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | error (21).png | 2025-11-21 06:39 | 171K | |
![[IMG]](/icons/image2.gif) | case (2).png | 2025-11-21 06:39 | 165K | |
![[ ]](/icons/layout.gif) | __urc-jd-fm.pdf | 2025-11-21 06:39 | 177 | |
![[ ]](/icons/unknown.gif) | User management fields 22_08_14 -Copy - Copy.xlsx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields (18).xlsx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | User management fields (1) (1).xlsx | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | Untitled2.png | 2025-11-21 06:39 | 211K | |
![[IMG]](/icons/image2.gif) | Untitled1.png | 2025-11-21 06:39 | 351K | |
![[IMG]](/icons/image2.gif) | Untitled (39).png | 2025-11-21 06:39 | 235K | |
![[ ]](/icons/unknown.gif) | Jeo Contract.xlsx | 2025-11-21 06:39 | 8.9K | |
![[ ]](/icons/unknown.gif) | ERROR (7).docx | 2025-11-21 06:39 | 157K | |
![[ ]](/icons/binary.gif) | ATT00002.bin | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/binary.gif) | ATT00001 (2).bin | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | ურგენტულ შემთხვევათა სია განახლებული.xlsx | 2025-11-21 06:39 | 604K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_ (5).xlsx | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (437).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (804).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (803).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (802).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (801).jpg | 2025-11-21 06:39 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (531).png | 2025-11-21 06:39 | 84K | |
![[IMG]](/icons/image2.gif) | image001 (530).png | 2025-11-21 06:39 | 84K | |
![[IMG]](/icons/image2.gif) | image001 (57).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (56).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (55).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (54).gif | 2025-11-21 06:39 | 32K | |
![[ ]](/icons/unknown.gif) | Untitled (40) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (39) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | TuberculosisExport25_08_2014_13_49_38.xlsx | 2025-11-21 06:39 | 206K | |
![[ ]](/icons/unknown.gif) | TuberculosisExport25_08_2014_13_34_18_xlsx.xls | 2025-11-21 06:39 | 510K | |
![[ ]](/icons/unknown.gif) | Providers (6).xlsx | 2025-11-21 06:39 | 431K | |
![[ ]](/icons/unknown.gif) | Patients phase end date before 30 June 2014.xlsx | 2025-11-21 06:39 | 91K | |
![[ ]](/icons/unknown.gif) | FY15 Q1 IHD Aug 21 2014 Qtrly Update Final Field.pptx | 2025-11-21 06:39 | 926K | |
![[ ]](/icons/unknown.gif) | Combined CR and EIDSS Disease List.xlsx | 2025-11-21 06:39 | 88K | |
![[ ]](/icons/unknown.gif) | Attachment 2 - EIDSS-HMIS Dataset Attributes, Mapping and Rules.xlsx | 2025-11-21 06:39 | 202K | |
![[ ]](/icons/unknown.gif) | ATT47307 | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | პერსონალის სია (საინფორმაციო პორტალი).xlsx | 2025-11-21 06:39 | 1.9M | |
![[IMG]](/icons/image2.gif) | ~WRD000 (18).jpg | 2025-11-21 06:39 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (800).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (799).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (798).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (797).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (796).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (795).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (794).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (793).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (792).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (529).png | 2025-11-21 06:39 | 84K | |
![[IMG]](/icons/image2.gif) | image001 (528).png | 2025-11-21 06:39 | 84K | |
![[IMG]](/icons/image2.gif) | image001 (527).png | 2025-11-21 06:39 | 84K | |
![[IMG]](/icons/image2.gif) | image001 (526).png | 2025-11-21 06:39 | 84K | |
![[IMG]](/icons/image2.gif) | image001 (525).png | 2025-11-21 06:39 | 84K | |
![[IMG]](/icons/image2.gif) | image001 (524).png | 2025-11-21 06:39 | 84K | |
![[IMG]](/icons/image2.gif) | image001 (53).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | ინფო (2).png | 2025-11-21 06:39 | 314K | |
![[ ]](/icons/unknown.gif) | აჭარა_იუზერი.xlsx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | აჭარა_იუზერი (1).xlsx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | modulshi cvdoma1.xls | 2025-11-21 06:39 | 49K | |
![[IMG]](/icons/image2.gif) | image004 (77).jpg | 2025-11-21 06:39 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (185).png | 2025-11-21 06:39 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (138).jpg | 2025-11-21 06:39 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (436).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (791).jpg | 2025-11-21 06:39 | 844K | |
![[IMG]](/icons/image2.gif) | image001 (790).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (789).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (52).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (51).gif | 2025-11-21 06:39 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (50).gif | 2025-11-21 06:39 | 3.5K | |
![[IMG]](/icons/image2.gif) | ar eqvemdebareba.png | 2025-11-21 06:39 | 159K | |
![[IMG]](/icons/image2.gif) | anazgaurdeba.png | 2025-11-21 06:39 | 148K | |
![[ ]](/icons/unknown.gif) | User management fields 27_08_14 -Copy - Copy.xlsx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields (17).xlsx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields (16).xlsx | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | Untitled (38).png | 2025-11-21 06:39 | 173K | |
![[ ]](/icons/unknown.gif) | Untitled (38) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (10).pdf | 2025-11-21 06:39 | 388K | |
![[ ]](/icons/unknown.gif) | კოდები-თათას.xlsx | 2025-11-21 06:39 | 9.7K | |
![[ ]](/icons/unknown.gif) | კატასტროფის მედიცინის პედიატრიული ცენტრი (1).docx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | saregistracio_lezhava.xlsx | 2025-11-21 06:39 | 9.9K | |
![[IMG]](/icons/image2.gif) | image003 (184).png | 2025-11-21 06:39 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (137).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (435).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (434).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (433).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (788).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (787).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (786).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (785).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (784).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (783).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (523).png | 2025-11-21 06:39 | 7.7K | |
![[ ]](/icons/unknown.gif) | N36,N165,N218.xlsx | 2025-11-21 06:39 | 226K | |
![[ ]](/icons/unknown.gif) | FW | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | ქვემო ქართლი_იუზერი.xlsx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | კატასტროფის მედიცინის პედიატრიული ცენტრი.docx | 2025-11-21 06:39 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (782).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (781).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (780).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (779).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (778).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (777).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (776).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (775).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (774).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (773).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (772).jpg | 2025-11-21 06:39 | 4.1K | |
![[ ]](/icons/unknown.gif) | icd10s.xlsx | 2025-11-21 06:39 | 964K | |
![[ ]](/icons/unknown.gif) | TB modulis arsebuli sakitxebi (1).docx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | Accounts R3 IBAN 201408.xlsx | 2025-11-21 06:39 | 11K | |
![[ ]](/icons/unknown.gif) | ივლისი, 2014 -validation___- დედათა და ბავშვთა ჯანმრთელობა.xls | 2025-11-21 06:39 | 47K | |
![[ ]](/icons/unknown.gif) | გასაგზავნი თამთას (2).xlsx | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (771).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (770).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (769).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (768).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (767).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (766).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (765).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (764).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (763).jpg | 2025-11-21 06:39 | 4.1K | |
![[ ]](/icons/unknown.gif) | User management fields 03_09_14 -Copy - Copy.xlsx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | Tamta Kobakhidze BioData_2013.doc | 2025-11-21 06:39 | 209K | |
![[ ]](/icons/unknown.gif) | Tamta Kobakhidze BioData_2013 (1).doc | 2025-11-21 06:39 | 209K | |
![[ ]](/icons/unknown.gif) | Screenshot CIS 20140903.docx | 2025-11-21 06:39 | 133K | |
![[IMG]](/icons/image2.gif) | soflis eqimi.PNG | 2025-11-21 06:39 | 102K | |
![[ ]](/icons/unknown.gif) | satesto ekimebis ekseli.xlsx | 2025-11-21 06:39 | 317K | |
![[IMG]](/icons/image2.gif) | reestrebi.PNG | 2025-11-21 06:39 | 27K | |
![[ ]](/icons/unknown.gif) | modulshi cvdoma2.xls | 2025-11-21 06:39 | 40K | |
![[ ]](/icons/unknown.gif) | iuzerebi.xlsx | 2025-11-21 06:39 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (432).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (762).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (761).jpg | 2025-11-21 06:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (760).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (522).png | 2025-11-21 06:39 | 11K | |
![[ ]](/icons/unknown.gif) | filialebis modultan wvdoma.xlsx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/unknown.gif) | additional Codes.xlsx | 2025-11-21 06:39 | 11K | |
![[ ]](/icons/unknown.gif) | additional Codes (1).xlsx | 2025-11-21 06:39 | 8.9K | |
![[ ]](/icons/layout.gif) | Sustainability Policy Aug 2014.pdf | 2025-11-21 06:39 | 103K | |
![[IMG]](/icons/image2.gif) | tata.jpeg | 2025-11-21 06:39 | 1.1M | |
![[IMG]](/icons/image2.gif) | tata (1).jpeg | 2025-11-21 06:39 | 1.1M | |
![[IMG]](/icons/image2.gif) | image003 (183).png | 2025-11-21 06:39 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (431).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (430).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (429).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (759).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (521).png | 2025-11-21 06:39 | 543K | |
![[IMG]](/icons/image2.gif) | image001 (520).png | 2025-11-21 06:39 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (519).png | 2025-11-21 06:39 | 119K | |
![[IMG]](/icons/image2.gif) | image001 (518).png | 2025-11-21 06:39 | 119K | |
![[IMG]](/icons/image2.gif) | image001 (517).png | 2025-11-21 06:39 | 119K | |
![[IMG]](/icons/image2.gif) | image001 (516).png | 2025-11-21 06:39 | 119K | |
![[IMG]](/icons/image2.gif) | image001 (515).png | 2025-11-21 06:39 | 119K | |
![[IMG]](/icons/image2.gif) | error (20).png | 2025-11-21 06:39 | 74K | |
![[ ]](/icons/unknown.gif) | Untitled (37) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | ATT81230 | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | ATT28097 | 2025-11-21 06:39 | 0 | |
![[IMG]](/icons/image2.gif) | 4 (4).png | 2025-11-21 06:39 | 205K | |
![[IMG]](/icons/image2.gif) | 3 (6).png | 2025-11-21 06:39 | 180K | |
![[IMG]](/icons/image2.gif) | 2 (14).png | 2025-11-21 06:39 | 202K | |
![[IMG]](/icons/image2.gif) | 1 (17).png | 2025-11-21 06:39 | 195K | |
![[IMG]](/icons/image2.gif) | image002 (428).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (427).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (426).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (425).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (424).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (514).png | 2025-11-21 06:39 | 119K | |
![[IMG]](/icons/image2.gif) | image001 (513).png | 2025-11-21 06:39 | 106K | |
![[IMG]](/icons/image2.gif) | image001 (512).png | 2025-11-21 06:39 | 106K | |
![[IMG]](/icons/image2.gif) | image001 (511).png | 2025-11-21 06:39 | 106K | |
![[IMG]](/icons/image2.gif) | image001 (510).png | 2025-11-21 06:39 | 106K | |
![[IMG]](/icons/image2.gif) | image001 (49).gif | 2025-11-21 06:39 | 3.4K | |
![[IMG]](/icons/image2.gif) | image001 (48).gif | 2025-11-21 06:39 | 3.4K | |
![[IMG]](/icons/image2.gif) | Untitled (37).png | 2025-11-21 06:39 | 240K | |
![[ ]](/icons/unknown.gif) | Untitled (36) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | Copy of გასაგზავნი თამთას.xlsx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | Attachment 2 - EIDSS-HMIS Dataset, Attributes Mapping and Rules.XLSX | 2025-11-21 06:39 | 217K | |
![[ ]](/icons/unknown.gif) | vakos beneficiarebi.xlsx | 2025-11-21 06:39 | 170K | |
![[IMG]](/icons/image2.gif) | user.PNG | 2025-11-21 06:39 | 88K | |
![[ ]](/icons/unknown.gif) | samedicino transportireba -xelovnuri kodebi.xlsx | 2025-11-21 06:39 | 11K | |
![[ ]](/icons/unknown.gif) | naxiduri (1).xlsx | 2025-11-21 06:39 | 8.9K | |
![[IMG]](/icons/image2.gif) | image002 (423).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (758).jpg | 2025-11-21 06:39 | 3.1K | |
![[ ]](/icons/unknown.gif) | error (5).docx | 2025-11-21 06:39 | 216K | |
![[ ]](/icons/unknown.gif) | eror11.docx | 2025-11-21 06:39 | 196K | |
![[ ]](/icons/unknown.gif) | dublirebuli Canawerebi.xlsx | 2025-11-21 06:39 | 8.5K | |
![[ ]](/icons/unknown.gif) | TB modulis arsebuli sakitxebi.docx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/unknown.gif) | ERROR (6).docx | 2025-11-21 06:39 | 207K | |
![[ ]](/icons/unknown.gif) | BIUJETI 2015 axali.docx | 2025-11-21 06:39 | 76K | |
![[ ]](/icons/unknown.gif) | ATT38535 | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | 09_09_2014.xlsx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/unknown.gif) | სკრინინგი - ხელოვნური კოდები.xlsx | 2025-11-21 06:39 | 9.8K | |
![[ ]](/icons/unknown.gif) | ნარკომანია-კოდები.xlsx | 2025-11-21 06:39 | 9.1K | |
![[ ]](/icons/unknown.gif) | naxiduri.xlsx | 2025-11-21 06:39 | 8.9K | |
![[IMG]](/icons/image2.gif) | image002 (422).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (216).png | 2025-11-21 06:39 | 49K | |
![[IMG]](/icons/image2.gif) | image001 (757).jpg | 2025-11-21 06:39 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (756).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (509).png | 2025-11-21 06:39 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (508).png | 2025-11-21 06:39 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (507).png | 2025-11-21 06:39 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (506).png | 2025-11-21 06:39 | 203K | |
![[IMG]](/icons/image2.gif) | image001 (505).png | 2025-11-21 06:39 | 37K | |
![[IMG]](/icons/image2.gif) | image001 (504).png | 2025-11-21 06:39 | 36K | |
![[IMG]](/icons/image2.gif) | image001 (503).png | 2025-11-21 06:39 | 29K | |
![[ ]](/icons/unknown.gif) | filialebis modultan wvdoma(2).xlsx | 2025-11-21 06:39 | 16K | |
![[ ]](/icons/unknown.gif) | eror22.docx | 2025-11-21 06:39 | 287K | |
![[IMG]](/icons/image2.gif) | eror (2).png | 2025-11-21 06:39 | 176K | |
![[ ]](/icons/unknown.gif) | User management fields 10_09_14 -Copy - Copy.xlsx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | PASPORTIZACIA - 09_09_2014.docx | 2025-11-21 06:39 | 72K | |
![[ ]](/icons/unknown.gif) | Ebola Screening.docx | 2025-11-21 06:39 | 16K | |
![[ ]](/icons/unknown.gif) | Doc.docx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | Copy of filialebis modultanwvdoma 3 (2).xlsx | 2025-11-21 06:39 | 13K | |
![[TXT]](/icons/text.gif) | ATT00001 (7).htm | 2025-11-21 06:39 | 168 | |
![[ ]](/icons/unknown.gif) | ფსიქიკური ჯანმრთელობა - ხელოვნური კოდები.xlsx | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | სკრინინგი - კოდები (1).xlsx | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | ინფექციური - ხელოვნური კოდები (1).xlsx | 2025-11-21 06:39 | 21K | |
![[ ]](/icons/unknown.gif) | shida qartlis centri.xlsx | 2025-11-21 06:39 | 8.9K | |
![[IMG]](/icons/image2.gif) | kardioqirurga.png | 2025-11-21 06:39 | 195K | |
![[IMG]](/icons/image2.gif) | image003 (136).jpg | 2025-11-21 06:39 | 20K | |
![[IMG]](/icons/image2.gif) | image002 (421).jpg | 2025-11-21 06:39 | 62K | |
![[IMG]](/icons/image2.gif) | image002 (420).jpg | 2025-11-21 06:39 | 62K | |
![[IMG]](/icons/image2.gif) | image001 (755).jpg | 2025-11-21 06:39 | 59K | |
![[IMG]](/icons/image2.gif) | image001 (754).jpg | 2025-11-21 06:39 | 59K | |
![[IMG]](/icons/image2.gif) | image001 (502).png | 2025-11-21 06:39 | 203K | |
![[ ]](/icons/unknown.gif) | gadaricxuli tanxebi.xlsx | 2025-11-21 06:39 | 92K | |
![[ ]](/icons/unknown.gif) | User management fields (15).xlsx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | Task Checklist 100914.xlsx | 2025-11-21 06:39 | 20K | |
![[ ]](/icons/unknown.gif) | PatientsWithNoDotsInJuly.xlsx | 2025-11-21 06:39 | 17K | |
![[IMG]](/icons/image2.gif) | 330.png | 2025-11-21 06:39 | 611 | |
![[ ]](/icons/unknown.gif) | 36_3_გადაუდებელი_სტაციონარული_მომსახურება -_საბაზისო-09_09_2014.xls | 2025-11-21 06:39 | 124K | |
![[ ]](/icons/unknown.gif) | kosta.xlsx | 2025-11-21 06:39 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (501).png | 2025-11-21 06:39 | 122K | |
![[ ]](/icons/unknown.gif) | gadaricxuli tanxebi (with status).xlsx | 2025-11-21 06:39 | 106K | |
![[ ]](/icons/unknown.gif) | error (4).docx | 2025-11-21 06:39 | 200K | |
![[ ]](/icons/unknown.gif) | erori.docx | 2025-11-21 06:39 | 195K | |
![[ ]](/icons/unknown.gif) | User management fields 11_09_14 -Copy - Copy.xlsx | 2025-11-21 06:39 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (182).png | 2025-11-21 06:39 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (419).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (418).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (500).png | 2025-11-21 06:39 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (499).png | 2025-11-21 06:39 | 65K | |
![[ ]](/icons/unknown.gif) | fizikuri piri (9).xlsx | 2025-11-21 06:39 | 9.8K | |
![[ ]](/icons/unknown.gif) | User management fields 12_09_14 -Copy - Copy.xlsx | 2025-11-21 06:39 | 14K | |
![[IMG]](/icons/image2.gif) | Untitled (36).png | 2025-11-21 06:39 | 231K | |
![[ ]](/icons/unknown.gif) | Copy of CALL CENTER NCDC xlsx (1).xlsx | 2025-11-21 06:39 | 8.2K | |
![[ ]](/icons/unknown.gif) | დიალიზისათვის.xlsx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | Untitled (35) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | TuberculosisExport09_09_2014_14_03_41.xlsx | 2025-11-21 06:39 | 277K | |
![[ ]](/icons/unknown.gif) | Tub.xlsx | 2025-11-21 06:39 | 11K | |
![[ ]](/icons/unknown.gif) | Book1 (3).xlsx | 2025-11-21 06:39 | 17K | |
![[ ]](/icons/unknown.gif) | ATT17491 | 2025-11-21 06:39 | 0 | |
![[IMG]](/icons/image2.gif) | 1 (16).PNG | 2025-11-21 06:39 | 103K | |
![[ ]](/icons/unknown.gif) | ქვეკომპონენტი და ფორმა.xlsx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | სენსიტიური პაციენტები- აღდგენილი.xlsx | 2025-11-21 06:39 | 15K | |
![[ ]](/icons/unknown.gif) | რეზისტენტული პაციენტები- აღსადგენია ივლისის თვე.xlsx | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | რეზისტენტული პაციენტები- აღდგენილი.xlsx | 2025-11-21 06:39 | 11K | |
![[IMG]](/icons/image2.gif) | pasebi.jpg | 2025-11-21 06:39 | 228K | |
![[IMG]](/icons/image2.gif) | image001 (753).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (752).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (751).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (498).png | 2025-11-21 06:39 | 196K | |
![[IMG]](/icons/image2.gif) | image001 (497).png | 2025-11-21 06:39 | 182K | |
![[ ]](/icons/unknown.gif) | VERTIKALURISXARVEZEBI-15_09_2014.docx | 2025-11-21 06:39 | 21K | |
![[ ]](/icons/unknown.gif) | Copy of filialebis modultanwvdoma 3.xlsx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | Copy of filialebis modultanwvdoma 3 (1).xlsx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | Copy of CALL CENTER NCDC xlsx.xlsx | 2025-11-21 06:39 | 8.4K | |
![[ ]](/icons/unknown.gif) | CALL CENTER NCDC xlsx (2).xlsx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | ATT75208 | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | სკრინინგი - კოდები.xlsx | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | ოქმი 2.docx | 2025-11-21 06:39 | 12K | |
![[ ]](/icons/unknown.gif) | ინფექციური - ხელოვნური კოდები.xlsx | 2025-11-21 06:39 | 21K | |
![[IMG]](/icons/image2.gif) | registracia.png | 2025-11-21 06:39 | 134K | |
![[IMG]](/icons/image2.gif) | image005 (39).jpg | 2025-11-21 06:39 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (181).png | 2025-11-21 06:39 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (180).png | 2025-11-21 06:39 | 182K | |
![[IMG]](/icons/image2.gif) | image002 (417).jpg | 2025-11-21 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (215).png | 2025-11-21 06:39 | 176K | |
![[IMG]](/icons/image2.gif) | image001 (750).jpg | 2025-11-21 06:39 | 967K | |
![[IMG]](/icons/image2.gif) | image001 (749).jpg | 2025-11-21 06:39 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (496).png | 2025-11-21 06:39 | 190K | |
![[ ]](/icons/unknown.gif) | hospital servisi.xlsx | 2025-11-21 06:39 | 14K | |
![[ ]](/icons/unknown.gif) | fizikuri piri (8).xlsx | 2025-11-21 06:39 | 9.8K | |
![[ ]](/icons/unknown.gif) | daregistrirebuli klinika (1).xlsx | 2025-11-21 06:39 | 15K | |
![[IMG]](/icons/image2.gif) | analitika.png | 2025-11-21 06:39 | 138K | |
![[ ]](/icons/unknown.gif) | Untitled (34) | 2025-11-21 06:39 | 0 | |
![[ ]](/icons/unknown.gif) | რეფერა.xls | 2025-11-21 06:39 | 10K | |
![[ ]](/icons/unknown.gif) | samcxee.xlsx | 2025-11-21 06:39 | 13K | |
![[ ]](/icons/unknown.gif) | mcxeta - mtianeti.xlsx | 2025-11-21 06:39 | 14K | |
![[IMG]](/icons/image2.gif) | image004 (91).png | 2025-11-21 06:39 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (135).jpg | 2025-11-21 06:39 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (22).gif | 2025-11-21 06:39 | 32K | |
![[IMG]](/icons/image2.gif) | image002 (416).jpg | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (748).jpg | 2025-11-21 06:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (495).png | 2025-11-21 06:39 | 168K | |
![[IMG]](/icons/image2.gif) | image001 (494).png | 2025-11-21 06:39 | 158K | |
![[ ]](/icons/unknown.gif) | fizikuri piri (6).xlsx | 2025-11-21 06:39 | 9.8K | |
![[ ]](/icons/unknown.gif) | Book1 (2).xlsx | 2025-11-21 06:39 | 8.7K | |
![[IMG]](/icons/image2.gif) | 123 (2).png | 2025-11-21 06:39 | 276K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_ (4).xlsx | 2025-11-21 06:39 | 13K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (17).jpg | 2025-11-21 06:38 | 823 | |
![[ ]](/icons/unknown.gif) | sun st.xlsx | 2025-11-21 06:38 | 11K | |
![[ ]](/icons/unknown.gif) | qvemo qartli fizikuri piri-17_09_2014.xlsx | 2025-11-21 06:38 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (415).jpg | 2025-11-21 06:38 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (747).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (746).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (745).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (744).jpg | 2025-11-21 06:38 | 4.2K | |
![[ ]](/icons/unknown.gif) | fizikuri piri (5).xlsx | 2025-11-21 06:38 | 11K | |
![[ ]](/icons/unknown.gif) | fizikuri piri (4).xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | fizikuri piri (3).xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | fizikuri piri (2).xlsx | 2025-11-21 06:38 | 11K | |
![[ ]](/icons/unknown.gif) | chanacvlebiti terapiisforma.xlsx | 2025-11-21 06:38 | 22K | |
![[ ]](/icons/unknown.gif) | N10-registrirebulta reestri.xlsx | 2025-11-21 06:38 | 13K | |
![[ ]](/icons/unknown.gif) | დიალიზისათვის(3).xlsx | 2025-11-21 06:38 | 14K | |
![[ ]](/icons/unknown.gif) | organizations2.xlsx | 2025-11-21 06:38 | 43K | |
![[ ]](/icons/unknown.gif) | organizations.xlsx | 2025-11-21 06:38 | 187K | |
![[IMG]](/icons/image2.gif) | mimdinare.png | 2025-11-21 06:38 | 124K | |
![[ ]](/icons/unknown.gif) | iuzerebi_ სერვის ცენტრები.xlsx | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image005 (38).jpg | 2025-11-21 06:38 | 14K | |
![[IMG]](/icons/image2.gif) | image004 (76).jpg | 2025-11-21 06:38 | 3.8K | |
![[IMG]](/icons/image2.gif) | image003 (179).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (178).png | 2025-11-21 06:38 | 158K | |
![[IMG]](/icons/image2.gif) | image003 (134).jpg | 2025-11-21 06:38 | 4.1K | |
![[IMG]](/icons/image2.gif) | image002 (414).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (413).jpg | 2025-11-21 06:38 | 4.7K | |
![[IMG]](/icons/image2.gif) | image002 (214).png | 2025-11-21 06:38 | 133K | |
![[IMG]](/icons/image2.gif) | image001 (743).jpg | 2025-11-21 06:38 | 578K | |
![[IMG]](/icons/image2.gif) | image001 (742).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (741).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (740).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (739).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (738).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (737).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (736).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (735).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | fsiqikuri janm_centri.djvu | 2025-11-21 06:38 | 20K | |
![[IMG]](/icons/image2.gif) | ToTeo.JPG | 2025-11-21 06:38 | 21K | |
![[ ]](/icons/unknown.gif) | GITI2014 and Cyber Security Event November 6-7 2013.doc | 2025-11-21 06:38 | 211K | |
![[IMG]](/icons/image2.gif) | 1 (15).PNG | 2025-11-21 06:38 | 5.8K | |
![[ ]](/icons/unknown.gif) | qvemo qartli fizikuri piri-18_09_2014.xlsx | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image005 (50).png | 2025-11-21 06:38 | 75K | |
![[IMG]](/icons/image2.gif) | image004 (90).png | 2025-11-21 06:38 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (177).png | 2025-11-21 06:38 | 34K | |
![[IMG]](/icons/image2.gif) | image003 (176).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (412).jpg | 2025-11-21 06:38 | 23K | |
![[IMG]](/icons/image2.gif) | image002 (411).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (410).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (734).jpg | 2025-11-21 06:38 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (493).png | 2025-11-21 06:38 | 45K | |
![[ ]](/icons/unknown.gif) | dawesebuleba (1).xlsx | 2025-11-21 06:38 | 10K | |
![[IMG]](/icons/image2.gif) | cloud (2).png | 2025-11-21 06:38 | 203K | |
![[IMG]](/icons/image2.gif) | cloud (1).png | 2025-11-21 06:38 | 203K | |
![[IMG]](/icons/image2.gif) | billing (2).png | 2025-11-21 06:38 | 168K | |
![[IMG]](/icons/image2.gif) | billing (1).png | 2025-11-21 06:38 | 168K | |
![[ ]](/icons/unknown.gif) | Report (1).sql | 2025-11-21 06:38 | 3.4K | |
![[ ]](/icons/unknown.gif) | Data (1).xlsx | 2025-11-21 06:38 | 491K | |
![[ ]](/icons/unknown.gif) | მოდულებზე წვდომის გაუქმება.xlsx | 2025-11-21 06:38 | 13K | |
![[ ]](/icons/unknown.gif) | samegrelo fiz_p_.xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | samcxe fiz_p_ (2).xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | samcxe fiz_p_ (1).xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | qvemo qartli fizikuripiri-bolo.xlsx | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (89).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (133).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (409).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (733).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (492).png | 2025-11-21 06:38 | 7.7K | |
![[ ]](/icons/unknown.gif) | fiz_p_.xlsx | 2025-11-21 06:38 | 9.8K | |
![[ ]](/icons/unknown.gif) | daregistrirebuli klinika.xlsx | 2025-11-21 06:38 | 15K | |
![[ ]](/icons/unknown.gif) | Untitled (33) | 2025-11-21 06:38 | 0 | |
![[ ]](/icons/unknown.gif) | Patch 1 (2).sql | 2025-11-21 06:38 | 3.2K | |
![[ ]](/icons/unknown.gif) | 19_09_2014 soflis eqimebisamcxe.xlsx | 2025-11-21 06:38 | 13K | |
![[ ]](/icons/unknown.gif) | ფარმაკოლოგიური საშუალების კლინიკური კვლევის სახელმწიფო რეესტრი.XLS | 2025-11-21 06:38 | 594K | |
![[ ]](/icons/unknown.gif) | samcxe fiz_p_.xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | panteleimoni.xlsx | 2025-11-21 06:38 | 8.9K | |
![[IMG]](/icons/image2.gif) | image005 (49).png | 2025-11-21 06:38 | 75K | |
![[IMG]](/icons/image2.gif) | image004 (88).png | 2025-11-21 06:38 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (175).png | 2025-11-21 06:38 | 158K | |
![[IMG]](/icons/image2.gif) | image003 (174).png | 2025-11-21 06:38 | 34K | |
![[IMG]](/icons/image2.gif) | image002 (408).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (407).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (406).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (213).png | 2025-11-21 06:38 | 133K | |
![[IMG]](/icons/image2.gif) | image002 (212).png | 2025-11-21 06:38 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (491).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (490).png | 2025-11-21 06:38 | 205K | |
![[IMG]](/icons/image2.gif) | image001 (489).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (488).png | 2025-11-21 06:38 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (487).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (486).png | 2025-11-21 06:38 | 119K | |
![[ ]](/icons/unknown.gif) | eleqtr_sistemis modeli 2.docx | 2025-11-21 06:38 | 38K | |
![[ ]](/icons/unknown.gif) | Untitled (32) | 2025-11-21 06:38 | 0 | |
![[ ]](/icons/unknown.gif) | AWARA-22_09_2014.xlsx | 2025-11-21 06:38 | 13K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩენილი დაწესებ,.xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | sensitiuri pacientebi dasrulebuli mkurnalobit- ar uweriat 4.xlsx | 2025-11-21 06:38 | 8.6K | |
![[ ]](/icons/unknown.gif) | samegrelo 22_09_.xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | rezistentuli paicentebi,- angarishgebis tve ar aqvt srulad shevsebuli.xlsx | 2025-11-21 06:38 | 8.9K | |
![[ ]](/icons/unknown.gif) | rezistentuli pacientebi dasrulebuli mkurnalobit- ar uweriat 4.xlsx | 2025-11-21 06:38 | 8.6K | |
![[ ]](/icons/unknown.gif) | qvemo qartli fizikuri piri-22_09_2014.xlsx | 2025-11-21 06:38 | 11K | |
![[ ]](/icons/unknown.gif) | manukiani.xlsx | 2025-11-21 06:38 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (732).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (485).png | 2025-11-21 06:38 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (484).png | 2025-11-21 06:38 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (483).png | 2025-11-21 06:38 | 96K | |
![[IMG]](/icons/image2.gif) | image001 (482).png | 2025-11-21 06:38 | 64K | |
![[ ]](/icons/unknown.gif) | წვდომის გაუქმება - ლია რაზმაძე.xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | sensitiuri paicentebi,- angarishgebis tve ar aqvt srulad shevsebuli.xlsx | 2025-11-21 06:38 | 8.4K | |
![[ ]](/icons/unknown.gif) | qvemo qartli fizikuripiri-24_09_2014.xlsx | 2025-11-21 06:38 | 11K | |
![[ ]](/icons/unknown.gif) | modulshi cvdoma.xls | 2025-11-21 06:38 | 28K | |
![[ ]](/icons/unknown.gif) | marneulis filiali.xlsx | 2025-11-21 06:38 | 9.7K | |
![[IMG]](/icons/image2.gif) | image003 (132).jpg | 2025-11-21 06:38 | 24K | |
![[IMG]](/icons/image2.gif) | image002 (405).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (731).jpg | 2025-11-21 06:38 | 3.1K | |
![[ ]](/icons/unknown.gif) | dawesebuleba.xlsx | 2025-11-21 06:38 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00002 (8).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (7).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (20).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00001 (19).png | 2025-11-21 06:38 | 12K | |
![[TXT]](/icons/text.gif) | ATT00001 (6).htm | 2025-11-21 06:38 | 260 | |
![[ ]](/icons/unknown.gif) | 23_09_2014 soflis eqimebismodultan wvdoma - samcxe.xlsx | 2025-11-21 06:38 | 13K | |
![[ ]](/icons/unknown.gif) | წვდომის გაუქმება 1.xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | გასაგზავნი თამთას (1).xlsx | 2025-11-21 06:38 | 13K | |
![[ ]](/icons/unknown.gif) | tata.docx | 2025-11-21 06:38 | 189K | |
![[ ]](/icons/unknown.gif) | qvemo qartli fizikuripiri-25_09_2014.xlsx | 2025-11-21 06:38 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (404).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (730).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (481).png | 2025-11-21 06:38 | 112K | |
![[IMG]](/icons/image2.gif) | image001 (480).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | eror (1).png | 2025-11-21 06:38 | 199K | |
![[ ]](/icons/unknown.gif) | Statements (18).xlsx | 2025-11-21 06:38 | 3.6K | |
![[ ]](/icons/unknown.gif) | Statements (18) (1).xlsx | 2025-11-21 06:38 | 3.6K | |
![[ ]](/icons/unknown.gif) | Duplicated Acceptance Acts.xlsx | 2025-11-21 06:38 | 14K | |
![[ ]](/icons/unknown.gif) | Copy of dawesebuleba 24_09_.xlsx | 2025-11-21 06:38 | 10K | |
![[IMG]](/icons/image2.gif) | ATT00003.jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (11).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00002 (6).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (5).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (4).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002 (3).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (18).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00001 (17).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (16).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00001 (15).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00001 (14).png | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | გასაგზავნი თამთას.xlsx | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image005 (48).png | 2025-11-21 06:38 | 15K | |
![[IMG]](/icons/image2.gif) | image004 (75).jpg | 2025-11-21 06:38 | 23K | |
![[IMG]](/icons/image2.gif) | image002 (403).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (402).jpg | 2025-11-21 06:38 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (729).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (728).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (727).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (726).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (725).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (724).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (723).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (722).jpg | 2025-11-21 06:38 | 726K | |
![[IMG]](/icons/image2.gif) | image001 (479).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (478).png | 2025-11-21 06:38 | 233K | |
![[IMG]](/icons/image2.gif) | Untitledfff.png | 2025-11-21 06:38 | 142K | |
![[IMG]](/icons/image2.gif) | ATT00002 (2).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (13).png | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | მედიაცია table.xlsx | 2025-11-21 06:38 | 7.1M | |
![[ ]](/icons/unknown.gif) | მედიაცია.xlsx | 2025-11-21 06:38 | 7.1M | |
![[ ]](/icons/unknown.gif) | განაცხადები (მედიაცია).xlsx | 2025-11-21 06:38 | 506K | |
![[IMG]](/icons/image2.gif) | klinikis mxare.png | 2025-11-21 06:38 | 215K | |
![[IMG]](/icons/image2.gif) | image003 (173).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (401).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (400).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (399).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (398).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (721).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (477).png | 2025-11-21 06:38 | 134K | |
![[IMG]](/icons/image2.gif) | image001 (476).png | 2025-11-21 06:38 | 134K | |
![[IMG]](/icons/image2.gif) | image001 (475).png | 2025-11-21 06:38 | 134K | |
![[ ]](/icons/unknown.gif) | fizikuri piri (1).xlsx | 2025-11-21 06:38 | 9.6K | |
![[IMG]](/icons/image2.gif) | chapidze (1).png | 2025-11-21 06:38 | 210K | |
![[IMG]](/icons/image2.gif) | batumi.png | 2025-11-21 06:38 | 214K | |
![[IMG]](/icons/image2.gif) | Untitled (35).png | 2025-11-21 06:38 | 206K | |
![[IMG]](/icons/image2.gif) | SSA mxare.png | 2025-11-21 06:38 | 116K | |
![[ ]](/icons/unknown.gif) | Mediation2.xlsx | 2025-11-21 06:38 | 7.1M | |
![[ ]](/icons/unknown.gif) | Mediation2 (1).xlsx | 2025-11-21 06:38 | 7.1M | |
![[ ]](/icons/unknown.gif) | Mediation1.xlsx | 2025-11-21 06:38 | 7.1M | |
![[ ]](/icons/unknown.gif) | 18 წლამდე პაციენტები, რომლებსაც შესაყვანი აქვთ მშობლის მონაცემები.xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | ვიდეოს ტექსტი (2).docx | 2025-11-21 06:38 | 17K | |
![[IMG]](/icons/image2.gif) | space.gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image012 (6).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image012 (5).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image012 (4).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image011 (7).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image011 (6).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image011 (5).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image010 (7).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image010 (6).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image010 (5).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image009 (8).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image009 (7).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image009 (6).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image008 (7).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image008 (6).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image008 (5).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image007 (12).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image007 (11).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image006 (22).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image006 (21).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image005 (22).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image005 (21).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image004 (18).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image004 (17).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image003 (172).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (21).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image003 (20).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image002 (397).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (396).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (211).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image002 (210).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (474).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (473).png | 2025-11-21 06:38 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (472).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | corner_normal_white_tr.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | corner_normal_white_tl.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | corner_normal_darkgrey_stroke_br.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | corner_normal_darkgrey_stroke_bl.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | button_black_r.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | button_black_l.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | arrow.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00012 (7).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00012 (6).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00011 (7).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00011 (6).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00010 (7).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00010 (6).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00009 (8).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00009 (7).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00008 (7).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00008 (6).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00007 (7).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00007 (6).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00006 (7).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00006 (6).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00005 (8).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00005 (7).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00004 (7).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | ATT00004 (6).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | ATT00003 (6).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00003 (5).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00002 (10).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00002 (9).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (12).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (11).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image013 (2).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image012 (3).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image012 (2).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image011 (4).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image011 (4).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image010 (4).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image010 (2).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image009 (5).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image009 (4).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image008 (4).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image008 (3).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image007 (19).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image007 (10).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image007 (9).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image006 (20).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image006 (19).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image006 (9).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image005 (20).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image005 (19).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image005 (18).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image004 (16).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image004 (15).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image004 (14).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image003 (171).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image003 (19).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image003 (18).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image002 (209).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image002 (208).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image002 (207).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (471).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (470).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (469).png | 2025-11-21 06:38 | 168 | |
![[ ]](/icons/unknown.gif) | ado__1_.xls | 2025-11-21 06:38 | 24M | |
![[ ]](/icons/unknown.gif) | ვერტიკალურები.xlsx | 2025-11-21 06:38 | 261K | |
![[IMG]](/icons/image2.gif) | image005 (37).jpg | 2025-11-21 06:38 | 40K | |
![[IMG]](/icons/image2.gif) | image003 (170).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (169).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (395).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (394).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (393).jpg | 2025-11-21 06:38 | 8.5K | |
![[IMG]](/icons/image2.gif) | image002 (392).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (720).jpg | 2025-11-21 06:38 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (719).jpg | 2025-11-21 06:38 | 358K | |
![[IMG]](/icons/image2.gif) | image001 (468).png | 2025-11-21 06:38 | 17K | |
![[ ]](/icons/unknown.gif) | No Name.xlsx | 2025-11-21 06:38 | 67K | |
![[ ]](/icons/unknown.gif) | No Name (2).xlsx | 2025-11-21 06:38 | 14K | |
![[ ]](/icons/unknown.gif) | No Name (1).xlsx | 2025-11-21 06:38 | 16K | |
![[ ]](/icons/binary.gif) | ATT00001 (1).bin | 2025-11-21 06:38 | 0 | |
![[ ]](/icons/unknown.gif) | 20_07_2014 - 29_09_2014 ყველა.xlsx | 2025-11-21 06:38 | 336K | |
![[ ]](/icons/unknown.gif) | 20_07_2014 - 29_09_2014 დაკავშირებული.xlsx | 2025-11-21 06:38 | 115K | |
![[ ]](/icons/unknown.gif) | ტუბერკულოზის მოდულში არსებული ვალიდაციები.docx | 2025-11-21 06:38 | 19K | |
![[ ]](/icons/unknown.gif) | სენსიტიური პაციენტები , მკურნალობის ხანგრძლივობა მეტია 6 თვეზე.xlsx | 2025-11-21 06:38 | 8.4K | |
![[ ]](/icons/unknown.gif) | რეზისტენტული პაციენტები, მკურნალობის ხანგრძლივობა მეტია 20 თვეზე.xlsx | 2025-11-21 06:38 | 9.8K | |
![[ ]](/icons/unknown.gif) | ონკოჰემატოლოგია - უწყისი.xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | modulze cvdoma 30_09_.xls | 2025-11-21 06:38 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (718).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (717).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (716).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (715).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (714).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (713).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (712).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (711).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (710).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (709).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (467).png | 2025-11-21 06:38 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (466).png | 2025-11-21 06:38 | 155K | |
![[ ]](/icons/unknown.gif) | Fwd migration | 2025-11-21 06:38 | 0 | |
![[ ]](/icons/unknown.gif) | ATT90832 | 2025-11-21 06:38 | 0 | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_ (3).xlsx | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (74).jpg | 2025-11-21 06:38 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (168).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (131).jpg | 2025-11-21 06:38 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (130).jpg | 2025-11-21 06:38 | 1.7K | |
![[IMG]](/icons/image2.gif) | image002 (391).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (390).jpg | 2025-11-21 06:38 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (708).jpg | 2025-11-21 06:38 | 794K | |
![[IMG]](/icons/image2.gif) | image001 (707).jpg | 2025-11-21 06:38 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (706).jpg | 2025-11-21 06:38 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (705).jpg | 2025-11-21 06:38 | 2.1K | |
![[ ]](/icons/unknown.gif) | dawesebuleba 01_10_.xlsx | 2025-11-21 06:38 | 10K | |
![[IMG]](/icons/image2.gif) | U_don't_say.jpg | 2025-11-21 06:38 | 33K | |
![[IMG]](/icons/image2.gif) | Logo-Mail.jpg | 2025-11-21 06:38 | 61K | |
![[ ]](/icons/layout.gif) | ITM-Translation.pdf | 2025-11-21 06:38 | 28K | |
![[ ]](/icons/layout.gif) | HR ge - GEO.pdf | 2025-11-21 06:38 | 1.3M | |
![[ ]](/icons/layout.gif) | HR CV Database Offer.pdf | 2025-11-21 06:38 | 1.0M | |
![[ ]](/icons/unknown.gif) | Doc4(error3).docx | 2025-11-21 06:38 | 253K | |
![[ ]](/icons/unknown.gif) | Doc1(error 1).docx | 2025-11-21 06:38 | 285K | |
![[ ]](/icons/unknown.gif) | Doc1(error).docx | 2025-11-21 06:38 | 236K | |
![[IMG]](/icons/image2.gif) | ATT00013 (1).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00012 (5).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00011.png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00010 (1).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00009 (6).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00008 (5).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00007.png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00006 (1).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00005 (6).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | ATT00004 (5).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00003 (1).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00002 (8).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (10).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (704).jpg | 2025-11-21 06:38 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (465).png | 2025-11-21 06:38 | 50K | |
![[ ]](/icons/unknown.gif) | fizikuri piri samegrelo.xlsx | 2025-11-21 06:38 | 9.6K | |
![[ ]](/icons/unknown.gif) | bazebis struqtura.xlsx | 2025-11-21 06:38 | 23K | |
![[IMG]](/icons/image2.gif) | Word Art Translations.jpg | 2025-11-21 06:38 | 589K | |
![[ ]](/icons/unknown.gif) | MSREPORT 26-Sep-2014.xlsx | 2025-11-21 06:38 | 9.4M | |
![[ ]](/icons/unknown.gif) | ATT30225 | 2025-11-21 06:38 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00012 (4).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00012 (3).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00011 (5).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00011 (4).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00010 (5).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00010 (4).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00009 (5).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00009 (4).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00008 (4).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00008 (3).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00007 (5).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00007 (4).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00006 (5).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00006 (4).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00005 (5).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00005 (4).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00004 (4).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | ATT00004 (3).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | ATT00003 (4).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00003 (3).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00002 (7).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00002 (6).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (9).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (8).png | 2025-11-21 06:38 | 168 | |
![[ ]](/icons/unknown.gif) | sh_qartlis filiali.xlsx | 2025-11-21 06:38 | 9.6K | |
![[ ]](/icons/unknown.gif) | iuzerebi_.xlsx | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image014 (1).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image013 (1).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image012 (3).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image012 (1).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image011 (3).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image011 (2).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image010 (3).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image010 (1).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image009 (3).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image009 (2).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image008 (9).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image008 (2).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image008 (1).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image007 (8).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image007 (7).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image007 (6).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image006 (18).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image006 (8).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image006 (7).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image005 (17).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image005 (16).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image005 (15).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image004 (87).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image004 (13).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image004 (12).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image003 (167).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image003 (17).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image003 (16).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image002 (389).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (206).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image002 (23).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image001 (464).png | 2025-11-21 06:38 | 141K | |
![[IMG]](/icons/image2.gif) | image001 (463).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (462).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (47).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | Uქntitled.png | 2025-11-21 06:38 | 281K | |
![[ ]](/icons/unknown.gif) | Letter to Marina Darakhvelidze - 01 10 2014.doc | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | ATT00012 (2).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00011 (3).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00010 (3).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00010 (2).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00009 (3).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00008 (2).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00007 (3).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00006 (3).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00006 (2).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00005 (3).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00004 (2).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | ATT00003 (2).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00002 (5).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00002 (4).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (7).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (6).png | 2025-11-21 06:38 | 168 | |
![[ ]](/icons/unknown.gif) | წვდომის გაუქმება.xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | დუბლი 5 კლინიკური.xlsx | 2025-11-21 06:38 | 9.9K | |
![[IMG]](/icons/image2.gif) | image018 (1).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image017 (1).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image016 (1).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image015 (1).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image014.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image013.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image012 (2).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image011 (1).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image010.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image009 (1).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image008 (8).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image007 (5).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image006 (6).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image005 (14).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image004 (86).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image003 (166).png | 2025-11-21 06:38 | 158K | |
![[IMG]](/icons/image2.gif) | image003 (165).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (164).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image002 (388).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (387).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (205).png | 2025-11-21 06:38 | 133K | |
![[IMG]](/icons/image2.gif) | image001 (703).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (461).png | 2025-11-21 06:38 | 205K | |
![[IMG]](/icons/image2.gif) | image001 (460).png | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | Untitled (31) | 2025-11-21 06:38 | 0 | |
![[ ]](/icons/unknown.gif) | NotUpdatedProductsIssuanceModes02102014.xlsx | 2025-11-21 06:38 | 78K | |
![[IMG]](/icons/image2.gif) | ATT00014.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00013.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00012.png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00011 (2).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00010.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00009 (2).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00008.png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00007 (2).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00006.gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | ATT00005 (2).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00004.png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00003.png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00002 (1).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00001 (5).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | istoria.png | 2025-11-21 06:38 | 206K | |
![[IMG]](/icons/image2.gif) | image002 (386).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (385).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (702).jpg | 2025-11-21 06:38 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (701).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (700).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (699).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (459).png | 2025-11-21 06:38 | 217K | |
![[IMG]](/icons/image2.gif) | image001 (458).png | 2025-11-21 06:38 | 111K | |
![[IMG]](/icons/image2.gif) | image001 (457).png | 2025-11-21 06:38 | 7.7K | |
![[IMG]](/icons/image2.gif) | el_angarishgeba.png | 2025-11-21 06:38 | 229K | |
![[ ]](/icons/unknown.gif) | User management fields 03_10_14 -Copy - Copy.xlsx | 2025-11-21 06:38 | 14K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (28).xlsx | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00018.png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00018 (1).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00017.png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00017 (1).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00016.png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00016 (1).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00015.png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00015 (1).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00014.jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00014 (1).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00013.png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00013 (1).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | ATT00012.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00012 (1).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00011.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00011 (1).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00010.png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00010 (1).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00009.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00009 (1).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00008.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00008 (1).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00007.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00007 (1).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | ATT00006.png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00006 (1).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | ATT00005.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00005 (1).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00004.gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | ATT00004 (1).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | ATT00003.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00003 (1).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | ATT00002 (3).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00002 (2).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (4).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (3).png | 2025-11-21 06:38 | 168 | |
![[ ]](/icons/unknown.gif) | web services - სამედიცინო შემთხვევების რეგისტრაციის მოდული (CRM) v1_0.docx | 2025-11-21 06:38 | 132K | |
![[ ]](/icons/unknown.gif) | qvemo qartlifiikuripiri-06_10_2014.xlsx | 2025-11-21 06:38 | 13K | |
![[ ]](/icons/unknown.gif) | iuzerebi_აშორდია.xlsx | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image014.jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image013 (2).png | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image012.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image011.gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image010 (2).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image009.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image008.gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image007 (4).gif | 2025-11-21 06:38 | 1.2K | |
![[IMG]](/icons/image2.gif) | image006 (17).png | 2025-11-21 06:38 | 167 | |
![[IMG]](/icons/image2.gif) | image005 (13).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image004 (11).gif | 2025-11-21 06:38 | 43 | |
![[IMG]](/icons/image2.gif) | image003 (15).gif | 2025-11-21 06:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | image002 (204).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (456).png | 2025-11-21 06:38 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (455).png | 2025-11-21 06:38 | 77K | |
![[ ]](/icons/unknown.gif) | Tube Files.rar | 2025-11-21 06:38 | 9.3M | |
![[ ]](/icons/unknown.gif) | TubeBilling Files.rar | 2025-11-21 06:38 | 2.6M | |
![[ ]](/icons/unknown.gif) | Georgia HMIS Indicators Brainstorm.docx | 2025-11-21 06:38 | 29K | |
![[ ]](/icons/unknown.gif) | ABT OFFER_Final.PDF | 2025-11-21 06:38 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1_ (4).png | 2025-11-21 06:38 | 259K | |
![[ ]](/icons/unknown.gif) | სანიმუშო დოკუმენტი.docx | 2025-11-21 06:38 | 124K | |
![[IMG]](/icons/image2.gif) | untitled (9).bmp | 2025-11-21 06:38 | 3.7M | |
![[IMG]](/icons/image2.gif) | samxedro.bmp | 2025-11-21 06:38 | 3.7M | |
![[IMG]](/icons/image2.gif) | image001 (698).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (697).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (696).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (695).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (694).jpg | 2025-11-21 06:38 | 3.1K | |
![[ ]](/icons/unknown.gif) | gasworebuli.xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | User management fields (14).xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | Tub Transfers - September.xlsx | 2025-11-21 06:38 | 80K | |
![[ ]](/icons/unknown.gif) | პირველადი წყაროები.xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | user maia chachua.xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | user ნათია ხმელიძე.xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | user ნათია ხმელიძე (1).xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | statistic.rar | 2025-11-21 06:38 | 169K | |
![[IMG]](/icons/image2.gif) | image001 (693).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (692).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (691).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (690).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (689).jpg | 2025-11-21 06:38 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (454).png | 2025-11-21 06:38 | 49K | |
![[ ]](/icons/unknown.gif) | fizikuri piri 07_10_.xlsx | 2025-11-21 06:38 | 11K | |
![[ ]](/icons/unknown.gif) | User management fields 08_10_14 -Copy - Copy.xlsx | 2025-11-21 06:38 | 14K | |
![[ ]](/icons/unknown.gif) | SDI CA meeting Sept 17 2014.ppt | 2025-11-21 06:38 | 2.2M | |
![[ ]](/icons/unknown.gif) | ტრანზაქციები.xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | პირველწყაროები (2).xlsx | 2025-11-21 06:38 | 22K | |
![[ ]](/icons/layout.gif) | pirobebi.pdf | 2025-11-21 06:38 | 207K | |
![[ ]](/icons/unknown.gif) | iuzerebi 2 (1).xlsx | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (163).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (384).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (453).png | 2025-11-21 06:38 | 50K | |
![[ ]](/icons/unknown.gif) | error 09_10_2014_.docx | 2025-11-21 06:38 | 174K | |
![[IMG]](/icons/image2.gif) | abeloff.png | 2025-11-21 06:38 | 149K | |
![[ ]](/icons/unknown.gif) | User management fields (13).xlsx | 2025-11-21 06:38 | 13K | |
![[ ]](/icons/unknown.gif) | TbilisiEpidemiologists.xls | 2025-11-21 06:38 | 25K | |
![[ ]](/icons/unknown.gif) | Presentation3.pptx | 2025-11-21 06:38 | 83K | |
![[ ]](/icons/unknown.gif) | შევსების წესი.docx | 2025-11-21 06:38 | 27K | |
![[ ]](/icons/unknown.gif) | ფორმატი თანამშრომლები.xlsx | 2025-11-21 06:38 | 8.9K | |
![[ ]](/icons/unknown.gif) | პირველწყაროები (1).xlsx | 2025-11-21 06:38 | 24K | |
![[ ]](/icons/unknown.gif) | მედიკამენტების საანგარიშგებო ფორმა.docx | 2025-11-21 06:38 | 16K | |
![[ ]](/icons/unknown.gif) | ამბულატორია; სტაციონარი.docx | 2025-11-21 06:38 | 21K | |
![[ ]](/icons/unknown.gif) | iuzerebi 2.xlsx | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (85).png | 2025-11-21 06:38 | 33K | |
![[IMG]](/icons/image2.gif) | image002 (383).jpg | 2025-11-21 06:38 | 3.2K | |
![[ ]](/icons/unknown.gif) | image001.wmz | 2025-11-21 06:38 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (688).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (687).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (686).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (685).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (684).jpg | 2025-11-21 06:38 | 4.2K | |
![[ ]](/icons/unknown.gif) | Sensitive_Patients_With_Incorrect_Monitoring (1).xlsx | 2025-11-21 06:38 | 8.2K | |
![[ ]](/icons/unknown.gif) | Resistent_Patients_With_Incorrect_Monitoring (1).xlsx | 2025-11-21 06:38 | 8.3K | |
![[ ]](/icons/unknown.gif) | Referral Tasks (2).docx | 2025-11-21 06:38 | 15K | |
![[ ]](/icons/layout.gif) | RESUMEDavidMeladze (1).pdf | 2025-11-21 06:38 | 130K | |
![[ ]](/icons/unknown.gif) | PSC CIDC Presentation 2 CFR 200 (2)-9-15-14 (3).pptx | 2025-11-21 06:38 | 415K | |
![[ ]](/icons/unknown.gif) | Giorgi Varadashvili Eng.doc | 2025-11-21 06:38 | 36K | |
![[ ]](/icons/unknown.gif) | Copy of user ქობლიანიძე(2).xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | ATT11029 | 2025-11-21 06:38 | 0 | |
![[IMG]](/icons/image2.gif) | შრ.png | 2025-11-21 06:38 | 194K | |
![[ ]](/icons/unknown.gif) | ტუბერკულოზის მართვის მოდული - სახელმძღვანელო.docx | 2025-11-21 06:38 | 1.7M | |
![[IMG]](/icons/image2.gif) | mixailovi.png | 2025-11-21 06:38 | 165K | |
![[ ]](/icons/layout.gif) | mariami gonashvili.pdf | 2025-11-21 06:38 | 581K | |
![[IMG]](/icons/image2.gif) | image005 (47).png | 2025-11-21 06:38 | 239K | |
![[IMG]](/icons/image2.gif) | image004 (84).png | 2025-11-21 06:38 | 251K | |
![[IMG]](/icons/image2.gif) | image003 (129).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (382).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (381).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (380).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (203).png | 2025-11-21 06:38 | 239K | |
![[IMG]](/icons/image2.gif) | image001 (683).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (682).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (681).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (680).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (679).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (452).png | 2025-11-21 06:38 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (451).png | 2025-11-21 06:38 | 251K | |
![[IMG]](/icons/image2.gif) | image001 (450).png | 2025-11-21 06:38 | 59K | |
![[IMG]](/icons/image2.gif) | image001 (449).png | 2025-11-21 06:38 | 59K | |
![[IMG]](/icons/image2.gif) | error_r.png | 2025-11-21 06:38 | 119K | |
![[ ]](/icons/unknown.gif) | cv-Gaga Gogolauri - Eng.docx | 2025-11-21 06:38 | 22K | |
![[TXT]](/icons/text.gif) | Zaal Kavelashvili.html | 2025-11-21 06:38 | 18K | |
![[ ]](/icons/layout.gif) | RESUMEDavidMeladze.pdf | 2025-11-21 06:38 | 130K | |
![[ ]](/icons/unknown.gif) | Mikheil Akopovi CV.doc | 2025-11-21 06:38 | 45K | |
![[ ]](/icons/layout.gif) | I_Gaimarjvashvili (CV).pdf | 2025-11-21 06:38 | 41K | |
![[ ]](/icons/unknown.gif) | Givi Bibileishvili - resume.doc | 2025-11-21 06:38 | 53K | |
![[ ]](/icons/unknown.gif) | D_ Salukvadze - CV.doc | 2025-11-21 06:38 | 34K | |
![[ ]](/icons/unknown.gif) | CV Artem Gandilyan.doc | 2025-11-21 06:38 | 104K | |
![[ ]](/icons/unknown.gif) | Aleqsandre Miuleri2013.doc | 2025-11-21 06:38 | 159K | |
![[ ]](/icons/unknown.gif) | მოცემულ ფინანსურ ერთეულებზე თარიღი გადაწეულია წლის ბოლომდე.xlsx | 2025-11-21 06:38 | 15K | |
![[ ]](/icons/unknown.gif) | კონტრაქტიდან წაშლილები.xlsx | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (128).jpg | 2025-11-21 06:38 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (678).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (677).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (676).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (675).jpg | 2025-11-21 06:38 | 4.2K | |
![[ ]](/icons/unknown.gif) | Sensitive_Patients_With_Incorrect_Monitoring.xlsx | 2025-11-21 06:38 | 8.2K | |
![[ ]](/icons/unknown.gif) | Resistent_Patients_With_Incorrect_Monitoring.xlsx | 2025-11-21 06:38 | 8.3K | |
![[ ]](/icons/unknown.gif) | Assesment form blank final lasteka nino(3).xls | 2025-11-21 06:38 | 82K | |
![[ ]](/icons/unknown.gif) | Assesment form blank final lasteka nino(3) (1).xls | 2025-11-21 06:38 | 87K | |
![[IMG]](/icons/image2.gif) | image003 (162).png | 2025-11-21 06:38 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (161).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (379).jpg | 2025-11-21 06:38 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (674).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (673).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (672).jpg | 2025-11-21 06:38 | 4.2K | |
![[ ]](/icons/unknown.gif) | Variance 20141016.xlsx | 2025-11-21 06:38 | 10K | |
![[ ]](/icons/unknown.gif) | Referral Tasks (1).docx | 2025-11-21 06:38 | 18K | |
![[ ]](/icons/layout.gif) | EAC Slipsheet 2014.pdf | 2025-11-21 06:38 | 797K | |
![[ ]](/icons/unknown.gif) | დანართი_6.xlsx | 2025-11-21 06:38 | 53K | |
![[ ]](/icons/unknown.gif) | დანართი_6 გადარიცხვა დამრგვალებული.xls | 2025-11-21 06:38 | 237K | |
![[ ]](/icons/unknown.gif) | დანართი_6 გადარიცხვა დამრგვალებული (1).xls | 2025-11-21 06:38 | 242K | |
![[IMG]](/icons/image2.gif) | image005 (36).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (83).png | 2025-11-21 06:38 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (160).png | 2025-11-21 06:38 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (127).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (378).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (377).jpg | 2025-11-21 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (376).jpg | 2025-11-21 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (448).png | 2025-11-21 06:38 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (447).png | 2025-11-21 06:38 | 2.6K | |
![[ ]](/icons/unknown.gif) | epidemiologists.xls | 2025-11-21 06:38 | 53K | |
![[ ]](/icons/unknown.gif) | admins.xls | 2025-11-21 06:38 | 34K | |
![[ ]](/icons/layout.gif) | Mid-Year FY15 Award Highlights 10-16-2014.pdf | 2025-11-21 06:38 | 323K | |
![[ ]](/icons/unknown.gif) | პირველწყაროები.xlsx | 2025-11-21 06:38 | 24K | |
![[ ]](/icons/unknown.gif) | ვინ რაზე მუშაობს 2.xlsx | 2025-11-21 06:38 | 96K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (27).xlsx | 2025-11-21 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (126).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (125).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (124).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (123).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (122).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (121).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (202).png | 2025-11-21 06:38 | 134K | |
![[IMG]](/icons/image2.gif) | image002 (201).png | 2025-11-21 06:38 | 134K | |
![[IMG]](/icons/image2.gif) | image002 (200).png | 2025-11-21 06:38 | 134K | |
![[IMG]](/icons/image2.gif) | image002 (199).png | 2025-11-21 06:38 | 134K | |
![[IMG]](/icons/image2.gif) | image002 (198).png | 2025-11-21 06:38 | 134K | |
![[IMG]](/icons/image2.gif) | image002 (197).png | 2025-11-21 06:38 | 134K | |
![[IMG]](/icons/image2.gif) | image001 (671).jpg | 2025-11-21 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (446).png | 2025-11-21 06:38 | 70K | |
![[IMG]](/icons/image2.gif) | image001 (445).png | 2025-11-21 06:38 | 70K | |
![[IMG]](/icons/image2.gif) | image001 (444).png | 2025-11-21 06:38 | 70K | |
![[IMG]](/icons/image2.gif) | image001 (443).png | 2025-11-21 06:38 | 70K | |
![[IMG]](/icons/image2.gif) | image001 (442).png | 2025-11-21 06:38 | 70K | |
![[IMG]](/icons/image2.gif) | image001 (441).png | 2025-11-21 06:38 | 70K | |
![[IMG]](/icons/image2.gif) | chapidze.png | 2025-11-21 06:38 | 240K | |
![[ ]](/icons/unknown.gif) | CRA_Base.docx | 2025-11-21 06:38 | 30K | |
![[ ]](/icons/unknown.gif) | 33 kodificirebuli.rtf | 2025-11-21 06:38 | 373K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (26).xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (25).xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (24).xlsx | 2025-11-21 06:38 | 12K | |
![[ ]](/icons/unknown.gif) | user-მაყაშვილი.xlsx | 2025-11-21 06:37 | 9.9K | |
![[IMG]](/icons/image2.gif) | image003 (120).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (196).png | 2025-11-21 06:37 | 72K | |
![[IMG]](/icons/image2.gif) | image001 (670).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (669).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (440).png | 2025-11-21 06:37 | 129K | |
![[ ]](/icons/unknown.gif) | achara.xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | Workshop_Agenda - 2014 September_ENG.docx | 2025-11-21 06:37 | 129K | |
![[ ]](/icons/unknown.gif) | Tub Person Accounts.xlsx | 2025-11-21 06:37 | 121K | |
![[ ]](/icons/unknown.gif) | Server Error.docx | 2025-11-21 06:37 | 15K | |
![[ ]](/icons/unknown.gif) | Referral Tasks.docx | 2025-11-21 06:37 | 19K | |
![[ ]](/icons/unknown.gif) | List of Participants.xlsx | 2025-11-21 06:37 | 14K | |
![[ ]](/icons/unknown.gif) | Copy of List of Participants.xlsx | 2025-11-21 06:37 | 15K | |
![[ ]](/icons/unknown.gif) | 33 -ის ცვლილების პროექტი - 20_10_2014(2).doc | 2025-11-21 06:37 | 85K | |
![[ ]](/icons/unknown.gif) | დანართი 1 2- last 20_ 10_2014 (2) (1).xls | 2025-11-21 06:37 | 96K | |
![[IMG]](/icons/image2.gif) | image002 (375).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (668).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (667).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (666).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (665).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (664).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (439).png | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (438).png | 2025-11-21 06:37 | 15K | |
![[ ]](/icons/unknown.gif) | User management fields 17_10_14 -Copy - Copy.xlsx | 2025-11-21 06:37 | 14K | |
![[IMG]](/icons/image2.gif) | Untitled-1.png | 2025-11-21 06:37 | 252K | |
![[IMG]](/icons/image2.gif) | ICD.png | 2025-11-21 06:37 | 176K | |
![[ ]](/icons/unknown.gif) | HSSP Modules.xlsx | 2025-11-21 06:37 | 21K | |
![[IMG]](/icons/image2.gif) | tiko azalaZes (1).djvu | 2025-11-21 06:37 | 58K | |
![[IMG]](/icons/image2.gif) | image009 (6).png | 2025-11-21 06:37 | 57K | |
![[IMG]](/icons/image2.gif) | image008 (7).png | 2025-11-21 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | image007 (18).png | 2025-11-21 06:37 | 59K | |
![[IMG]](/icons/image2.gif) | image006 (16).png | 2025-11-21 06:37 | 21K | |
![[IMG]](/icons/image2.gif) | image005 (46).png | 2025-11-21 06:37 | 23K | |
![[IMG]](/icons/image2.gif) | image004 (82).png | 2025-11-21 06:37 | 52K | |
![[IMG]](/icons/image2.gif) | image003 (159).png | 2025-11-21 06:37 | 68K | |
![[IMG]](/icons/image2.gif) | image002 (195).png | 2025-11-21 06:37 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (663).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (437).png | 2025-11-21 06:37 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (436).png | 2025-11-21 06:37 | 52K | |
![[IMG]](/icons/image2.gif) | image (13).png | 2025-11-21 06:37 | 75K | |
![[IMG]](/icons/image2.gif) | image (12).png | 2025-11-21 06:37 | 78K | |
![[IMG]](/icons/image2.gif) | image (11).png | 2025-11-21 06:37 | 81K | |
![[IMG]](/icons/image2.gif) | image (10).png | 2025-11-21 06:37 | 189K | |
![[IMG]](/icons/image2.gif) | image (9).png | 2025-11-21 06:37 | 92K | |
![[IMG]](/icons/image2.gif) | image (8).png | 2025-11-21 06:37 | 222K | |
![[IMG]](/icons/image2.gif) | image (7).png | 2025-11-21 06:37 | 109K | |
![[IMG]](/icons/image2.gif) | image (6).png | 2025-11-21 06:37 | 88K | |
![[IMG]](/icons/image2.gif) | image (5).png | 2025-11-21 06:37 | 256K | |
![[ ]](/icons/unknown.gif) | Workshop_Agenda - 2014 September_GEO (1).docx | 2025-11-21 06:37 | 132K | |
![[ ]](/icons/unknown.gif) | TB Module_Tako.xls | 2025-11-21 06:37 | 25K | |
![[ ]](/icons/unknown.gif) | Handover Scenarios V2.docx | 2025-11-21 06:37 | 72K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation-(GUDAURI)-GEO.pptx | 2025-11-21 06:37 | 2.0M | |
![[ ]](/icons/unknown.gif) | Call centre registry_NCDC_IMM_edited_TK_16_10_2014 (1).xlsx | 2025-11-21 06:37 | 9.3K | |
![[ ]](/icons/unknown.gif) | Call centre registry_NCDC_IMM_edited_TK_16 10 2014.xlsx | 2025-11-21 06:37 | 15K | |
![[ ]](/icons/unknown.gif) | მოდულები მოხმარებლები და მათი როლები (1).docx | 2025-11-21 06:37 | 38K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (23).xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (22).xlsx | 2025-11-21 06:37 | 13K | |
![[ ]](/icons/unknown.gif) | user - ციალა ნიაზაშვილი.xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | raw (2).xlsx | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (158).png | 2025-11-21 06:37 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (374).jpg | 2025-11-21 06:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (373).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (662).jpg | 2025-11-21 06:37 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (435).png | 2025-11-21 06:37 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (434).png | 2025-11-21 06:37 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (433).png | 2025-11-21 06:37 | 65K | |
![[ ]](/icons/unknown.gif) | User management fields 24_10_14 -Copy - Copy.xlsx | 2025-11-21 06:37 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields 24_10_14 -Copy - Copy (1).xlsx | 2025-11-21 06:37 | 14K | |
![[ ]](/icons/unknown.gif) | Handover Scenarios V3.docx | 2025-11-21 06:37 | 74K | |
![[ ]](/icons/unknown.gif) | ATT10614 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (21).xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (20).xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | user- გოგიჩაიშვილი.xlsx | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | tubi.PNG | 2025-11-21 06:37 | 57K | |
![[IMG]](/icons/image2.gif) | image009 (5).png | 2025-11-21 06:37 | 57K | |
![[IMG]](/icons/image2.gif) | image009 (4).png | 2025-11-21 06:37 | 57K | |
![[IMG]](/icons/image2.gif) | image008 (6).png | 2025-11-21 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | image008 (5).png | 2025-11-21 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | image007 (17).png | 2025-11-21 06:37 | 59K | |
![[IMG]](/icons/image2.gif) | image007 (16).png | 2025-11-21 06:37 | 59K | |
![[IMG]](/icons/image2.gif) | image006 (15).png | 2025-11-21 06:37 | 21K | |
![[IMG]](/icons/image2.gif) | image006 (14).png | 2025-11-21 06:37 | 21K | |
![[IMG]](/icons/image2.gif) | image005 (45).png | 2025-11-21 06:37 | 23K | |
![[IMG]](/icons/image2.gif) | image005 (44).png | 2025-11-21 06:37 | 23K | |
![[IMG]](/icons/image2.gif) | image004 (81).png | 2025-11-21 06:37 | 52K | |
![[IMG]](/icons/image2.gif) | image004 (80).png | 2025-11-21 06:37 | 52K | |
![[IMG]](/icons/image2.gif) | image003 (157).png | 2025-11-21 06:37 | 68K | |
![[IMG]](/icons/image2.gif) | image003 (156).png | 2025-11-21 06:37 | 68K | |
![[IMG]](/icons/image2.gif) | image002 (372).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (194).png | 2025-11-21 06:37 | 35K | |
![[IMG]](/icons/image2.gif) | image002 (193).png | 2025-11-21 06:37 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (432).png | 2025-11-21 06:37 | 52K | |
![[IMG]](/icons/image2.gif) | image001 (431).png | 2025-11-21 06:37 | 52K | |
![[ ]](/icons/unknown.gif) | MediationTasks.docx | 2025-11-21 06:37 | 20K | |
![[ ]](/icons/unknown.gif) | Draft MOU MoLHSA and HSSP_GEO.docx | 2025-11-21 06:37 | 183K | |
![[ ]](/icons/unknown.gif) | Call centre registry_NCDC_IMM_edited_TK_16_10_2014.xlsx | 2025-11-21 06:37 | 37K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_ (2).xlsx | 2025-11-21 06:37 | 13K | |
![[ ]](/icons/unknown.gif) | saregistracio_nimushi.xlsx | 2025-11-21 06:37 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (155).png | 2025-11-21 06:37 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (371).jpg | 2025-11-21 06:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (370).jpg | 2025-11-21 06:37 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (661).jpg | 2025-11-21 06:37 | 3.1K | |
![[ ]](/icons/unknown.gif) | Workshop_Agenda - 2014 September_GEO.docx | 2025-11-21 06:37 | 132K | |
![[ ]](/icons/unknown.gif) | Untitled (30) | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | MOU MoLHSA and HSSP_GEO_28 10 2014_KT EDITS_.docx | 2025-11-21 06:37 | 253K | |
![[IMG]](/icons/image2.gif) | MOH Logo-GEO.png | 2025-11-21 06:37 | 75K | |
![[IMG]](/icons/image2.gif) | MOH Logo-ENG.png | 2025-11-21 06:37 | 67K | |
![[ ]](/icons/unknown.gif) | Draft MOU MoLHSA and HSSP_GEO (27_10_2014).docx | 2025-11-21 06:37 | 261K | |
![[ ]](/icons/binary.gif) | ATT00001.bin | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/layout.gif) | რეესტრი 11037.pdf | 2025-11-21 06:37 | 1.0M | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_ (1).xlsx | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (369).jpg | 2025-11-21 06:37 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (660).jpg | 2025-11-21 06:37 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (659).jpg | 2025-11-21 06:37 | 15K | |
![[ ]](/icons/unknown.gif) | User management fields 29_10_14 -Copy - Copy.xlsx | 2025-11-21 06:37 | 14K | |
![[IMG]](/icons/image2.gif) | Untitled (34).png | 2025-11-21 06:37 | 193K | |
![[ ]](/icons/unknown.gif) | Handover Scenarios V4.docx | 2025-11-21 06:37 | 75K | |
![[ ]](/icons/unknown.gif) | HMIS _Oct 16, 2014.pptx | 2025-11-21 06:37 | 964K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation-(GUDAURI - MOU)-GEO_28_10_2014.pptx | 2025-11-21 06:37 | 2.0M | |
![[ ]](/icons/unknown.gif) | ATT78870 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | ATT64342 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | ATT45854 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | ATT37528 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | ATT29956 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | ATT18712 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | ATT10454 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | ATT04289 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | მიმართვების ადმინისტრირების მოდული (GM) v2_3 (1).docx | 2025-11-21 06:37 | 2.1M | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორ ჩენილი დაწესებ_.xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (19).xlsx | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | tiko azalaZes.djvu | 2025-11-21 06:37 | 58K | |
![[IMG]](/icons/image2.gif) | log2.PNG | 2025-11-21 06:37 | 118K | |
![[IMG]](/icons/image2.gif) | log1.PNG | 2025-11-21 06:37 | 190K | |
![[IMG]](/icons/image2.gif) | image003 (154).png | 2025-11-21 06:37 | 54K | |
![[IMG]](/icons/image2.gif) | image002 (192).png | 2025-11-21 06:37 | 49K | |
![[IMG]](/icons/image2.gif) | image001 (658).jpg | 2025-11-21 06:37 | 15K | |
![[IMG]](/icons/image2.gif) | error (19).png | 2025-11-21 06:37 | 233K | |
![[ ]](/icons/unknown.gif) | UserAccountForSargisi.xlsx | 2025-11-21 06:37 | 10K | |
![[ ]](/icons/unknown.gif) | UserAccountForSargisi (1).xlsx | 2025-11-21 06:37 | 10K | |
![[IMG]](/icons/image2.gif) | 24 saatiani.png | 2025-11-21 06:37 | 208K | |
![[ ]](/icons/unknown.gif) | სამშობიარო - მთლიანი (4).xlsx | 2025-11-21 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | ინფო (1).png | 2025-11-21 06:37 | 212K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (18).xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | menu HSSP.xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | lkmkm.xls | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (153).png | 2025-11-21 06:37 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (368).jpg | 2025-11-21 06:37 | 108K | |
![[IMG]](/icons/image2.gif) | image002 (367).jpg | 2025-11-21 06:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (657).jpg | 2025-11-21 06:37 | 4.2K | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (9).pdf | 2025-11-21 06:37 | 388K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation-(GUDAURI - MOU)-GEO_29_10_2014.pptx | 2025-11-21 06:37 | 2.1M | |
![[ ]](/icons/unknown.gif) | ATT45830 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | ზედამხვედველობის პრეზენტაცია.ppt | 2025-11-21 06:37 | 1.0M | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (17).xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (16).xlsx | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image005 (43).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (79).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (152).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (151).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (366).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (365).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (191).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (190).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (656).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (430).png | 2025-11-21 06:37 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (429).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (428).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | errorrr.png | 2025-11-21 06:37 | 139K | |
![[ ]](/icons/unknown.gif) | TuberculosisExport31 10 2014_17 07 16.xlsx | 2025-11-21 06:37 | 141K | |
![[ ]](/icons/unknown.gif) | Providers (5).xlsx | 2025-11-21 06:37 | 23K | |
![[ ]](/icons/unknown.gif) | Mtg Summary_Nov 1-2 2014.docx | 2025-11-21 06:37 | 20K | |
![[ ]](/icons/unknown.gif) | HMIS Presentation-(GUDAURI - MOU)- V3.pptx | 2025-11-21 06:37 | 2.4M | |
![[ ]](/icons/unknown.gif) | Chapter1.xlsx | 2025-11-21 06:37 | 145K | |
![[ ]](/icons/unknown.gif) | ATT93315 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | სამშობიარო - მთლიანი (3).xlsx | 2025-11-21 06:37 | 18K | |
![[ ]](/icons/unknown.gif) | სამშობიარო - მთლიანი (2).xlsx | 2025-11-21 06:37 | 18K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (15).xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (14).xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (13).xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | user- 0411.xlsx | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (655).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (654).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (653).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (427).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (426).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (425).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | Untitled (33).png | 2025-11-21 06:37 | 212K | |
![[IMG]](/icons/image2.gif) | ATT00002 (1).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | ATT00001 (2).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | 123 (1).png | 2025-11-21 06:37 | 244K | |
![[ ]](/icons/unknown.gif) | 31 აგვისტოს მდგომარეობით სენსიტიური ბენეფიციარების სია.xlsx | 2025-11-21 06:37 | 256K | |
![[IMG]](/icons/image2.gif) | 2 (13).png | 2025-11-21 06:37 | 233K | |
![[ ]](/icons/unknown.gif) | 1_damtkicebis gilaki ar aris.dib | 2025-11-21 06:37 | 182K | |
![[ ]](/icons/unknown.gif) | სენსიტიური პაციენტები დამატებული 03-11.xlsx | 2025-11-21 06:37 | 9.8K | |
![[ ]](/icons/unknown.gif) | საანგარიშგებო ფორმა, განმარტებები.xlsx | 2025-11-21 06:37 | 24K | |
![[ ]](/icons/unknown.gif) | პროცესი.docx | 2025-11-21 06:37 | 113K | |
![[ ]](/icons/unknown.gif) | ვისაც გადაერიცხათ თანხები.xlsx | 2025-11-21 06:37 | 33K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (12).xlsx | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | misagebi.png | 2025-11-21 06:37 | 149K | |
![[IMG]](/icons/image2.gif) | image002 (364).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (652).jpg | 2025-11-21 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (651).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (650).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (424).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (423).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (422).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (421).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (420).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (419).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (418).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (417).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (416).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (415).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (414).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | damushavebuli.png | 2025-11-21 06:37 | 135K | |
![[ ]](/icons/unknown.gif) | სამშობიარო - მთლიანი (1).xlsx | 2025-11-21 06:37 | 20K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (11).xlsx | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (363).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (649).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (648).jpg | 2025-11-21 06:37 | 9.6K | |
![[IMG]](/icons/image2.gif) | image001 (647).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (646).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (645).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (413).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (412).png | 2025-11-21 06:37 | 171K | |
![[IMG]](/icons/image2.gif) | Untitled (32).png | 2025-11-21 06:37 | 270K | |
![[ ]](/icons/unknown.gif) | Tbilisi Providers.xlsx | 2025-11-21 06:37 | 99K | |
![[ ]](/icons/unknown.gif) | Patient Paied Amounts.xlsx | 2025-11-21 06:37 | 25K | |
![[ ]](/icons/unknown.gif) | სამშობიარო - მთლიანი.xlsx | 2025-11-21 06:37 | 20K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (16).jpg | 2025-11-21 06:37 | 823 | |
![[IMG]](/icons/image2.gif) | image003 (150).png | 2025-11-21 06:37 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (362).jpg | 2025-11-21 06:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (361).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (360).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (359).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (644).jpg | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (643).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (642).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (641).jpg | 2025-11-21 06:37 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (411).png | 2025-11-21 06:37 | 124K | |
![[IMG]](/icons/image2.gif) | image001 (410).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (409).png | 2025-11-21 06:37 | 11K | |
![[ ]](/icons/unknown.gif) | Tbilisi Providers, დანართი N2.xlsx | 2025-11-21 06:37 | 131K | |
![[ ]](/icons/unknown.gif) | Providers (4).xlsx | 2025-11-21 06:37 | 16K | |
![[ ]](/icons/unknown.gif) | სამშობიარო_რაიონები_06_11_2014_თამთა.xlsx | 2025-11-21 06:37 | 19K | |
![[ ]](/icons/unknown.gif) | სამშობიარო_რაიონები_06_11_2014_თამთა (1).xlsx | 2025-11-21 06:37 | 23K | |
![[ ]](/icons/unknown.gif) | სამშობიარო_რაიონები_06 11 2014_თამთა (1).xlsx | 2025-11-21 06:37 | 23K | |
![[ ]](/icons/unknown.gif) | კომისიის ქუდი, დანართი N1.xlsx | 2025-11-21 06:37 | 18K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (10).xlsx | 2025-11-21 06:37 | 11K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (9).xlsx | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (358).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (357).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (356).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (355).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (354).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (640).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (639).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (408).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (407).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (406).png | 2025-11-21 06:37 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (405).png | 2025-11-21 06:37 | 21K | |
![[IMG]](/icons/image2.gif) | error (18).png | 2025-11-21 06:37 | 331K | |
![[ ]](/icons/unknown.gif) | eroooooor.docx | 2025-11-21 06:37 | 159K | |
![[ ]](/icons/unknown.gif) | Tub Transfers - October.xlsx | 2025-11-21 06:37 | 42K | |
![[ ]](/icons/unknown.gif) | 218.docx | 2025-11-21 06:37 | 181K | |
![[ ]](/icons/unknown.gif) | ნარკომანიის მოდულის ტესტირების შედეგები.docx | 2025-11-21 06:37 | 48K | |
![[ ]](/icons/unknown.gif) | ნარკომანიის მოდულის ტესტირების შედეგები (1).docx | 2025-11-21 06:37 | 47K | |
![[IMG]](/icons/image2.gif) | qauqmebulze 3.png | 2025-11-21 06:37 | 172K | |
![[ ]](/icons/unknown.gif) | immunization beneficiaries.xlsx | 2025-11-21 06:37 | 1.3M | |
![[ ]](/icons/unknown.gif) | immunization beneficiaries (1).xlsx | 2025-11-21 06:37 | 1.3M | |
![[IMG]](/icons/image2.gif) | image006 (31).jpg | 2025-11-21 06:37 | 110K | |
![[IMG]](/icons/image2.gif) | image004 (73).jpg | 2025-11-21 06:37 | 9.4K | |
![[IMG]](/icons/image2.gif) | image003 (119).jpg | 2025-11-21 06:37 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (118).jpg | 2025-11-21 06:37 | 7.9K | |
![[IMG]](/icons/image2.gif) | image003 (117).jpg | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (638).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (637).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (636).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (635).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (634).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (633).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (632).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (631).jpg | 2025-11-21 06:37 | 4.2K | |
![[ ]](/icons/layout.gif) | ATLAS-FY15-Goals-Quick-Reference-Supervisor (2).pdf | 2025-11-21 06:37 | 181K | |
![[ ]](/icons/layout.gif) | ATLAS-FY15-Goals-Quick-Reference-Employee (2).pdf | 2025-11-21 06:37 | 107K | |
![[IMG]](/icons/image2.gif) | 2 (12).png | 2025-11-21 06:37 | 166K | |
![[IMG]](/icons/image2.gif) | 1 (14).png | 2025-11-21 06:37 | 171K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (8).xlsx | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | mshobiaroba.png | 2025-11-21 06:37 | 196K | |
![[IMG]](/icons/image2.gif) | image002 (353).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (630).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (629).jpg | 2025-11-21 06:37 | 4.2K | |
![[ ]](/icons/unknown.gif) | dublirebuli.xlsx | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (78).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (116).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (352).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (351).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (628).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (627).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (626).jpg | 2025-11-21 06:37 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (404).png | 2025-11-21 06:37 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (403).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (402).png | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | error 12_11_2014.docx | 2025-11-21 06:37 | 186K | |
![[ ]](/icons/unknown.gif) | el_ moduli (3).xls | 2025-11-21 06:37 | 26K | |
![[ ]](/icons/unknown.gif) | ZaaliKavelashvili.docx | 2025-11-21 06:37 | 6.9K | |
![[ ]](/icons/unknown.gif) | 30_09_2014 - 31_10_2014 ყველა შემთხვევა.xlsx | 2025-11-21 06:37 | 224K | |
![[ ]](/icons/unknown.gif) | 30_09_2014 - 31_10_2014 დაკავშირებული შემთხვევები.xlsx | 2025-11-21 06:37 | 90K | |
![[ ]](/icons/unknown.gif) | +1-2 - Task for Developer.rar | 2025-11-21 06:37 | 41K | |
![[IMG]](/icons/image2.gif) | motxovna 69885.png | 2025-11-21 06:37 | 164K | |
![[IMG]](/icons/image2.gif) | klinikis mxaresdatvalierebit.png | 2025-11-21 06:37 | 166K | |
![[IMG]](/icons/image2.gif) | image003 (115).jpg | 2025-11-21 06:37 | 24K | |
![[IMG]](/icons/image2.gif) | image002 (350).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (349).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (348).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (347).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (625).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (401).png | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (400).png | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (399).png | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (398).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (397).png | 2025-11-21 06:37 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (396).png | 2025-11-21 06:37 | 167K | |
![[IMG]](/icons/image2.gif) | gadacemulia gansaxilvelad-klinikis mxares.png | 2025-11-21 06:37 | 188K | |
![[IMG]](/icons/image2.gif) | dadebiti pasuxi 69885.png | 2025-11-21 06:37 | 187K | |
![[IMG]](/icons/image2.gif) | 123456 (2).png | 2025-11-21 06:37 | 177K | |
![[ ]](/icons/unknown.gif) | 2 - Task for Developer.rar | 2025-11-21 06:37 | 13K | |
![[ ]](/icons/unknown.gif) | სამშობიარო_რაიონები_06 11 2014_თამთა.xlsx | 2025-11-21 06:37 | 21K | |
![[IMG]](/icons/image2.gif) | image033.jpg | 2025-11-21 06:37 | 2.3K | |
![[IMG]](/icons/image2.gif) | image032.png | 2025-11-21 06:37 | 25K | |
![[IMG]](/icons/image2.gif) | image031.png | 2025-11-21 06:37 | 26K | |
![[IMG]](/icons/image2.gif) | image030.png | 2025-11-21 06:37 | 23K | |
![[IMG]](/icons/image2.gif) | image029.png | 2025-11-21 06:37 | 30K | |
![[IMG]](/icons/image2.gif) | image028.png | 2025-11-21 06:37 | 91K | |
![[IMG]](/icons/image2.gif) | image027.png | 2025-11-21 06:37 | 2.3K | |
![[ ]](/icons/unknown.gif) | image026.emz | 2025-11-21 06:37 | 77K | |
![[IMG]](/icons/image2.gif) | image025.jpg | 2025-11-21 06:37 | 7.2K | |
![[IMG]](/icons/image2.gif) | image024.png | 2025-11-21 06:37 | 37K | |
![[IMG]](/icons/image2.gif) | image022.jpg | 2025-11-21 06:37 | 3.7K | |
![[IMG]](/icons/image2.gif) | image021.png | 2025-11-21 06:37 | 27K | |
![[IMG]](/icons/image2.gif) | image020.png | 2025-11-21 06:37 | 23K | |
![[IMG]](/icons/image2.gif) | image018.png | 2025-11-21 06:37 | 36K | |
![[IMG]](/icons/image2.gif) | image016.png | 2025-11-21 06:37 | 24K | |
![[IMG]](/icons/image2.gif) | image015.png | 2025-11-21 06:37 | 28K | |
![[IMG]](/icons/image2.gif) | image013 (1).png | 2025-11-21 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | image011 (3).png | 2025-11-21 06:37 | 26K | |
![[IMG]](/icons/image2.gif) | image009 (3).png | 2025-11-21 06:37 | 34K | |
![[IMG]](/icons/image2.gif) | image008 (4).png | 2025-11-21 06:37 | 34K | |
![[IMG]](/icons/image2.gif) | image007 (15).png | 2025-11-21 06:37 | 39K | |
![[IMG]](/icons/image2.gif) | image006 (13).png | 2025-11-21 06:37 | 33K | |
![[IMG]](/icons/image2.gif) | image005 (42).png | 2025-11-21 06:37 | 45K | |
![[IMG]](/icons/image2.gif) | image003 (149).png | 2025-11-21 06:37 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (346).jpg | 2025-11-21 06:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (624).jpg | 2025-11-21 06:37 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (395).png | 2025-11-21 06:37 | 15K | |
![[ ]](/icons/unknown.gif) | Submissions.xlsx | 2025-11-21 06:37 | 207K | |
![[ ]](/icons/unknown.gif) | RE - | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | Persons.xlsx | 2025-11-21 06:37 | 490K | |
![[ ]](/icons/unknown.gif) | ტრანზაქციები-22001010961__1_.xls | 2025-11-21 06:37 | 35K | |
![[IMG]](/icons/image2.gif) | ინფორმაცია პოლიკლინიკაში რეგისტრაციის შესახებ (USAID).PNG | 2025-11-21 06:37 | 22K | |
![[IMG]](/icons/image2.gif) | image004 (72).jpg | 2025-11-21 06:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (345).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (344).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (623).jpg | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (394).png | 2025-11-21 06:37 | 65K | |
![[IMG]](/icons/image2.gif) | image001 (393).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (392).png | 2025-11-21 06:37 | 7.7K | |
![[ ]](/icons/unknown.gif) | User management fields 14_11_14 -Copy - Copy.xlsx | 2025-11-21 06:37 | 14K | |
![[IMG]](/icons/image2.gif) | 1510353_873385612674056_5247496402282512922_n.jpg | 2025-11-21 06:37 | 53K | |
![[IMG]](/icons/image2.gif) | image002 (343).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (342).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (622).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (621).jpg | 2025-11-21 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (391).png | 2025-11-21 06:37 | 53K | |
![[IMG]](/icons/image2.gif) | image001 (390).png | 2025-11-21 06:37 | 53K | |
![[IMG]](/icons/image2.gif) | image001 (389).png | 2025-11-21 06:37 | 11K | |
![[ ]](/icons/unknown.gif) | angarishgebis tarigi migeba chabarebis aqtis mixedvit.xlsx | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | ERROR MADONA.png | 2025-11-21 06:37 | 203K | |
![[ ]](/icons/unknown.gif) | u10DBu10D4u10E0u10D8u10D8u10E1 u10D9u10DDu10DBu10D8u10E1u10D8u10D0.xlsx | 2025-11-21 06:37 | 36K | |
![[IMG]](/icons/image2.gif) | image006 (30).jpg | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image005 (41).png | 2025-11-21 06:37 | 82K | |
![[IMG]](/icons/image2.gif) | image005 (35).jpg | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (71).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (148).png | 2025-11-21 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (341).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (620).jpg | 2025-11-21 06:37 | 344 | |
![[IMG]](/icons/image2.gif) | image001 (619).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (618).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (388).png | 2025-11-21 06:37 | 15K | |
![[ ]](/icons/unknown.gif) | User management fields 18_11_14 -Copy - Copy.xlsx | 2025-11-21 06:37 | 14K | |
![[ ]](/icons/unknown.gif) | Infotrieve QuickReferenceGuide.PDF | 2025-11-21 06:37 | 162K | |
![[ ]](/icons/layout.gif) | Infotrieve EndUserReferenceGuide.pdf | 2025-11-21 06:37 | 510K | |
![[ ]](/icons/layout.gif) | Certificate (2).pdf | 2025-11-21 06:37 | 118K | |
![[IMG]](/icons/image2.gif) | image005 (40).png | 2025-11-21 06:37 | 63K | |
![[IMG]](/icons/image2.gif) | image004 (77).png | 2025-11-21 06:37 | 61K | |
![[IMG]](/icons/image2.gif) | image003 (147).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (114).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (189).png | 2025-11-21 06:37 | 63K | |
![[IMG]](/icons/image2.gif) | image002 (188).png | 2025-11-21 06:37 | 63K | |
![[IMG]](/icons/image2.gif) | image001 (617).jpg | 2025-11-21 06:37 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (616).jpg | 2025-11-21 06:37 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (615).jpg | 2025-11-21 06:37 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (614).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (613).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (612).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (611).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (610).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (387).png | 2025-11-21 06:37 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (386).png | 2025-11-21 06:37 | 61K | |
![[ ]](/icons/unknown.gif) | UserMedison2.xlsx | 2025-11-21 06:37 | 11K | |
![[ ]](/icons/unknown.gif) | User-Medison.xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | User-Medison (1).xlsx | 2025-11-21 06:37 | 10K | |
![[IMG]](/icons/image2.gif) | 4 (3).png | 2025-11-21 06:37 | 198K | |
![[IMG]](/icons/image2.gif) | 3_.png | 2025-11-21 06:37 | 179K | |
![[IMG]](/icons/image2.gif) | 2 (11).png | 2025-11-21 06:37 | 175K | |
![[IMG]](/icons/image2.gif) | 1_ (3).png | 2025-11-21 06:37 | 204K | |
![[ ]](/icons/unknown.gif) | user - new (1).xlsx | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (146).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (145).png | 2025-11-21 06:37 | 63K | |
![[IMG]](/icons/image2.gif) | image002 (187).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (186).png | 2025-11-21 06:37 | 61K | |
![[IMG]](/icons/image2.gif) | image001 (609).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (608).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (607).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (385).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | Untitled (31).png | 2025-11-21 06:37 | 129K | |
![[ ]](/icons/unknown.gif) | ImmunizationExcels (1).rar | 2025-11-21 06:37 | 11M | |
![[ ]](/icons/unknown.gif) | ATT71202 | 2025-11-21 06:37 | 0 | |
![[ ]](/icons/unknown.gif) | შერეული დაწესებულებები.xlsx | 2025-11-21 06:37 | 15K | |
![[ ]](/icons/unknown.gif) | მხოლოდ შერეულ დაწესებულებაში რეგისტრირებული.xlsx | 2025-11-21 06:37 | 2.7M | |
![[ ]](/icons/unknown.gif) | დუბლირებული ბენეფიციარები (7).xlsx | 2025-11-21 06:37 | 6.0M | |
![[ ]](/icons/unknown.gif) | დუბლირებული ბენეფიციარები (6).xlsx | 2025-11-21 06:37 | 6.0M | |
![[ ]](/icons/unknown.gif) | დუბლირებული ბენეფიციარები (5).xlsx | 2025-11-21 06:37 | 6.0M | |
![[ ]](/icons/unknown.gif) | ბენეფიციარები ვისაც გაკეთებული აქვს არასამშობიარო აცრა საკუთარ დაწ_ ში.xlsx | 2025-11-21 06:37 | 603K | |
![[ ]](/icons/unknown.gif) | აცრილი ბენეფიციარები აცრებით.xlsx | 2025-11-21 06:37 | 5.5M | |
![[ ]](/icons/unknown.gif) | wvdomis minicheba.xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | wvdoma.xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | user - new.xlsx | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (144).png | 2025-11-21 06:37 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (340).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (339).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (338).jpg | 2025-11-21 06:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (337).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (185).png | 2025-11-21 06:37 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (606).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (605).jpg | 2025-11-21 06:37 | 20K | |
![[IMG]](/icons/image2.gif) | image001 (384).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (383).png | 2025-11-21 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (46).gif | 2025-11-21 06:37 | 15K | |
![[ ]](/icons/unknown.gif) | Tatas eleqtronuli modulisaTvis.docx | 2025-11-21 06:37 | 101K | |
![[ ]](/icons/unknown.gif) | Recruitment.ppt | 2025-11-21 06:37 | 1.0M | |
![[ ]](/icons/unknown.gif) | Recommendation.rar | 2025-11-21 06:37 | 5.0M | |
![[ ]](/icons/unknown.gif) | ImmunizationExcels.rar | 2025-11-21 06:37 | 11M | |
![[ ]](/icons/unknown.gif) | სამშობიაროების პასპორტიზაციის ფორმა.xls | 2025-11-21 06:37 | 102K | |
![[ ]](/icons/unknown.gif) | სამშობიაროების პასპორტიზაციის ფორმა (1).xls | 2025-11-21 06:37 | 102K | |
![[ ]](/icons/unknown.gif) | პასპორტიზაცია vs პერინატალური.docx | 2025-11-21 06:37 | 22K | |
![[IMG]](/icons/image2.gif) | image006 (29).jpg | 2025-11-21 06:37 | 110K | |
![[IMG]](/icons/image2.gif) | image003 (113).jpg | 2025-11-21 06:37 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (336).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (335).jpg | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (604).jpg | 2025-11-21 06:37 | 8.4K | |
![[IMG]](/icons/image2.gif) | image001 (603).jpg | 2025-11-21 06:37 | 9.4K | |
![[IMG]](/icons/image2.gif) | image001 (602).jpg | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (382).png | 2025-11-21 06:37 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (381).png | 2025-11-21 06:37 | 2.6K | |
![[ ]](/icons/unknown.gif) | Krishna_CV.doc | 2025-11-21 06:37 | 99K | |
![[ ]](/icons/layout.gif) | ATLAS-FY15-Goals-Quick-Reference-Supervisor (1).pdf | 2025-11-21 06:37 | 181K | |
![[ ]](/icons/layout.gif) | ATLAS-FY15-Goals-Quick-Reference-Employee (1).pdf | 2025-11-21 06:37 | 107K | |
![[ ]](/icons/unknown.gif) | ფორმა 2_3.xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | ფორმა 2_3 განხილვა.docx | 2025-11-21 06:37 | 21K | |
![[ ]](/icons/unknown.gif) | ფორმა 2_2.xlsx | 2025-11-21 06:37 | 13K | |
![[ ]](/icons/unknown.gif) | რეპორტები (1).rar | 2025-11-21 06:37 | 159K | |
![[IMG]](/icons/image2.gif) | image007 (8).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image006 (12).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image005 (34).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (33).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image004 (76).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (70).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (112).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (111).jpg | 2025-11-21 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (334).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (184).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image001 (601).jpg | 2025-11-21 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (600).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (380).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image001 (379).png | 2025-11-21 06:37 | 12K | |
![[IMG]](/icons/image2.gif) | gauqmebuli klinikis mxareschans.png | 2025-11-21 06:37 | 193K | |
![[IMG]](/icons/image2.gif) | gamcemi administratori ssamxridan.png | 2025-11-21 06:37 | 213K | |
![[IMG]](/icons/image2.gif) | gamcemi -provaideri klinikismxridan_ gasemulia ssa mxridan.png | 2025-11-21 06:37 | 191K | |
![[IMG]](/icons/image2.gif) | dublikatze- kodi ar emtxveva.png | 2025-11-21 06:37 | 200K | |
![[IMG]](/icons/image2.gif) | aqtivatori provaideri ssamxridanac ukve.png | 2025-11-21 06:37 | 224K | |
![[IMG]](/icons/image2.gif) | aqtivaciis gilaki rekvizitebisgverdze 1.png | 2025-11-21 06:37 | 284K | |
![[ ]](/icons/unknown.gif) | Report.rar | 2025-11-21 06:37 | 158K | |
![[ ]](/icons/unknown.gif) | რეზისტენტული პაციენტები პირადი ნომრის დაჯგუფების გარეშე.xlsx | 2025-11-21 06:37 | 71K | |
![[ ]](/icons/unknown.gif) | გადარიცხვები ფინანსური მოდულიდან.xlsx | 2025-11-21 06:37 | 340K | |
![[IMG]](/icons/image2.gif) | image006 (28).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image006 (27).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image006 (26).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image006 (25).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (39).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image005 (38).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image005 (37).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image005 (36).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (75).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (74).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (73).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (72).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (71).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (70).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (69).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (68).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (110).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (109).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (108).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (107).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (106).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (105).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (104).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image002 (333).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image002 (332).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image002 (331).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image002 (183).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image002 (182).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image001 (599).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (598).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (597).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (596).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (595).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (594).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (593).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (592).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (591).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (378).png | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | user - november (1).xlsx | 2025-11-21 06:37 | 12K | |
![[ ]](/icons/unknown.gif) | securedownload.xlsx | 2025-11-21 06:37 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (24).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (35).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (69).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image004 (67).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (66).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (103).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (102).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image002 (181).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image002 (180).png | 2025-11-21 06:37 | 354K | |
![[IMG]](/icons/image2.gif) | image001 (590).jpg | 2025-11-21 06:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (589).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (588).jpg | 2025-11-21 06:37 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (587).jpg | 2025-11-21 06:37 | 4.2K | |
![[ ]](/icons/unknown.gif) | ASMATI.xlsx | 2025-11-21 06:37 | 9.2K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (7).xlsx | 2025-11-21 06:37 | 11K | |
![[ ]](/icons/unknown.gif) | გრიპის ახალი ვაქცინა (1).xlsx | 2025-11-21 06:37 | 8.7K | |
![[ ]](/icons/unknown.gif) | xelvachauri.xlsx | 2025-11-21 06:36 | 8.3K | |
![[IMG]](/icons/image2.gif) | welcome (1).jpg | 2025-11-21 06:36 | 56K | |
![[ ]](/icons/unknown.gif) | web services - მიმართვების ადმინისტრირების მოდული v1_0.docx | 2025-11-21 06:36 | 133K | |
![[ ]](/icons/unknown.gif) | user - november.xlsx | 2025-11-21 06:36 | 12K | |
![[IMG]](/icons/image2.gif) | twitter (1).png | 2025-11-21 06:36 | 3.0K | |
![[IMG]](/icons/image2.gif) | top_img (1).jpg | 2025-11-21 06:36 | 37K | |
![[IMG]](/icons/image2.gif) | spacer (1).gif | 2025-11-21 06:36 | 43 | |
![[IMG]](/icons/image2.gif) | main_shadow (1).png | 2025-11-21 06:36 | 9.6K | |
![[IMG]](/icons/image2.gif) | main_img (1).jpg | 2025-11-21 06:36 | 99K | |
![[IMG]](/icons/image2.gif) | logo (1).jpg | 2025-11-21 06:36 | 26K | |
![[IMG]](/icons/image2.gif) | img_shadow.png | 2025-11-21 06:36 | 1.6K | |
![[IMG]](/icons/image2.gif) | img2.jpg | 2025-11-21 06:36 | 52K | |
![[IMG]](/icons/image2.gif) | img1.jpg | 2025-11-21 06:36 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (330).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (329).jpg | 2025-11-21 06:36 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (179).png | 2025-11-21 06:36 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (377).png | 2025-11-21 06:36 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (376).png | 2025-11-21 06:36 | 7.7K | |
![[IMG]](/icons/image2.gif) | google_plus (1).png | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | get_in_touch (1).png | 2025-11-21 06:36 | 50K | |
![[IMG]](/icons/image2.gif) | footer_bg (1).png | 2025-11-21 06:36 | 35K | |
![[IMG]](/icons/image2.gif) | facebook (1).png | 2025-11-21 06:36 | 1.7K | |
![[IMG]](/icons/image2.gif) | devider (1).png | 2025-11-21 06:36 | 2.4K | |
![[IMG]](/icons/image2.gif) | container_bg (1).jpg | 2025-11-21 06:36 | 17K | |
![[IMG]](/icons/image2.gif) | bg (1).jpg | 2025-11-21 06:36 | 1.4K | |
![[ ]](/icons/unknown.gif) | batumi.xlsx | 2025-11-21 06:36 | 9.5K | |
![[IMG]](/icons/image2.gif) | Untitledddd (1).png | 2025-11-21 06:36 | 224K | |
![[IMG]](/icons/image2.gif) | Untitled (30).png | 2025-11-21 06:36 | 163K | |
![[ ]](/icons/unknown.gif) | Untitled (29) | 2025-11-21 06:36 | 0 | |
![[ ]](/icons/unknown.gif) | 10თვე.xlsx | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | მიმართვების ადმინისტრირების მოდული (GM) v2_3.docx | 2025-11-21 06:36 | 2.1M | |
![[ ]](/icons/unknown.gif) | ვერა ფასუაშვილი.xlsx | 2025-11-21 06:36 | 8.4K | |
![[ ]](/icons/unknown.gif) | xelvachauri maia qolbaia.xlsx | 2025-11-21 06:36 | 9.2K | |
![[IMG]](/icons/image2.gif) | tipi.png | 2025-11-21 06:36 | 134K | |
![[IMG]](/icons/image2.gif) | test ssa.png | 2025-11-21 06:36 | 220K | |
![[IMG]](/icons/image2.gif) | submitting.png | 2025-11-21 06:36 | 179K | |
![[IMG]](/icons/image2.gif) | image001 (586).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (585).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (584).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | gamcemi provaideri nacvladadministratorisa ukve ssa mxaresac_.png | 2025-11-21 06:36 | 232K | |
![[IMG]](/icons/image2.gif) | gamcemi provaideri.png | 2025-11-21 06:36 | 193K | |
![[IMG]](/icons/image2.gif) | gamcemi -administratori.png | 2025-11-21 06:36 | 242K | |
![[IMG]](/icons/image2.gif) | dublirebulebi gadaigzavna.png | 2025-11-21 06:36 | 189K | |
![[IMG]](/icons/image2.gif) | image002 (178).png | 2025-11-21 06:36 | 223K | |
![[IMG]](/icons/image2.gif) | image002 (177).png | 2025-11-21 06:36 | 223K | |
![[IMG]](/icons/image2.gif) | image002 (176).png | 2025-11-21 06:36 | 223K | |
![[IMG]](/icons/image2.gif) | image001 (375).png | 2025-11-21 06:36 | 151K | |
![[IMG]](/icons/image2.gif) | image001 (374).png | 2025-11-21 06:36 | 151K | |
![[IMG]](/icons/image2.gif) | image001 (373).png | 2025-11-21 06:36 | 151K | |
![[IMG]](/icons/image2.gif) | dublirebuliu gadaigzavnaaaa.png | 2025-11-21 06:36 | 185K | |
![[IMG]](/icons/image2.gif) | dubli davakomentare.png | 2025-11-21 06:36 | 198K | |
![[IMG]](/icons/image2.gif) | dubli.png | 2025-11-21 06:36 | 210K | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (8).pdf | 2025-11-21 06:36 | 388K | |
![[IMG]](/icons/image2.gif) | image002 (175).png | 2025-11-21 06:36 | 223K | |
![[IMG]](/icons/image2.gif) | image001 (583).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (372).png | 2025-11-21 06:36 | 151K | |
![[IMG]](/icons/image2.gif) | image002 (174).png | 2025-11-21 06:36 | 223K | |
![[IMG]](/icons/image2.gif) | image001 (582).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (371).png | 2025-11-21 06:36 | 151K | |
![[ ]](/icons/unknown.gif) | გრიპის ახალი ვაქცინა.xlsx | 2025-11-21 06:36 | 8.7K | |
![[IMG]](/icons/image2.gif) | image002 (173).png | 2025-11-21 06:36 | 223K | |
![[IMG]](/icons/image2.gif) | image001 (370).png | 2025-11-21 06:36 | 151K | |
![[ ]](/icons/unknown.gif) | User management fields 2_12_14 -Copy - Copy (1).xlsx | 2025-11-21 06:36 | 14K | |
![[ ]](/icons/unknown.gif) | პაროლის აღდგენა.xlsx | 2025-11-21 06:36 | 9.3K | |
![[ ]](/icons/unknown.gif) | ირინე ბაღაშვილი.xlsx | 2025-11-21 06:36 | 9.2K | |
![[IMG]](/icons/image2.gif) | welcome.jpg | 2025-11-21 06:36 | 56K | |
![[IMG]](/icons/image2.gif) | twitter.png | 2025-11-21 06:36 | 3.0K | |
![[IMG]](/icons/image2.gif) | top_img.jpg | 2025-11-21 06:36 | 37K | |
![[IMG]](/icons/image2.gif) | spacer.gif | 2025-11-21 06:36 | 43 | |
![[IMG]](/icons/image2.gif) | main_shadow.png | 2025-11-21 06:36 | 9.6K | |
![[IMG]](/icons/image2.gif) | main_img.jpg | 2025-11-21 06:36 | 303K | |
![[IMG]](/icons/image2.gif) | logo.jpg | 2025-11-21 06:36 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (581).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | google_plus.png | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | get_in_touch.png | 2025-11-21 06:36 | 50K | |
![[IMG]](/icons/image2.gif) | footer_bg.png | 2025-11-21 06:36 | 35K | |
![[IMG]](/icons/image2.gif) | facebook.png | 2025-11-21 06:36 | 1.7K | |
![[IMG]](/icons/image2.gif) | devider.png | 2025-11-21 06:36 | 2.4K | |
![[IMG]](/icons/image2.gif) | container_bg.jpg | 2025-11-21 06:36 | 17K | |
![[ ]](/icons/unknown.gif) | ATT46697 | 2025-11-21 06:36 | 0 | |
![[IMG]](/icons/image2.gif) | image002 (328).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (369).png | 2025-11-21 06:36 | 119K | |
![[IMG]](/icons/image2.gif) | bg.jpg | 2025-11-21 06:36 | 1.4K | |
![[ ]](/icons/unknown.gif) | User management fields 2_12_14 -Copy - Copy.xlsx | 2025-11-21 06:36 | 14K | |
![[ ]](/icons/unknown.gif) | Untitled (28) | 2025-11-21 06:36 | 0 | |
![[ ]](/icons/unknown.gif) | 1_სენსიტიური_ტბ_პაციენტების_ამბულატორიული_მკურნალობისადმი_დამყოლობის_აღრ___.xls | 2025-11-21 06:36 | 49K | |
![[IMG]](/icons/image2.gif) | image001 (368).png | 2025-11-21 06:36 | 15K | |
![[ ]](/icons/unknown.gif) | TuberculosisExport03_12_2014_14_41_42.xlsx | 2025-11-21 06:36 | 128K | |
![[ ]](/icons/unknown.gif) | TuberculosisExport03_12_2014_14_41_42 (1).xlsx | 2025-11-21 06:36 | 128K | |
![[ ]](/icons/unknown.gif) | ATT58867 | 2025-11-21 06:36 | 0 | |
![[ ]](/icons/unknown.gif) | ATT29644 | 2025-11-21 06:36 | 0 | |
![[ ]](/icons/unknown.gif) | სენსიტიურები სექტემბერი.xls | 2025-11-21 06:36 | 256K | |
![[ ]](/icons/unknown.gif) | დანართი 1 2- last 20_ 10_2014 (2).xls | 2025-11-21 06:36 | 97K | |
![[IMG]](/icons/image2.gif) | image002 (172).png | 2025-11-21 06:36 | 223K | |
![[IMG]](/icons/image2.gif) | image002 (171).png | 2025-11-21 06:36 | 223K | |
![[IMG]](/icons/image2.gif) | image001 (580).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (579).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (578).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (367).png | 2025-11-21 06:36 | 151K | |
![[IMG]](/icons/image2.gif) | image001 (366).png | 2025-11-21 06:36 | 151K | |
![[ ]](/icons/unknown.gif) | Untitled (27) | 2025-11-21 06:36 | 0 | |
![[ ]](/icons/unknown.gif) | Letter to maia maglakelidze - 04 12 2014.doc | 2025-11-21 06:36 | 68K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (6).xlsx | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (143).png | 2025-11-21 06:36 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (327).jpg | 2025-11-21 06:36 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (365).png | 2025-11-21 06:36 | 15K | |
![[ ]](/icons/layout.gif) | Katy.pdf | 2025-11-21 06:36 | 350K | |
![[ ]](/icons/unknown.gif) | A-25 New Timesheet_Blank (1).xls | 2025-11-21 06:36 | 310K | |
![[ ]](/icons/unknown.gif) | A-25 New Timesheet Gaga Sample.xls | 2025-11-21 06:36 | 309K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (15).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | shetyobinebagagzavnilia-monishvna ar mushaobs_.png | 2025-11-21 06:36 | 209K | |
![[IMG]](/icons/image2.gif) | image002 (326).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (577).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | gauqmeba-motxovnis statusiagdgenili.png | 2025-11-21 06:36 | 197K | |
![[IMG]](/icons/image2.gif) | eror.PNG | 2025-11-21 06:36 | 67K | |
![[IMG]](/icons/image2.gif) | cultural (zeda).JPG | 2025-11-21 06:36 | 44K | |
![[IMG]](/icons/image2.gif) | cultural(qveda).JPG | 2025-11-21 06:36 | 88K | |
![[IMG]](/icons/image2.gif) | Untitled (29).png | 2025-11-21 06:36 | 203K | |
![[IMG]](/icons/image2.gif) | Untitled (28).png | 2025-11-21 06:36 | 200K | |
![[ ]](/icons/unknown.gif) | მიღება-ჩაბარება.docx | 2025-11-21 06:36 | 212K | |
![[IMG]](/icons/image2.gif) | მესიჯი არ არის შეცვლილი.png | 2025-11-21 06:36 | 197K | |
![[IMG]](/icons/image2.gif) | აქთივაცია-აქტივაცია_.png | 2025-11-21 06:36 | 231K | |
![[ ]](/icons/unknown.gif) | აბაშა 1-1.xlsx | 2025-11-21 06:36 | 9.4K | |
![[IMG]](/icons/image2.gif) | image002 (170).png | 2025-11-21 06:36 | 223K | |
![[IMG]](/icons/image2.gif) | image001 (364).png | 2025-11-21 06:36 | 151K | |
![[IMG]](/icons/image2.gif) | validacia.png | 2025-11-21 06:36 | 136K | |
![[ ]](/icons/unknown.gif) | user - new08.xlsx | 2025-11-21 06:36 | 12K | |
![[IMG]](/icons/image2.gif) | image005 (34).png | 2025-11-21 06:36 | 8.5K | |
![[IMG]](/icons/image2.gif) | image004 (65).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (64).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (142).png | 2025-11-21 06:36 | 82K | |
![[IMG]](/icons/image2.gif) | image003 (101).jpg | 2025-11-21 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (325).jpg | 2025-11-21 06:36 | 7.6K | |
![[IMG]](/icons/image2.gif) | image001 (576).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (575).jpg | 2025-11-21 06:36 | 4.2K | |
![[ ]](/icons/unknown.gif) | CamonaTvali.xlsx | 2025-11-21 06:36 | 77K | |
![[IMG]](/icons/image2.gif) | 3 (5).PNG | 2025-11-21 06:36 | 119K | |
![[IMG]](/icons/image2.gif) | 2 (10).png | 2025-11-21 06:36 | 56K | |
![[IMG]](/icons/image2.gif) | 1 (13).png | 2025-11-21 06:36 | 89K | |
![[ ]](/icons/unknown.gif) | ქეთევან ტაბატაძე.xlsx | 2025-11-21 06:36 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (574).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (573).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (363).png | 2025-11-21 06:36 | 165K | |
![[ ]](/icons/unknown.gif) | fizikuri piri.xlsx | 2025-11-21 06:36 | 10K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_personal.xlsx | 2025-11-21 06:36 | 15K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_eRecipes.xlsx | 2025-11-21 06:36 | 8.8K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_capitation_personal.xlsx | 2025-11-21 06:36 | 10K | |
![[ ]](/icons/unknown.gif) | Universal_Healthcare_capitation.xlsx | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | Shemtxvevebis_Registracia_Analitika.xls | 2025-11-21 06:36 | 28K | |
![[ ]](/icons/unknown.gif) | Mimartvebis_Analitika (1).xlsx | 2025-11-21 06:36 | 2.9M | |
![[ ]](/icons/unknown.gif) | ATT95071 | 2025-11-21 06:36 | 0 | |
![[ ]](/icons/unknown.gif) | 165 საერთო (1).xlsx | 2025-11-21 06:36 | 95K | |
![[ ]](/icons/unknown.gif) | მიღებული.xlsx | 2025-11-21 06:36 | 149K | |
![[ ]](/icons/unknown.gif) | მისაღები.xlsx | 2025-11-21 06:36 | 40K | |
![[ ]](/icons/unknown.gif) | provaider (5).xlsx | 2025-11-21 06:36 | 10K | |
![[IMG]](/icons/image2.gif) | image006 (23).jpg | 2025-11-21 06:36 | 110K | |
![[IMG]](/icons/image2.gif) | image004 (63).jpg | 2025-11-21 06:36 | 15K | |
![[IMG]](/icons/image2.gif) | image003 (100).jpg | 2025-11-21 06:36 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (324).jpg | 2025-11-21 06:36 | 9.4K | |
![[IMG]](/icons/image2.gif) | image001 (572).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (571).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (570).jpg | 2025-11-21 06:36 | 7.7K | |
![[ ]](/icons/unknown.gif) | User management fields (12).xlsx | 2025-11-21 06:36 | 12K | |
![[ ]](/icons/layout.gif) | ATLAS-FY15-Goals-Quick-Reference-Supervisor.pdf | 2025-11-21 06:36 | 181K | |
![[ ]](/icons/layout.gif) | ATLAS-FY15-Goals-Quick-Reference-Employee.pdf | 2025-11-21 06:36 | 107K | |
![[IMG]](/icons/image2.gif) | image002 (323).jpg | 2025-11-21 06:36 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (569).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (568).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (567).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (362).png | 2025-11-21 06:36 | 14K | |
![[ ]](/icons/unknown.gif) | ATT44782 | 2025-11-21 06:36 | 0 | |
![[IMG]](/icons/image2.gif) | image001 (361).png | 2025-11-21 06:36 | 40K | |
![[ ]](/icons/unknown.gif) | Resistent 31_10_2014.xlsx | 2025-11-21 06:36 | 128K | |
![[ ]](/icons/unknown.gif) | Resistent - 31_08_2014.xlsx | 2025-11-21 06:36 | 128K | |
![[IMG]](/icons/image2.gif) | image001 (566).jpg | 2025-11-21 06:36 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (565).jpg | 2025-11-21 06:36 | 4.1K | |
![[ ]](/icons/unknown.gif) | f_p_samcxe10_12_.xlsx | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | User management fields 10_12_14 -Copy - Copy.xlsx | 2025-11-21 06:36 | 14K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (14).jpg | 2025-11-21 06:36 | 823 | |
![[ ]](/icons/unknown.gif) | provaiderebi (1).xlsx | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | provaider (4).xlsx | 2025-11-21 06:36 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (141).png | 2025-11-21 06:36 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (322).jpg | 2025-11-21 06:36 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (169).png | 2025-11-21 06:36 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (564).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (360).png | 2025-11-21 06:36 | 208K | |
![[ ]](/icons/unknown.gif) | fizikuri piri maiavardoshvili.xlsx | 2025-11-21 06:36 | 12K | |
![[ ]](/icons/unknown.gif) | Report.xlsx | 2025-11-21 06:36 | 154K | |
![[ ]](/icons/unknown.gif) | New Hire Account Setup.docx | 2025-11-21 06:36 | 1.3M | |
![[ ]](/icons/unknown.gif) | qobuleti.xls | 2025-11-21 06:36 | 27K | |
![[ ]](/icons/unknown.gif) | provaiderebi.xlsx | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | provaider (3).xlsx | 2025-11-21 06:36 | 10K | |
![[ ]](/icons/unknown.gif) | kasrelishvili.xlsx | 2025-11-21 06:36 | 9.7K | |
![[ ]](/icons/unknown.gif) | irine bagashvili.xlsx | 2025-11-21 06:36 | 9.1K | |
![[IMG]](/icons/image2.gif) | image004 (68).png | 2025-11-21 06:36 | 15K | |
![[IMG]](/icons/image2.gif) | image003 (99).jpg | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (98).jpg | 2025-11-21 06:36 | 279K | |
![[IMG]](/icons/image2.gif) | image002 (321).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (320).jpg | 2025-11-21 06:36 | 25K | |
![[IMG]](/icons/image2.gif) | image002 (319).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (318).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (563).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (562).jpg | 2025-11-21 06:36 | 726K | |
![[IMG]](/icons/image2.gif) | image001 (359).png | 2025-11-21 06:36 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (358).png | 2025-11-21 06:36 | 1.0M | |
![[IMG]](/icons/image2.gif) | image001 (357).png | 2025-11-21 06:36 | 1.0M | |
![[IMG]](/icons/image2.gif) | banner.jpg | 2025-11-21 06:36 | 26K | |
![[ ]](/icons/unknown.gif) | Junona.xlsx | 2025-11-21 06:36 | 10K | |
![[ ]](/icons/layout.gif) | HMM11 Brochure.pdf | 2025-11-21 06:36 | 1.2M | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (10).xlsx | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | ვერტიკალურიები (1).xlsx | 2025-11-21 06:36 | 264K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (5).xlsx | 2025-11-21 06:36 | 12K | |
![[TXT]](/icons/text.gif) | sayoveltao.txt | 2025-11-21 06:36 | 948 | |
![[IMG]](/icons/image2.gif) | image001 (561).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (560).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (559).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (558).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (557).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (556).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (356).png | 2025-11-21 06:36 | 17K | |
![[ ]](/icons/unknown.gif) | fizikuri piri (7).xlsx | 2025-11-21 06:36 | 12K | |
![[IMG]](/icons/image2.gif) | N4.png | 2025-11-21 06:36 | 268K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (4).xlsx | 2025-11-21 06:36 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (3).xlsx | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | zuras (3).png | 2025-11-21 06:36 | 170K | |
![[IMG]](/icons/image2.gif) | xarji.png | 2025-11-21 06:36 | 148K | |
![[IMG]](/icons/image2.gif) | vajas (1).png | 2025-11-21 06:36 | 226K | |
![[IMG]](/icons/image2.gif) | image005 (32).jpg | 2025-11-21 06:36 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (140).png | 2025-11-21 06:36 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (317).jpg | 2025-11-21 06:36 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (316).jpg | 2025-11-21 06:36 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (555).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (554).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (553).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (355).png | 2025-11-21 06:36 | 662K | |
![[IMG]](/icons/image2.gif) | faqtiuri xarji.png | 2025-11-21 06:36 | 221K | |
![[ ]](/icons/unknown.gif) | CountByRegions.xlsx | 2025-11-21 06:36 | 8.3K | |
![[ ]](/icons/unknown.gif) | ATT99491 | 2025-11-21 06:36 | 0 | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (9).xlsx | 2025-11-21 06:36 | 10K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (2).xlsx | 2025-11-21 06:36 | 12K | |
![[ ]](/icons/unknown.gif) | mariam mjedliZe.xlsx | 2025-11-21 06:36 | 9.1K | |
![[IMG]](/icons/image2.gif) | image002 (315).jpg | 2025-11-21 06:36 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (314).jpg | 2025-11-21 06:36 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (552).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (551).jpg | 2025-11-21 06:36 | 34K | |
![[IMG]](/icons/image2.gif) | image001 (550).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (549).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (354).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (353).png | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | User management fields 17_12_14 -Copy - Copy.xlsx | 2025-11-21 06:36 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields 17_12_14 -Copy - Copy (1).xlsx | 2025-11-21 06:36 | 14K | |
![[ ]](/icons/unknown.gif) | ProblemRounding.xlsx | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (8).xlsx | 2025-11-21 06:36 | 9.8K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ (1).xlsx | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | ანგარიშგების ველები ინტერფეისზე.xlsx | 2025-11-21 06:36 | 11K | |
![[ ]](/icons/unknown.gif) | user -თავართქილაძე.xlsx | 2025-11-21 06:36 | 12K | |
![[IMG]](/icons/image2.gif) | image005 (31).jpg | 2025-11-21 06:36 | 25K | |
![[IMG]](/icons/image2.gif) | image004 (62).jpg | 2025-11-21 06:36 | 25K | |
![[IMG]](/icons/image2.gif) | image003 (14).gif | 2025-11-21 06:36 | 541 | |
![[IMG]](/icons/image2.gif) | image003 (13).gif | 2025-11-21 06:36 | 541 | |
![[IMG]](/icons/image2.gif) | image002 (313).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (312).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (548).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (547).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (546).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (545).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (544).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (543).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (542).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (541).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (352).png | 2025-11-21 06:36 | 133K | |
![[IMG]](/icons/image2.gif) | image001 (351).png | 2025-11-21 06:36 | 859K | |
![[IMG]](/icons/image2.gif) | image001 (350).png | 2025-11-21 06:36 | 859K | |
![[IMG]](/icons/image2.gif) | ados.png | 2025-11-21 06:36 | 325K | |
![[ ]](/icons/unknown.gif) | Unit Of Measure Instructions (2).docx | 2025-11-21 06:36 | 18K | |
![[IMG]](/icons/image2.gif) | 10857974_414850568670078_2016555861620403203_n.jpg | 2025-11-21 06:36 | 102K | |
![[IMG]](/icons/image2.gif) | 338.gif | 2025-11-21 06:36 | 541 | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (7).xlsx | 2025-11-21 06:36 | 9.9K | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (6).xlsx | 2025-11-21 06:36 | 10K | |
![[ ]](/icons/unknown.gif) | პროგრამების_კოდები (1).xlsx | 2025-11-21 06:36 | 12K | |
![[ ]](/icons/unknown.gif) | ეკა.xlsx | 2025-11-21 06:36 | 9.5K | |
![[ ]](/icons/unknown.gif) | დანართი #1 - გამორჩ ენილი დაწესებ.xlsx | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | sergos (2).png | 2025-11-21 06:36 | 239K | |
![[IMG]](/icons/image2.gif) | image003 (139).png | 2025-11-21 06:36 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (311).jpg | 2025-11-21 06:36 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (540).jpg | 2025-11-21 06:36 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (539).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (349).png | 2025-11-21 06:36 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (348).png | 2025-11-21 06:36 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (347).png | 2025-11-21 06:36 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (346).png | 2025-11-21 06:36 | 12K | |
![[ ]](/icons/layout.gif) | file0003.pdf | 2025-11-21 06:36 | 1.8M | |
![[IMG]](/icons/image2.gif) | erorii.png | 2025-11-21 06:36 | 196K | |
![[ ]](/icons/unknown.gif) | User management fields 19_12_14 -Copy - Copy.xlsx | 2025-11-21 06:36 | 14K | |
![[ ]](/icons/unknown.gif) | Rounded Amounts.xlsx | 2025-11-21 06:36 | 9.7K | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (5).xlsx | 2025-11-21 06:36 | 10K | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (4).xlsx | 2025-11-21 06:36 | 9.9K | |
![[IMG]](/icons/image2.gif) | vakos.png | 2025-11-21 06:36 | 113K | |
![[IMG]](/icons/image2.gif) | ushkas (1).png | 2025-11-21 06:36 | 218K | |
![[IMG]](/icons/image2.gif) | image003 (97).jpg | 2025-11-21 06:36 | 23K | |
![[IMG]](/icons/image2.gif) | image002 (310).jpg | 2025-11-21 06:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (309).jpg | 2025-11-21 06:36 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (538).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (537).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (536).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (535).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (345).png | 2025-11-21 06:36 | 7.7K | |
![[ ]](/icons/unknown.gif) | Population01012015V_I (2).docx | 2025-11-21 06:36 | 21K | |
![[ ]](/icons/unknown.gif) | Population01012015.docx | 2025-11-21 06:36 | 16K | |
![[ ]](/icons/unknown.gif) | Population01012015 (1).docx | 2025-11-21 06:36 | 16K | |
![[ ]](/icons/unknown.gif) | No Name (1).docx | 2025-11-21 06:36 | 13K | |
![[ ]](/icons/unknown.gif) | სტატისტიკა-საინფორმაციო პორტალი.xlsx | 2025-11-21 06:36 | 6.1M | |
![[ ]](/icons/unknown.gif) | საყოველთაოში ჩართული კლინიკების რაოდენობები რეგიონების მიხედვით.xlsx | 2025-11-21 06:36 | 8.8K | |
![[ ]](/icons/unknown.gif) | საინფორმაციო პორტალი-სტატისტიკა.xlsx | 2025-11-21 06:36 | 6.5M | |
![[ ]](/icons/unknown.gif) | პროგრამების_კოდები.xlsx | 2025-11-21 06:36 | 12K | |
![[ ]](/icons/unknown.gif) | დაწესებულებები გეგმიურ ამბულატორიაში.xlsx | 2025-11-21 06:36 | 70K | |
![[IMG]](/icons/image2.gif) | sergos (1).png | 2025-11-21 06:36 | 239K | |
![[IMG]](/icons/image2.gif) | image002 (168).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (167).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (166).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (165).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (164).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (163).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (534).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (533).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (532).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (531).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (530).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (344).png | 2025-11-21 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (343).png | 2025-11-21 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (342).png | 2025-11-21 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (341).png | 2025-11-21 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (340).png | 2025-11-21 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (339).png | 2025-11-21 06:36 | 19K | |
![[ ]](/icons/unknown.gif) | error (3).docx | 2025-11-21 06:36 | 414K | |
![[IMG]](/icons/image2.gif) | block.png | 2025-11-21 06:36 | 209K | |
![[ ]](/icons/unknown.gif) | User management fields 22_12_14 -Copy - Copy (2).xlsx | 2025-11-21 06:36 | 14K | |
![[IMG]](/icons/image2.gif) | Untitled (27).png | 2025-11-21 06:36 | 197K | |
![[ ]](/icons/unknown.gif) | PopulationIsBeneficiary01012015 (1).docx | 2025-11-21 06:36 | 14K | |
![[ ]](/icons/unknown.gif) | Population01012015V_I.docx | 2025-11-21 06:36 | 22K | |
![[ ]](/icons/unknown.gif) | Population01012015V_I (1).DOCX | 2025-11-21 06:36 | 21K | |
![[ ]](/icons/unknown.gif) | List of Partners and their emails for ChristmasNT.docx | 2025-11-21 06:36 | 40K | |
![[ ]](/icons/layout.gif) | Internal Audit-Risk oriented method_Seminar_Georgia.pdf | 2025-11-21 06:36 | 260K | |
![[IMG]](/icons/image2.gif) | IncludeExclude.JPG | 2025-11-21 06:36 | 93K | |
![[ ]](/icons/layout.gif) | IC_risk management_Georgia.pdf | 2025-11-21 06:36 | 236K | |
![[ ]](/icons/layout.gif) | IC_Georgia.pdf | 2025-11-21 06:36 | 290K | |
![[ ]](/icons/layout.gif) | Finance for Non-financiers_Georgia.pdf | 2025-11-21 06:36 | 194K | |
![[ ]](/icons/unknown.gif) | ExcludedOrganizations.xlsx | 2025-11-21 06:36 | 9.8K | |
![[IMG]](/icons/image2.gif) | Capture.jpg | 2025-11-21 06:36 | 31K | |
![[ ]](/icons/layout.gif) | 12-22-2014 16-57-46.pdf | 2025-11-21 06:36 | 14K | |
![[ ]](/icons/layout.gif) | 12-22-2014 14-04-04.pdf | 2025-11-21 06:36 | 198K | |
![[ ]](/icons/unknown.gif) | ჩასასწორებლები.docx | 2025-11-21 06:36 | 152K | |
![[ ]](/icons/unknown.gif) | user - დესკი.xlsx | 2025-11-21 06:36 | 12K | |
![[ ]](/icons/unknown.gif) | oledata (1).mso | 2025-11-21 06:36 | 730 | |
![[IMG]](/icons/image2.gif) | nikushas (1).png | 2025-11-21 06:36 | 136K | |
![[IMG]](/icons/image2.gif) | image006 (11).png | 2025-11-21 06:36 | 168 | |
![[IMG]](/icons/image2.gif) | image004 (61).jpg | 2025-11-21 06:36 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (138).png | 2025-11-21 06:36 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (162).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (161).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (160).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (159).png | 2025-11-21 06:36 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (529).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (528).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (527).jpg | 2025-11-21 06:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (526).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (525).jpg | 2025-11-21 06:36 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (338).png | 2025-11-21 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (337).png | 2025-11-21 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (336).png | 2025-11-21 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (335).png | 2025-11-21 06:36 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (334).png | 2025-11-21 06:36 | 19K | |
![[ ]](/icons/unknown.gif) | asaki gasuli.xls | 2025-11-21 06:36 | 37K | |
![[ ]](/icons/unknown.gif) | PopulationIsBeneficiary01012015.docx | 2025-11-21 06:36 | 14K | |
![[ ]](/icons/unknown.gif) | Population01012015VanikoIrakliV_I.docx | 2025-11-21 06:36 | 26K | |
![[ ]](/icons/unknown.gif) | Population01012015VanikoIrakliV_I (1).docx | 2025-11-21 06:36 | 21K | |
![[ ]](/icons/unknown.gif) | List of Partners and their emails for Christmas_KT AT_NB.docx | 2025-11-21 06:36 | 61K | |
![[ ]](/icons/unknown.gif) | List of Partners and their emails for Christmas_KT, AT.docx | 2025-11-21 06:36 | 58K | |
![[ ]](/icons/unknown.gif) | შპს რეგიონული ჯანდაცვის ცენტრი.xlsx | 2025-11-21 06:36 | 15K | |
![[ ]](/icons/unknown.gif) | რეგიონული ჯანდაცვის ცენტრი-ამბროლაური.xls | 2025-11-21 06:36 | 95K | |
![[IMG]](/icons/image2.gif) | image003 (96).jpg | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (308).jpg | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (158).png | 2025-11-21 06:35 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (524).jpg | 2025-11-21 06:35 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (523).jpg | 2025-11-21 06:35 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (522).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (521).jpg | 2025-11-21 06:35 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (520).jpg | 2025-11-21 06:35 | 127K | |
![[IMG]](/icons/image2.gif) | image001 (519).jpg | 2025-11-21 06:35 | 127K | |
![[IMG]](/icons/image2.gif) | image001 (333).png | 2025-11-21 06:35 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (332).png | 2025-11-21 06:35 | 168 | |
![[ ]](/icons/unknown.gif) | List of Partners and their emails for Christmas 2014 updated.xlsx | 2025-11-21 06:35 | 27K | |
![[IMG]](/icons/image2.gif) | Greeting Card.jpg | 2025-11-21 06:35 | 492K | |
![[IMG]](/icons/image2.gif) | Greeting Card (1).jpg | 2025-11-21 06:35 | 476K | |
![[ ]](/icons/layout.gif) | Gmail - ☑ ტესტირების შედეგები, მიმდინარე დავალებები.pdf | 2025-11-21 06:35 | 118K | |
![[ ]](/icons/unknown.gif) | Contracted Provaiders.xls | 2025-11-21 06:35 | 909K | |
![[ ]](/icons/unknown.gif) | Contracted Provaiders (1).xls | 2025-11-21 06:35 | 825K | |
![[ ]](/icons/unknown.gif) | ATT39000 | 2025-11-21 06:35 | 0 | |
![[IMG]](/icons/image2.gif) | 204556541.jpg | 2025-11-21 06:35 | 100K | |
![[IMG]](/icons/image2.gif) | yipshidze.png | 2025-11-21 06:35 | 178K | |
![[IMG]](/icons/image2.gif) | yifshidze.PNG | 2025-11-21 06:35 | 61K | |
![[IMG]](/icons/image2.gif) | yifshidze (1).png | 2025-11-21 06:35 | 188K | |
![[IMG]](/icons/image2.gif) | yif2.png | 2025-11-21 06:35 | 215K | |
![[IMG]](/icons/image2.gif) | image002 (157).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (156).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (331).png | 2025-11-21 06:35 | 193K | |
![[IMG]](/icons/image2.gif) | image001 (330).png | 2025-11-21 06:35 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (329).png | 2025-11-21 06:35 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (328).png | 2025-11-21 06:35 | 19K | |
![[ ]](/icons/unknown.gif) | InsuranceReport.xlsx | 2025-11-21 06:35 | 2.1M | |
![[IMG]](/icons/image2.gif) | 123.png | 2025-11-21 06:35 | 176K | |
![[IMG]](/icons/image2.gif) | 1 (12).png | 2025-11-21 06:35 | 211K | |
![[ ]](/icons/unknown.gif) | კლინიკა პანაცეა.xlsx | 2025-11-21 06:35 | 15K | |
![[ ]](/icons/unknown.gif) | regionuli jandacviscentri-gudauri.xlsx | 2025-11-21 06:35 | 15K | |
![[IMG]](/icons/image2.gif) | mimartvebi (4).png | 2025-11-21 06:35 | 242K | |
![[ ]](/icons/unknown.gif) | imeretis fizikuri piri.xlsx | 2025-11-21 06:35 | 12K | |
![[IMG]](/icons/image2.gif) | image006 (10).png | 2025-11-21 06:35 | 2.7K | |
![[IMG]](/icons/image2.gif) | image005 (33).png | 2025-11-21 06:35 | 5.6K | |
![[IMG]](/icons/image2.gif) | image004 (67).png | 2025-11-21 06:35 | 9.5K | |
![[IMG]](/icons/image2.gif) | image003 (137).png | 2025-11-21 06:35 | 8.3K | |
![[IMG]](/icons/image2.gif) | image003 (136).png | 2025-11-21 06:35 | 8.1K | |
![[IMG]](/icons/image2.gif) | image002 (155).png | 2025-11-21 06:35 | 8.1K | |
![[IMG]](/icons/image2.gif) | image001 (518).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (517).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (516).jpg | 2025-11-21 06:35 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (515).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (514).jpg | 2025-11-21 06:35 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (513).jpg | 2025-11-21 06:35 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (327).png | 2025-11-21 06:35 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (326).png | 2025-11-21 06:35 | 33K | |
![[ ]](/icons/unknown.gif) | guriis fizikuri pirebi.xlsx | 2025-11-21 06:35 | 12K | |
![[IMG]](/icons/image2.gif) | error (17).png | 2025-11-21 06:35 | 226K | |
![[IMG]](/icons/image2.gif) | error (16).png | 2025-11-21 06:35 | 226K | |
![[ ]](/icons/unknown.gif) | User management fields (11).xlsx | 2025-11-21 06:35 | 12K | |
![[ ]](/icons/unknown.gif) | USAID.xlsx | 2025-11-21 06:35 | 10K | |
![[ ]](/icons/unknown.gif) | EVEX Medical Facilities_Usernames_Passwords_Access to Modules -08_07_2014.xlsx | 2025-11-21 06:35 | 22K | |
![[IMG]](/icons/image2.gif) | Capture (14).PNG | 2025-11-21 06:35 | 136K | |
![[IMG]](/icons/image2.gif) | ეძებს.PNG | 2025-11-21 06:35 | 74K | |
![[IMG]](/icons/image2.gif) | არდის აქცია.jpg | 2025-11-21 06:35 | 217K | |
![[ ]](/icons/unknown.gif) | server.docx | 2025-11-21 06:35 | 14K | |
![[IMG]](/icons/image2.gif) | image006 (9).png | 2025-11-21 06:35 | 8.1K | |
![[IMG]](/icons/image2.gif) | image005 (32).png | 2025-11-21 06:35 | 8.1K | |
![[IMG]](/icons/image2.gif) | image004 (66).png | 2025-11-21 06:35 | 8.1K | |
![[IMG]](/icons/image2.gif) | image003 (135).png | 2025-11-21 06:35 | 8.1K | |
![[IMG]](/icons/image2.gif) | image003 (134).png | 2025-11-21 06:35 | 8.1K | |
![[IMG]](/icons/image2.gif) | image002 (154).png | 2025-11-21 06:35 | 8.1K | |
![[IMG]](/icons/image2.gif) | image001 (512).jpg | 2025-11-21 06:35 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (511).jpg | 2025-11-21 06:35 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (510).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (509).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (325).png | 2025-11-21 06:35 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (324).png | 2025-11-21 06:35 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (323).png | 2025-11-21 06:35 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (322).png | 2025-11-21 06:35 | 168 | |
![[IMG]](/icons/image2.gif) | image001 (321).png | 2025-11-21 06:35 | 168 | |
![[ ]](/icons/unknown.gif) | filialebis modultanwvdoma 3(3) (1).xlsx | 2025-11-21 06:35 | 9.8K | |
![[ ]](/icons/unknown.gif) | error9.docx | 2025-11-21 06:35 | 16K | |
![[ ]](/icons/unknown.gif) | error8.docx | 2025-11-21 06:35 | 17K | |
![[ ]](/icons/unknown.gif) | error7.docx | 2025-11-21 06:35 | 20K | |
![[ ]](/icons/unknown.gif) | error2.docx | 2025-11-21 06:35 | 14K | |
![[IMG]](/icons/image2.gif) | Error.jpg | 2025-11-21 06:35 | 543K | |
![[ ]](/icons/unknown.gif) | ERROR3.docx | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | Capture (13).png | 2025-11-21 06:35 | 41K | |
![[ ]](/icons/unknown.gif) | Accounts R14 IBAN 201412.xlsx | 2025-11-21 06:35 | 24K | |
![[ ]](/icons/unknown.gif) | ნინო გელაშვილი.xlsx | 2025-11-21 06:35 | 9.3K | |
![[ ]](/icons/unknown.gif) | ვერტიკალურიები.xlsx | 2025-11-21 06:35 | 268K | |
![[ ]](/icons/unknown.gif) | დაწესებულებები რომელთაც შევსებული აქვთ პერინატალური ფორმა.xlsx | 2025-11-21 06:35 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (508).jpg | 2025-11-21 06:35 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (507).jpg | 2025-11-21 06:35 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (506).jpg | 2025-11-21 06:35 | 4.2K | |
![[ ]](/icons/unknown.gif) | III (1).XLSX | 2025-11-21 06:35 | 244K | |
![[ ]](/icons/unknown.gif) | II (1).XLSX | 2025-11-21 06:35 | 1.9M | |
![[ ]](/icons/unknown.gif) | I (1).XLSX | 2025-11-21 06:35 | 736K | |
![[ ]](/icons/unknown.gif) | Duplicated Financing Items.xlsx | 2025-11-21 06:35 | 10M | |
![[ ]](/icons/unknown.gif) | სტატუსები.xlsx | 2025-11-21 06:35 | 13K | |
![[ ]](/icons/unknown.gif) | დუბლირებული ბენეფიციარები (4).xlsx | 2025-11-21 06:35 | 3.7M | |
![[ ]](/icons/unknown.gif) | დანართი #1 (24).xlsx | 2025-11-21 06:35 | 11K | |
![[ ]](/icons/unknown.gif) | qvemo qartli fizikuripiri-26_12_2014.xlsx | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | narkomania.png | 2025-11-21 06:35 | 134K | |
![[IMG]](/icons/image2.gif) | image005 (31).png | 2025-11-21 06:35 | 8.5K | |
![[IMG]](/icons/image2.gif) | image004 (60).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (133).png | 2025-11-21 06:35 | 82K | |
![[IMG]](/icons/image2.gif) | image002 (307).jpg | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (505).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (504).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (503).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (502).jpg | 2025-11-21 06:35 | 4.2K | |
![[ ]](/icons/unknown.gif) | filialebis modultanwvdoma 3(3).xlsx | 2025-11-21 06:35 | 9.7K | |
![[ ]](/icons/unknown.gif) | Tub Payments 2014.xlsx | 2025-11-21 06:35 | 160K | |
![[ ]](/icons/unknown.gif) | III.XLSX | 2025-11-21 06:35 | 244K | |
![[ ]](/icons/unknown.gif) | II.XLSX | 2025-11-21 06:35 | 1.9M | |
![[ ]](/icons/unknown.gif) | I.XLSX | 2025-11-21 06:35 | 736K | |
![[ ]](/icons/unknown.gif) | დუბლირებული ბენეფიციარები (3).xlsx | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | image003 (132).png | 2025-11-21 06:35 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (95).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (306).jpg | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (305).jpg | 2025-11-21 06:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (153).png | 2025-11-21 06:35 | 256K | |
![[IMG]](/icons/image2.gif) | image001 (501).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (500).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (499).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (498).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (497).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (320).png | 2025-11-21 06:35 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (319).png | 2025-11-21 06:35 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (318).png | 2025-11-21 06:35 | 14K | |
![[IMG]](/icons/image2.gif) | error (15).png | 2025-11-21 06:35 | 224K | |
![[ ]](/icons/unknown.gif) | Data.xlsx | 2025-11-21 06:35 | 48K | |
![[ ]](/icons/unknown.gif) | Contract Financing Items.xlsx | 2025-11-21 06:35 | 8.9M | |
![[ ]](/icons/unknown.gif) | ჩემი ოჯახის კლინიკა.xlsx | 2025-11-21 06:35 | 15K | |
![[IMG]](/icons/image2.gif) | mimartvebi (3).png | 2025-11-21 06:35 | 133K | |
![[IMG]](/icons/image2.gif) | image002 (304).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (303).jpg | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (317).png | 2025-11-21 06:35 | 7.7K | |
![[ ]](/icons/unknown.gif) | error (2).docx | 2025-11-21 06:35 | 150K | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (7).pdf | 2025-11-21 06:35 | 388K | |
![[ ]](/icons/unknown.gif) | გადაუდებელი ამბულატორიის ტარიფი.xlsx | 2025-11-21 06:35 | 3.2M | |
![[ ]](/icons/unknown.gif) | rust n2 diagn.docx | 2025-11-21 06:35 | 439K | |
![[IMG]](/icons/image2.gif) | image002 (152).png | 2025-11-21 06:35 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (496).jpg | 2025-11-21 06:35 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (495).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (316).png | 2025-11-21 06:35 | 234K | |
![[IMG]](/icons/image2.gif) | image001 (315).png | 2025-11-21 06:35 | 224K | |
![[ ]](/icons/unknown.gif) | danarti 3.docx | 2025-11-21 06:35 | 151K | |
![[ ]](/icons/unknown.gif) | danarti 2.docx | 2025-11-21 06:35 | 149K | |
![[ ]](/icons/unknown.gif) | User management fields05_01_145 -Copy - Copy.xlsx | 2025-11-21 06:35 | 14K | |
![[ ]](/icons/unknown.gif) | Danarti 1.docx | 2025-11-21 06:35 | 152K | |
![[ ]](/icons/unknown.gif) | ATT25298 | 2025-11-21 06:35 | 0 | |
![[ ]](/icons/unknown.gif) | ATT02636 | 2025-11-21 06:35 | 0 | |
![[ ]](/icons/unknown.gif) | შპს მკურნალი.xlsx | 2025-11-21 06:35 | 15K | |
![[ ]](/icons/unknown.gif) | მუხრანი.xlsx | 2025-11-21 06:35 | 12K | |
![[IMG]](/icons/image2.gif) | ინფო.png | 2025-11-21 06:35 | 208K | |
![[IMG]](/icons/image2.gif) | image003 (131).png | 2025-11-21 06:35 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (302).jpg | 2025-11-21 06:35 | 26K | |
![[IMG]](/icons/image2.gif) | image002 (301).jpg | 2025-11-21 06:35 | 15K | |
![[IMG]](/icons/image2.gif) | image002 (300).jpg | 2025-11-21 06:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (299).jpg | 2025-11-21 06:35 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (494).jpg | 2025-11-21 06:35 | 6.3K | |
![[IMG]](/icons/image2.gif) | image001 (493).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (314).png | 2025-11-21 06:35 | 15K | |
![[ ]](/icons/unknown.gif) | მოდულები მოხმარებლები და მათი როლები.docx | 2025-11-21 06:35 | 38K | |
![[ ]](/icons/unknown.gif) | user -0801.xlsx | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | mimartvebi (2).png | 2025-11-21 06:35 | 218K | |
![[IMG]](/icons/image2.gif) | image003 (94).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (298).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (492).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (491).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (490).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (489).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (488).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (487).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (313).png | 2025-11-21 06:35 | 134K | |
![[ ]](/icons/layout.gif) | completion_certificate.pdf | 2025-11-21 06:35 | 623K | |
![[IMG]](/icons/image2.gif) | antenataluri metvalyureoba.bmp | 2025-11-21 06:35 | 2.2M | |
![[ ]](/icons/unknown.gif) | Referrals.xlsx | 2025-11-21 06:35 | 104K | |
![[ ]](/icons/unknown.gif) | 01_11_2014 - 31_12_2014 ყველა შემთხვევა.xlsx | 2025-11-21 06:35 | 390K | |
![[ ]](/icons/unknown.gif) | 01_11_2014 - 31_12_2014 დაკავშირებული შემთხვევები.xlsx | 2025-11-21 06:35 | 152K | |
![[IMG]](/icons/image2.gif) | ანტენატალური მეთვალყურეობა.bmp | 2025-11-21 06:35 | 2.1M | |
![[IMG]](/icons/image2.gif) | image003 (130).png | 2025-11-21 06:35 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (297).jpg | 2025-11-21 06:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (486).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (485).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (312).png | 2025-11-21 06:35 | 14K | |
![[IMG]](/icons/image2.gif) | dializi.bmp | 2025-11-21 06:35 | 2.7M | |
![[ ]](/icons/unknown.gif) | რეესტრი (2014_01_01-2015_09_01).xlsx | 2025-11-21 06:35 | 161K | |
![[IMG]](/icons/image2.gif) | image014.png | 2025-11-21 06:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | image013.png | 2025-11-21 06:35 | 1.7K | |
![[IMG]](/icons/image2.gif) | image012 (1).png | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image011 (2).png | 2025-11-21 06:35 | 1.8K | |
![[IMG]](/icons/image2.gif) | image010 (1).png | 2025-11-21 06:35 | 1.6K | |
![[IMG]](/icons/image2.gif) | image009 (2).png | 2025-11-21 06:35 | 936 | |
![[IMG]](/icons/image2.gif) | image008 (3).png | 2025-11-21 06:35 | 1.6K | |
![[IMG]](/icons/image2.gif) | image007 (14).png | 2025-11-21 06:35 | 1.0K | |
![[IMG]](/icons/image2.gif) | image006 (22).jpg | 2025-11-21 06:35 | 5.1K | |
![[IMG]](/icons/image2.gif) | image005 (30).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (296).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (295).jpg | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (484).jpg | 2025-11-21 06:35 | 431 | |
![[IMG]](/icons/image2.gif) | image001 (483).jpg | 2025-11-21 06:35 | 431 | |
![[IMG]](/icons/image2.gif) | image001 (482).jpg | 2025-11-21 06:35 | 431 | |
![[IMG]](/icons/image2.gif) | image001 (481).jpg | 2025-11-21 06:35 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (311).png | 2025-11-21 06:35 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (310).png | 2025-11-21 06:35 | 12K | |
![[ ]](/icons/compressed.gif) | January Newsletter attachments.zip | 2025-11-21 06:35 | 1.3M | |
![[ ]](/icons/unknown.gif) | All Active Providers (1).xls | 2025-11-21 06:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | თბილისის სახელმწიფო სამედიცინო უნივერსიტეტი.xlsx | 2025-11-21 06:35 | 15K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (23).xlsx | 2025-11-21 06:35 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (22).xlsx | 2025-11-21 06:35 | 11K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (21).xlsx | 2025-11-21 06:35 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (22).gif | 2025-11-21 06:35 | 453 | |
![[IMG]](/icons/image2.gif) | image002 (21).gif | 2025-11-21 06:35 | 453 | |
![[IMG]](/icons/image2.gif) | image001 (480).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (479).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (478).jpg | 2025-11-21 06:35 | 431 | |
![[IMG]](/icons/image2.gif) | image001 (477).jpg | 2025-11-21 06:35 | 431 | |
![[ ]](/icons/unknown.gif) | Tub Payments 2014 December.xlsx | 2025-11-21 06:35 | 112K | |
![[ ]](/icons/unknown.gif) | All Active Providers.xls | 2025-11-21 06:35 | 1.9M | |
![[IMG]](/icons/image2.gif) | 360.gif | 2025-11-21 06:35 | 453 | |
![[ ]](/icons/unknown.gif) | ფიზიკური პირები.xlsx | 2025-11-21 06:35 | 9.0K | |
![[ ]](/icons/unknown.gif) | დუბლირებული ბენეფიციარები (2).xlsx | 2025-11-21 06:35 | 2.7M | |
![[IMG]](/icons/image2.gif) | zuras (2).png | 2025-11-21 06:35 | 314K | |
![[IMG]](/icons/image2.gif) | image004 (65).png | 2025-11-21 06:35 | 8.5K | |
![[IMG]](/icons/image2.gif) | image003 (129).png | 2025-11-21 06:35 | 82K | |
![[IMG]](/icons/image2.gif) | image003 (128).png | 2025-11-21 06:35 | 8.5K | |
![[IMG]](/icons/image2.gif) | image003 (127).png | 2025-11-21 06:35 | 8.5K | |
![[IMG]](/icons/image2.gif) | image003 (126).png | 2025-11-21 06:35 | 8.5K | |
![[IMG]](/icons/image2.gif) | image002 (151).png | 2025-11-21 06:35 | 82K | |
![[IMG]](/icons/image2.gif) | image002 (150).png | 2025-11-21 06:35 | 82K | |
![[IMG]](/icons/image2.gif) | image002 (149).png | 2025-11-21 06:35 | 82K | |
![[IMG]](/icons/image2.gif) | image001 (476).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (475).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (474).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (473).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (472).jpg | 2025-11-21 06:35 | 431 | |
![[ ]](/icons/unknown.gif) | hssp.xls | 2025-11-21 06:35 | 52K | |
![[ ]](/icons/unknown.gif) | User management fields 22_12_14 -Copy - Copy (1).xlsx | 2025-11-21 06:35 | 14K | |
![[IMG]](/icons/image2.gif) | Sidsi.bmp | 2025-11-21 06:35 | 2.2M | |
![[IMG]](/icons/image2.gif) | Sids.bmp | 2025-11-21 06:35 | 2.5M | |
![[ ]](/icons/unknown.gif) | Hotels January 2015 year.xlsx | 2025-11-21 06:35 | 11K | |
![[ ]](/icons/unknown.gif) | provaider (2).xlsx | 2025-11-21 06:35 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (125).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (148).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (147).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (146).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (471).jpg | 2025-11-21 06:35 | 431 | |
![[IMG]](/icons/image2.gif) | image001 (470).jpg | 2025-11-21 06:35 | 431 | |
![[IMG]](/icons/image2.gif) | image001 (469).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (309).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (308).png | 2025-11-21 06:35 | 240K | |
![[IMG]](/icons/image2.gif) | image001 (307).png | 2025-11-21 06:35 | 240K | |
![[IMG]](/icons/image2.gif) | image001 (306).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (305).png | 2025-11-21 06:35 | 11K | |
![[ ]](/icons/unknown.gif) | Untitled (26) | 2025-11-21 06:35 | 0 | |
![[ ]](/icons/unknown.gif) | Changed Payment Orders.xlsx | 2025-11-21 06:35 | 10K | |
![[ ]](/icons/unknown.gif) | rustavis n2 diagnostikuri.docx | 2025-11-21 06:35 | 446K | |
![[ ]](/icons/unknown.gif) | provaider (1).xlsx | 2025-11-21 06:35 | 10K | |
![[IMG]](/icons/image2.gif) | image005 (30).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (64).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (124).png | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (93).jpg | 2025-11-21 06:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (294).jpg | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (145).png | 2025-11-21 06:35 | 1.1K | |
![[IMG]](/icons/image2.gif) | image002 (20).gif | 2025-11-21 06:35 | 453 | |
![[IMG]](/icons/image2.gif) | image001 (468).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (304).png | 2025-11-21 06:35 | 1.1K | |
![[IMG]](/icons/image2.gif) | image001 (303).png | 2025-11-21 06:35 | 60K | |
![[ ]](/icons/unknown.gif) | Social Marketing Creative Brief for a Visual Hammer.docx | 2025-11-21 06:35 | 38K | |
![[ ]](/icons/unknown.gif) | RBM CCoP Reporting Guide for Malaria Communication Evaluations -Sept2014 FINAL.doc | 2025-11-21 06:35 | 131K | |
![[ ]](/icons/layout.gif) | Lewandowsky_PscyhSciPublicInterest_2012.pdf | 2025-11-21 06:35 | 441K | |
![[ ]](/icons/unknown.gif) | Ebola and Nutrition webinar 12_17_14.docx | 2025-11-21 06:35 | 18K | |
![[ ]](/icons/unknown.gif) | user -ჩაჩუა.xlsx | 2025-11-21 06:35 | 12K | |
![[TXT]](/icons/text.gif) | synch_2015_01_13-00.txt | 2025-11-21 06:35 | 593K | |
![[TXT]](/icons/text.gif) | synch_2015_01_12-00.txt | 2025-11-21 06:35 | 320K | |
![[TXT]](/icons/text.gif) | synch_2015_01_11-00.txt | 2025-11-21 06:35 | 354K | |
![[TXT]](/icons/text.gif) | synch_2015_01_10-00.txt | 2025-11-21 06:35 | 630K | |
![[TXT]](/icons/text.gif) | synch_2015_01_09-00.txt | 2025-11-21 06:35 | 366K | |
![[TXT]](/icons/text.gif) | synch_2015_01_08-00.txt | 2025-11-21 06:35 | 364K | |
![[TXT]](/icons/text.gif) | synch_2015_01_07-00.txt | 2025-11-21 06:35 | 810K | |
![[IMG]](/icons/image2.gif) | image001 (467).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (466).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (465).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (464).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (463).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (462).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (302).png | 2025-11-21 06:35 | 106K | |
![[ ]](/icons/unknown.gif) | error 14_01_2015.docx | 2025-11-21 06:35 | 166K | |
![[ ]](/icons/unknown.gif) | Vday_00_jpg_srz | 2025-11-21 06:35 | 61K | |
![[ ]](/icons/unknown.gif) | User management fields14_01_145 -Copy - Copy.xlsx | 2025-11-21 06:35 | 14K | |
![[IMG]](/icons/image2.gif) | Shidsi.bmp | 2025-11-21 06:35 | 1.9M | |
![[ ]](/icons/unknown.gif) | ერისთავი - მოდულით.xlsx | 2025-11-21 06:35 | 21K | |
![[ ]](/icons/unknown.gif) | ემ-ემ-ტე ჰოსპიტალი.xlsx | 2025-11-21 06:35 | 15K | |
![[ ]](/icons/unknown.gif) | ახალი სამედიცინო ცენტრი-ბოლნისის ფილიალი.xlsx | 2025-11-21 06:35 | 15K | |
![[ ]](/icons/unknown.gif) | user - 1501 (1).xlsx | 2025-11-21 06:35 | 12K | |
![[IMG]](/icons/image2.gif) | samzedro 1.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | samzedro 1 (1).bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | samzedro.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | samxedro - dzveli kontraqti.bmp | 2025-11-21 06:35 | 1.8M | |
![[IMG]](/icons/image2.gif) | image003 (92).jpg | 2025-11-21 06:35 | 22K | |
![[IMG]](/icons/image2.gif) | image003 (91).jpg | 2025-11-21 06:35 | 17K | |
![[IMG]](/icons/image2.gif) | faqtiuri xarji 2.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | faqtiru xarji 1.bmp | 2025-11-21 06:35 | 2.0M | |
![[IMG]](/icons/image2.gif) | ჩაჩავას კლინიკა.bmp | 2025-11-21 06:35 | 2.3M | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (3).xlsx | 2025-11-21 06:35 | 9.9K | |
![[ ]](/icons/unknown.gif) | პერიტონ_ ელ მოდული.xls | 2025-11-21 06:35 | 69K | |
![[ ]](/icons/unknown.gif) | დუბლირებული ბენეფიციარები II.XLSX | 2025-11-21 06:35 | 753K | |
![[ ]](/icons/unknown.gif) | გუდაური 2015.xlsx | 2025-11-21 06:35 | 12K | |
![[IMG]](/icons/image2.gif) | zuras (1).png | 2025-11-21 06:35 | 228K | |
![[ ]](/icons/unknown.gif) | user - 1501.xlsx | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | untitled (8).bmp | 2025-11-21 06:35 | 4.1M | |
![[IMG]](/icons/image2.gif) | image001 (301).png | 2025-11-21 06:35 | 66K | |
![[IMG]](/icons/image2.gif) | image001 (300).png | 2025-11-21 06:35 | 46K | |
![[ ]](/icons/unknown.gif) | Agenda_study_dissemination_workshop_1_14_2015.docx | 2025-11-21 06:35 | 117K | |
![[ ]](/icons/unknown.gif) | ფასები 0000000044 კოდზე.xlsx | 2025-11-21 06:35 | 14K | |
![[ ]](/icons/unknown.gif) | პერინატალური დაწესებულებები (3).xlsx | 2025-11-21 06:35 | 18K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (13).jpg | 2025-11-21 06:35 | 823 | |
![[ ]](/icons/compressed.gif) | reinvigorate.zip | 2025-11-21 06:35 | 19K | |
![[IMG]](/icons/image2.gif) | kontraqti - sawyisisheyvana.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | kontraqti - ghudushauri.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | image006 (21).jpg | 2025-11-21 06:35 | 332 | |
![[IMG]](/icons/image2.gif) | image005 (29).png | 2025-11-21 06:35 | 15K | |
![[IMG]](/icons/image2.gif) | image005 (29).jpg | 2025-11-21 06:35 | 338 | |
![[IMG]](/icons/image2.gif) | image004 (59).jpg | 2025-11-21 06:35 | 23K | |
![[IMG]](/icons/image2.gif) | image004 (58).jpg | 2025-11-21 06:35 | 332 | |
![[IMG]](/icons/image2.gif) | image003 (90).jpg | 2025-11-21 06:35 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (89).jpg | 2025-11-21 06:35 | 1.4K | |
![[IMG]](/icons/image2.gif) | image002 (293).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (292).jpg | 2025-11-21 06:35 | 4.6K | |
![[IMG]](/icons/image2.gif) | image001 (461).jpg | 2025-11-21 06:35 | 726K | |
![[IMG]](/icons/image2.gif) | image001 (460).jpg | 2025-11-21 06:35 | 332 | |
![[IMG]](/icons/image2.gif) | image001 (459).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (299).png | 2025-11-21 06:35 | 66K | |
![[IMG]](/icons/image2.gif) | image001 (298).png | 2025-11-21 06:35 | 7.7K | |
![[ ]](/icons/unknown.gif) | Unit Of Measure Instructions (1).docx | 2025-11-21 06:35 | 18K | |
![[ ]](/icons/unknown.gif) | TBCaseComments.docx | 2025-11-21 06:35 | 105K | |
![[ ]](/icons/unknown.gif) | Rosetta-Stone-Application.docx | 2025-11-21 06:35 | 47K | |
![[ ]](/icons/unknown.gif) | MonitoringComments.docx | 2025-11-21 06:35 | 76K | |
![[IMG]](/icons/image2.gif) | Monitoring2.png | 2025-11-21 06:35 | 42K | |
![[IMG]](/icons/image2.gif) | Monitoring1.png | 2025-11-21 06:35 | 8.6K | |
![[ ]](/icons/unknown.gif) | Book1 (1).xlsx | 2025-11-21 06:35 | 8.9K | |
![[IMG]](/icons/image2.gif) | ღუდუშაური - ტრანსპორტირება (1).bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | transportireba - validacia.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | mimartva1.png | 2025-11-21 06:35 | 210K | |
![[IMG]](/icons/image2.gif) | mimartva.png | 2025-11-21 06:35 | 205K | |
![[ ]](/icons/unknown.gif) | mcxeta21_01_2015.xlsx | 2025-11-21 06:35 | 11K | |
![[ ]](/icons/unknown.gif) | mcxeta - mtianeti f_p_ -prov.xlsx | 2025-11-21 06:35 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (458).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (457).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (456).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (455).jpg | 2025-11-21 06:35 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (454).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (453).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (452).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (297).png | 2025-11-21 06:35 | 45K | |
![[ ]](/icons/unknown.gif) | ganaxlebuli bazisTvis2015.xls | 2025-11-21 06:35 | 29K | |
![[ ]](/icons/unknown.gif) | ganaxlebuli bazisTvis2015 (1).xls | 2025-11-21 06:35 | 27K | |
![[ ]](/icons/unknown.gif) | User management fields_E_Ruadze.xlsx | 2025-11-21 06:35 | 14K | |
![[ ]](/icons/unknown.gif) | Referrals (1).xlsx | 2025-11-21 06:35 | 58K | |
![[ ]](/icons/unknown.gif) | ProvidersFull (1) (1).xlsx | 2025-11-21 06:35 | 1.2M | |
![[ ]](/icons/unknown.gif) | Copy of SSA - vertikaluri-2 (1).xlsx | 2025-11-21 06:35 | 11K | |
![[ ]](/icons/unknown.gif) | პერინატალური დაწესებულებები (2).xlsx | 2025-11-21 06:35 | 20K | |
![[ ]](/icons/unknown.gif) | იონი.xlsx | 2025-11-21 06:35 | 8.9K | |
![[ ]](/icons/unknown.gif) | ვერტიკალები (1).xlsx | 2025-11-21 06:35 | 229K | |
![[ ]](/icons/unknown.gif) | დაწესებულების რეკვიზიტები.xlsx | 2025-11-21 06:35 | 9.9K | |
![[ ]](/icons/unknown.gif) | ახალი დეფინიციები_2015_01_20.docx | 2025-11-21 06:35 | 54K | |
![[IMG]](/icons/image2.gif) | serxios (1).png | 2025-11-21 06:35 | 203K | |
![[IMG]](/icons/image2.gif) | image002 (291).jpg | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (296).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | image001 (295).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | image001 (294).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | image001 (293).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | image001 (292).png | 2025-11-21 06:35 | 238K | |
![[ ]](/icons/unknown.gif) | WEB&DB_for_Aleko.docx | 2025-11-21 06:35 | 48K | |
![[ ]](/icons/unknown.gif) | User management fields21_01_145 -Copy - Copy.xlsx | 2025-11-21 06:35 | 14K | |
![[IMG]](/icons/image2.gif) | TRANSPORTIREBA - DAWESEBULEBISMISAMARTI.bmp | 2025-11-21 06:35 | 2.1M | |
![[ ]](/icons/unknown.gif) | პროვაიდერი.xlsx | 2025-11-21 06:35 | 10K | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (2).xlsx | 2025-11-21 06:35 | 9.9K | |
![[ ]](/icons/unknown.gif) | პროვაიდერი (1).xlsx | 2025-11-21 06:35 | 9.9K | |
![[ ]](/icons/unknown.gif) | ველები (1).xlsx | 2025-11-21 06:35 | 9.5K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (12).jpg | 2025-11-21 06:35 | 823 | |
![[ ]](/icons/unknown.gif) | skriningi.xlsx | 2025-11-21 06:35 | 28K | |
![[ ]](/icons/unknown.gif) | narkomania.xlsx | 2025-11-21 06:35 | 22K | |
![[IMG]](/icons/image2.gif) | image003 (123).png | 2025-11-21 06:35 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (290).jpg | 2025-11-21 06:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (289).jpg | 2025-11-21 06:35 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (451).jpg | 2025-11-21 06:35 | 344 | |
![[IMG]](/icons/image2.gif) | image001 (450).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (449).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (448).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (447).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (446).jpg | 2025-11-21 06:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (291).png | 2025-11-21 06:35 | 86K | |
![[IMG]](/icons/image2.gif) | image001 (290).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | image001 (289).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | image001 (45).gif | 2025-11-21 06:35 | 45K | |
![[ ]](/icons/unknown.gif) | epidzedamxedveloba.xlsx | 2025-11-21 06:35 | 19K | |
![[IMG]](/icons/image2.gif) | deka2.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | deka1.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | deka.bmp | 2025-11-21 06:35 | 3.7M | |
![[ ]](/icons/unknown.gif) | amulatoriuli qirurgia.xlsx | 2025-11-21 06:35 | 19K | |
![[ ]](/icons/unknown.gif) | User management fields23_01_145 -Copy - Copy.xlsx | 2025-11-21 06:35 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields 22_12_14 -Copy - Copy.xlsx | 2025-11-21 06:35 | 14K | |
![[ ]](/icons/unknown.gif) | Problem Contracts.xlsx | 2025-11-21 06:35 | 9.5K | |
![[ ]](/icons/unknown.gif) | Book1.xlsx | 2025-11-21 06:35 | 12K | |
![[ ]](/icons/unknown.gif) | ATT87992 | 2025-11-21 06:35 | 0 | |
![[IMG]](/icons/image2.gif) | qvekomponenti - damtkicebulibiujeti.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | kontraqti - axali.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | image001 (288).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | image001 (287).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | image001 (286).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | image001 (285).png | 2025-11-21 06:35 | 238K | |
![[IMG]](/icons/image2.gif) | finansuri erteuli - 11140033.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | 999999.bmp | 2025-11-21 06:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | image002 (288).jpg | 2025-11-21 06:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (284).png | 2025-11-21 06:35 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (283).png | 2025-11-21 06:35 | 265K | |
![[IMG]](/icons/image2.gif) | image001 (445).jpg | 2025-11-21 06:35 | 4.2K | |
![[ ]](/icons/unknown.gif) | პერინატალური დაწესებულებები (1).xlsx | 2025-11-21 06:35 | 22K | |
![[ ]](/icons/unknown.gif) | თამთას ახალი (1).xlsx | 2025-11-21 06:35 | 12K | |
![[ ]](/icons/unknown.gif) | user -შალამბერიძე.xlsx | 2025-11-21 06:35 | 12K | |
![[ ]](/icons/unknown.gif) | mestia.xlsx | 2025-11-21 06:35 | 12K | |
![[ ]](/icons/unknown.gif) | abazadze.xlsx | 2025-11-21 06:35 | 10K | |
![[ ]](/icons/unknown.gif) | Error 26_01_2015 (2).docx | 2025-11-21 06:35 | 171K | |
![[ ]](/icons/unknown.gif) | ATT11663 | 2025-11-21 06:35 | 0 | |
![[IMG]](/icons/image2.gif) | tubis xelshewy_.bmp | 2025-11-21 06:35 | 4.1M | |
![[IMG]](/icons/image2.gif) | image003 (88).jpg | 2025-11-21 06:35 | 23K | |
![[IMG]](/icons/image2.gif) | image002 (287).jpg | 2025-11-21 06:35 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (444).jpg | 2025-11-21 06:35 | 4.2K | |
![[ ]](/icons/unknown.gif) | ველები.xlsx | 2025-11-21 06:35 | 9.5K | |
![[IMG]](/icons/image2.gif) | image002 (286).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (443).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (442).jpg | 2025-11-21 06:34 | 4.2K | |
![[ ]](/icons/unknown.gif) | რეპორტი (2).xlsx | 2025-11-21 06:34 | 11K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (20).xlsx | 2025-11-21 06:34 | 11K | |
![[ ]](/icons/unknown.gif) | awara 27_01_2015 (1).xlsx | 2025-11-21 06:34 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (19).xlsx | 2025-11-21 06:34 | 12K | |
![[ ]](/icons/unknown.gif) | shida qartlis soflebisxelsh_biujeti.docx | 2025-11-21 06:34 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (282).png | 2025-11-21 06:34 | 296K | |
![[ ]](/icons/unknown.gif) | User management fields28_01_145 -Copy - Copy.xlsx | 2025-11-21 06:34 | 14K | |
![[ ]](/icons/unknown.gif) | N25-sh_qartlis forma.xlsx | 2025-11-21 06:34 | 17K | |
![[ ]](/icons/unknown.gif) | u10DBu10DDu10D3u10E3u10DAu10D8_28_01_15.xlsx | 2025-11-21 06:34 | 19K | |
![[ ]](/icons/unknown.gif) | provaider.xlsx | 2025-11-21 06:34 | 10K | |
![[IMG]](/icons/image2.gif) | დაზღვევის სტატუსი.bmp | 2025-11-21 06:34 | 3.7M | |
![[ ]](/icons/unknown.gif) | პერინატალური დაწესებულებები.xlsx | 2025-11-21 06:34 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (441).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (440).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (439).jpg | 2025-11-21 06:34 | 4.2K | |
![[ ]](/icons/unknown.gif) | awara 27_01_2015.xlsx | 2025-11-21 06:34 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (87).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (285).jpg | 2025-11-21 06:34 | 70K | |
![[IMG]](/icons/image2.gif) | image001 (438).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (437).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (436).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (435).jpg | 2025-11-21 06:34 | 4.2K | |
![[ ]](/icons/unknown.gif) | User management fields29_01_145 -Copy - Copy.xlsx | 2025-11-21 06:34 | 14K | |
![[IMG]](/icons/image2.gif) | beneficiaris registracia (1).png | 2025-11-21 06:34 | 87K | |
![[ ]](/icons/unknown.gif) | awara 29_01_2015.xlsx | 2025-11-21 06:34 | 10K | |
![[ ]](/icons/unknown.gif) | ფორმა 2 3 განხილვა-[ახალი].docx | 2025-11-21 06:34 | 24K | |
![[ ]](/icons/unknown.gif) | ფორმა 2 3 განხილვა-Taplo[ძველი].docx | 2025-11-21 06:34 | 29K | |
![[ ]](/icons/unknown.gif) | ვერტიკალები.xlsx | 2025-11-21 06:34 | 229K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (11).jpg | 2025-11-21 06:34 | 823 | |
![[ ]](/icons/unknown.gif) | Unit Of Measure Instructions.docx | 2025-11-21 06:34 | 18K | |
![[ ]](/icons/unknown.gif) | TuberculosisExport28_01_2015_19_00_45(1).xlsx | 2025-11-21 06:34 | 80K | |
![[ ]](/icons/unknown.gif) | ProvidersFull (1).xlsx | 2025-11-21 06:34 | 1.2M | |
![[ ]](/icons/unknown.gif) | შპს ბათუმის დიალიზისა და ნეფროლოგიის ცენტრი.xlsx | 2025-11-21 06:34 | 9.9K | |
![[ ]](/icons/unknown.gif) | რეცეპტი Cloud.xlsx | 2025-11-21 06:34 | 18K | |
![[ ]](/icons/unknown.gif) | დანართი (8).xlsx | 2025-11-21 06:34 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (434).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (433).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | datvaliereba.bmp | 2025-11-21 06:34 | 3.7M | |
![[IMG]](/icons/image2.gif) | angarishgebis periopdi (1).bmp | 2025-11-21 06:34 | 3.7M | |
![[ ]](/icons/unknown.gif) | Providers (3).xlsx | 2025-11-21 06:34 | 30K | |
![[IMG]](/icons/image2.gif) | შპს თბილისის პედიატრიული პრივატ კლინიკა- 863654136 (1).bmp | 2025-11-21 06:34 | 3.7M | |
![[IMG]](/icons/image2.gif) | untitled (7).bmp | 2025-11-21 06:34 | 4.1M | |
![[IMG]](/icons/image2.gif) | sergos.png | 2025-11-21 06:34 | 220K | |
![[IMG]](/icons/image2.gif) | transportireba - tanxebi.bmp | 2025-11-21 06:34 | 3.7M | |
![[IMG]](/icons/image2.gif) | image001 (281).png | 2025-11-21 06:34 | 13K | |
![[ ]](/icons/unknown.gif) | მოდული - დასრულებული ფორმები (2).xlsx | 2025-11-21 06:34 | 9.1K | |
![[ ]](/icons/unknown.gif) | მოდული - დასრულებული ფორმები (1).xlsx | 2025-11-21 06:34 | 9.1K | |
![[IMG]](/icons/image2.gif) | image001 (432).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (284).jpg | 2025-11-21 06:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (283).jpg | 2025-11-21 06:34 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (144).png | 2025-11-21 06:34 | 132K | |
![[IMG]](/icons/image2.gif) | image001 (280).png | 2025-11-21 06:34 | 87K | |
![[IMG]](/icons/image2.gif) | image001 (279).png | 2025-11-21 06:34 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (278).png | 2025-11-21 06:34 | 14K | |
![[IMG]](/icons/image2.gif) | ჯეოჰოსპიტალსი.PNG | 2025-11-21 06:34 | 108K | |
![[IMG]](/icons/image2.gif) | image003 (86).jpg | 2025-11-21 06:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (282).jpg | 2025-11-21 06:34 | 4.7K | |
![[IMG]](/icons/image2.gif) | image002 (143).png | 2025-11-21 06:34 | 132K | |
![[IMG]](/icons/image2.gif) | image001 (431).jpg | 2025-11-21 06:34 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (277).png | 2025-11-21 06:34 | 87K | |
![[ ]](/icons/unknown.gif) | user -ლორთქიფანიძე.xlsx | 2025-11-21 06:34 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (430).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | ფსიქიატრია.bmp | 2025-11-21 06:34 | 3.7M | |
![[IMG]](/icons/image2.gif) | image002 (142).png | 2025-11-21 06:34 | 132K | |
![[IMG]](/icons/image2.gif) | image001 (276).png | 2025-11-21 06:34 | 87K | |
![[ ]](/icons/unknown.gif) | agricxvaze asayvani.xlsx | 2025-11-21 06:34 | 9.8K | |
![[ ]](/icons/unknown.gif) | მოდული - დასრულებული ფორმები.xlsx | 2025-11-21 06:34 | 9.1K | |
![[IMG]](/icons/image2.gif) | image004 (57).jpg | 2025-11-21 06:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | image003 (85).jpg | 2025-11-21 06:34 | 411 | |
![[IMG]](/icons/image2.gif) | image002 (281).jpg | 2025-11-21 06:34 | 423 | |
![[IMG]](/icons/image2.gif) | image002 (141).png | 2025-11-21 06:34 | 132K | |
![[IMG]](/icons/image2.gif) | image001 (429).jpg | 2025-11-21 06:34 | 406 | |
![[IMG]](/icons/image2.gif) | image001 (275).png | 2025-11-21 06:34 | 87K | |
![[IMG]](/icons/image2.gif) | image001 (274).png | 2025-11-21 06:34 | 13K | |
![[ ]](/icons/unknown.gif) | Accounts R2 IBAN 201501.xlsx | 2025-11-21 06:34 | 22K | |
![[ ]](/icons/unknown.gif) | ATT46332 | 2025-11-21 06:34 | 0 | |
![[ ]](/icons/unknown.gif) | მოდულის ტექსტი.doc | 2025-11-21 06:34 | 37K | |
![[ ]](/icons/unknown.gif) | დაწესებულებები (2).xlsx | 2025-11-21 06:34 | 11K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (18).xlsx | 2025-11-21 06:34 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (428).jpg | 2025-11-21 06:34 | 10K | |
![[ ]](/icons/unknown.gif) | User management fields03_02_145 -Copy - Copy (1).xlsx | 2025-11-21 06:34 | 14K | |
![[ ]](/icons/unknown.gif) | Doctors.xlsx | 2025-11-21 06:34 | 3.5M | |
![[IMG]](/icons/image2.gif) | beneficiary (1).png | 2025-11-21 06:34 | 178K | |
![[IMG]](/icons/image2.gif) | reporting.png | 2025-11-21 06:34 | 124K | |
![[IMG]](/icons/image2.gif) | mimartvebi (1).png | 2025-11-21 06:34 | 299K | |
![[ ]](/icons/layout.gif) | BioData -Tamta Kobakhidze_Sep 2014.pdf | 2025-11-21 06:34 | 128K | |
![[ ]](/icons/unknown.gif) | BioData -Tamta Kobakhidze_Sep 2014.doc | 2025-11-21 06:34 | 180K | |
![[IMG]](/icons/image2.gif) | image004 (56).jpg | 2025-11-21 06:34 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (122).png | 2025-11-21 06:34 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (280).jpg | 2025-11-21 06:34 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (273).png | 2025-11-21 06:34 | 13K | |
![[ ]](/icons/unknown.gif) | User management fields03_02_145 -Copy - Copy.xlsx | 2025-11-21 06:34 | 14K | |
![[ ]](/icons/unknown.gif) | ვერტიკალურის ფორმები.xlsx | 2025-11-21 06:34 | 16K | |
![[IMG]](/icons/image2.gif) | image007 (7).jpg | 2025-11-21 06:34 | 9.5K | |
![[IMG]](/icons/image2.gif) | image006 (20).jpg | 2025-11-21 06:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | image005 (12).gif | 2025-11-21 06:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | image003 (121).png | 2025-11-21 06:34 | 552K | |
![[IMG]](/icons/image2.gif) | image001 (427).jpg | 2025-11-21 06:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (426).jpg | 2025-11-21 06:34 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (140).png | 2025-11-21 06:34 | 8.1K | |
![[IMG]](/icons/image2.gif) | image001 (272).png | 2025-11-21 06:34 | 33K | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (6).pdf | 2025-11-21 06:34 | 388K | |
![[IMG]](/icons/image2.gif) | Portal problem.png | 2025-11-21 06:34 | 204K | |
![[IMG]](/icons/image2.gif) | image002 (139).png | 2025-11-21 06:34 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (138).png | 2025-11-21 06:34 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (425).jpg | 2025-11-21 06:34 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (424).jpg | 2025-11-21 06:34 | 19K | |
![[ ]](/icons/unknown.gif) | User management fields04_02_145 -Copy - Copy (1).xlsx | 2025-11-21 06:34 | 14K | |
![[ ]](/icons/unknown.gif) | SENSITIVE_PATIENTS_REPORT.XLSX | 2025-11-21 06:34 | 128K | |
![[ ]](/icons/unknown.gif) | RESISTENT_PATIENTS_REPORT.XLSX | 2025-11-21 06:34 | 69K | |
![[ ]](/icons/unknown.gif) | ხონის ჰოსპიტალი.xlsx | 2025-11-21 06:34 | 15K | |
![[ ]](/icons/unknown.gif) | ტყიბულის ჰოსპიტალი.xlsx | 2025-11-21 06:34 | 15K | |
![[ ]](/icons/unknown.gif) | რეესტრი (20140901-20150203).xlsx | 2025-11-21 06:34 | 1.1M | |
![[IMG]](/icons/image2.gif) | tubis amb_.bmp | 2025-11-21 06:34 | 4.1M | |
![[ ]](/icons/unknown.gif) | filialebis modultanwvdoma (2).xlsx | 2025-11-21 06:34 | 9.6K | |
![[IMG]](/icons/image2.gif) | antenataluri.bmp | 2025-11-21 06:34 | 4.1M | |
![[ ]](/icons/unknown.gif) | User management fields04_02_145 -Copy - Copy.xlsx | 2025-11-21 06:34 | 14K | |
![[ ]](/icons/unknown.gif) | Reestri.xlsx | 2025-11-21 06:34 | 1.1M | |
![[ ]](/icons/unknown.gif) | FinancingUsingItems.xlsx | 2025-11-21 06:34 | 66K | |
![[IMG]](/icons/image2.gif) | შპს დეკა 1.bmp | 2025-11-21 06:34 | 3.7M | |
![[IMG]](/icons/image2.gif) | შპს დეკა - ანტენატალური.bmp | 2025-11-21 06:34 | 3.7M | |
![[IMG]](/icons/image2.gif) | image001 (423).jpg | 2025-11-21 06:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | შპს დეკა.bmp | 2025-11-21 06:34 | 3.7M | |
![[IMG]](/icons/image2.gif) | image001 (422).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (421).jpg | 2025-11-21 06:33 | 4.2K | |
![[ ]](/icons/unknown.gif) | ATT35367 | 2025-11-21 06:33 | 0 | |
![[ ]](/icons/unknown.gif) | დაწესებულებები (1).xlsx | 2025-11-21 06:33 | 11K | |
![[ ]](/icons/unknown.gif) | samcxe f_p_05_02_2015.xlsx | 2025-11-21 06:33 | 9.9K | |
![[IMG]](/icons/image2.gif) | image003 (120).png | 2025-11-21 06:33 | 8.1K | |
![[IMG]](/icons/image2.gif) | image001 (420).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (419).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (271).png | 2025-11-21 06:33 | 33K | |
![[ ]](/icons/unknown.gif) | awaris f_p_05_02_2015.xlsx | 2025-11-21 06:33 | 10K | |
![[ ]](/icons/unknown.gif) | User management fields05_02_145 -Copy - Copy (2).xlsx | 2025-11-21 06:33 | 14K | |
![[ ]](/icons/unknown.gif) | დაწესებულებები რომლებსაც არ აქვთ კავშირი ფინანსურთან.xlsx | 2025-11-21 06:33 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (119).png | 2025-11-21 06:33 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (279).jpg | 2025-11-21 06:33 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (270).png | 2025-11-21 06:33 | 78K | |
![[IMG]](/icons/image2.gif) | batumis infeqciuri.bmp | 2025-11-21 06:33 | 3.7M | |
![[ ]](/icons/unknown.gif) | User management fields05_02_145 -Copy - Copy (1).xlsx | 2025-11-21 06:33 | 14K | |
![[ ]](/icons/unknown.gif) | provaider - შპს დეკა.xlsx | 2025-11-21 06:33 | 10K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (17).xlsx | 2025-11-21 06:33 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (137).png | 2025-11-21 06:33 | 132K | |
![[IMG]](/icons/image2.gif) | image001 (269).png | 2025-11-21 06:33 | 87K | |
![[ ]](/icons/unknown.gif) | Referrals Print Page.docx | 2025-11-21 06:33 | 13K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (16).xlsx | 2025-11-21 06:33 | 12K | |
![[ ]](/icons/unknown.gif) | user - ნანა კიკაძე.xlsx | 2025-11-21 06:33 | 12K | |
![[ ]](/icons/layout.gif) | tradeshowCard-Fionet-General-USA-5-highres.pdf | 2025-11-21 06:33 | 1.1M | |
![[ ]](/icons/unknown.gif) | nimushi.xlsx | 2025-11-21 06:33 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (278).jpg | 2025-11-21 06:33 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (268).png | 2025-11-21 06:33 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (267).png | 2025-11-21 06:33 | 275K | |
![[IMG]](/icons/image2.gif) | error (14).png | 2025-11-21 06:33 | 373K | |
![[ ]](/icons/unknown.gif) | User management fields09_02_14 -Copy - Copy (1).xlsx | 2025-11-21 06:33 | 14K | |
![[ ]](/icons/unknown.gif) | Data Before Update.xlsx | 2025-11-21 06:33 | 25K | |
![[ ]](/icons/unknown.gif) | ATT73577 | 2025-11-21 06:33 | 0 | |
![[IMG]](/icons/image2.gif) | image002 (277).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (276).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (418).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (417).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (266).png | 2025-11-21 06:33 | 275K | |
![[IMG]](/icons/image2.gif) | image001 (265).png | 2025-11-21 06:33 | 364K | |
![[IMG]](/icons/image2.gif) | image001 (264).png | 2025-11-21 06:33 | 364K | |
![[IMG]](/icons/image2.gif) | image001 (263).png | 2025-11-21 06:33 | 364K | |
![[IMG]](/icons/image2.gif) | image001 (262).png | 2025-11-21 06:33 | 360K | |
![[IMG]](/icons/image2.gif) | image001 (261).png | 2025-11-21 06:33 | 360K | |
![[IMG]](/icons/image2.gif) | image001 (260).png | 2025-11-21 06:33 | 543K | |
![[IMG]](/icons/image2.gif) | image001 (259).png | 2025-11-21 06:33 | 543K | |
![[ ]](/icons/unknown.gif) | User management fields09_02_14 -Copy - Copy.xlsx | 2025-11-21 06:33 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields05_02_145 -Copy - Copy.xlsx | 2025-11-21 06:33 | 14K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (15).xlsx | 2025-11-21 06:33 | 12K | |
![[ ]](/icons/unknown.gif) | meriis formebi all (1).xlsx | 2025-11-21 06:33 | 52K | |
![[IMG]](/icons/image2.gif) | image009 (4).jpg | 2025-11-21 06:33 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (55).jpg | 2025-11-21 06:33 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (54).jpg | 2025-11-21 06:33 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (84).jpg | 2025-11-21 06:33 | 8.7K | |
![[IMG]](/icons/image2.gif) | image001 (416).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (415).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (414).jpg | 2025-11-21 06:33 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (413).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (412).jpg | 2025-11-21 06:33 | 10K | |
![[ ]](/icons/layout.gif) | USAID_HIV_FP Integration Presentation.pdf | 2025-11-21 06:33 | 3.0M | |
![[ ]](/icons/layout.gif) | Talent Management_Strategy.pdf | 2025-11-21 06:33 | 577K | |
![[ ]](/icons/unknown.gif) | SENSITIVE_PATIENTS_REPORT(CASE_ID).xlsx | 2025-11-21 06:33 | 140K | |
![[ ]](/icons/unknown.gif) | SENSITIVE_PATIENTS_REPORT(CASE_ID) (1).xlsx | 2025-11-21 06:33 | 133K | |
![[ ]](/icons/unknown.gif) | RESISTENT_PATIENTS_REPORT(CASE_ID).xlsx | 2025-11-21 06:33 | 75K | |
![[ ]](/icons/unknown.gif) | RESISTENT_PATIENTS_REPORT(CASE_ID) (1).xlsx | 2025-11-21 06:33 | 72K | |
![[ ]](/icons/layout.gif) | Publishing Agreement Approvals Jan 2015.pdf | 2025-11-21 06:33 | 148K | |
![[ ]](/icons/unknown.gif) | ATT64381 | 2025-11-21 06:33 | 0 | |
![[ ]](/icons/unknown.gif) | ATT36583 | 2025-11-21 06:33 | 0 | |
![[ ]](/icons/unknown.gif) | კარაბადინი.xlsx | 2025-11-21 06:33 | 15K | |
![[ ]](/icons/unknown.gif) | meriis formebi all.xlsx | 2025-11-21 06:33 | 56K | |
![[IMG]](/icons/image2.gif) | image004 (53).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (118).png | 2025-11-21 06:33 | 104K | |
![[IMG]](/icons/image2.gif) | image003 (117).png | 2025-11-21 06:33 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (136).png | 2025-11-21 06:33 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (135).png | 2025-11-21 06:33 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (411).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (410).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (409).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | antenataluri - batumi.bmp | 2025-11-21 06:33 | 3.7M | |
![[ ]](/icons/unknown.gif) | Providers (2).xlsx | 2025-11-21 06:33 | 503K | |
![[ ]](/icons/unknown.gif) | Copy of SSA - vertikaluri-2.xlsx | 2025-11-21 06:33 | 13K | |
![[IMG]](/icons/image2.gif) | მიღება ჩაბარების აქტი.bmp | 2025-11-21 06:33 | 3.7M | |
![[ ]](/icons/unknown.gif) | დაწესებულებები.xlsx | 2025-11-21 06:33 | 86K | |
![[IMG]](/icons/image2.gif) | ანგარიშგება.bmp | 2025-11-21 06:33 | 3.7M | |
![[ ]](/icons/unknown.gif) | last meriis formebi all (1).xlsx | 2025-11-21 06:33 | 58K | |
![[IMG]](/icons/image2.gif) | image003 (83).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (82).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (275).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (134).png | 2025-11-21 06:33 | 25K | |
![[IMG]](/icons/image2.gif) | image002 (133).png | 2025-11-21 06:33 | 25K | |
![[IMG]](/icons/image2.gif) | image002 (19).gif | 2025-11-21 06:33 | 96 | |
![[IMG]](/icons/image2.gif) | image002 (18).gif | 2025-11-21 06:33 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (408).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (407).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (406).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (258).png | 2025-11-21 06:33 | 65K | |
![[IMG]](/icons/image2.gif) | image001 (257).png | 2025-11-21 06:33 | 65K | |
![[IMG]](/icons/image2.gif) | image001 (44).gif | 2025-11-21 06:33 | 96 | |
![[ ]](/icons/unknown.gif) | SENSITIVE_PATIENTS(10 თვის ჩათვლით_CASE_ID).xlsx | 2025-11-21 06:33 | 140K | |
![[ ]](/icons/unknown.gif) | RESISTENT_PATIENTS(12 თვის ჩათვლით_CASE_ID).xlsx | 2025-11-21 06:33 | 75K | |
![[ ]](/icons/unknown.gif) | RESISTENT_PATIENTS(10 თვის ჩათვლით_CASE_ID).xlsx | 2025-11-21 06:33 | 74K | |
![[ ]](/icons/unknown.gif) | ATT47128 | 2025-11-21 06:33 | 0 | |
![[IMG]](/icons/image2.gif) | 330.gif | 2025-11-21 06:33 | 96 | |
![[ ]](/icons/unknown.gif) | დუბლირებულები, რომლების ერთ-ერთი დუბლიკატის ფასი მაინც გაგზავნილია ფინანსურში.xlsx | 2025-11-21 06:33 | 35K | |
![[ ]](/icons/unknown.gif) | დუბლირებულები, რომელთა ფასები არ გაგზავნილა ფინანსურში და განსხვავებული ფასებია.xlsx | 2025-11-21 06:33 | 377K | |
![[ ]](/icons/unknown.gif) | last meriis formebi all.xlsx | 2025-11-21 06:33 | 60K | |
![[IMG]](/icons/image2.gif) | image002 (274).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (273).jpg | 2025-11-21 06:33 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (272).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (405).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (43).gif | 2025-11-21 06:33 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (42).gif | 2025-11-21 06:33 | 96 | |
![[IMG]](/icons/image2.gif) | billing -.bmp | 2025-11-21 06:33 | 3.7M | |
![[ ]](/icons/unknown.gif) | IHD_Country_Teams.xlsx | 2025-11-21 06:33 | 50K | |
![[IMG]](/icons/image2.gif) | Capture (12).PNG | 2025-11-21 06:33 | 165K | |
![[IMG]](/icons/image2.gif) | 2_.png | 2025-11-21 06:33 | 160K | |
![[IMG]](/icons/image2.gif) | 1_ (2).png | 2025-11-21 06:33 | 168K | |
![[IMG]](/icons/image2.gif) | Capture (11).PNG | 2025-11-21 06:33 | 165K | |
![[IMG]](/icons/image2.gif) | validuria.bmp | 2025-11-21 06:33 | 3.7M | |
![[IMG]](/icons/image2.gif) | dagvianebuli shetyobineba.bmp | 2025-11-21 06:33 | 3.7M | |
![[IMG]](/icons/image2.gif) | image002 (271).jpg | 2025-11-21 06:33 | 13K | |
![[ ]](/icons/unknown.gif) | Error 12_02_2015.docx | 2025-11-21 06:33 | 131K | |
![[IMG]](/icons/image2.gif) | image001 (404).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (403).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | erro 111.png | 2025-11-21 06:33 | 187K | |
![[IMG]](/icons/image2.gif) | erro 111 (1).png | 2025-11-21 06:33 | 187K | |
![[ ]](/icons/unknown.gif) | სტაციონარი_საიდენტიფიკაციო კოდი.xlsx | 2025-11-21 06:33 | 26K | |
![[ ]](/icons/unknown.gif) | SSA - vertikaluri.xlsx | 2025-11-21 06:33 | 9.4K | |
![[ ]](/icons/unknown.gif) | user - რაჭა (1).xlsx | 2025-11-21 06:33 | 12K | |
![[IMG]](/icons/image2.gif) | angarishgebis periopdi.bmp | 2025-11-21 06:33 | 3.7M | |
![[IMG]](/icons/image2.gif) | შპს თბილისის პედიატრიული პრივატ კლინიკა- 863654136.bmp | 2025-11-21 06:33 | 3.7M | |
![[IMG]](/icons/image2.gif) | image005 (28).jpg | 2025-11-21 06:33 | 80K | |
![[IMG]](/icons/image2.gif) | image004 (52).jpg | 2025-11-21 06:33 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (270).jpg | 2025-11-21 06:33 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (132).png | 2025-11-21 06:33 | 70K | |
![[IMG]](/icons/image2.gif) | image001 (256).png | 2025-11-21 06:33 | 7.7K | |
![[ ]](/icons/unknown.gif) | SENSITIVE_PATIENTS(10 თვის ჩათვლით_CASE_ID)_სრული.xlsx | 2025-11-21 06:33 | 268K | |
![[ ]](/icons/unknown.gif) | RESISTENT_PATIENTS(10 თვის ჩათვლით_CASE_ID)_სრული.xlsx | 2025-11-21 06:33 | 80K | |
![[ ]](/icons/unknown.gif) | ATT72062 | 2025-11-21 06:33 | 0 | |
![[ ]](/icons/unknown.gif) | ATT18615 | 2025-11-21 06:33 | 0 | |
![[IMG]](/icons/image2.gif) | image004 (51).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (116).png | 2025-11-21 06:33 | 36K | |
![[IMG]](/icons/image2.gif) | image003 (115).png | 2025-11-21 06:33 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (131).png | 2025-11-21 06:33 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (402).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | gauqmebuli.png | 2025-11-21 06:33 | 409K | |
![[IMG]](/icons/image2.gif) | arsebobs.png | 2025-11-21 06:33 | 401K | |
![[ ]](/icons/unknown.gif) | 13_02_2014.docx | 2025-11-21 06:33 | 112K | |
![[ ]](/icons/unknown.gif) | 0032_შესრულებული მომსახურების ჩამონათვალი ამბ N14.xl | 2025-11-21 06:33 | 20K | |
![[IMG]](/icons/image2.gif) | vajas.png | 2025-11-21 06:33 | 206K | |
![[IMG]](/icons/image2.gif) | image001 (401).jpg | 2025-11-21 06:33 | 4.2K | |
![[ ]](/icons/unknown.gif) | User management fields.xls | 2025-11-21 06:33 | 57K | |
![[ ]](/icons/unknown.gif) | NCDCD Subcomponents - Aids.xlsx | 2025-11-21 06:33 | 8.8K | |
![[ ]](/icons/unknown.gif) | 135.xlsx | 2025-11-21 06:33 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1 (11).png | 2025-11-21 06:33 | 213K | |
![[IMG]](/icons/image2.gif) | ncsp.png | 2025-11-21 06:33 | 234K | |
![[IMG]](/icons/image2.gif) | Untitled (26).png | 2025-11-21 06:33 | 219K | |
![[IMG]](/icons/image2.gif) | 404438033.JPG | 2025-11-21 06:33 | 93K | |
![[IMG]](/icons/image2.gif) | image001 (400).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (399).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (398).jpg | 2025-11-21 06:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (41).gif | 2025-11-21 06:33 | 43 | |
![[ ]](/icons/unknown.gif) | გადაუდებელი მედიცინის ცენტრი.xlsx | 2025-11-21 06:33 | 15K | |
![[IMG]](/icons/image2.gif) | image002 (269).jpg | 2025-11-21 06:33 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (397).jpg | 2025-11-21 06:32 | 3.1K | |
![[ ]](/icons/unknown.gif) | ATT32989 | 2025-11-21 06:32 | 0 | |
![[ ]](/icons/unknown.gif) | user - კუცა ხომასურიძე.xlsx | 2025-11-21 06:32 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (14).xlsx | 2025-11-21 06:32 | 12K | |
![[ ]](/icons/unknown.gif) | u10DBu10D0u10E0u10D0u10D2u10D4u10D1u10D8u10E1 u10DBu10D0u10E0u10D7u10D5u10D0.xlsx | 2025-11-21 06:32 | 10K | |
![[ ]](/icons/unknown.gif) | Patch 1 (1).sql | 2025-11-21 06:32 | 3.9K | |
![[ ]](/icons/unknown.gif) | ფინანსური მოდული (2).xlsx | 2025-11-21 06:32 | 12K | |
![[ ]](/icons/unknown.gif) | ფინანსური მოდული (1).xlsx | 2025-11-21 06:32 | 12K | |
![[ ]](/icons/unknown.gif) | user - რუსთავი.xlsx | 2025-11-21 06:32 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (50).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (114).png | 2025-11-21 06:32 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (130).png | 2025-11-21 06:32 | 28K | |
![[ ]](/icons/unknown.gif) | Patch.sql | 2025-11-21 06:32 | 549 | |
![[ ]](/icons/unknown.gif) | ფინანსური მოდული.xlsx | 2025-11-21 06:32 | 13K | |
![[ ]](/icons/unknown.gif) | Report.sql | 2025-11-21 06:32 | 3.3K | |
![[IMG]](/icons/image2.gif) | image002 (268).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (255).png | 2025-11-21 06:32 | 506K | |
![[IMG]](/icons/image2.gif) | image001 (396).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (254).png | 2025-11-21 06:32 | 14K | |
![[ ]](/icons/unknown.gif) | ATT51667 | 2025-11-21 06:32 | 0 | |
![[ ]](/icons/unknown.gif) | რეესტრი 2014_08_01-2015_02_18.xlsx | 2025-11-21 06:32 | 1.4M | |
![[ ]](/icons/unknown.gif) | user - 19.xlsx | 2025-11-21 06:32 | 12K | |
![[ ]](/icons/unknown.gif) | User management fields19_02_14 -Copy - Copy (1).xlsx | 2025-11-21 06:32 | 14K | |
![[IMG]](/icons/image2.gif) | 1_ (1).png | 2025-11-21 06:32 | 406K | |
![[ ]](/icons/unknown.gif) | ფორმის მიხედვით რეპორტი (1).xlsx | 2025-11-21 06:32 | 10K | |
![[IMG]](/icons/image2.gif) | რეპორტები.bmp | 2025-11-21 06:32 | 3.7M | |
![[ ]](/icons/unknown.gif) | დანართ - მიღება-ჩაბარების აქტი.xls | 2025-11-21 06:32 | 26K | |
![[ ]](/icons/unknown.gif) | დანართი 3 (1).xls | 2025-11-21 06:32 | 19K | |
![[IMG]](/icons/image2.gif) | არსებობობს.png | 2025-11-21 06:32 | 407K | |
![[ ]](/icons/unknown.gif) | User management fields19_02_14 -Copy - Copy.xlsx | 2025-11-21 06:32 | 14K | |
![[ ]](/icons/unknown.gif) | სადავო შემთხვევების რეპორტი (1).xlsx | 2025-11-21 06:32 | 9.6K | |
![[ ]](/icons/unknown.gif) | კომპონენტების მიხედვით რეპორტი.xlsx | 2025-11-21 06:32 | 8.7K | |
![[ ]](/icons/unknown.gif) | დანართი 11 (2).xls | 2025-11-21 06:32 | 17K | |
![[ ]](/icons/unknown.gif) | დანართი 1 (1).xls | 2025-11-21 06:32 | 26K | |
![[ ]](/icons/unknown.gif) | ბენეფიციარის პირადი ნომრით რეპორტი (1).xls | 2025-11-21 06:32 | 18K | |
![[ ]](/icons/unknown.gif) | ბენეფიციარების რაოდენობა (1).xlsx | 2025-11-21 06:32 | 9.5K | |
![[ ]](/icons/unknown.gif) | არ ანაზღაურდა -შემთხვევების რეპორტი (1).xlsx | 2025-11-21 06:32 | 8.7K | |
![[ ]](/icons/unknown.gif) | saregistracio_nimushi19_02_2015.xlsx | 2025-11-21 06:32 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (395).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (394).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (393).jpg | 2025-11-21 06:32 | 4.2K | |
![[ ]](/icons/unknown.gif) | Untitled (25) | 2025-11-21 06:32 | 0 | |
![[ ]](/icons/unknown.gif) | დანართი #1 (13).xlsx | 2025-11-21 06:32 | 12K | |
![[IMG]](/icons/image2.gif) | image005 (28).png | 2025-11-21 06:32 | 104K | |
![[IMG]](/icons/image2.gif) | image005 (27).png | 2025-11-21 06:32 | 104K | |
![[IMG]](/icons/image2.gif) | image004 (63).png | 2025-11-21 06:32 | 28K | |
![[IMG]](/icons/image2.gif) | image004 (62).png | 2025-11-21 06:32 | 28K | |
![[IMG]](/icons/image2.gif) | image003 (113).png | 2025-11-21 06:32 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (81).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (80).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (79).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (78).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (267).jpg | 2025-11-21 06:32 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (129).png | 2025-11-21 06:32 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (128).png | 2025-11-21 06:32 | 104K | |
![[IMG]](/icons/image2.gif) | image001 (253).png | 2025-11-21 06:32 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (252).png | 2025-11-21 06:32 | 28K | |
![[ ]](/icons/unknown.gif) | 31761.docx | 2025-11-21 06:32 | 242K | |
![[ ]](/icons/unknown.gif) | რეცეპტი.xlsx | 2025-11-21 06:32 | 655K | |
![[IMG]](/icons/image2.gif) | image002 (266).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (265).jpg | 2025-11-21 06:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (251).png | 2025-11-21 06:32 | 254K | |
![[IMG]](/icons/image2.gif) | image001 (250).png | 2025-11-21 06:32 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (392).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (391).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (40).gif | 2025-11-21 06:32 | 32K | |
![[IMG]](/icons/image2.gif) | er (2).png | 2025-11-21 06:32 | 342K | |
![[ ]](/icons/unknown.gif) | qobuleti__ (1).xls | 2025-11-21 06:32 | 27K | |
![[IMG]](/icons/image2.gif) | pediatriuli privat klinika.png | 2025-11-21 06:32 | 314K | |
![[IMG]](/icons/image2.gif) | kontraqti.png | 2025-11-21 06:32 | 180K | |
![[IMG]](/icons/image2.gif) | image001 (249).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | er2.png | 2025-11-21 06:32 | 128K | |
![[IMG]](/icons/image2.gif) | er1.png | 2025-11-21 06:32 | 308K | |
![[IMG]](/icons/image2.gif) | lop.PNG | 2025-11-21 06:32 | 29K | |
![[IMG]](/icons/image2.gif) | image002 (264).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (39).gif | 2025-11-21 06:32 | 96 | |
![[IMG]](/icons/image2.gif) | image003 (12).gif | 2025-11-21 06:32 | 96 | |
![[IMG]](/icons/image2.gif) | image002 (263).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (248).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | ATT00002.jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | ATT00001.gif | 2025-11-21 06:32 | 96 | |
![[ ]](/icons/layout.gif) | BlueGold.pdf | 2025-11-21 06:32 | 1.3M | |
![[IMG]](/icons/image2.gif) | ATT00002.gif | 2025-11-21 06:32 | 96 | |
![[IMG]](/icons/image2.gif) | ATT00001 (2).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | 4 (2).png | 2025-11-21 06:32 | 163K | |
![[IMG]](/icons/image2.gif) | 2 (9).png | 2025-11-21 06:32 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1 (10).png | 2025-11-21 06:32 | 872K | |
![[IMG]](/icons/image2.gif) | image002 (262).jpg | 2025-11-21 06:32 | 13K | |
![[ ]](/icons/unknown.gif) | ATT39321 | 2025-11-21 06:32 | 0 | |
![[ ]](/icons/unknown.gif) | დანართი #1 (12).xlsx | 2025-11-21 06:32 | 12K | |
![[ ]](/icons/unknown.gif) | oledata.mso | 2025-11-21 06:32 | 724K | |
![[IMG]](/icons/image2.gif) | image006 (8).png | 2025-11-21 06:32 | 60K | |
![[IMG]](/icons/image2.gif) | image003 (112).png | 2025-11-21 06:32 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (261).jpg | 2025-11-21 06:32 | 3.2K | |
![[ ]](/icons/unknown.gif) | image001.emz | 2025-11-21 06:32 | 317K | |
![[ ]](/icons/unknown.gif) | ATT51858 | 2025-11-21 06:32 | 0 | |
![[IMG]](/icons/image2.gif) | zurikos.png | 2025-11-21 06:32 | 189K | |
![[ ]](/icons/unknown.gif) | Excel Sample.xlsx | 2025-11-21 06:32 | 11K | |
![[IMG]](/icons/image2.gif) | 1 (9).png | 2025-11-21 06:32 | 178K | |
![[ ]](/icons/unknown.gif) | ფორმის მიხედვით რეპორტი.xlsx | 2025-11-21 06:32 | 12K | |
![[ ]](/icons/unknown.gif) | სადავო შემთხვევების რეპორტი.xlsx | 2025-11-21 06:32 | 13K | |
![[ ]](/icons/unknown.gif) | კომპონენტების მიხედვით რეპორტი-3.xlsx | 2025-11-21 06:32 | 10K | |
![[ ]](/icons/unknown.gif) | დანართი 11 (1).xls | 2025-11-21 06:32 | 16K | |
![[ ]](/icons/unknown.gif) | დანართი 3.xls | 2025-11-21 06:32 | 19K | |
![[ ]](/icons/unknown.gif) | დანართი 1.xls | 2025-11-21 06:32 | 26K | |
![[ ]](/icons/unknown.gif) | დანართი - მიღება-ჩაბარების აქტი.xls | 2025-11-21 06:32 | 26K | |
![[ ]](/icons/unknown.gif) | ბენეფიციარის პირადი ნომრით რეპორტი.xls | 2025-11-21 06:32 | 18K | |
![[ ]](/icons/unknown.gif) | ბენეფიციარების რაოდენობა.xlsx | 2025-11-21 06:32 | 10K | |
![[ ]](/icons/unknown.gif) | არ ანაზღაურდა -შემთხვევების რეპორტი.xlsx | 2025-11-21 06:32 | 9.4K | |
![[ ]](/icons/unknown.gif) | prescriptions qimio.xlsx | 2025-11-21 06:32 | 12M | |
![[IMG]](/icons/image2.gif) | image002 (260).jpg | 2025-11-21 06:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (390).jpg | 2025-11-21 06:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (247).png | 2025-11-21 06:32 | 60K | |
![[ ]](/icons/unknown.gif) | modultanwvdoma (3).xlsx | 2025-11-21 06:32 | 9.7K | |
![[ ]](/icons/unknown.gif) | modultanwvdoma (2).xlsx | 2025-11-21 06:32 | 9.7K | |
![[ ]](/icons/unknown.gif) | modultanwvdoma (1).xlsx | 2025-11-21 06:32 | 9.7K | |
![[IMG]](/icons/image2.gif) | image002 (259).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (246).png | 2025-11-21 06:32 | 304K | |
![[ ]](/icons/unknown.gif) | User management fields (10).xlsx | 2025-11-21 06:32 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (258).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (257).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (256).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (127).png | 2025-11-21 06:32 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (389).jpg | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (245).png | 2025-11-21 06:32 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (244).png | 2025-11-21 06:32 | 349K | |
![[IMG]](/icons/image2.gif) | image001 (38).gif | 2025-11-21 06:32 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (37).gif | 2025-11-21 06:32 | 96 | |
![[IMG]](/icons/image2.gif) | beneficiaris registracia.png | 2025-11-21 06:32 | 87K | |
![[ ]](/icons/unknown.gif) | Sjcs.xlsx | 2025-11-21 06:32 | 23K | |
![[ ]](/icons/unknown.gif) | Mimartvebis_Analitika.xlsx | 2025-11-21 06:32 | 2.7M | |
![[ ]](/icons/unknown.gif) | ATT41217 | 2025-11-21 06:32 | 0 | |
![[ ]](/icons/unknown.gif) | 218_სია.xlsx | 2025-11-21 06:32 | 42K | |
![[ ]](/icons/unknown.gif) | 165 საერთო.xlsx | 2025-11-21 06:32 | 95K | |
![[ ]](/icons/unknown.gif) | ვინ რაზე მუშაობს 4.xlsx | 2025-11-21 06:32 | 146K | |
![[ ]](/icons/unknown.gif) | qobuleti__.xls | 2025-11-21 06:32 | 27K | |
![[IMG]](/icons/image2.gif) | image004 (49).jpg | 2025-11-21 06:32 | 8.7K | |
![[IMG]](/icons/image2.gif) | image003 (111).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (126).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (125).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (124).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (123).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (122).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (121).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (120).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (119).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (388).jpg | 2025-11-21 06:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (243).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (242).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (241).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (240).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (239).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (238).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (237).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (36).gif | 2025-11-21 06:32 | 32K | |
![[ ]](/icons/unknown.gif) | User management fields 1 (1).xls | 2025-11-21 06:32 | 23K | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (5).pdf | 2025-11-21 06:32 | 388K | |
![[ ]](/icons/layout.gif) | QRG_ATLAS-Employee-Info-QRG-Career-Profile_2_24_2015.pdf | 2025-11-21 06:32 | 760K | |
![[IMG]](/icons/image2.gif) | image005 (26).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (61).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (110).png | 2025-11-21 06:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (255).jpg | 2025-11-21 06:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (254).jpg | 2025-11-21 06:32 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (253).jpg | 2025-11-21 06:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (118).png | 2025-11-21 06:32 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (236).png | 2025-11-21 06:32 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (235).png | 2025-11-21 06:32 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (234).png | 2025-11-21 06:32 | 7.7K | |
![[ ]](/icons/unknown.gif) | Copy of User management fields - globali operatorebi.xls | 2025-11-21 06:32 | 32K | |
![[ ]](/icons/unknown.gif) | ATT77434 | 2025-11-21 06:32 | 0 | |
![[IMG]](/icons/image2.gif) | image001 (387).jpg | 2025-11-21 06:32 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (233).png | 2025-11-21 06:32 | 2.6K | |
![[ ]](/icons/layout.gif) | How to Download Adobe Digital Editions (1).pdf | 2025-11-21 06:32 | 445K | |
![[ ]](/icons/unknown.gif) | ATT64051 | 2025-11-21 06:32 | 0 | |
![[IMG]](/icons/image2.gif) | წერილი.djvu | 2025-11-21 06:31 | 61K | |
![[IMG]](/icons/image2.gif) | image003 (109).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (108).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (107).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (77).jpg | 2025-11-21 06:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (117).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (116).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (115).png | 2025-11-21 06:31 | 48K | |
![[IMG]](/icons/image2.gif) | image002 (114).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (386).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (232).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (231).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (230).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | ბავშვთა ახალი კლინიკა.bmp | 2025-11-21 06:31 | 3.7M | |
![[IMG]](/icons/image2.gif) | ბავშვთა ახალი კლინიკა-1.bmp | 2025-11-21 06:31 | 3.7M | |
![[IMG]](/icons/image2.gif) | ბავშვთა ახალი კლინიკა-1 (1).bmp | 2025-11-21 06:31 | 3.7M | |
![[IMG]](/icons/image2.gif) | ბავშვთა ახალი კლინიკა (1).bmp | 2025-11-21 06:31 | 3.7M | |
![[ ]](/icons/unknown.gif) | user - თოხაძე.xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | saregistracio_nimushi19 022015 (2).xlsx | 2025-11-21 06:31 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (106).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (105).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (104).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (113).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (112).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (111).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (229).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (228).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (227).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (226).png | 2025-11-21 06:31 | 59K | |
![[ ]](/icons/unknown.gif) | Code Prices 2_.xlsx | 2025-11-21 06:31 | 518K | |
![[ ]](/icons/unknown.gif) | Code Prices (1).xlsx | 2025-11-21 06:31 | 421K | |
![[ ]](/icons/unknown.gif) | საყოველთაო ვალიდაციები (1).xlsx | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (10).jpg | 2025-11-21 06:31 | 823 | |
![[ ]](/icons/unknown.gif) | user - თოხაძე 1 (1).xlsx | 2025-11-21 06:31 | 12K | |
![[IMG]](/icons/image2.gif) | image007 (13).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image006 (7).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image005 (25).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image005 (24).png | 2025-11-21 06:31 | 1.3K | |
![[IMG]](/icons/image2.gif) | image004 (60).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (10).gif | 2025-11-21 06:31 | 43 | |
![[IMG]](/icons/image2.gif) | image003 (103).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (102).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (101).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (252).jpg | 2025-11-21 06:31 | 24K | |
![[IMG]](/icons/image2.gif) | image002 (110).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (109).png | 2025-11-21 06:31 | 16K | |
![[IMG]](/icons/image2.gif) | image002 (108).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (107).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (106).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (105).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (385).jpg | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (384).jpg | 2025-11-21 06:31 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (383).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (225).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (224).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (223).png | 2025-11-21 06:31 | 516 | |
![[ ]](/icons/unknown.gif) | UserManagement.xlsx | 2025-11-21 06:31 | 161K | |
![[ ]](/icons/unknown.gif) | P2P example database.accdb | 2025-11-21 06:31 | 604K | |
![[ ]](/icons/unknown.gif) | ATT31466 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | სერგოს.docx | 2025-11-21 06:31 | 341K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (11).xlsx | 2025-11-21 06:31 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (100).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (99).png | 2025-11-21 06:31 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (104).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (103).png | 2025-11-21 06:31 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (382).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (381).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (222).png | 2025-11-21 06:31 | 516 | |
![[ ]](/icons/unknown.gif) | Untitled (24) | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (23) | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | GFATM users.xls | 2025-11-21 06:31 | 33K | |
![[ ]](/icons/unknown.gif) | საყოველთაო ვალიდაციები.xlsx | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (98).png | 2025-11-21 06:31 | 104K | |
![[IMG]](/icons/image2.gif) | image003 (97).png | 2025-11-21 06:31 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (102).png | 2025-11-21 06:31 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (101).png | 2025-11-21 06:31 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (380).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (379).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | Untitled (25).png | 2025-11-21 06:31 | 119K | |
![[IMG]](/icons/image2.gif) | image002 (251).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (250).jpg | 2025-11-21 06:31 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (378).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (221).png | 2025-11-21 06:31 | 895K | |
![[ ]](/icons/unknown.gif) | 001_mimartva.xlsx | 2025-11-21 06:31 | 29K | |
![[ ]](/icons/unknown.gif) | 001_mimartva (1).xlsx | 2025-11-21 06:31 | 28K | |
![[ ]](/icons/unknown.gif) | user - თოხაძე 1.xlsx | 2025-11-21 06:31 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (96).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (100).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (220).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | doc.png | 2025-11-21 06:31 | 264K | |
![[IMG]](/icons/image2.gif) | doc (1).png | 2025-11-21 06:31 | 264K | |
![[ ]](/icons/unknown.gif) | Untitled (22) | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (21) | 2025-11-21 06:31 | 0 | |
![[IMG]](/icons/image2.gif) | Capture (10).PNG | 2025-11-21 06:31 | 61K | |
![[ ]](/icons/unknown.gif) | სუბსპეციალობების ბაზა 1.xlsx | 2025-11-21 06:31 | 361K | |
![[IMG]](/icons/image2.gif) | ushkas.png | 2025-11-21 06:31 | 257K | |
![[ ]](/icons/unknown.gif) | user -დოიჯაშვილი.xlsx | 2025-11-21 06:31 | 12K | |
![[IMG]](/icons/image2.gif) | image006 (19).jpg | 2025-11-21 06:31 | 16K | |
![[IMG]](/icons/image2.gif) | image005 (27).jpg | 2025-11-21 06:31 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (48).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (95).png | 2025-11-21 06:31 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (249).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (248).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (247).jpg | 2025-11-21 06:31 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (377).jpg | 2025-11-21 06:31 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (219).png | 2025-11-21 06:31 | 59K | |
![[IMG]](/icons/image2.gif) | image001 (218).png | 2025-11-21 06:31 | 7.7K | |
![[IMG]](/icons/image2.gif) | Untitled (24).png | 2025-11-21 06:31 | 200K | |
![[ ]](/icons/unknown.gif) | Providers_ (1).xlsx | 2025-11-21 06:31 | 49K | |
![[ ]](/icons/unknown.gif) | მოსათხოვი ინფორმაციის ფორმები (საყოველთაო) 2014_xls (1).xlsx | 2025-11-21 06:31 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (94).png | 2025-11-21 06:31 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (99).png | 2025-11-21 06:31 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (376).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (375).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (374).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (373).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (372).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (371).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (370).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (369).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (217).png | 2025-11-21 06:31 | 98K | |
![[IMG]](/icons/image2.gif) | image001 (216).png | 2025-11-21 06:31 | 98K | |
![[IMG]](/icons/image2.gif) | image001 (215).png | 2025-11-21 06:31 | 98K | |
![[ ]](/icons/unknown.gif) | User management fields10_03_15 -Copy - Copy.xlsx | 2025-11-21 06:31 | 14K | |
![[IMG]](/icons/image2.gif) | Untitleddd.png | 2025-11-21 06:31 | 128K | |
![[ ]](/icons/unknown.gif) | TuberculosisExport - 31_01_2015.xlsx | 2025-11-21 06:31 | 256K | |
![[ ]](/icons/unknown.gif) | TuberculosisExport - 31_01_2015 (1).xlsx | 2025-11-21 06:31 | 256K | |
![[ ]](/icons/unknown.gif) | Power Analysis-Session3.pptx | 2025-11-21 06:31 | 1.3M | |
![[ ]](/icons/unknown.gif) | ATT52942 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | სენს.xls | 2025-11-21 06:31 | 96K | |
![[ ]](/icons/unknown.gif) | ვერტიკალურ პორგრამებში ჩართული დაწესებულებები (2).xlsx | 2025-11-21 06:31 | 250K | |
![[ ]](/icons/unknown.gif) | ვერტიკალურ პორგრამებში ჩართული დაწესებულებები (1).xlsx | 2025-11-21 06:31 | 250K | |
![[ ]](/icons/unknown.gif) | problems.xls | 2025-11-21 06:31 | 66K | |
![[ ]](/icons/unknown.gif) | modultanwvdoma.xlsx | 2025-11-21 06:31 | 9.5K | |
![[IMG]](/icons/image2.gif) | image003 (93).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (246).jpg | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (245).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (98).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (368).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (367).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (214).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (35).gif | 2025-11-21 06:31 | 96 | |
![[ ]](/icons/unknown.gif) | existing.xls | 2025-11-21 06:31 | 227K | |
![[ ]](/icons/unknown.gif) | User management fields 19 12 14-Copy - Copy.xlsx | 2025-11-21 06:31 | 17K | |
![[ ]](/icons/unknown.gif) | TuberculosisExport10_03_2015_20_51_25.xlsx | 2025-11-21 06:31 | 128K | |
![[ ]](/icons/unknown.gif) | Overview and Research Questions.doc | 2025-11-21 06:31 | 25K | |
![[ ]](/icons/unknown.gif) | ATT22575 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | 33 -ის ცვლილების პროექტი(3)(2).doc | 2025-11-21 06:31 | 308K | |
![[ ]](/icons/unknown.gif) | დანართი (7).xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი (6).xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | ბანკების რეკ ვიზიტები.xlsx | 2025-11-21 06:31 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (244).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (243).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (242).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (34).gif | 2025-11-21 06:31 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (33).gif | 2025-11-21 06:31 | 96 | |
![[IMG]](/icons/image2.gif) | image001 (32).gif | 2025-11-21 06:31 | 96 | |
![[ ]](/icons/unknown.gif) | User management fields 19 12 14_-Copy - Copy.xlsx | 2025-11-21 06:31 | 17K | |
![[ ]](/icons/unknown.gif) | User management fields(1).xlsx | 2025-11-21 06:31 | 17K | |
![[ ]](/icons/unknown.gif) | User management fields(1) (1).xlsx | 2025-11-21 06:31 | 14K | |
![[ ]](/icons/unknown.gif) | რეესტრის ნომრები (1).xlsx | 2025-11-21 06:31 | 8.9K | |
![[ ]](/icons/unknown.gif) | ბანკების რეკ ვიზიტები (1).xlsx | 2025-11-21 06:31 | 19K | |
![[IMG]](/icons/image2.gif) | image003 (92).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (97).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image001 (213).png | 2025-11-21 06:31 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (212).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | error (13).PNG | 2025-11-21 06:31 | 173K | |
![[IMG]](/icons/image2.gif) | Untitled (23).png | 2025-11-21 06:31 | 286K | |
![[ ]](/icons/unknown.gif) | Tub Payments 2015 February.xlsx | 2025-11-21 06:31 | 111K | |
![[ ]](/icons/unknown.gif) | 1_Sample- Participants info bilingual.docx | 2025-11-21 06:31 | 116K | |
![[ ]](/icons/unknown.gif) | საყოველთაო ვალიდაციები_2 (1).xlsx | 2025-11-21 06:31 | 13K | |
![[ ]](/icons/unknown.gif) | სამცხე.xlsx | 2025-11-21 06:31 | 8.4K | |
![[ ]](/icons/unknown.gif) | დანართი (2.xlsx | 2025-11-21 06:31 | 13K | |
![[ ]](/icons/unknown.gif) | დანართი (2) (1).xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | user - კვირიკაშვილი.xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | user - ირემაძე (1).xlsx | 2025-11-21 06:31 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (91).png | 2025-11-21 06:31 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (241).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (240).jpg | 2025-11-21 06:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (211).png | 2025-11-21 06:31 | 7.7K | |
![[ ]](/icons/unknown.gif) | User management fields16_03_15 -Copy - Copy.xlsx | 2025-11-21 06:31 | 14K | |
![[ ]](/icons/unknown.gif) | Providers_.xlsx | 2025-11-21 06:31 | 32K | |
![[ ]](/icons/unknown.gif) | Power Analysis-Session4.pptx | 2025-11-21 06:31 | 2.1M | |
![[ ]](/icons/unknown.gif) | ATT41354 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | წვდომა 1303.xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | საყოველთაო ვალიდაციები_2.xlsx | 2025-11-21 06:31 | 13K | |
![[ ]](/icons/unknown.gif) | მისამართის ცვლილება.xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/layout.gif) | ევექსი.pdf | 2025-11-21 06:31 | 46K | |
![[ ]](/icons/unknown.gif) | გამგეობებიდან წარმომადგენლების ინფორმაცია_Fin.xlsx | 2025-11-21 06:31 | 16K | |
![[ ]](/icons/unknown.gif) | user - ლორთქიფანიძე.xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | user - ირემაძე.xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | problemurebi.rar | 2025-11-21 06:31 | 841K | |
![[ ]](/icons/unknown.gif) | ncaa_2015_instructions (1).docx | 2025-11-21 06:31 | 18K | |
![[ ]](/icons/unknown.gif) | meria.xlsx | 2025-11-21 06:31 | 9.1K | |
![[IMG]](/icons/image2.gif) | image007 (12).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image006 (6).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image005 (23).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (59).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (47).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (46).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image003 (90).png | 2025-11-21 06:31 | 154K | |
![[IMG]](/icons/image2.gif) | image003 (89).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (239).jpg | 2025-11-21 06:31 | 8.7K | |
![[IMG]](/icons/image2.gif) | image002 (238).jpg | 2025-11-21 06:31 | 8.7K | |
![[IMG]](/icons/image2.gif) | image002 (237).jpg | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (96).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (366).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (365).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (364).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (31).gif | 2025-11-21 06:31 | 32K | |
![[IMG]](/icons/image2.gif) | Reanimation.JPG | 2025-11-21 06:31 | 75K | |
![[ ]](/icons/unknown.gif) | ATT01453 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | 405018831.xlsx | 2025-11-21 06:31 | 17K | |
![[ ]](/icons/layout.gif) | 2015-ncaa-tournament-bracket-print-printable-march-madness (1).pdf | 2025-11-21 06:31 | 70K | |
![[IMG]](/icons/image2.gif) | image004 (58).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (57).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (56).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (55).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (54).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (53).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (52).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (51).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (50).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (88).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (87).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (86).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (85).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (84).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (83).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (82).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (81).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (80).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (95).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (94).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (93).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (92).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (91).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (90).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (89).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (88).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (87).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (363).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (362).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (361).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (360).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (359).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (358).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (357).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (356).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (355).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (354).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | OtherBeds.JPG | 2025-11-21 06:31 | 68K | |
![[ ]](/icons/unknown.gif) | ContractPersonsTemplate.xls | 2025-11-21 06:31 | 47K | |
![[ ]](/icons/unknown.gif) | Code Prices.xlsx | 2025-11-21 06:31 | 229K | |
![[ ]](/icons/unknown.gif) | BeneficiariesWithoutNames.xlsx | 2025-11-21 06:31 | 9.4K | |
![[ ]](/icons/unknown.gif) | BeneficiariesWithoutCorrectAddress.xlsx | 2025-11-21 06:31 | 2.9M | |
![[ ]](/icons/unknown.gif) | BeneficiariesWithMoreThanOneAgreementNumber.xlsx | 2025-11-21 06:31 | 28K | |
![[ ]](/icons/unknown.gif) | BeneficiariesDoubled.xlsx | 2025-11-21 06:31 | 17K | |
![[IMG]](/icons/image2.gif) | BedsAll.JPG | 2025-11-21 06:31 | 67K | |
![[ ]](/icons/unknown.gif) | ATT91341 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | ATT31061 | 2025-11-21 06:31 | 0 | |
![[IMG]](/icons/image2.gif) | 2.JPG | 2025-11-21 06:31 | 158K | |
![[IMG]](/icons/image2.gif) | 1.JPG | 2025-11-21 06:31 | 84K | |
![[ ]](/icons/unknown.gif) | user - მარკოზია.xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | ncaa_2015_instructions.docx | 2025-11-21 06:31 | 18K | |
![[IMG]](/icons/image2.gif) | image004 (49).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (48).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (47).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (46).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (45).jpg | 2025-11-21 06:31 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (79).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (78).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (77).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (76).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (75).png | 2025-11-21 06:31 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (74).png | 2025-11-21 06:31 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (236).jpg | 2025-11-21 06:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (235).jpg | 2025-11-21 06:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (86).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (85).png | 2025-11-21 06:31 | 8.4K | |
![[IMG]](/icons/image2.gif) | image002 (84).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (83).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (82).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (353).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (352).jpg | 2025-11-21 06:31 | 1.7K | |
![[IMG]](/icons/image2.gif) | image001 (351).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (350).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (349).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (348).jpg | 2025-11-21 06:31 | 150K | |
![[IMG]](/icons/image2.gif) | image001 (210).png | 2025-11-21 06:31 | 104K | |
![[ ]](/icons/unknown.gif) | form 025_Corrected.xls | 2025-11-21 06:31 | 30K | |
![[IMG]](/icons/image2.gif) | Untitled (22).png | 2025-11-21 06:31 | 129K | |
![[ ]](/icons/unknown.gif) | ATT97538 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | ATT24503 | 2025-11-21 06:31 | 0 | |
![[IMG]](/icons/image2.gif) | 405018831.JPG | 2025-11-21 06:31 | 199K | |
![[IMG]](/icons/image2.gif) | 405018831----2.JPG | 2025-11-21 06:31 | 89K | |
![[IMG]](/icons/image2.gif) | 212153747.JPG | 2025-11-21 06:31 | 121K | |
![[IMG]](/icons/image2.gif) | 212153747-----2.JPG | 2025-11-21 06:31 | 41K | |
![[ ]](/icons/layout.gif) | 2015-ncaa-tournament-bracket-print-printable-march-madness.pdf | 2025-11-21 06:31 | 70K | |
![[ ]](/icons/unknown.gif) | verticals analitic (1).rar | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (44).jpg | 2025-11-21 06:31 | 7.1K | |
![[IMG]](/icons/image2.gif) | image002 (234).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (233).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (347).jpg | 2025-11-21 06:31 | 3.6K | |
![[IMG]](/icons/image2.gif) | image001 (346).jpg | 2025-11-21 06:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (345).jpg | 2025-11-21 06:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (344).jpg | 2025-11-21 06:31 | 9.8K | |
![[IMG]](/icons/image2.gif) | image001 (209).png | 2025-11-21 06:31 | 137K | |
![[IMG]](/icons/image2.gif) | image001 (208).png | 2025-11-21 06:31 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (207).png | 2025-11-21 06:31 | 15K | |
![[ ]](/icons/unknown.gif) | error 19_03__2015_docx (3).docx | 2025-11-21 06:31 | 126K | |
![[ ]](/icons/unknown.gif) | error 19_03__2015_docx (3) (1).docx | 2025-11-21 06:31 | 126K | |
![[ ]](/icons/unknown.gif) | error 19_03__2015_docx (2).docx | 2025-11-21 06:31 | 125K | |
![[ ]](/icons/unknown.gif) | error 19_03__2015_docx (2) (1).docx | 2025-11-21 06:31 | 125K | |
![[ ]](/icons/unknown.gif) | error 19_03__2015.docx | 2025-11-21 06:31 | 126K | |
![[ ]](/icons/unknown.gif) | error 19_03__2015 (1).docx | 2025-11-21 06:31 | 126K | |
![[IMG]](/icons/image2.gif) | error (12).png | 2025-11-21 06:31 | 249K | |
![[ ]](/icons/layout.gif) | WISH-preventing and managing type 2 diabetes 2015.pdf | 2025-11-21 06:31 | 3.3M | |
![[ ]](/icons/layout.gif) | WISH-delivering affordable cancer care a value challenge to health systems 2015.pdf | 2025-11-21 06:31 | 1.6M | |
![[ ]](/icons/layout.gif) | Survey tables.pdf | 2025-11-21 06:31 | 476K | |
![[ ]](/icons/layout.gif) | QRG_ATLAS-Employee-Info-QRG-Career-Profile_2 24 2015.pdf | 2025-11-21 06:31 | 760K | |
![[ ]](/icons/unknown.gif) | New Microsoft Office WordDocument (4).docx | 2025-11-21 06:31 | 162K | |
![[ ]](/icons/unknown.gif) | New Microsoft Office WordDocument (3).docx | 2025-11-21 06:31 | 137K | |
![[ ]](/icons/unknown.gif) | ATT37881 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | სამედიცინო ცენტრი მედიმედი.xlsx | 2025-11-21 06:31 | 15K | |
![[ ]](/icons/unknown.gif) | რეპორტი (1).xlsx | 2025-11-21 06:31 | 11K | |
![[ ]](/icons/unknown.gif) | პასპორტიზაცია___404866123.xlsx | 2025-11-21 06:31 | 5.2K | |
![[ ]](/icons/unknown.gif) | მოსათხოვი ინფორმაციის ფორმები (საყოველთაო) 2014_xls.xlsx | 2025-11-21 06:31 | 16K | |
![[ ]](/icons/unknown.gif) | დანართი (5).xlsx | 2025-11-21 06:31 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (45).png | 2025-11-21 06:31 | 18K | |
![[IMG]](/icons/image2.gif) | image004 (43).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (76).jpg | 2025-11-21 06:31 | 5.2K | |
![[IMG]](/icons/image2.gif) | image003 (73).png | 2025-11-21 06:31 | 93K | |
![[IMG]](/icons/image2.gif) | image003 (72).png | 2025-11-21 06:31 | 93K | |
![[IMG]](/icons/image2.gif) | image003 (71).png | 2025-11-21 06:31 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (232).jpg | 2025-11-21 06:31 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (231).jpg | 2025-11-21 06:31 | 8.7K | |
![[IMG]](/icons/image2.gif) | image002 (230).jpg | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (81).png | 2025-11-21 06:31 | 97K | |
![[IMG]](/icons/image2.gif) | image002 (80).png | 2025-11-21 06:31 | 97K | |
![[IMG]](/icons/image2.gif) | image002 (79).png | 2025-11-21 06:31 | 682 | |
![[IMG]](/icons/image2.gif) | image001 (343).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (342).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (206).png | 2025-11-21 06:31 | 93K | |
![[IMG]](/icons/image2.gif) | image001 (205).png | 2025-11-21 06:31 | 96K | |
![[IMG]](/icons/image2.gif) | image001 (204).png | 2025-11-21 06:31 | 36K | |
![[IMG]](/icons/image2.gif) | image001 (203).png | 2025-11-21 06:31 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (202).png | 2025-11-21 06:31 | 690 | |
![[ ]](/icons/unknown.gif) | User management fields24_03_15 -Copy - Copy (2).xlsx | 2025-11-21 06:31 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields20_03_15 -Copy - Copy.xlsx | 2025-11-21 06:31 | 14K | |
![[ ]](/icons/layout.gif) | Gov TWG BrownBag (20 March 2015).pdf | 2025-11-21 06:31 | 882K | |
![[ ]](/icons/layout.gif) | GavinMS_Ebola_Abt_PPT_Final_20March2015.pdf | 2025-11-21 06:31 | 6.4M | |
![[ ]](/icons/unknown.gif) | ATT96077 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | ATT03438 | 2025-11-21 06:31 | 0 | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალება ჩასწორებული ვარიანტი.docx | 2025-11-21 06:31 | 155K | |
![[ ]](/icons/unknown.gif) | გასაუქმებელი კომბინაციები (2).xlsx | 2025-11-21 06:31 | 28K | |
![[IMG]](/icons/image2.gif) | image004 (44).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (43).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (42).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (42).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (41).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (75).jpg | 2025-11-21 06:31 | 5.2K | |
![[IMG]](/icons/image2.gif) | image003 (70).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (69).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (68).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (67).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (78).png | 2025-11-21 06:31 | 682 | |
![[IMG]](/icons/image2.gif) | image002 (77).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (76).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (75).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (74).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (341).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (340).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (339).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (338).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (201).png | 2025-11-21 06:31 | 690 | |
![[IMG]](/icons/image2.gif) | image001 (200).png | 2025-11-21 06:31 | 255 | |
![[ ]](/icons/unknown.gif) | -13_03_2015.xlsx | 2025-11-21 06:31 | 15K | |
![[ ]](/icons/unknown.gif) | momsaxureba.doc | 2025-11-21 06:31 | 46K | |
![[IMG]](/icons/image2.gif) | image002 (229).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (199).png | 2025-11-21 06:31 | 255 | |
![[IMG]](/icons/image2.gif) | image001 (198).png | 2025-11-21 06:31 | 7.7K | |
![[ ]](/icons/unknown.gif) | codes chart1.xls | 2025-11-21 06:31 | 213K | |
![[ ]](/icons/unknown.gif) | codes chart1 (1).xls | 2025-11-21 06:31 | 222K | |
![[ ]](/icons/unknown.gif) | Suggestions for April.docx | 2025-11-21 06:31 | 16K | |
![[ ]](/icons/unknown.gif) | Suggestions for April (1).docx | 2025-11-21 06:31 | 15K | |
![[ ]](/icons/unknown.gif) | Referrals Adjara (4).docx | 2025-11-21 06:31 | 17K | |
![[ ]](/icons/unknown.gif) | N19-1_xlsx-1.xlsx | 2025-11-21 06:31 | 21K | |
![[ ]](/icons/unknown.gif) | Agvistos ambebi.doc | 2025-11-21 06:31 | 40K | |
![[ ]](/icons/unknown.gif) | 1 ივლისის თემები.doc | 2025-11-21 06:31 | 57K | |
![[ ]](/icons/unknown.gif) | ხელოვნური კოდის ლოგიკები.xls | 2025-11-21 06:31 | 25K | |
![[ ]](/icons/unknown.gif) | პროგრამების წესები 2015 წელი.rar | 2025-11-21 06:31 | 642K | |
![[ ]](/icons/unknown.gif) | მოდული,,,,,,.xlsx | 2025-11-21 06:31 | 31K | |
![[ ]](/icons/unknown.gif) | ლიმიტების დათვლა.docx | 2025-11-21 06:31 | 13K | |
![[ ]](/icons/unknown.gif) | ლიმიტების დათვლა (1).docx | 2025-11-21 06:31 | 13K | |
![[ ]](/icons/unknown.gif) | კრიტიკულის დონეები - ტარიფები (2).xlsx | 2025-11-21 06:31 | 49K | |
![[ ]](/icons/unknown.gif) | კაპიტაცია-სტატისტიკა.xls | 2025-11-21 06:31 | 28K | |
![[ ]](/icons/unknown.gif) | ელექტრონული რეცეპტი.xls | 2025-11-21 06:31 | 26K | |
![[ ]](/icons/unknown.gif) | დანართი (4).xlsx | 2025-11-21 06:31 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (41).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (74).jpg | 2025-11-21 06:31 | 5.2K | |
![[IMG]](/icons/image2.gif) | image002 (73).png | 2025-11-21 06:31 | 682 | |
![[IMG]](/icons/image2.gif) | image001 (197).png | 2025-11-21 06:31 | 690 | |
![[IMG]](/icons/image2.gif) | image002 (228).jpg | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (227).jpg | 2025-11-21 06:31 | 13K | |
![[ ]](/icons/unknown.gif) | 5001N.xlsx | 2025-11-21 06:31 | 9.8K | |
![[IMG]](/icons/image2.gif) | ადოს (5).png | 2025-11-21 06:31 | 201K | |
![[IMG]](/icons/image2.gif) | image005 (26).jpg | 2025-11-21 06:31 | 48K | |
![[IMG]](/icons/image2.gif) | image004 (40).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (40).jpg | 2025-11-21 06:31 | 9.5K | |
![[IMG]](/icons/image2.gif) | image004 (39).png | 2025-11-21 06:31 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (66).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (65).png | 2025-11-21 06:31 | 516 | |
![[IMG]](/icons/image2.gif) | image002 (72).png | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (71).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (70).png | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (337).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (336).jpg | 2025-11-21 06:31 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (335).jpg | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (196).png | 2025-11-21 06:31 | 13K | |
![[ ]](/icons/unknown.gif) | ხელოვნური კოდების დასახელება.docx | 2025-11-21 06:31 | 35K | |
![[IMG]](/icons/image2.gif) | image003 (64).png | 2025-11-21 06:31 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (226).jpg | 2025-11-21 06:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (334).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (333).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (195).png | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (194).png | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (193).png | 2025-11-21 06:31 | 11K | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (4).pdf | 2025-11-21 06:31 | 388K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields.xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields (1).xlsx | 2025-11-21 06:31 | 12K | |
![[ ]](/icons/unknown.gif) | ArtificialCodes.xlsx | 2025-11-21 06:31 | 13K | |
![[ ]](/icons/unknown.gif) | ArtificialCodes (3).xlsx | 2025-11-21 06:31 | 16K | |
![[ ]](/icons/unknown.gif) | ArtificialCodes (2).xlsx | 2025-11-21 06:31 | 20K | |
![[ ]](/icons/unknown.gif) | ArtificialCodes (1).xlsx | 2025-11-21 06:31 | 20K | |
![[ ]](/icons/unknown.gif) | კომპონენტების მიხედვით (1).xlsx | 2025-11-21 06:31 | 37K | |
![[ ]](/icons/unknown.gif) | user - 0204.xlsx | 2025-11-21 06:31 | 12K | |
![[IMG]](/icons/image2.gif) | slimdown.jpg | 2025-11-21 06:31 | 275K | |
![[IMG]](/icons/image2.gif) | sabechdi forma (1).bmp | 2025-11-21 06:31 | 3.7M | |
![[ ]](/icons/unknown.gif) | logikebi.xlsx | 2025-11-21 06:31 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (63).png | 2025-11-21 06:31 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (62).png | 2025-11-21 06:31 | 2.6K | |
![[IMG]](/icons/image2.gif) | image002 (225).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (224).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (223).jpg | 2025-11-21 06:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (222).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (221).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (69).png | 2025-11-21 06:31 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (332).jpg | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (331).jpg | 2025-11-21 06:31 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (330).jpg | 2025-11-21 06:31 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (329).jpg | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (328).jpg | 2025-11-21 06:31 | 9.8K | |
![[IMG]](/icons/image2.gif) | image001 (327).jpg | 2025-11-21 06:31 | 9.8K | |
![[IMG]](/icons/image2.gif) | image001 (192).png | 2025-11-21 06:31 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (191).png | 2025-11-21 06:31 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (190).png | 2025-11-21 06:31 | 158K | |
![[ ]](/icons/unknown.gif) | User management fields24_03_15 -Copy - Copy.xlsx | 2025-11-21 06:31 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields24_03_15 -Copy - Copy (1).xlsx | 2025-11-21 06:31 | 15K | |
![[ ]](/icons/unknown.gif) | CloudDrugStores.xlsx | 2025-11-21 06:31 | 9.8K | |
![[IMG]](/icons/image2.gif) | ფინანსურში გადაგზავნა (1).bmp | 2025-11-21 06:31 | 3.7M | |
![[IMG]](/icons/image2.gif) | ასანაზღაურებელი თანხა (1).bmp | 2025-11-21 06:31 | 3.7M | |
![[IMG]](/icons/image2.gif) | image011 (1).png | 2025-11-21 06:31 | 5.6K | |
![[IMG]](/icons/image2.gif) | image005 (22).png | 2025-11-21 06:31 | 2.7K | |
![[IMG]](/icons/image2.gif) | image004 (38).png | 2025-11-21 06:31 | 9.5K | |
![[IMG]](/icons/image2.gif) | image003 (61).png | 2025-11-21 06:31 | 170 | |
![[IMG]](/icons/image2.gif) | image002 (220).jpg | 2025-11-21 06:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (219).jpg | 2025-11-21 06:31 | 35K | |
![[IMG]](/icons/image2.gif) | image002 (218).jpg | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (217).jpg | 2025-11-21 06:31 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (189).png | 2025-11-21 06:31 | 255 | |
![[IMG]](/icons/image2.gif) | image001 (188).png | 2025-11-21 06:31 | 8.3K | |
![[IMG]](/icons/image2.gif) | image001 (187).png | 2025-11-21 06:31 | 255 | |
![[IMG]](/icons/image2.gif) | image001 (186).png | 2025-11-21 06:31 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (185).png | 2025-11-21 06:31 | 255 | |
![[ ]](/icons/unknown.gif) | eTreasury External Service Documentation 26 02 2013 (1).docx | 2025-11-21 06:31 | 101K | |
![[ ]](/icons/unknown.gif) | Copy of 4-aprili.xlsx | 2025-11-21 06:31 | 10K | |
![[ ]](/icons/layout.gif) | Business-1428064926045.pdf | 2025-11-21 06:31 | 263K | |
![[ ]](/icons/unknown.gif) | 4-aprili.xlsx | 2025-11-21 06:31 | 10K | |
![[ ]](/icons/unknown.gif) | დაავადებათა კლასები ბოლო.xlsx | 2025-11-21 06:31 | 15K | |
![[IMG]](/icons/image2.gif) | image012.png | 2025-11-21 06:30 | 128K | |
![[IMG]](/icons/image2.gif) | image003 (60).png | 2025-11-21 06:30 | 810K | |
![[IMG]](/icons/image2.gif) | image002 (216).jpg | 2025-11-21 06:30 | 8.5K | |
![[IMG]](/icons/image2.gif) | image002 (215).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (214).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (326).jpg | 2025-11-21 06:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (325).jpg | 2025-11-21 06:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (324).jpg | 2025-11-21 06:30 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (323).jpg | 2025-11-21 06:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (322).jpg | 2025-11-21 06:30 | 3.6K | |
![[IMG]](/icons/image2.gif) | image001 (184).png | 2025-11-21 06:30 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (183).png | 2025-11-21 06:30 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (182).png | 2025-11-21 06:30 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (181).png | 2025-11-21 06:30 | 810K | |
![[IMG]](/icons/image2.gif) | image001 (180).png | 2025-11-21 06:30 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (179).png | 2025-11-21 06:30 | 255 | |
![[ ]](/icons/unknown.gif) | TuberculosisExport06_04_2015_16_40_23.xlsx | 2025-11-21 06:30 | 128K | |
![[ ]](/icons/unknown.gif) | Referrals Adjara (3).docx | 2025-11-21 06:30 | 28K | |
![[ ]](/icons/unknown.gif) | NCDC_l_shengelia.xlsx | 2025-11-21 06:30 | 9.9K | |
![[ ]](/icons/unknown.gif) | ფარმაცევტული საქმიანობის დეპარტამენტი.xlsx | 2025-11-21 06:30 | 9.9K | |
![[ ]](/icons/layout.gif) | პირადობა.pdf | 2025-11-21 06:30 | 229K | |
![[ ]](/icons/unknown.gif) | დიალიზის პროვაიდერი.xlsx | 2025-11-21 06:30 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (37).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image003 (59).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (58).png | 2025-11-21 06:30 | 74K | |
![[IMG]](/icons/image2.gif) | image002 (68).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (321).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (320).jpg | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (319).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (318).jpg | 2025-11-21 06:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (178).png | 2025-11-21 06:30 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (177).png | 2025-11-21 06:30 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (176).png | 2025-11-21 06:30 | 13K | |
![[ ]](/icons/unknown.gif) | User management fields24 03 15-Copy - Copy.xlsx | 2025-11-21 06:30 | 16K | |
![[ ]](/icons/unknown.gif) | Untitled (20) | 2025-11-21 06:30 | 0 | |
![[ ]](/icons/unknown.gif) | HMIS Sustainability Scenarios_ May 28, 2014 ENG.docx | 2025-11-21 06:30 | 108K | |
![[ ]](/icons/unknown.gif) | HMIS Modules Descriptions (2).docx | 2025-11-21 06:30 | 113K | |
![[ ]](/icons/unknown.gif) | HMIS Modules Descriptions (1).docx | 2025-11-21 06:30 | 125K | |
![[ ]](/icons/unknown.gif) | სახ_ კოდები.xlsx | 2025-11-21 06:30 | 20K | |
![[ ]](/icons/unknown.gif) | ნათია-777.xlsx | 2025-11-21 06:30 | 15K | |
![[ ]](/icons/unknown.gif) | მოსათხოვი ინფორმაციის ფორმები (საყოველთაო) 2014 whole year.xlsx | 2025-11-21 06:30 | 2.9M | |
![[TXT]](/icons/text.gif) | თანხების დაბრუნება.html | 2025-11-21 06:30 | 123K | |
![[ ]](/icons/unknown.gif) | verticals analitic.rar | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (39).jpg | 2025-11-21 06:30 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (38).jpg | 2025-11-21 06:30 | 13K | |
![[IMG]](/icons/image2.gif) | image004 (37).jpg | 2025-11-21 06:30 | 5.9K | |
![[IMG]](/icons/image2.gif) | image003 (57).png | 2025-11-21 06:30 | 2.6K | |
![[IMG]](/icons/image2.gif) | image003 (56).png | 2025-11-21 06:30 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (55).png | 2025-11-21 06:30 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (213).jpg | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (212).jpg | 2025-11-21 06:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (211).jpg | 2025-11-21 06:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (210).jpg | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (209).jpg | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (317).jpg | 2025-11-21 06:30 | 9.8K | |
![[IMG]](/icons/image2.gif) | image001 (316).jpg | 2025-11-21 06:30 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (315).jpg | 2025-11-21 06:30 | 9.8K | |
![[IMG]](/icons/image2.gif) | image001 (175).png | 2025-11-21 06:30 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (174).png | 2025-11-21 06:30 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (173).png | 2025-11-21 06:30 | 15K | |
![[ ]](/icons/unknown.gif) | artificialCodes 212841424.xlsx | 2025-11-21 06:30 | 32M | |
![[ ]](/icons/unknown.gif) | Referrals - Tbilisi Hall (3).docx | 2025-11-21 06:30 | 24K | |
![[ ]](/icons/unknown.gif) | Referrals - Adjara.docx | 2025-11-21 06:30 | 29K | |
![[ ]](/icons/unknown.gif) | NCDC MOH modules.xlsx | 2025-11-21 06:30 | 12K | |
![[ ]](/icons/layout.gif) | Kobakhidze, Tamta.pdf | 2025-11-21 06:30 | 174K | |
![[ ]](/icons/unknown.gif) | How to access the IHD AGI pages.docx | 2025-11-21 06:30 | 4.3M | |
![[ ]](/icons/unknown.gif) | Fourth Annual Abt Photo Contest English (2).docx | 2025-11-21 06:30 | 4.0M | |
![[ ]](/icons/unknown.gif) | ATT91688 | 2025-11-21 06:30 | 0 | |
![[ ]](/icons/layout.gif) | 4th Photo Contest - Spanish-French_Portuguese and Amharic (2).pdf | 2025-11-21 06:30 | 474K | |
![[ ]](/icons/unknown.gif) | რეპორტი.xlsx | 2025-11-21 06:30 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (36).jpg | 2025-11-21 06:30 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (73).jpg | 2025-11-21 06:30 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (314).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (313).jpg | 2025-11-21 06:30 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (312).jpg | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | Untitled (21).png | 2025-11-21 06:30 | 250K | |
![[ ]](/icons/unknown.gif) | Untitled (19) | 2025-11-21 06:30 | 0 | |
![[ ]](/icons/unknown.gif) | Referrals - Tbilisi Hall (2).docx | 2025-11-21 06:30 | 24K | |
![[ ]](/icons/unknown.gif) | user - ქავთარაძე.xlsx | 2025-11-21 06:30 | 12K | |
![[IMG]](/icons/image2.gif) | image009 (1).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image008 (2).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image007 (11).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image006 (18).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image005 (25).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image005 (21).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (36).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (72).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (71).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (54).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (208).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image002 (67).png | 2025-11-21 06:30 | 938K | |
![[IMG]](/icons/image2.gif) | image002 (66).png | 2025-11-21 06:30 | 938K | |
![[IMG]](/icons/image2.gif) | image001 (311).jpg | 2025-11-21 06:30 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (310).jpg | 2025-11-21 06:30 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (309).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (172).png | 2025-11-21 06:30 | 1.4M | |
![[IMG]](/icons/image2.gif) | image001 (171).png | 2025-11-21 06:30 | 1.4M | |
![[ ]](/icons/unknown.gif) | Contracted Providers.xlsx | 2025-11-21 06:30 | 164K | |
![[ ]](/icons/unknown.gif) | qvemo qarTli.xlsx | 2025-11-21 06:30 | 14K | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (10).xls | 2025-11-21 06:30 | 27K | |
![[IMG]](/icons/image2.gif) | image011.png | 2025-11-21 06:30 | 938K | |
![[IMG]](/icons/image2.gif) | image010.png | 2025-11-21 06:30 | 1.4M | |
![[IMG]](/icons/image2.gif) | image009 (3).jpg | 2025-11-21 06:30 | 43K | |
![[IMG]](/icons/image2.gif) | image008 (2).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image007 (10).png | 2025-11-21 06:30 | 938K | |
![[IMG]](/icons/image2.gif) | image007 (9).png | 2025-11-21 06:30 | 49K | |
![[IMG]](/icons/image2.gif) | image006 (5).png | 2025-11-21 06:30 | 1.4M | |
![[IMG]](/icons/image2.gif) | image006 (4).png | 2025-11-21 06:30 | 132K | |
![[IMG]](/icons/image2.gif) | image005 (24).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (20).png | 2025-11-21 06:30 | 938K | |
![[IMG]](/icons/image2.gif) | image005 (19).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image005 (18).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (35).png | 2025-11-21 06:30 | 1.4M | |
![[IMG]](/icons/image2.gif) | image004 (35).jpg | 2025-11-21 06:30 | 43K | |
![[IMG]](/icons/image2.gif) | image004 (34).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image004 (33).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (70).jpg | 2025-11-21 06:30 | 43K | |
![[IMG]](/icons/image2.gif) | image003 (53).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (52).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (207).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (206).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image002 (205).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (308).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (170).png | 2025-11-21 06:30 | 49K | |
![[IMG]](/icons/image2.gif) | ღუდუშაური - ტრანსპორტირება.bmp | 2025-11-21 06:30 | 3.7M | |
![[IMG]](/icons/image2.gif) | image005 (17).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image005 (16).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (34).jpg | 2025-11-21 06:30 | 20K | |
![[IMG]](/icons/image2.gif) | image004 (32).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image004 (31).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (51).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (50).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (204).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image002 (203).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image002 (202).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (307).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (306).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (305).jpg | 2025-11-21 06:30 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (304).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (169).png | 2025-11-21 06:30 | 326K | |
![[IMG]](/icons/image2.gif) | image (4).png | 2025-11-21 06:30 | 8.3K | |
![[IMG]](/icons/image2.gif) | image (3).png | 2025-11-21 06:30 | 5.7K | |
![[ ]](/icons/unknown.gif) | Tuberculosis_Analytic_Export16_04_2015_16_45_35_.xlsx | 2025-11-21 06:30 | 71K | |
![[ ]](/icons/unknown.gif) | Referrals - Tbilisi Hall (1).docx | 2025-11-21 06:30 | 24K | |
![[ ]](/icons/unknown.gif) | ATT30455 | 2025-11-21 06:30 | 0 | |
![[ ]](/icons/unknown.gif) | ვერტიკალურ პორგრამებში ჩართული დაწესებულებები.xlsx | 2025-11-21 06:30 | 254K | |
![[IMG]](/icons/image2.gif) | sabechdi forma.bmp | 2025-11-21 06:30 | 3.7M | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (9).xls | 2025-11-21 06:30 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (303).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (30).gif | 2025-11-21 06:30 | 32K | |
![[IMG]](/icons/image2.gif) | ფსიქოსოციალური - ფინანსურში გადაგზავნა.bmp | 2025-11-21 06:30 | 3.7M | |
![[IMG]](/icons/image2.gif) | ფსიქოსოციალური - რეესტრი.bmp | 2025-11-21 06:30 | 3.7M | |
![[IMG]](/icons/image2.gif) | ფინანსურში გადაგზავნა.bmp | 2025-11-21 06:30 | 3.7M | |
![[IMG]](/icons/image2.gif) | ასანაზღაურებელი თანხა.bmp | 2025-11-21 06:30 | 3.7M | |
![[IMG]](/icons/image2.gif) | image002 (201).jpg | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (168).png | 2025-11-21 06:30 | 7.7K | |
![[ ]](/icons/unknown.gif) | HMIS Modules Descriptions.docx | 2025-11-21 06:30 | 117K | |
![[ ]](/icons/unknown.gif) | Migeba_Chabareba.doc | 2025-11-21 06:30 | 34K | |
![[ ]](/icons/unknown.gif) | Current Tasks.docx | 2025-11-21 06:30 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (49).png | 2025-11-21 06:30 | 3.7K | |
![[IMG]](/icons/image2.gif) | image002 (65).png | 2025-11-21 06:30 | 1.1K | |
![[IMG]](/icons/image2.gif) | image001 (167).png | 2025-11-21 06:30 | 1.1K | |
![[IMG]](/icons/image2.gif) | image001 (29).gif | 2025-11-21 06:30 | 32K | |
![[ ]](/icons/unknown.gif) | delivery acceptance_ENG.doc | 2025-11-21 06:30 | 36K | |
![[IMG]](/icons/image2.gif) | Untitled (20).png | 2025-11-21 06:30 | 144K | |
![[ ]](/icons/unknown.gif) | ვერ გადაიგზავნა.xlsx | 2025-11-21 06:30 | 9.4K | |
![[IMG]](/icons/image2.gif) | image005 (15).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (30).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (48).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (200).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (302).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (166).png | 2025-11-21 06:30 | 129K | |
![[IMG]](/icons/image2.gif) | image001 (165).png | 2025-11-21 06:30 | 129K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (10).xlsx | 2025-11-21 06:30 | 12K | |
![[IMG]](/icons/image2.gif) | image005 (14).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image005 (13).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image005 (12).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (29).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image004 (28).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (47).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (46).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (199).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image002 (198).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (301).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (300).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image005 (11).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image005 (10).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image005 (9).png | 2025-11-21 06:30 | 55K | |
![[IMG]](/icons/image2.gif) | image004 (27).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image004 (26).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image004 (25).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image004 (24).png | 2025-11-21 06:30 | 516 | |
![[IMG]](/icons/image2.gif) | image003 (45).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (44).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (43).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (42).png | 2025-11-21 06:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (197).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image002 (196).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image002 (195).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image002 (194).jpg | 2025-11-21 06:30 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (299).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (298).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (297).jpg | 2025-11-21 06:30 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (296).jpg | 2025-11-21 06:30 | 38K | |
![[ ]](/icons/unknown.gif) | კომპონენტების მიხედვით.xlsx | 2025-11-21 06:30 | 31K | |
![[IMG]](/icons/image2.gif) | image003 (69).jpg | 2025-11-21 06:30 | 2.0K | |
![[IMG]](/icons/image2.gif) | image002 (193).jpg | 2025-11-21 06:30 | 4.2K | |
![[ ]](/icons/unknown.gif) | HMIS Modules Descriptions_ENG.docx | 2025-11-21 06:30 | 113K | |
![[ ]](/icons/unknown.gif) | HMIS Modules Descriptions_ENG (1).docx | 2025-11-21 06:30 | 113K | |
![[ ]](/icons/unknown.gif) | ATT63906 | 2025-11-21 06:30 | 0 | |
![[IMG]](/icons/image2.gif) | image002 (192).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (164).png | 2025-11-21 06:30 | 214K | |
![[ ]](/icons/unknown.gif) | User management fields21_04_15 -Copy - Copy.xlsx | 2025-11-21 06:30 | 14K | |
![[IMG]](/icons/image2.gif) | image007 (8).png | 2025-11-21 06:30 | 214K | |
![[IMG]](/icons/image2.gif) | image006 (17).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (8).png | 2025-11-21 06:30 | 708K | |
![[IMG]](/icons/image2.gif) | image004 (33).jpg | 2025-11-21 06:30 | 28K | |
![[IMG]](/icons/image2.gif) | image003 (41).png | 2025-11-21 06:30 | 214K | |
![[IMG]](/icons/image2.gif) | image002 (191).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (190).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (189).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (163).png | 2025-11-21 06:30 | 214K | |
![[IMG]](/icons/image2.gif) | image001 (162).png | 2025-11-21 06:30 | 214K | |
![[IMG]](/icons/image2.gif) | Untitled (19).png | 2025-11-21 06:30 | 219K | |
![[IMG]](/icons/image2.gif) | 1215921624_1198677861_gruzin.jpg | 2025-11-21 06:30 | 25K | |
![[IMG]](/icons/image2.gif) | image005 (7).png | 2025-11-21 06:30 | 214K | |
![[IMG]](/icons/image2.gif) | image004 (23).png | 2025-11-21 06:30 | 708K | |
![[IMG]](/icons/image2.gif) | image003 (68).jpg | 2025-11-21 06:30 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (188).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (187).jpg | 2025-11-21 06:30 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (161).png | 2025-11-21 06:30 | 363K | |
![[IMG]](/icons/image2.gif) | err.png | 2025-11-21 06:30 | 158K | |
![[ ]](/icons/unknown.gif) | გულის ქირურუგია - ვაუჩერის ფორმა.doc | 2025-11-21 06:30 | 152K | |
![[IMG]](/icons/image2.gif) | image005 (6).png | 2025-11-21 06:30 | 214K | |
![[IMG]](/icons/image2.gif) | image004 (22).png | 2025-11-21 06:30 | 708K | |
![[IMG]](/icons/image2.gif) | image003 (67).jpg | 2025-11-21 06:30 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (186).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (160).png | 2025-11-21 06:30 | 363K | |
![[ ]](/icons/unknown.gif) | ინდივიდუალური - ვაუჩერის ფორმა.doc | 2025-11-21 06:30 | 243K | |
![[ ]](/icons/unknown.gif) | ენდოპროტეზირება - ვაუჩერის ფორმა-2014.doc | 2025-11-21 06:30 | 124K | |
![[ ]](/icons/unknown.gif) | გამოკვლევები - ვაუჩერის ფორმა.doc | 2025-11-21 06:30 | 120K | |
![[IMG]](/icons/image2.gif) | image001 (295).jpg | 2025-11-21 06:30 | 3.1K | |
![[ ]](/icons/unknown.gif) | ATT47298 | 2025-11-21 06:30 | 0 | |
![[ ]](/icons/unknown.gif) | პრობლემატური ტარიფის არეალის კომბინაციები.xlsx | 2025-11-21 06:30 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (294).jpg | 2025-11-21 06:30 | 7.7K | |
![[ ]](/icons/unknown.gif) | eTreasury External Service Documentation 26 02 2013.docx | 2025-11-21 06:30 | 101K | |
![[IMG]](/icons/image2.gif) | image003 (66).jpg | 2025-11-21 06:30 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (293).jpg | 2025-11-21 06:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (292).jpg | 2025-11-21 06:30 | 108K | |
![[ ]](/icons/unknown.gif) | Fourth Annual Abt Photo Contest English (1).docx | 2025-11-21 06:30 | 4.0M | |
![[ ]](/icons/layout.gif) | 4th Photo Contest - Spanish-French_Portuguese and Amharic (1).pdf | 2025-11-21 06:30 | 474K | |
![[ ]](/icons/unknown.gif) | user - 2304.xlsx | 2025-11-21 06:30 | 12K | |
![[ ]](/icons/unknown.gif) | User management fields23_04_15 -Copy - Copy.xlsx | 2025-11-21 06:30 | 14K | |
![[ ]](/icons/unknown.gif) | Referrals - Tbilisi Hall.docx | 2025-11-21 06:30 | 31K | |
![[ ]](/icons/unknown.gif) | All Contracted Providers - 2015-Apr-23.xls | 2025-11-21 06:30 | 4.2M | |
![[TXT]](/icons/text.gif) | ATT00001 (5).htm | 2025-11-21 06:30 | 168 | |
![[ ]](/icons/unknown.gif) | წამლების ბაზა (3).xlsx | 2025-11-21 06:30 | 20K | |
![[IMG]](/icons/image2.gif) | image003 (40).png | 2025-11-21 06:30 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (185).jpg | 2025-11-21 06:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (64).png | 2025-11-21 06:30 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (28).gif | 2025-11-21 06:30 | 15K | |
![[IMG]](/icons/image2.gif) | 2_sabaziso.png | 2025-11-21 06:30 | 187K | |
![[IMG]](/icons/image2.gif) | 1_.png | 2025-11-21 06:30 | 220K | |
![[IMG]](/icons/image2.gif) | image001 (159).png | 2025-11-21 06:30 | 62K | |
![[ ]](/icons/unknown.gif) | Untitled (18) | 2025-11-21 06:30 | 0 | |
![[ ]](/icons/unknown.gif) | ინ-ვიტრო განაყოფიერების ცენტრი.xlsx | 2025-11-21 06:30 | 15K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (9).xlsx | 2025-11-21 06:30 | 11K | |
![[IMG]](/icons/image2.gif) | image017.png | 2025-11-21 06:30 | 67K | |
![[IMG]](/icons/image2.gif) | image016.jpg | 2025-11-21 06:30 | 11K | |
![[IMG]](/icons/image2.gif) | image012.jpg | 2025-11-21 06:30 | 19K | |
![[IMG]](/icons/image2.gif) | image010 (2).jpg | 2025-11-21 06:30 | 17K | |
![[IMG]](/icons/image2.gif) | image007 (7).png | 2025-11-21 06:30 | 30K | |
![[IMG]](/icons/image2.gif) | image007 (6).png | 2025-11-21 06:30 | 67K | |
![[IMG]](/icons/image2.gif) | image006 (16).jpg | 2025-11-21 06:30 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (23).jpg | 2025-11-21 06:30 | 45K | |
![[IMG]](/icons/image2.gif) | image005 (22).jpg | 2025-11-21 06:30 | 19K | |
![[IMG]](/icons/image2.gif) | image004 (32).jpg | 2025-11-21 06:30 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (65).jpg | 2025-11-21 06:30 | 27K | |
![[IMG]](/icons/image2.gif) | image003 (39).png | 2025-11-21 06:30 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (184).jpg | 2025-11-21 06:30 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (291).jpg | 2025-11-21 06:30 | 27K | |
![[IMG]](/icons/image2.gif) | image007 (5).png | 2025-11-21 06:29 | 67K | |
![[IMG]](/icons/image2.gif) | image006 (15).jpg | 2025-11-21 06:29 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (21).jpg | 2025-11-21 06:29 | 19K | |
![[IMG]](/icons/image2.gif) | image004 (31).jpg | 2025-11-21 06:29 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (38).png | 2025-11-21 06:29 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (183).jpg | 2025-11-21 06:29 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (290).jpg | 2025-11-21 06:29 | 27K | |
![[ ]](/icons/unknown.gif) | Referrals Adjara (2).docx | 2025-11-21 06:29 | 29K | |
![[ ]](/icons/unknown.gif) | AprilWrongCapitationProviders (1).xlsx | 2025-11-21 06:29 | 24K | |
![[ ]](/icons/unknown.gif) | 13 რეესტრი.xls | 2025-11-21 06:29 | 28K | |
![[ ]](/icons/unknown.gif) | 13 რეესტრი (3).xls | 2025-11-21 06:29 | 23K | |
![[IMG]](/icons/image2.gif) | image002 (182).jpg | 2025-11-21 06:29 | 3.1K | |
![[ ]](/icons/unknown.gif) | AprilWrongCapitationProviders.xlsx | 2025-11-21 06:29 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (289).jpg | 2025-11-21 06:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | image001 (158).png | 2025-11-21 06:29 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (157).png | 2025-11-21 06:29 | 255 | |
![[IMG]](/icons/image2.gif) | image001 (156).png | 2025-11-21 06:29 | 255 | |
![[ ]](/icons/unknown.gif) | AprilWrongCapitationProvidersAllProviders.xlsx | 2025-11-21 06:29 | 1.0M | |
![[IMG]](/icons/image2.gif) | image004 (30).jpg | 2025-11-21 06:29 | 13K | |
![[ ]](/icons/unknown.gif) | c hepatitis formaangarishgeba.xls | 2025-11-21 06:29 | 40K | |
![[IMG]](/icons/image2.gif) | image007 (4).png | 2025-11-21 06:29 | 67K | |
![[IMG]](/icons/image2.gif) | image006 (14).jpg | 2025-11-21 06:29 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (20).jpg | 2025-11-21 06:29 | 19K | |
![[IMG]](/icons/image2.gif) | image004 (29).jpg | 2025-11-21 06:29 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (37).png | 2025-11-21 06:29 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (181).jpg | 2025-11-21 06:29 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (180).jpg | 2025-11-21 06:29 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (288).jpg | 2025-11-21 06:29 | 27K | |
![[ ]](/icons/unknown.gif) | თამთას ახალი.xlsx | 2025-11-21 06:29 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (155).png | 2025-11-21 06:29 | 87K | |
![[ ]](/icons/unknown.gif) | User management fields27_04_15 -Copy - Copy.xlsx | 2025-11-21 06:29 | 14K | |
![[IMG]](/icons/image2.gif) | რეცეპტი 3.png | 2025-11-21 06:29 | 227K | |
![[IMG]](/icons/image2.gif) | რეცეპტი 2.png | 2025-11-21 06:29 | 302K | |
![[IMG]](/icons/image2.gif) | რეცეპტი 1.png | 2025-11-21 06:29 | 398K | |
![[IMG]](/icons/image2.gif) | რეცეპტი.png | 2025-11-21 06:29 | 325K | |
![[ ]](/icons/unknown.gif) | რეესტრი 2014_12_01-2015_04_27.xlsx | 2025-11-21 06:29 | 780K | |
![[IMG]](/icons/image2.gif) | image001 (154).png | 2025-11-21 06:29 | 255 | |
![[ ]](/icons/unknown.gif) | User management fields-1 (6).xlsx | 2025-11-21 06:29 | 13K | |
![[IMG]](/icons/image2.gif) | Untitled (18).png | 2025-11-21 06:29 | 219K | |
![[IMG]](/icons/image2.gif) | image002 (63).png | 2025-11-21 06:29 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (287).jpg | 2025-11-21 06:29 | 17K | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (3).pdf | 2025-11-21 06:29 | 388K | |
![[ ]](/icons/unknown.gif) | ცენტრი.xlsx | 2025-11-21 06:29 | 38K | |
![[ ]](/icons/unknown.gif) | ურანტი_ფორმა.xlsx | 2025-11-21 06:29 | 14K | |
![[ ]](/icons/unknown.gif) | რეგიონული ჯანდაცვის ცენტრი.xlsx | 2025-11-21 06:29 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (153).png | 2025-11-21 06:29 | 21K | |
![[TXT]](/icons/text.gif) | ATT00002 (3).htm | 2025-11-21 06:29 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (4).htm | 2025-11-21 06:29 | 7.6K | |
![[ ]](/icons/unknown.gif) | წამლების ბაზა (GPC) 2015_04_27.xlsx | 2025-11-21 06:29 | 28K | |
![[ ]](/icons/unknown.gif) | tuberkulozis moduli.xlsx | 2025-11-21 06:29 | 9.8K | |
![[ ]](/icons/unknown.gif) | User management fields (9).xlsx | 2025-11-21 06:29 | 14K | |
![[ ]](/icons/unknown.gif) | რეგიონული ჯანდაცვის ცენტრი-წალკა.xlsx | 2025-11-21 06:29 | 15K | |
![[ ]](/icons/unknown.gif) | რეგიონული ჯანდაცვის ცენტრი-ყაზბეგის რ-ნი.xlsx | 2025-11-21 06:29 | 15K | |
![[ ]](/icons/unknown.gif) | რეგიონული ჯანდაცვის ცენტრი-თიანეთი.xlsx | 2025-11-21 06:29 | 15K | |
![[ ]](/icons/unknown.gif) | რეგიონული ჯანდაცვის ცენტრი-თეთრიწყაროს რ-ნი.xlsx | 2025-11-21 06:29 | 15K | |
![[ ]](/icons/unknown.gif) | რეგიონული ჯანდაცვის ცენტრი-ბაკურიანი.xlsx | 2025-11-21 06:29 | 15K | |
![[ ]](/icons/unknown.gif) | გასაუქმებელი კომბინაციები (1).xlsx | 2025-11-21 06:29 | 468K | |
![[ ]](/icons/layout.gif) | scan0011.pdf | 2025-11-21 06:29 | 63K | |
![[IMG]](/icons/image2.gif) | scan0011-1.png | 2025-11-21 06:29 | 233K | |
![[IMG]](/icons/image2.gif) | image003 (36).png | 2025-11-21 06:29 | 255 | |
![[IMG]](/icons/image2.gif) | image002 (179).jpg | 2025-11-21 06:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (178).jpg | 2025-11-21 06:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (286).jpg | 2025-11-21 06:29 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (152).png | 2025-11-21 06:29 | 27K | |
![[ ]](/icons/unknown.gif) | Template Job Details.xlsx | 2025-11-21 06:29 | 735K | |
![[ ]](/icons/unknown.gif) | მიღება- ჩაბარების აქტი - ნიმუში (1).xls | 2025-11-21 06:29 | 22K | |
![[IMG]](/icons/image2.gif) | untitled (17).PNG | 2025-11-21 06:29 | 86K | |
![[IMG]](/icons/image2.gif) | error (11).PNG | 2025-11-21 06:29 | 111K | |
![[IMG]](/icons/image2.gif) | untitled (16).PNG | 2025-11-21 06:29 | 305K | |
![[IMG]](/icons/image2.gif) | dublireba (1).png | 2025-11-21 06:29 | 211K | |
![[ ]](/icons/unknown.gif) | დანართი (3).xlsx | 2025-11-21 06:29 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (177).jpg | 2025-11-21 06:29 | 60K | |
![[IMG]](/icons/image2.gif) | ადოს (4).png | 2025-11-21 06:29 | 197K | |
![[IMG]](/icons/image2.gif) | image003 (35).png | 2025-11-21 06:29 | 176K | |
![[IMG]](/icons/image2.gif) | image002 (62).png | 2025-11-21 06:29 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (285).jpg | 2025-11-21 06:29 | 20K | |
![[IMG]](/icons/image2.gif) | image001 (284).jpg | 2025-11-21 06:29 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (283).jpg | 2025-11-21 06:29 | 4.2K | |
![[ ]](/icons/unknown.gif) | Fourth Annual Abt Photo Contest English.docx | 2025-11-21 06:29 | 4.0M | |
![[ ]](/icons/layout.gif) | 4th Photo Contest - Spanish-French_Portuguese and Amharic.pdf | 2025-11-21 06:29 | 474K | |
![[IMG]](/icons/image2.gif) | prescription Error.PNG | 2025-11-21 06:29 | 295K | |
![[IMG]](/icons/image2.gif) | image002 (61).png | 2025-11-21 06:29 | 63K | |
![[IMG]](/icons/image2.gif) | form 100 - Bad Design.PNG | 2025-11-21 06:29 | 33K | |
![[IMG]](/icons/image2.gif) | 2 (8).png | 2025-11-21 06:29 | 190K | |
![[IMG]](/icons/image2.gif) | 1 (8).png | 2025-11-21 06:29 | 258K | |
![[ ]](/icons/unknown.gif) | User management fields29_04_15 -Copy - Copy.xlsx | 2025-11-21 06:29 | 14K | |
![[IMG]](/icons/image2.gif) | 2 (7).png | 2025-11-21 06:29 | 311K | |
![[IMG]](/icons/image2.gif) | 1 (7).png | 2025-11-21 06:29 | 363K | |
![[IMG]](/icons/image2.gif) | image001 (151).png | 2025-11-21 06:29 | 255 | |
![[ ]](/icons/unknown.gif) | User management fields medicine.xlsx | 2025-11-21 06:29 | 16K | |
![[ ]](/icons/unknown.gif) | მოთხოვნა 304925.docx | 2025-11-21 06:29 | 508K | |
![[ ]](/icons/unknown.gif) | User management fields-1 (5).xlsx | 2025-11-21 06:29 | 13K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (8).xlsx | 2025-11-21 06:29 | 12K | |
![[IMG]](/icons/image2.gif) | Ganacxadis nomeri.png | 2025-11-21 06:29 | 7.7M | |
![[IMG]](/icons/image2.gif) | image001 (150).png | 2025-11-21 06:29 | 255 | |
![[ ]](/icons/unknown.gif) | User management fields new.xlsx | 2025-11-21 06:29 | 17K | |
![[ ]](/icons/unknown.gif) | User management fields bolo.xlsx | 2025-11-21 06:29 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (27).gif | 2025-11-21 06:29 | 32K | |
![[IMG]](/icons/image2.gif) | image007 (3).png | 2025-11-21 06:29 | 67K | |
![[IMG]](/icons/image2.gif) | image006 (13).jpg | 2025-11-21 06:29 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (19).jpg | 2025-11-21 06:29 | 19K | |
![[IMG]](/icons/image2.gif) | image004 (28).jpg | 2025-11-21 06:29 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (34).png | 2025-11-21 06:29 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (176).jpg | 2025-11-21 06:29 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (282).jpg | 2025-11-21 06:29 | 27K | |
![[IMG]](/icons/image2.gif) | gadatvla.png | 2025-11-21 06:29 | 212K | |
![[ ]](/icons/unknown.gif) | 302 განკარგულენა.doc | 2025-11-21 06:29 | 44K | |
![[IMG]](/icons/image2.gif) | ჯეო ჰოსპიტალსის წერილი.djvu | 2025-11-21 06:29 | 29K | |
![[IMG]](/icons/image2.gif) | რეგიონული ჯანდაცვის ცენტრის წერილი.djvu | 2025-11-21 06:29 | 17K | |
![[ ]](/icons/layout.gif) | ამონაწერი.pdf | 2025-11-21 06:29 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (281).jpg | 2025-11-21 06:29 | 2.3K | |
![[ ]](/icons/unknown.gif) | User management fields blank (3).xlsx | 2025-11-21 06:29 | 15K | |
![[ ]](/icons/unknown.gif) | User management fields-1 (4).xlsx | 2025-11-21 06:29 | 13K | |
![[ ]](/icons/unknown.gif) | Untitled (17) | 2025-11-21 06:29 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (16) | 2025-11-21 06:29 | 0 | |
![[ ]](/icons/unknown.gif) | AprilWrongCapitationProvidersAllProvidersVer2 (2).xlsx | 2025-11-21 06:29 | 1.3M | |
![[TXT]](/icons/text.gif) | ATT00003 (1).htm | 2025-11-21 06:29 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (2).htm | 2025-11-21 06:29 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (3).htm | 2025-11-21 06:29 | 1.2K | |
![[ ]](/icons/unknown.gif) | წამლების ბაზა (2).xlsx | 2025-11-21 06:29 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (175).jpg | 2025-11-21 06:29 | 13K | |
![[ ]](/icons/unknown.gif) | AprilWrongCapitationProvidersAllProvidersVer2 (1).xlsx | 2025-11-21 06:29 | 1.3M | |
![[ ]](/icons/unknown.gif) | გასაუქმებელი კომბინაციები.xlsx | 2025-11-21 06:29 | 9.4K | |
![[IMG]](/icons/image2.gif) | image001 (280).jpg | 2025-11-21 06:29 | 7.8K | |
![[IMG]](/icons/image2.gif) | image002 (174).jpg | 2025-11-21 06:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (149).png | 2025-11-21 06:28 | 7.7K | |
![[ ]](/icons/unknown.gif) | User management fields (8).xlsx | 2025-11-21 06:28 | 13K | |
![[IMG]](/icons/image2.gif) | image007 (2).png | 2025-11-21 06:28 | 67K | |
![[IMG]](/icons/image2.gif) | image006 (12).jpg | 2025-11-21 06:28 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (18).jpg | 2025-11-21 06:28 | 19K | |
![[IMG]](/icons/image2.gif) | image004 (27).jpg | 2025-11-21 06:28 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (33).png | 2025-11-21 06:28 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (173).jpg | 2025-11-21 06:28 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (279).jpg | 2025-11-21 06:28 | 27K | |
![[ ]](/icons/unknown.gif) | c hepatitis forma (1).xlsx | 2025-11-21 06:28 | 18K | |
![[ ]](/icons/unknown.gif) | Vertical - Samples.xlsx | 2025-11-21 06:28 | 9.4K | |
![[ ]](/icons/unknown.gif) | ანგარიშგება ინსტრუქცია.docx | 2025-11-21 06:28 | 19K | |
![[IMG]](/icons/image2.gif) | waa.png | 2025-11-21 06:28 | 206K | |
![[ ]](/icons/unknown.gif) | AprilWrongCapitationProvidersAllProvidersVer2.xlsx | 2025-11-21 06:28 | 1.3M | |
![[ ]](/icons/unknown.gif) | Ushka.xlsx | 2025-11-21 06:28 | 8.9K | |
![[ ]](/icons/unknown.gif) | მიღება- ჩაბარების აქტი - ნიმუში.xls | 2025-11-21 06:28 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (278).jpg | 2025-11-21 06:28 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (277).jpg | 2025-11-21 06:28 | 4.2K | |
![[ ]](/icons/unknown.gif) | aversi.xlsx | 2025-11-21 06:28 | 11K | |
![[ ]](/icons/unknown.gif) | abc (1).xlsx | 2025-11-21 06:28 | 12K | |
![[ ]](/icons/unknown.gif) | User management fields-1 (3).xlsx | 2025-11-21 06:28 | 13K | |
![[IMG]](/icons/image2.gif) | 2 (6).PNG | 2025-11-21 06:28 | 96K | |
![[IMG]](/icons/image2.gif) | 1 (6).PNG | 2025-11-21 06:28 | 67K | |
![[IMG]](/icons/image2.gif) | ექსპორტი (1).png | 2025-11-21 06:28 | 230K | |
![[ ]](/icons/unknown.gif) | წერილი (1).docx | 2025-11-21 06:28 | 11K | |
![[IMG]](/icons/image2.gif) | rep_.png | 2025-11-21 06:28 | 192K | |
![[IMG]](/icons/image2.gif) | image001 (276).jpg | 2025-11-21 06:28 | 4.2K | |
![[ ]](/icons/unknown.gif) | Untitled (15) | 2025-11-21 06:28 | 0 | |
![[ ]](/icons/unknown.gif) | GoodTypesAndGroups.xlsx | 2025-11-21 06:28 | 9.4K | |
![[ ]](/icons/unknown.gif) | ExcelStructureExample.xls | 2025-11-21 06:28 | 29K | |
![[ ]](/icons/unknown.gif) | DataForCatalogueImport.rar | 2025-11-21 06:28 | 5.7M | |
![[IMG]](/icons/image2.gif) | image001 (275).jpg | 2025-11-21 06:28 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (274).jpg | 2025-11-21 06:28 | 3.1K | |
![[ ]](/icons/unknown.gif) | ვაქცინების სია.xlsx | 2025-11-21 06:28 | 14K | |
![[IMG]](/icons/image2.gif) | image009.png | 2025-11-21 06:28 | 10K | |
![[IMG]](/icons/image2.gif) | image007 (6).jpg | 2025-11-21 06:28 | 30K | |
![[IMG]](/icons/image2.gif) | image006 (3).png | 2025-11-21 06:28 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (60).png | 2025-11-21 06:28 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (273).jpg | 2025-11-21 06:28 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (272).jpg | 2025-11-21 06:28 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (271).jpg | 2025-11-21 06:28 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (270).jpg | 2025-11-21 06:28 | 4.2K | |
![[ ]](/icons/unknown.gif) | თამთა კომახიძე.xlsx | 2025-11-21 06:28 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (269).jpg | 2025-11-21 06:28 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (148).png | 2025-11-21 06:28 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (147).png | 2025-11-21 06:28 | 13K | |
![[ ]](/icons/unknown.gif) | user - 0605.xlsx | 2025-11-21 06:28 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (146).png | 2025-11-21 06:28 | 13K | |
![[ ]](/icons/unknown.gif) | Vertical - Samples-1.xlsx | 2025-11-21 06:28 | 10K | |
![[ ]](/icons/unknown.gif) | Referrals Adjara (1).docx | 2025-11-21 06:28 | 29K | |
![[ ]](/icons/unknown.gif) | Georgia HSSP deliverables tracker - Only Yallow.xlsx | 2025-11-21 06:28 | 19K | |
![[ ]](/icons/unknown.gif) | xlsx_.xlsx | 2025-11-21 06:28 | 11K | |
![[ ]](/icons/unknown.gif) | პრობლემური მოთხოვნები.xlsx | 2025-11-21 06:28 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (59).png | 2025-11-21 06:28 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (268).jpg | 2025-11-21 06:28 | 17K | |
![[ ]](/icons/unknown.gif) | მერიის ახალი საკითხები 30_04_2015.docx | 2025-11-21 06:28 | 16K | |
![[ ]](/icons/unknown.gif) | ექსპორტი 1 (1).xlsx | 2025-11-21 06:28 | 11K | |
![[ ]](/icons/unknown.gif) | მედიკამნტები.rar | 2025-11-21 06:28 | 165K | |
![[ ]](/icons/unknown.gif) | moTxovna.xlsx | 2025-11-21 06:28 | 4.1M | |
![[IMG]](/icons/image2.gif) | image003 (32).png | 2025-11-21 06:28 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (58).png | 2025-11-21 06:28 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (267).jpg | 2025-11-21 06:28 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (266).jpg | 2025-11-21 06:28 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (145).png | 2025-11-21 06:28 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (144).png | 2025-11-21 06:28 | 13K | |
![[IMG]](/icons/image2.gif) | Untitledddd.png | 2025-11-21 06:28 | 149K | |
![[ ]](/icons/unknown.gif) | Untitled (14) | 2025-11-21 06:28 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (13) | 2025-11-21 06:28 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (12) | 2025-11-21 06:28 | 0 | |
![[IMG]](/icons/image2.gif) | 300000.png | 2025-11-21 06:28 | 308K | |
![[IMG]](/icons/image2.gif) | image001 (265).jpg | 2025-11-21 06:28 | 3.2K | |
![[ ]](/icons/unknown.gif) | ივნისი ივლისი.rar | 2025-11-21 06:28 | 442K | |
![[IMG]](/icons/image2.gif) | image007 (5).jpg | 2025-11-21 06:28 | 3.6K | |
![[IMG]](/icons/image2.gif) | image006 (11).jpg | 2025-11-21 06:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | image006 (10).jpg | 2025-11-21 06:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | image005 (17).jpg | 2025-11-21 06:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | image005 (16).jpg | 2025-11-21 06:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (26).jpg | 2025-11-21 06:28 | 5.2K | |
![[IMG]](/icons/image2.gif) | image004 (25).jpg | 2025-11-21 06:28 | 5.2K | |
![[IMG]](/icons/image2.gif) | image003 (31).png | 2025-11-21 06:28 | 682 | |
![[IMG]](/icons/image2.gif) | image003 (30).png | 2025-11-21 06:28 | 682 | |
![[IMG]](/icons/image2.gif) | image002 (57).png | 2025-11-21 06:28 | 690 | |
![[IMG]](/icons/image2.gif) | image002 (56).png | 2025-11-21 06:28 | 690 | |
![[IMG]](/icons/image2.gif) | image001 (264).jpg | 2025-11-21 06:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (263).jpg | 2025-11-21 06:28 | 2.5K | |
![[IMG]](/icons/image2.gif) | image006 (9).jpg | 2025-11-21 06:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | image004 (24).jpg | 2025-11-21 06:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | image003 (64).jpg | 2025-11-21 06:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | image003 (63).jpg | 2025-11-21 06:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (172).jpg | 2025-11-21 06:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (171).jpg | 2025-11-21 06:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (55).png | 2025-11-21 06:28 | 3.5K | |
![[IMG]](/icons/image2.gif) | image001 (262).jpg | 2025-11-21 06:28 | 8.5K | |
![[ ]](/icons/unknown.gif) | 203834075.xlsx | 2025-11-21 06:28 | 17K | |
![[ ]](/icons/layout.gif) | 2015 COP Conference Resource Guide.pdf | 2025-11-21 06:28 | 277K | |
![[ ]](/icons/unknown.gif) | ფსიქოსოციალური - პროგრამით ასანაზღაურებელი თა� | 2025-11-21 06:28 | 3.7M | |
![[IMG]](/icons/image2.gif) | ფსიქოსოციალური - ნოზოლოგიის კოდი.bmp | 2025-11-21 06:28 | 3.7M | |
![[ ]](/icons/unknown.gif) | user - ბოდოკია.xlsx | 2025-11-21 06:28 | 12K | |
![[IMG]](/icons/image2.gif) | med (2).PNG | 2025-11-21 06:28 | 114K | |
![[IMG]](/icons/image2.gif) | image002 (170).jpg | 2025-11-21 06:28 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (261).jpg | 2025-11-21 06:28 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (260).jpg | 2025-11-21 06:28 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (259).jpg | 2025-11-21 06:28 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (258).jpg | 2025-11-21 06:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (143).png | 2025-11-21 06:28 | 1.2M | |
![[IMG]](/icons/image2.gif) | zuras.png | 2025-11-21 06:28 | 164K | |
![[IMG]](/icons/image2.gif) | image002 (169).jpg | 2025-11-21 06:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (142).png | 2025-11-21 06:28 | 7.7K | |
![[ ]](/icons/unknown.gif) | Copy of user - ბოდოკია.xlsx | 2025-11-21 06:28 | 12K | |
![[ ]](/icons/unknown.gif) | ExcelStructureExample (1) - ზიანი.xls | 2025-11-21 06:28 | 40K | |
![[ ]](/icons/unknown.gif) | ჰეპატიტის ფორმები მერია (1).xlsx | 2025-11-21 06:28 | 33K | |
![[IMG]](/icons/image2.gif) | image002 (168).jpg | 2025-11-21 06:28 | 13K | |
![[IMG]](/icons/image2.gif) | Untitled (15).png | 2025-11-21 06:28 | 230K | |
![[ ]](/icons/unknown.gif) | დანართი (2).xlsx | 2025-11-21 06:28 | 10K | |
![[IMG]](/icons/image2.gif) | untiteled1.png | 2025-11-21 06:28 | 211K | |
![[IMG]](/icons/image2.gif) | Untitled (14).png | 2025-11-21 06:28 | 202K | |
![[ ]](/icons/unknown.gif) | User management fields 11_05_2015.xlsx | 2025-11-21 06:27 | 20K | |
![[ ]](/icons/unknown.gif) | USAID.doc | 2025-11-21 06:27 | 199K | |
![[ ]](/icons/unknown.gif) | სამცხე 05_2015_.xlsx | 2025-11-21 06:27 | 11K | |
![[ ]](/icons/unknown.gif) | ვაქცინები.xlsx | 2025-11-21 06:27 | 12K | |
![[ ]](/icons/unknown.gif) | გამხსნელები.xlsx | 2025-11-21 06:27 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (141).png | 2025-11-21 06:27 | 13K | |
![[ ]](/icons/unknown.gif) | Referrals Adjara.docx | 2025-11-21 06:27 | 37K | |
![[IMG]](/icons/image2.gif) | image004 (21).png | 2025-11-21 06:27 | 64K | |
![[IMG]](/icons/image2.gif) | image003 (29).png | 2025-11-21 06:27 | 128K | |
![[IMG]](/icons/image2.gif) | image002 (54).png | 2025-11-21 06:27 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (257).jpg | 2025-11-21 06:27 | 17K | |
![[IMG]](/icons/image2.gif) | image006 (8).jpg | 2025-11-21 06:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | image005 (15).jpg | 2025-11-21 06:27 | 3.1K | |
![[IMG]](/icons/image2.gif) | image005 (14).jpg | 2025-11-21 06:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | image004 (23).jpg | 2025-11-21 06:27 | 5.2K | |
![[IMG]](/icons/image2.gif) | image004 (22).jpg | 2025-11-21 06:27 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (62).jpg | 2025-11-21 06:27 | 5.2K | |
![[IMG]](/icons/image2.gif) | image003 (28).png | 2025-11-21 06:27 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (27).png | 2025-11-21 06:27 | 682 | |
![[IMG]](/icons/image2.gif) | image002 (167).jpg | 2025-11-21 06:27 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (166).jpg | 2025-11-21 06:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (53).png | 2025-11-21 06:27 | 690 | |
![[IMG]](/icons/image2.gif) | image002 (52).png | 2025-11-21 06:27 | 682 | |
![[IMG]](/icons/image2.gif) | image001 (256).jpg | 2025-11-21 06:27 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (140).png | 2025-11-21 06:27 | 690 | |
![[IMG]](/icons/image2.gif) | FullSizeRender (5).jpg | 2025-11-21 06:27 | 344K | |
![[TXT]](/icons/text.gif) | ATT00001 (3).txt | 2025-11-21 06:27 | 25 | |
![[IMG]](/icons/image2.gif) | yoz.PNG | 2025-11-21 06:27 | 94K | |
![[IMG]](/icons/image2.gif) | image002 (165).jpg | 2025-11-21 06:27 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (164).jpg | 2025-11-21 06:27 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (139).png | 2025-11-21 06:27 | 350K | |
![[IMG]](/icons/image2.gif) | image001 (138).png | 2025-11-21 06:27 | 350K | |
![[ ]](/icons/unknown.gif) | სორტირების_ლოგიკა.xlsx | 2025-11-21 06:27 | 17K | |
![[ ]](/icons/unknown.gif) | ექსპორტი 1.xlsx | 2025-11-21 06:27 | 12K | |
![[IMG]](/icons/image2.gif) | image005 (5).png | 2025-11-21 06:27 | 350K | |
![[IMG]](/icons/image2.gif) | image004 (21).jpg | 2025-11-21 06:27 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (26).png | 2025-11-21 06:27 | 557K | |
![[IMG]](/icons/image2.gif) | image001 (255).jpg | 2025-11-21 06:27 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (137).png | 2025-11-21 06:27 | 52K | |
![[IMG]](/icons/image2.gif) | image001 (136).png | 2025-11-21 06:27 | 52K | |
![[IMG]](/icons/image2.gif) | image001 (135).png | 2025-11-21 06:27 | 209K | |
![[ ]](/icons/unknown.gif) | user - მცხეთა.xlsx | 2025-11-21 06:27 | 12K | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (8).xls | 2025-11-21 06:27 | 27K | |
![[IMG]](/icons/image2.gif) | image004 (20).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image003 (25).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image002 (51).png | 2025-11-21 06:27 | 104K | |
![[IMG]](/icons/image2.gif) | image001 (134).png | 2025-11-21 06:27 | 92K | |
![[IMG]](/icons/image2.gif) | FullSizeRender (4).jpg | 2025-11-21 06:27 | 344K | |
![[TXT]](/icons/text.gif) | ATT00001 (2).txt | 2025-11-21 06:27 | 25 | |
![[IMG]](/icons/image2.gif) | serxios2.png | 2025-11-21 06:27 | 257K | |
![[IMG]](/icons/image2.gif) | serxios.png | 2025-11-21 06:27 | 255K | |
![[IMG]](/icons/image2.gif) | image004 (19).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image003 (24).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image002 (50).png | 2025-11-21 06:27 | 104K | |
![[IMG]](/icons/image2.gif) | image001 (133).png | 2025-11-21 06:27 | 92K | |
![[ ]](/icons/unknown.gif) | User management fields (7).xlsx | 2025-11-21 06:27 | 9.9K | |
![[IMG]](/icons/image2.gif) | Untitled (13).png | 2025-11-21 06:27 | 199K | |
![[TXT]](/icons/text.gif) | ATT00001 (2).htm | 2025-11-21 06:27 | 168 | |
![[IMG]](/icons/image2.gif) | image004 (18).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image003 (23).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image002 (49).png | 2025-11-21 06:27 | 104K | |
![[IMG]](/icons/image2.gif) | image001 (132).png | 2025-11-21 06:27 | 92K | |
![[IMG]](/icons/image2.gif) | image003 (61).jpg | 2025-11-21 06:27 | 29K | |
![[IMG]](/icons/image2.gif) | image002 (163).jpg | 2025-11-21 06:27 | 74K | |
![[IMG]](/icons/image2.gif) | image002 (162).jpg | 2025-11-21 06:27 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (254).jpg | 2025-11-21 06:27 | 74K | |
![[IMG]](/icons/image2.gif) | image.png | 2025-11-21 06:27 | 3.9K | |
![[IMG]](/icons/image2.gif) | image (2).png | 2025-11-21 06:27 | 3.9K | |
![[IMG]](/icons/image2.gif) | image (1).png | 2025-11-21 06:27 | 3.9K | |
![[ ]](/icons/unknown.gif) | Drugs (1).xlsx | 2025-11-21 06:27 | 430K | |
![[IMG]](/icons/image2.gif) | image004 (17).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image004 (16).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image003 (22).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image003 (21).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image002 (48).png | 2025-11-21 06:27 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (47).png | 2025-11-21 06:27 | 104K | |
![[IMG]](/icons/image2.gif) | image001 (131).png | 2025-11-21 06:27 | 92K | |
![[ ]](/icons/layout.gif) | რეესტრის ამონაწერი.pdf | 2025-11-21 06:27 | 58K | |
![[IMG]](/icons/image2.gif) | ევექსის წერილი.djvu | 2025-11-21 06:27 | 147K | |
![[IMG]](/icons/image2.gif) | image011 (1).jpg | 2025-11-21 06:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | image010 (1).jpg | 2025-11-21 06:27 | 3.1K | |
![[IMG]](/icons/image2.gif) | image009 (2).jpg | 2025-11-21 06:27 | 5.2K | |
![[IMG]](/icons/image2.gif) | image008 (1).png | 2025-11-21 06:27 | 682 | |
![[IMG]](/icons/image2.gif) | image007 (1).png | 2025-11-21 06:27 | 690 | |
![[IMG]](/icons/image2.gif) | image006 (7).jpg | 2025-11-21 06:27 | 4.6K | |
![[IMG]](/icons/image2.gif) | image004 (15).png | 2025-11-21 06:27 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (253).jpg | 2025-11-21 06:27 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (130).png | 2025-11-21 06:27 | 92K | |
![[ ]](/icons/unknown.gif) | Untitled (11) | 2025-11-21 06:27 | 0 | |
![[ ]](/icons/unknown.gif) | დანართი #1 (7).xlsx | 2025-11-21 06:27 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (161).jpg | 2025-11-21 06:27 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (252).jpg | 2025-11-21 06:27 | 74K | |
![[ ]](/icons/unknown.gif) | Untitled (10) | 2025-11-21 06:27 | 0 | |
![[ ]](/icons/unknown.gif) | moTxovna1.xlsx | 2025-11-21 06:27 | 2.5M | |
![[IMG]](/icons/image2.gif) | image006 (6).jpg | 2025-11-21 06:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | image005 (13).jpg | 2025-11-21 06:27 | 3.1K | |
![[IMG]](/icons/image2.gif) | image004 (20).jpg | 2025-11-21 06:27 | 5.2K | |
![[IMG]](/icons/image2.gif) | image003 (20).png | 2025-11-21 06:27 | 682 | |
![[IMG]](/icons/image2.gif) | image002 (46).png | 2025-11-21 06:27 | 690 | |
![[IMG]](/icons/image2.gif) | image001 (251).jpg | 2025-11-21 06:27 | 4.6K | |
![[IMG]](/icons/image2.gif) | image001 (129).png | 2025-11-21 06:27 | 66K | |
![[IMG]](/icons/image2.gif) | wa.png | 2025-11-21 06:27 | 203K | |
![[IMG]](/icons/image2.gif) | image004 (14).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image004 (13).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image004 (12).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image003 (19).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image003 (18).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image003 (17).png | 2025-11-21 06:27 | 210K | |
![[IMG]](/icons/image2.gif) | image002 (45).png | 2025-11-21 06:27 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (44).png | 2025-11-21 06:27 | 104K | |
![[IMG]](/icons/image2.gif) | image002 (43).png | 2025-11-21 06:27 | 104K | |
![[IMG]](/icons/image2.gif) | image001 (250).jpg | 2025-11-21 06:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (249).jpg | 2025-11-21 06:27 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (128).png | 2025-11-21 06:27 | 92K | |
![[IMG]](/icons/image2.gif) | image001 (127).png | 2025-11-21 06:27 | 92K | |
![[IMG]](/icons/image2.gif) | image001 (126).png | 2025-11-21 06:27 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (125).png | 2025-11-21 06:27 | 92K | |
![[ ]](/icons/unknown.gif) | Users.xlsx | 2025-11-21 06:27 | 164K | |
![[IMG]](/icons/image2.gif) | Untitled (12).png | 2025-11-21 06:27 | 130K | |
![[IMG]](/icons/image2.gif) | untitled (11).PNG | 2025-11-21 06:27 | 88K | |
![[IMG]](/icons/image2.gif) | image003 (60).jpg | 2025-11-21 06:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | image003 (16).png | 2025-11-21 06:27 | 8.1K | |
![[IMG]](/icons/image2.gif) | image002 (42).png | 2025-11-21 06:27 | 8.1K | |
![[IMG]](/icons/image2.gif) | image002 (17).gif | 2025-11-21 06:27 | 3.5K | |
![[IMG]](/icons/image2.gif) | image001 (248).jpg | 2025-11-21 06:27 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (124).png | 2025-11-21 06:27 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (123).png | 2025-11-21 06:27 | 33K | |
![[ ]](/icons/unknown.gif) | Scan1.PDF | 2025-11-21 06:27 | 93K | |
![[ ]](/icons/unknown.gif) | უნიმედი აჭარა-ონკოლოგიის ცენტრი.xlsx | 2025-11-21 06:27 | 15K | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (7).xls | 2025-11-21 06:27 | 27K | |
![[IMG]](/icons/image2.gif) | image002 (160).jpg | 2025-11-21 06:27 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (122).png | 2025-11-21 06:27 | 7.7K | |
![[ ]](/icons/unknown.gif) | c hepatitis forma.xlsx | 2025-11-21 06:27 | 18K | |
![[IMG]](/icons/image2.gif) | 218 (1).png | 2025-11-21 06:27 | 197K | |
![[IMG]](/icons/image2.gif) | 36.png | 2025-11-21 06:27 | 211K | |
![[IMG]](/icons/image2.gif) | 36-218.png | 2025-11-21 06:27 | 187K | |
![[ ]](/icons/unknown.gif) | პრობლემური მიმართვები კომისია 30167.xlsx | 2025-11-21 06:27 | 12K | |
![[ ]](/icons/unknown.gif) | მიმწოდებლები (5).xlsx | 2025-11-21 06:27 | 8.8K | |
![[ ]](/icons/unknown.gif) | მიმწოდებლები (4).xlsx | 2025-11-21 06:27 | 8.8K | |
![[ ]](/icons/unknown.gif) | მიმწოდებლები (3).xlsx | 2025-11-21 06:27 | 8.7K | |
![[IMG]](/icons/image2.gif) | cap.PNG | 2025-11-21 06:27 | 127K | |
![[ ]](/icons/unknown.gif) | -.docx | 2025-11-21 06:27 | 15K | |
![[IMG]](/icons/image2.gif) | Untitled (10).png | 2025-11-21 06:27 | 187K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (9).jpg | 2025-11-21 06:27 | 823 | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (6).xls | 2025-11-21 06:27 | 28K | |
![[IMG]](/icons/image2.gif) | lol.jpg | 2025-11-21 06:27 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (247).jpg | 2025-11-21 06:27 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (246).jpg | 2025-11-21 06:27 | 29K | |
![[ ]](/icons/unknown.gif) | მიმწოდებლები (2).xlsx | 2025-11-21 06:27 | 8.8K | |
![[ ]](/icons/unknown.gif) | komisiis_oqmebi_2015_asatvirti.xlsx | 2025-11-21 06:27 | 563K | |
![[IMG]](/icons/image2.gif) | image001 (121).png | 2025-11-21 06:27 | 94K | |
![[IMG]](/icons/image2.gif) | error (10).png | 2025-11-21 06:27 | 289K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (8).jpg | 2025-11-21 06:27 | 823 | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (5).xls | 2025-11-21 06:27 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (159).jpg | 2025-11-21 06:27 | 13K | |
![[ ]](/icons/unknown.gif) | რეესტრის ნომრები.xlsx | 2025-11-21 06:27 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (245).jpg | 2025-11-21 06:27 | 29K | |
![[IMG]](/icons/image2.gif) | Untitled (9).png | 2025-11-21 06:27 | 171K | |
![[IMG]](/icons/image2.gif) | image005 (4).png | 2025-11-21 06:27 | 165 | |
![[IMG]](/icons/image2.gif) | image003 (59).jpg | 2025-11-21 06:27 | 4.5K | |
![[IMG]](/icons/image2.gif) | image001 (244).jpg | 2025-11-21 06:27 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (120).png | 2025-11-21 06:27 | 94K | |
![[IMG]](/icons/image2.gif) | image001 (119).png | 2025-11-21 06:27 | 159K | |
![[ ]](/icons/unknown.gif) | User management fields-1 (2).xlsx | 2025-11-21 06:27 | 13K | |
![[IMG]](/icons/image2.gif) | Capture (9).png | 2025-11-21 06:27 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (118).png | 2025-11-21 06:26 | 209K | |
![[ ]](/icons/unknown.gif) | User management fields blank (2).xlsx | 2025-11-21 06:26 | 17K | |
![[ ]](/icons/unknown.gif) | User management fields-1 (1).xlsx | 2025-11-21 06:26 | 13K | |
![[ ]](/icons/unknown.gif) | Untitled (9) | 2025-11-21 06:26 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (8) | 2025-11-21 06:26 | 0 | |
![[ ]](/icons/unknown.gif) | MERIA FASEBI AVERSI GEOFARMI.xls | 2025-11-21 06:26 | 288K | |
![[ ]](/icons/unknown.gif) | MERIA FASEBI AVERSI FARMA.xls | 2025-11-21 06:26 | 288K | |
![[ ]](/icons/unknown.gif) | MERIA AVERSI-GEOFARMI.xlsx | 2025-11-21 06:26 | 23K | |
![[TXT]](/icons/text.gif) | ATT00003.htm | 2025-11-21 06:26 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002.htm | 2025-11-21 06:26 | 9.2K | |
![[TXT]](/icons/text.gif) | ATT00002 (1).htm | 2025-11-21 06:26 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001.htm | 2025-11-21 06:26 | 13K | |
![[TXT]](/icons/text.gif) | ATT00001 (1).htm | 2025-11-21 06:26 | 216 | |
![[ ]](/icons/unknown.gif) | სერგოს(1).docx | 2025-11-21 06:26 | 146K | |
![[ ]](/icons/unknown.gif) | კლინიკები.xlsx | 2025-11-21 06:26 | 9.9K | |
![[IMG]](/icons/image2.gif) | katastrofa.bmp | 2025-11-21 06:26 | 3.0M | |
![[IMG]](/icons/image2.gif) | image001 (243).jpg | 2025-11-21 06:26 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (117).png | 2025-11-21 06:26 | 94K | |
![[IMG]](/icons/image2.gif) | image001 (116).png | 2025-11-21 06:26 | 94K | |
![[IMG]](/icons/image2.gif) | elene (2).jpg | 2025-11-21 06:26 | 127K | |
![[IMG]](/icons/image2.gif) | elene (1).jpg | 2025-11-21 06:26 | 127K | |
![[ ]](/icons/layout.gif) | eBooks_Quick_Reference_Guide.pdf | 2025-11-21 06:26 | 547K | |
![[ ]](/icons/unknown.gif) | User management fields-1.xlsx | 2025-11-21 06:26 | 12K | |
![[IMG]](/icons/image2.gif) | Untitled (8).png | 2025-11-21 06:26 | 216K | |
![[ ]](/icons/layout.gif) | How to Download Adobe Digital Editions.pdf | 2025-11-21 06:26 | 445K | |
![[ ]](/icons/unknown.gif) | რობლემური მიმართვები 2015 წლის 21 მაისი.xlsx | 2025-11-21 06:26 | 26K | |
![[ ]](/icons/unknown.gif) | კომისიის ოქმის ქუდის ცხრილი.xlsx | 2025-11-21 06:26 | 13K | |
![[ ]](/icons/unknown.gif) | კომისიის ექსპორტის ცხრილი.xlsx | 2025-11-21 06:26 | 8.2K | |
![[ ]](/icons/unknown.gif) | არ ჩანს თანხა.docx | 2025-11-21 06:26 | 232K | |
![[IMG]](/icons/image2.gif) | untitled (6).bmp | 2025-11-21 06:26 | 3.9M | |
![[ ]](/icons/unknown.gif) | psp-s fasebi meriasatvis.xlsx | 2025-11-21 06:26 | 192K | |
![[IMG]](/icons/image2.gif) | image004 (11).png | 2025-11-21 06:26 | 25K | |
![[IMG]](/icons/image2.gif) | image002 (41).png | 2025-11-21 06:26 | 8.1K | |
![[IMG]](/icons/image2.gif) | image002 (40).png | 2025-11-21 06:26 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (242).jpg | 2025-11-21 06:26 | 2.9K | |
![[IMG]](/icons/image2.gif) | image001 (241).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (115).png | 2025-11-21 06:26 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (114).png | 2025-11-21 06:26 | 94K | |
![[ ]](/icons/unknown.gif) | autizmis eleqtronuli (1).docx | 2025-11-21 06:26 | 27K | |
![[ ]](/icons/unknown.gif) | User management fields-1(2)21_05_2015.xlsx | 2025-11-21 06:26 | 11K | |
![[IMG]](/icons/image2.gif) | Untitled.jpg | 2025-11-21 06:26 | 222K | |
![[ ]](/icons/unknown.gif) | Tamar Dolakidze-Experiance.docx | 2025-11-21 06:26 | 13K | |
![[IMG]](/icons/image2.gif) | ATT00002.png | 2025-11-21 06:26 | 3.7K | |
![[IMG]](/icons/image2.gif) | ATT00001 (1).jpg | 2025-11-21 06:26 | 57K | |
![[ ]](/icons/unknown.gif) | კალენდრის ტიპის რეპორტი დანართი N1 (1).xlsx | 2025-11-21 06:26 | 10K | |
![[ ]](/icons/unknown.gif) | ბენეფიციარის კალენდრის ტიპის რეპორტი დანართი N2 (1).xlsx | 2025-11-21 06:26 | 9.0K | |
![[ ]](/icons/unknown.gif) | user - დესკკი.xlsx | 2025-11-21 06:26 | 12K | |
![[ ]](/icons/unknown.gif) | user - ბერძენიშვილი.xlsx | 2025-11-21 06:26 | 12K | |
![[IMG]](/icons/image2.gif) | image007.png | 2025-11-21 06:26 | 67K | |
![[IMG]](/icons/image2.gif) | image006 (5).jpg | 2025-11-21 06:26 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (12).jpg | 2025-11-21 06:26 | 19K | |
![[IMG]](/icons/image2.gif) | image004 (19).jpg | 2025-11-21 06:26 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (15).png | 2025-11-21 06:26 | 30K | |
![[IMG]](/icons/image2.gif) | image002 (158).jpg | 2025-11-21 06:26 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (157).jpg | 2025-11-21 06:26 | 45K | |
![[IMG]](/icons/image2.gif) | image002 (39).png | 2025-11-21 06:26 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (240).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (239).jpg | 2025-11-21 06:26 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (238).jpg | 2025-11-21 06:26 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (113).png | 2025-11-21 06:26 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (112).png | 2025-11-21 06:26 | 208K | |
![[IMG]](/icons/image2.gif) | image001 (111).png | 2025-11-21 06:26 | 118K | |
![[IMG]](/icons/image2.gif) | image001 (110).png | 2025-11-21 06:26 | 94K | |
![[IMG]](/icons/image2.gif) | error (9).png | 2025-11-21 06:26 | 318K | |
![[ ]](/icons/unknown.gif) | User management fields - GPC.xlsx | 2025-11-21 06:26 | 9.8K | |
![[ ]](/icons/unknown.gif) | Untitled (7) | 2025-11-21 06:26 | 0 | |
![[ ]](/icons/unknown.gif) | მედიკამენტები-ქლაუდ.xlsx | 2025-11-21 06:26 | 1.3M | |
![[IMG]](/icons/image2.gif) | ~WRD000 (7).jpg | 2025-11-21 06:26 | 823 | |
![[IMG]](/icons/image2.gif) | untitled (7).PNG | 2025-11-21 06:26 | 16K | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (4).xls | 2025-11-21 06:26 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (237).jpg | 2025-11-21 06:26 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (236).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (235).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (109).png | 2025-11-21 06:26 | 114K | |
![[IMG]](/icons/image2.gif) | image005 (3).png | 2025-11-21 06:26 | 35K | |
![[IMG]](/icons/image2.gif) | image004 (10).png | 2025-11-21 06:26 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (58).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (14).png | 2025-11-21 06:26 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (38).png | 2025-11-21 06:26 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (37).png | 2025-11-21 06:26 | 1.1M | |
![[IMG]](/icons/image2.gif) | image001 (108).png | 2025-11-21 06:26 | 118K | |
![[ ]](/icons/unknown.gif) | Patch 1.sql | 2025-11-21 06:26 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (234).jpg | 2025-11-21 06:26 | 108K | |
![[ ]](/icons/unknown.gif) | ATT10918 | 2025-11-21 06:26 | 0 | |
![[IMG]](/icons/image2.gif) | 3 (4).PNG | 2025-11-21 06:26 | 113K | |
![[IMG]](/icons/image2.gif) | 2 (5).PNG | 2025-11-21 06:26 | 113K | |
![[IMG]](/icons/image2.gif) | 1 (5).PNG | 2025-11-21 06:26 | 111K | |
![[IMG]](/icons/image2.gif) | med (1).png | 2025-11-21 06:26 | 153K | |
![[IMG]](/icons/image2.gif) | image002 (156).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (233).jpg | 2025-11-21 06:26 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (107).png | 2025-11-21 06:26 | 190K | |
![[IMG]](/icons/image2.gif) | filiali.png | 2025-11-21 06:26 | 213K | |
![[IMG]](/icons/image2.gif) | error (8).png | 2025-11-21 06:26 | 306K | |
![[IMG]](/icons/image2.gif) | elene.jpg | 2025-11-21 06:26 | 127K | |
![[IMG]](/icons/image2.gif) | dziritadi.png | 2025-11-21 06:26 | 185K | |
![[IMG]](/icons/image2.gif) | Untitled (6).png | 2025-11-21 06:26 | 297K | |
![[IMG]](/icons/image2.gif) | image001 (232).jpg | 2025-11-21 06:26 | 4.2K | |
![[ ]](/icons/unknown.gif) | SQL.rar | 2025-11-21 06:26 | 2.2M | |
![[IMG]](/icons/image2.gif) | C.PNG | 2025-11-21 06:26 | 118K | |
![[ ]](/icons/unknown.gif) | Billing_Templates_Db_Agwera.xlsx | 2025-11-21 06:26 | 12K | |
![[IMG]](/icons/image2.gif) | 4 (1).PNG | 2025-11-21 06:26 | 97K | |
![[IMG]](/icons/image2.gif) | 3 (3).PNG | 2025-11-21 06:26 | 93K | |
![[IMG]](/icons/image2.gif) | 2 (4).PNG | 2025-11-21 06:26 | 83K | |
![[IMG]](/icons/image2.gif) | 1 (4).PNG | 2025-11-21 06:26 | 96K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (6).xlsx | 2025-11-21 06:26 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (155).jpg | 2025-11-21 06:26 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (154).jpg | 2025-11-21 06:26 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (153).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (231).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (230).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (229).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (106).png | 2025-11-21 06:26 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (105).png | 2025-11-21 06:26 | 195K | |
![[ ]](/icons/unknown.gif) | ATT90262 | 2025-11-21 06:26 | 0 | |
![[ ]](/icons/unknown.gif) | ATT80966 | 2025-11-21 06:26 | 0 | |
![[ ]](/icons/unknown.gif) | ATT79871 | 2025-11-21 06:26 | 0 | |
![[IMG]](/icons/image2.gif) | ადოს (3).png | 2025-11-21 06:26 | 199K | |
![[IMG]](/icons/image2.gif) | mimarTvebi.png | 2025-11-21 06:26 | 165K | |
![[IMG]](/icons/image2.gif) | image001 (228).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (227).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (226).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (225).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (224).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (223).jpg | 2025-11-21 06:26 | 4.2K | |
![[ ]](/icons/unknown.gif) | gauqmeba.xlsx | 2025-11-21 06:26 | 12K | |
![[IMG]](/icons/image2.gif) | case (1).png | 2025-11-21 06:26 | 162K | |
![[IMG]](/icons/image2.gif) | beneficiary.png | 2025-11-21 06:26 | 191K | |
![[IMG]](/icons/image2.gif) | 218.png | 2025-11-21 06:26 | 188K | |
![[IMG]](/icons/image2.gif) | image006 (2).png | 2025-11-21 06:26 | 17K | |
![[IMG]](/icons/image2.gif) | image005 (2).png | 2025-11-21 06:26 | 151K | |
![[IMG]](/icons/image2.gif) | image001 (222).jpg | 2025-11-21 06:26 | 29K | |
![[IMG]](/icons/image2.gif) | error (7).png | 2025-11-21 06:26 | 178K | |
![[IMG]](/icons/image2.gif) | image001 (221).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (220).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (219).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (218).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (217).jpg | 2025-11-21 06:26 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (216).jpg | 2025-11-21 06:26 | 16K | |
![[ ]](/icons/unknown.gif) | autizmis eleqtronuli.docx | 2025-11-21 06:26 | 27K | |
![[ ]](/icons/unknown.gif) | Untitled (6) | 2025-11-21 06:26 | 0 | |
![[IMG]](/icons/image2.gif) | Image (7).jpg | 2025-11-21 06:26 | 536K | |
![[ ]](/icons/unknown.gif) | კალენდრის ტიპის რეპორტი დანართი N1.xlsx | 2025-11-21 06:26 | 10K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (5).xlsx | 2025-11-21 06:26 | 12K | |
![[ ]](/icons/unknown.gif) | ბენეფიციარის კალენდრის ტიპის რეპორტი დანართი N2.xlsx | 2025-11-21 06:26 | 9.0K | |
![[IMG]](/icons/image2.gif) | image003 (57).jpg | 2025-11-21 06:26 | 34K | |
![[IMG]](/icons/image2.gif) | image002 (36).png | 2025-11-21 06:26 | 32K | |
![[IMG]](/icons/image2.gif) | image002 (35).png | 2025-11-21 06:26 | 94K | |
![[IMG]](/icons/image2.gif) | image001 (215).jpg | 2025-11-21 06:26 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (214).jpg | 2025-11-21 06:26 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (213).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (212).jpg | 2025-11-21 06:26 | 34K | |
![[IMG]](/icons/image2.gif) | image001 (211).jpg | 2025-11-21 06:26 | 4.2K | |
![[ ]](/icons/unknown.gif) | Untitled (5) | 2025-11-21 06:26 | 0 | |
![[ ]](/icons/unknown.gif) | TaskList_2015 04 17.docx | 2025-11-21 06:26 | 158K | |
![[ ]](/icons/unknown.gif) | 2015 05 20- done.docx | 2025-11-21 06:26 | 67K | |
![[ ]](/icons/unknown.gif) | 2015 05 13 done.docx | 2025-11-21 06:26 | 934K | |
![[ ]](/icons/unknown.gif) | წვდომები done.docx | 2025-11-21 06:26 | 13K | |
![[ ]](/icons/unknown.gif) | პრობლემები კომისია 2000მდე.xlsx | 2025-11-21 06:26 | 19K | |
![[ ]](/icons/unknown.gif) | მიმწოდებლები (1).xlsx | 2025-11-21 06:26 | 8.7K | |
![[ ]](/icons/unknown.gif) | გვერდითი ეფექტები და ბედაქილინი.docx | 2025-11-21 06:26 | 68K | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (3).xls | 2025-11-21 06:26 | 27K | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (2).xls | 2025-11-21 06:26 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (210).jpg | 2025-11-21 06:26 | 4.2K | |
![[ ]](/icons/unknown.gif) | მარაგების მართვის მოდული.docx | 2025-11-21 06:26 | 1.9M | |
![[ ]](/icons/unknown.gif) | იმუნიზაციის სახელმძღვანელო სჯც ცენტრებისათვის (1).docx | 2025-11-21 06:26 | 501K | |
![[ ]](/icons/unknown.gif) | იმუნიზაცია_მომხმარებლის სახელმძღვანელო ბოლო (2) (1).docx | 2025-11-21 06:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | იმუნიზაცია_ ადმინისტრატორის სახელმძღვანელო2015.docx | 2025-11-21 06:26 | 1.2M | |
![[IMG]](/icons/image2.gif) | image002 (34).png | 2025-11-21 06:26 | 94K | |
![[IMG]](/icons/image2.gif) | image002 (33).png | 2025-11-21 06:26 | 94K | |
![[IMG]](/icons/image2.gif) | image001 (209).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (208).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (207).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (206).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (205).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (204).jpg | 2025-11-21 06:26 | 34K | |
![[IMG]](/icons/image2.gif) | image001 (203).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (202).jpg | 2025-11-21 06:26 | 34K | |
![[ ]](/icons/unknown.gif) | User management fields (6).xlsx | 2025-11-21 06:26 | 14K | |
![[ ]](/icons/layout.gif) | Kakhniashvili Tamila.pdf | 2025-11-21 06:26 | 187K | |
![[ ]](/icons/layout.gif) | Kachlishvili Giorgi.pdf | 2025-11-21 06:26 | 184K | |
![[ ]](/icons/layout.gif) | Davitashvili Marine.pdf | 2025-11-21 06:26 | 185K | |
![[IMG]](/icons/image2.gif) | image001 (201).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (104).png | 2025-11-21 06:26 | 17K | |
![[ ]](/icons/unknown.gif) | Providers (1).xlsx | 2025-11-21 06:26 | 1.3M | |
![[ ]](/icons/unknown.gif) | მედიკამენტები შაბლონი.xlsx | 2025-11-21 06:26 | 835K | |
![[IMG]](/icons/image2.gif) | image005 (1).png | 2025-11-21 06:26 | 558K | |
![[IMG]](/icons/image2.gif) | image004 (18).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (13).png | 2025-11-21 06:26 | 206K | |
![[IMG]](/icons/image2.gif) | image002 (152).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (200).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (103).png | 2025-11-21 06:26 | 558K | |
![[IMG]](/icons/image2.gif) | 2 (3).png | 2025-11-21 06:26 | 336K | |
![[IMG]](/icons/image2.gif) | 1 (3).png | 2025-11-21 06:26 | 222K | |
![[IMG]](/icons/image2.gif) | ჰეპატიტი.bmp | 2025-11-21 06:26 | 3.7M | |
![[IMG]](/icons/image2.gif) | image008.png | 2025-11-21 06:26 | 15K | |
![[IMG]](/icons/image2.gif) | image007 (4).jpg | 2025-11-21 06:26 | 8.9K | |
![[IMG]](/icons/image2.gif) | image006 (4).jpg | 2025-11-21 06:26 | 6.9K | |
![[IMG]](/icons/image2.gif) | image005 (11).jpg | 2025-11-21 06:26 | 19K | |
![[IMG]](/icons/image2.gif) | image004 (17).jpg | 2025-11-21 06:26 | 23K | |
![[IMG]](/icons/image2.gif) | image002 (151).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (150).jpg | 2025-11-21 06:26 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (32).png | 2025-11-21 06:26 | 154K | |
![[IMG]](/icons/image2.gif) | image001 (102).png | 2025-11-21 06:26 | 220K | |
![[IMG]](/icons/image2.gif) | image001 (101).png | 2025-11-21 06:26 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (100).png | 2025-11-21 06:26 | 7.7K | |
![[ ]](/icons/unknown.gif) | User management fields-1-5 (2).xlsx | 2025-11-21 06:26 | 11K | |
![[IMG]](/icons/image2.gif) | Gunashvili Raisa 2gv.jpg | 2025-11-21 06:26 | 261K | |
![[IMG]](/icons/image2.gif) | Gunashvili Raisa 1gv.jpg | 2025-11-21 06:26 | 356K | |
![[IMG]](/icons/image2.gif) | Gunashvili Raisa - piradoba.jpg | 2025-11-21 06:26 | 172K | |
![[IMG]](/icons/image2.gif) | Gunashvili Raisa - oqmi 2gv.jpg | 2025-11-21 06:26 | 247K | |
![[IMG]](/icons/image2.gif) | Gunashvili Raisa - oqmi 1gv.jpg | 2025-11-21 06:26 | 563K | |
![[IMG]](/icons/image2.gif) | GunaSvili Raisa.jpg | 2025-11-21 06:26 | 251K | |
![[IMG]](/icons/image2.gif) | image002 (31).png | 2025-11-21 06:26 | 154K | |
![[IMG]](/icons/image2.gif) | image001 (199).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (99).png | 2025-11-21 06:26 | 60K | |
![[IMG]](/icons/image2.gif) | error (6).png | 2025-11-21 06:26 | 196K | |
![[ ]](/icons/unknown.gif) | User management fields-1-5 (1).xlsx | 2025-11-21 06:26 | 11K | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (2).pdf | 2025-11-21 06:26 | 388K | |
![[IMG]](/icons/image2.gif) | IMG_08062015_185440.png | 2025-11-21 06:26 | 99K | |
![[ ]](/icons/unknown.gif) | აუტიზმი usaid.docx | 2025-11-21 06:26 | 34K | |
![[IMG]](/icons/image2.gif) | sms.png | 2025-11-21 06:26 | 149K | |
![[IMG]](/icons/image2.gif) | image002 (149).jpg | 2025-11-21 06:26 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (198).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (197).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (196).jpg | 2025-11-21 06:26 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (195).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | cloud.png | 2025-11-21 06:26 | 295K | |
![[IMG]](/icons/image2.gif) | case.png | 2025-11-21 06:26 | 222K | |
![[IMG]](/icons/image2.gif) | billing.png | 2025-11-21 06:26 | 214K | |
![[ ]](/icons/unknown.gif) | HospitalizationDays.xlsx | 2025-11-21 06:26 | 10K | |
![[ ]](/icons/unknown.gif) | შპს გლობალმედი.xlsx | 2025-11-21 06:26 | 15K | |
![[ ]](/icons/unknown.gif) | შპს ბავშვთა საავადმყოფო_.xlsx | 2025-11-21 06:26 | 15K | |
![[ ]](/icons/unknown.gif) | მერიის რეცეპტის სერვისის აღწერა (1).docx | 2025-11-21 06:26 | 21K | |
![[ ]](/icons/unknown.gif) | დუბლირებული ბენეფიციარები.xlsx | 2025-11-21 06:26 | 911K | |
![[ ]](/icons/unknown.gif) | დუბლირებული ბენეფიციარები (1).xlsx | 2025-11-21 06:26 | 965K | |
![[ ]](/icons/unknown.gif) | user - ქამუშაძე.xlsx | 2025-11-21 06:26 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (16).jpg | 2025-11-21 06:26 | 452 | |
![[IMG]](/icons/image2.gif) | image004 (15).jpg | 2025-11-21 06:26 | 452 | |
![[IMG]](/icons/image2.gif) | image003 (56).jpg | 2025-11-21 06:26 | 416 | |
![[IMG]](/icons/image2.gif) | image003 (55).jpg | 2025-11-21 06:26 | 416 | |
![[IMG]](/icons/image2.gif) | image002 (148).jpg | 2025-11-21 06:26 | 413 | |
![[IMG]](/icons/image2.gif) | image002 (147).jpg | 2025-11-21 06:26 | 413 | |
![[IMG]](/icons/image2.gif) | image001 (194).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (193).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (192).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (191).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (190).jpg | 2025-11-21 06:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (98).png | 2025-11-21 06:26 | 283K | |
![[IMG]](/icons/image2.gif) | image001 (97).png | 2025-11-21 06:26 | 283K | |
![[IMG]](/icons/image2.gif) | gadagzavnilia.png | 2025-11-21 06:26 | 214K | |
![[IMG]](/icons/image2.gif) | 3 (2).png | 2025-11-21 06:26 | 281K | |
![[IMG]](/icons/image2.gif) | 2 (2).png | 2025-11-21 06:26 | 211K | |
![[ ]](/icons/unknown.gif) | იმუნიზაცია_მომხმარებლის სახელმძღვანელო ბოლო (2).docx | 2025-11-21 06:26 | 1.3M | |
![[ ]](/icons/unknown.gif) | დანართი (1).xlsx | 2025-11-21 06:26 | 11K | |
![[IMG]](/icons/image2.gif) | image007 (3).gif | 2025-11-21 06:25 | 5.8K | |
![[IMG]](/icons/image2.gif) | image006 (5).gif | 2025-11-21 06:25 | 5.8K | |
![[IMG]](/icons/image2.gif) | image006 (4).gif | 2025-11-21 06:25 | 73 | |
![[IMG]](/icons/image2.gif) | image005 (11).gif | 2025-11-21 06:25 | 73 | |
![[IMG]](/icons/image2.gif) | image005 (10).gif | 2025-11-21 06:25 | 5.8K | |
![[IMG]](/icons/image2.gif) | image004 (9).gif | 2025-11-21 06:25 | 73 | |
![[IMG]](/icons/image2.gif) | image002 (30).png | 2025-11-21 06:25 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (189).jpg | 2025-11-21 06:25 | 4.2K | |
![[ ]](/icons/unknown.gif) | ePrescription Service Documentation for Tbilisi City Hall - v1.docx | 2025-11-21 06:25 | 21K | |
![[ ]](/icons/unknown.gif) | NotSentSms.xlsx | 2025-11-21 06:25 | 8.4K | |
![[ ]](/icons/unknown.gif) | ATT23302 | 2025-11-21 06:25 | 0 | |
![[IMG]](/icons/image2.gif) | image005 (9).gif | 2025-11-21 06:25 | 5.8K | |
![[IMG]](/icons/image2.gif) | image004 (8).gif | 2025-11-21 06:25 | 73 | |
![[IMG]](/icons/image2.gif) | image003 (11).gif | 2025-11-21 06:25 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (188).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (187).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (96).png | 2025-11-21 06:25 | 63K | |
![[ ]](/icons/unknown.gif) | filialebis modultanwvdoma (1).xlsx | 2025-11-21 06:25 | 9.6K | |
![[ ]](/icons/unknown.gif) | error19 -11_06_2015-14_10.docx | 2025-11-21 06:25 | 14K | |
![[ ]](/icons/unknown.gif) | 11_06_2015 მიმწოდებლები.docx | 2025-11-21 06:25 | 31K | |
![[ ]](/icons/unknown.gif) | 11_06_2015 ადმინისტრატორი.docx | 2025-11-21 06:25 | 39K | |
![[ ]](/icons/unknown.gif) | ჰეპატიტის ფორმები მერია.xlsx | 2025-11-21 06:25 | 38K | |
![[ ]](/icons/unknown.gif) | დიალიზის სტატისტიკა.xlsx | 2025-11-21 06:25 | 9.4K | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik piri (2).xls | 2025-11-21 06:25 | 35K | |
![[IMG]](/icons/image2.gif) | image002 (146).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (186).jpg | 2025-11-21 06:25 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (185).jpg | 2025-11-21 06:25 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (95).png | 2025-11-21 06:25 | 226K | |
![[ ]](/icons/unknown.gif) | სჯც-ები.xlsx | 2025-11-21 06:25 | 29K | |
![[ ]](/icons/unknown.gif) | დანართი 12_06_2015.xlsx | 2025-11-21 06:25 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (145).jpg | 2025-11-21 06:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (184).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (183).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (182).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (181).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (180).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (94).png | 2025-11-21 06:25 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (93).png | 2025-11-21 06:25 | 95K | |
![[ ]](/icons/layout.gif) | ATLAS Compensation Statement Access Instructions.pdf | 2025-11-21 06:25 | 383K | |
![[IMG]](/icons/image2.gif) | image002 (144).jpg | 2025-11-21 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (179).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (178).jpg | 2025-11-21 06:25 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (177).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (92).png | 2025-11-21 06:25 | 43K | |
![[ ]](/icons/unknown.gif) | Untitled (4) | 2025-11-21 06:25 | 512 | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალება-09 06 2015-ncdc.docx | 2025-11-21 06:25 | 128K | |
![[IMG]](/icons/image2.gif) | image002 (143).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (91).png | 2025-11-21 06:25 | 265K | |
![[VID]](/icons/movie.gif) | mariam.avi | 2025-11-21 06:25 | 8.7M | |
![[IMG]](/icons/image2.gif) | image002 (142).jpg | 2025-11-21 06:25 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (176).jpg | 2025-11-21 06:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (175).jpg | 2025-11-21 06:25 | 4.2K | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალების ცნობის სტატუსები (4).docx | 2025-11-21 06:25 | 24K | |
![[IMG]](/icons/image2.gif) | shetyobinebis gagzavnis dros.png | 2025-11-21 06:25 | 163K | |
![[IMG]](/icons/image2.gif) | image001 (174).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (173).jpg | 2025-11-21 06:25 | 4.2K | |
![[ ]](/icons/unknown.gif) | error (1).docx | 2025-11-21 06:25 | 235K | |
![[IMG]](/icons/image2.gif) | er (1).png | 2025-11-21 06:25 | 203K | |
![[IMG]](/icons/image2.gif) | dasaxeleba_.png | 2025-11-21 06:25 | 165K | |
![[IMG]](/icons/image2.gif) | კალკულაციის გვერდის შენახვის დროს.png | 2025-11-21 06:25 | 160K | |
![[IMG]](/icons/image2.gif) | sms_.png | 2025-11-21 06:25 | 239K | |
![[IMG]](/icons/image2.gif) | image001 (172).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (171).jpg | 2025-11-21 06:25 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (90).png | 2025-11-21 06:25 | 225K | |
![[IMG]](/icons/image2.gif) | image001 (89).png | 2025-11-21 06:25 | 16K | |
![[ ]](/icons/unknown.gif) | იმუნიზციის სახელმძღვანელო 2015 (1).docx | 2025-11-21 06:25 | 1.1M | |
![[IMG]](/icons/image2.gif) | image003 (54).jpg | 2025-11-21 06:25 | 29K | |
![[IMG]](/icons/image2.gif) | image002 (141).jpg | 2025-11-21 06:25 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (170).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (169).jpg | 2025-11-21 06:25 | 29K | |
![[IMG]](/icons/image2.gif) | image002 (29).png | 2025-11-21 06:25 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (168).jpg | 2025-11-21 06:25 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (167).jpg | 2025-11-21 06:25 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (166).jpg | 2025-11-21 06:25 | 4.2K | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალების ცნობის სტატუსები (3).docx | 2025-11-21 06:25 | 25K | |
![[ ]](/icons/unknown.gif) | status_cross (1).xlsx | 2025-11-21 06:25 | 11K | |
![[IMG]](/icons/image2.gif) | image003 (53).jpg | 2025-11-21 06:25 | 29K | |
![[IMG]](/icons/image2.gif) | image002 (140).jpg | 2025-11-21 06:25 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (165).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (164).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (163).jpg | 2025-11-21 06:25 | 45K | |
![[ ]](/icons/unknown.gif) | c_hepatitis_kodebi.xlsx | 2025-11-21 06:25 | 12K | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალების ცნობის სტატუსები (2).docx | 2025-11-21 06:25 | 25K | |
![[IMG]](/icons/image2.gif) | image006 (1).png | 2025-11-21 06:25 | 24K | |
![[IMG]](/icons/image2.gif) | image005.png | 2025-11-21 06:25 | 23K | |
![[IMG]](/icons/image2.gif) | image004 (7).gif | 2025-11-21 06:25 | 3.5K | |
![[IMG]](/icons/image2.gif) | image004 (6).gif | 2025-11-21 06:25 | 3.5K | |
![[IMG]](/icons/image2.gif) | image003 (52).jpg | 2025-11-21 06:25 | 29K | |
![[IMG]](/icons/image2.gif) | image003 (51).jpg | 2025-11-21 06:25 | 411 | |
![[IMG]](/icons/image2.gif) | image003 (50).jpg | 2025-11-21 06:25 | 411 | |
![[IMG]](/icons/image2.gif) | image003 (12).png | 2025-11-21 06:25 | 79K | |
![[IMG]](/icons/image2.gif) | image002 (139).jpg | 2025-11-21 06:25 | 41K | |
![[IMG]](/icons/image2.gif) | image002 (138).jpg | 2025-11-21 06:25 | 423 | |
![[IMG]](/icons/image2.gif) | image002 (137).jpg | 2025-11-21 06:25 | 423 | |
![[IMG]](/icons/image2.gif) | image002 (136).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (162).jpg | 2025-11-21 06:25 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (161).jpg | 2025-11-21 06:25 | 406 | |
![[IMG]](/icons/image2.gif) | image001 (160).jpg | 2025-11-21 06:25 | 406 | |
![[IMG]](/icons/image2.gif) | image001 (88).png | 2025-11-21 06:25 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (87).png | 2025-11-21 06:25 | 115K | |
![[IMG]](/icons/image2.gif) | image001 (86).png | 2025-11-21 06:25 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (85).png | 2025-11-21 06:25 | 16K | |
![[ ]](/icons/unknown.gif) | error.docx | 2025-11-21 06:25 | 238K | |
![[ ]](/icons/unknown.gif) | c hepatitis monitoringisforma (2).xlsx | 2025-11-21 06:25 | 15K | |
![[ ]](/icons/unknown.gif) | SSA_ monitoring form_15 06_nfinal.doc | 2025-11-21 06:25 | 131K | |
![[ ]](/icons/unknown.gif) | D&D_Call_for_Applications_FallFY16.doc | 2025-11-21 06:25 | 80K | |
![[ ]](/icons/unknown.gif) | D&D_Call_for_Applications_FallFY16 (1).doc | 2025-11-21 06:25 | 80K | |
![[ ]](/icons/unknown.gif) | D&D Application Fall FY16.docx | 2025-11-21 06:25 | 21K | |
![[ ]](/icons/unknown.gif) | D&D Application Fall FY16 (1).docx | 2025-11-21 06:25 | 21K | |
![[ ]](/icons/unknown.gif) | user - 1906 (1).xlsx | 2025-11-21 06:25 | 12K | |
![[IMG]](/icons/image2.gif) | sms ar igzavneba.png | 2025-11-21 06:25 | 225K | |
![[IMG]](/icons/image2.gif) | image003 (49).jpg | 2025-11-21 06:25 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (135).jpg | 2025-11-21 06:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (28).png | 2025-11-21 06:25 | 108K | |
![[IMG]](/icons/image2.gif) | image001 (159).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (158).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (157).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (84).png | 2025-11-21 06:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | ფორმა N IV-025.docx | 2025-11-21 06:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | რეპორტები.rar | 2025-11-21 06:25 | 60K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (4).xlsx | 2025-11-21 06:25 | 12K | |
![[IMG]](/icons/image2.gif) | image005 (10).jpg | 2025-11-21 06:25 | 6.5K | |
![[IMG]](/icons/image2.gif) | image003 (11).png | 2025-11-21 06:25 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (134).jpg | 2025-11-21 06:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (133).jpg | 2025-11-21 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (156).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (83).png | 2025-11-21 06:25 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (82).png | 2025-11-21 06:25 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (81).png | 2025-11-21 06:25 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (80).png | 2025-11-21 06:25 | 203K | |
![[ ]](/icons/unknown.gif) | Med Tables (2).docx | 2025-11-21 06:25 | 20K | |
![[ ]](/icons/unknown.gif) | MedCertificatesTables (2).rar | 2025-11-21 06:25 | 1.2M | |
![[ ]](/icons/unknown.gif) | ATT53231 | 2025-11-21 06:25 | 0 | |
![[ ]](/icons/unknown.gif) | ATT01986 | 2025-11-21 06:25 | 0 | |
![[ ]](/icons/unknown.gif) | pirveladi skriningi (1).xlsx | 2025-11-21 06:25 | 45K | |
![[ ]](/icons/unknown.gif) | meriis kodebi (1).xlsx | 2025-11-21 06:25 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (155).jpg | 2025-11-21 06:25 | 823 | |
![[IMG]](/icons/image2.gif) | ხელოვნური კოდი.png | 2025-11-21 06:25 | 251K | |
![[IMG]](/icons/image2.gif) | ქლაუდი.png | 2025-11-21 06:25 | 247K | |
![[IMG]](/icons/image2.gif) | ფინანსური 36.png | 2025-11-21 06:25 | 207K | |
![[IMG]](/icons/image2.gif) | ფინანსური.png | 2025-11-21 06:25 | 218K | |
![[IMG]](/icons/image2.gif) | image001 (154).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (153).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | Sagarantioze.PNG | 2025-11-21 06:25 | 129K | |
![[ ]](/icons/unknown.gif) | იმუნიზციის სახელმძღვანელო 2015.docx | 2025-11-21 06:25 | 1.1M | |
![[ ]](/icons/unknown.gif) | დანართი #1 (3).xlsx | 2025-11-21 06:25 | 12K | |
![[ ]](/icons/unknown.gif) | meriis kodebi.xlsx | 2025-11-21 06:25 | 12K | |
![[ ]](/icons/unknown.gif) | სამშობიარო დაწესებულება (2).xlsx | 2025-11-21 06:25 | 11K | |
![[ ]](/icons/unknown.gif) | სამშობიარო დაწესებულება (1).xlsx | 2025-11-21 06:25 | 11K | |
![[ ]](/icons/unknown.gif) | დაწესებულებების ჩამონათვალი_ძველი თბილისი.docx | 2025-11-21 06:25 | 14K | |
![[ ]](/icons/unknown.gif) | mimartvebi.xlsx | 2025-11-21 06:25 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (132).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (131).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (79).png | 2025-11-21 06:25 | 276K | |
![[IMG]](/icons/image2.gif) | image001 (78).png | 2025-11-21 06:25 | 276K | |
![[IMG]](/icons/image2.gif) | iashvili cloud.png | 2025-11-21 06:25 | 217K | |
![[IMG]](/icons/image2.gif) | iashvili bill.png | 2025-11-21 06:25 | 229K | |
![[IMG]](/icons/image2.gif) | iashvili 1.png | 2025-11-21 06:25 | 279K | |
![[IMG]](/icons/image2.gif) | image003 (48).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (130).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (27).png | 2025-11-21 06:25 | 6.5K | |
![[IMG]](/icons/image2.gif) | image002 (26).png | 2025-11-21 06:25 | 6.5K | |
![[IMG]](/icons/image2.gif) | image001 (152).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (151).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (150).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (77).png | 2025-11-21 06:25 | 276K | |
![[IMG]](/icons/image2.gif) | პაროლის შეცვლა.png | 2025-11-21 06:25 | 119K | |
![[ ]](/icons/unknown.gif) | იმუნიზციის სახელმძღვანელო 2015 last.docx | 2025-11-21 06:25 | 1.3M | |
![[ ]](/icons/unknown.gif) | იმუნიზაციის სახელმძღვანელო სჯც ცენტრებისათვის.docx | 2025-11-21 06:25 | 501K | |
![[IMG]](/icons/image2.gif) | image002 (25).png | 2025-11-21 06:25 | 6.5K | |
![[IMG]](/icons/image2.gif) | image001 (149).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (148).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (14).jpg | 2025-11-21 06:25 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (24).png | 2025-11-21 06:25 | 6.5K | |
![[IMG]](/icons/image2.gif) | image001 (147).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (146).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (145).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (144).jpg | 2025-11-21 06:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (26).gif | 2025-11-21 06:25 | 32K | |
![[ ]](/icons/unknown.gif) | იმუნიზაციის სახელმძღვანელო სჯც ცენტრებისათვის_2015_06_23_თკ (1).docx | 2025-11-21 06:25 | 523K | |
![[ ]](/icons/unknown.gif) | აუტიზმი სიები პროვაიდერისგან.xlsx | 2025-11-21 06:25 | 25K | |
![[ ]](/icons/unknown.gif) | pirveladi skriningi.xlsx | 2025-11-21 06:25 | 45K | |
![[IMG]](/icons/image2.gif) | image003 (10).png | 2025-11-21 06:25 | 67K | |
![[IMG]](/icons/image2.gif) | image002 (129).jpg | 2025-11-21 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (143).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (142).jpg | 2025-11-21 06:25 | 4.2K | |
![[ ]](/icons/unknown.gif) | User management fieldsdavinchi -Copy - Copy.xlsx | 2025-11-21 06:25 | 14K | |
![[ ]](/icons/unknown.gif) | User management fields24_06_15 -Copy - Copy.xlsx | 2025-11-21 06:25 | 14K | |
![[ ]](/icons/unknown.gif) | Doc1 (1).docx | 2025-11-21 06:25 | 171K | |
![[IMG]](/icons/image2.gif) | DUBLIREBA.png | 2025-11-21 06:25 | 211K | |
![[ ]](/icons/unknown.gif) | იმუნიზაციის სახელმძღვანელო სჯც ცენტრებისათვის_2015_06_23_თკ last.docx | 2025-11-21 06:25 | 602K | |
![[IMG]](/icons/image2.gif) | medikamenti_2 (2).PNG | 2025-11-21 06:25 | 3.8M | |
![[IMG]](/icons/image2.gif) | medikamenti_1 (2).PNG | 2025-11-21 06:25 | 124K | |
![[IMG]](/icons/image2.gif) | image002 (128).jpg | 2025-11-21 06:25 | 13K | |
![[ ]](/icons/unknown.gif) | Doc2.docx | 2025-11-21 06:25 | 174K | |
![[ ]](/icons/unknown.gif) | xarvezi.docx | 2025-11-21 06:25 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (76).png | 2025-11-21 06:25 | 664 | |
![[ ]](/icons/unknown.gif) | UserManagmentFields.xlsx | 2025-11-21 06:25 | 9.3K | |
![[ ]](/icons/unknown.gif) | Providers.xlsx | 2025-11-21 06:25 | 1.3M | |
![[ ]](/icons/unknown.gif) | DialysisExcel 2013.xlsx | 2025-11-21 06:25 | 16M | |
![[ ]](/icons/unknown.gif) | ATT30477 | 2025-11-21 06:25 | 0 | |
![[ ]](/icons/unknown.gif) | user - 25062.xlsx | 2025-11-21 06:25 | 12K | |
![[ ]](/icons/unknown.gif) | user - 2506.xlsx | 2025-11-21 06:25 | 12K | |
![[IMG]](/icons/image2.gif) | komisiis gadacyvetilebis forma (1).png | 2025-11-21 06:25 | 326K | |
![[IMG]](/icons/image2.gif) | image003 (47).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (127).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (126).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (23).png | 2025-11-21 06:25 | 7.0K | |
![[IMG]](/icons/image2.gif) | image001 (141).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (75).png | 2025-11-21 06:25 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (74).png | 2025-11-21 06:25 | 154K | |
![[IMG]](/icons/image2.gif) | image001 (73).png | 2025-11-21 06:25 | 154K | |
![[ ]](/icons/unknown.gif) | c hepatitis monitoringisforma (1).xlsx | 2025-11-21 06:25 | 15K | |
![[ ]](/icons/unknown.gif) | user - 1906.xlsx | 2025-11-21 06:25 | 12K | |
![[IMG]](/icons/image2.gif) | medikamenti_2 (1).PNG | 2025-11-21 06:25 | 3.8M | |
![[IMG]](/icons/image2.gif) | medikamenti_1 (1).PNG | 2025-11-21 06:25 | 124K | |
![[IMG]](/icons/image2.gif) | komisiis gadacyvetilebis forma.png | 2025-11-21 06:25 | 326K | |
![[IMG]](/icons/image2.gif) | image004 (9).png | 2025-11-21 06:25 | 118K | |
![[IMG]](/icons/image2.gif) | image003 (46).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (45).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (22).png | 2025-11-21 06:25 | 118K | |
![[IMG]](/icons/image2.gif) | image001 (72).png | 2025-11-21 06:25 | 99K | |
![[IMG]](/icons/image2.gif) | image004 (8).png | 2025-11-21 06:25 | 186K | |
![[IMG]](/icons/image2.gif) | image003 (9).png | 2025-11-21 06:25 | 118K | |
![[IMG]](/icons/image2.gif) | image002 (125).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (71).png | 2025-11-21 06:25 | 99K | |
![[IMG]](/icons/image2.gif) | image001 (140).jpg | 2025-11-21 06:25 | 4.2K | |
![[ ]](/icons/unknown.gif) | ATT70699 | 2025-11-21 06:25 | 0 | |
![[ ]](/icons/unknown.gif) | ATT64696 | 2025-11-21 06:25 | 0 | |
![[ ]](/icons/unknown.gif) | ATT13159 | 2025-11-21 06:25 | 0 | |
![[ ]](/icons/unknown.gif) | მედიკამენტები.xlsx | 2025-11-21 06:25 | 108K | |
![[IMG]](/icons/image2.gif) | medikamenti_2.PNG | 2025-11-21 06:25 | 3.8M | |
![[IMG]](/icons/image2.gif) | image001 (139).jpg | 2025-11-21 06:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | medikamenti_1.PNG | 2025-11-21 06:24 | 124K | |
![[IMG]](/icons/image2.gif) | image007 (3).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image006 (3).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image005 (9).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image004 (13).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image004 (12).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image003 (44).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image002 (124).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (138).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | untitled (5).bmp | 2025-11-21 06:24 | 4.1M | |
![[IMG]](/icons/image2.gif) | image004 (11).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image004 (10).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image004 (9).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image004 (8).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image003 (43).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image003 (42).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image003 (41).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image003 (40).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image002 (123).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image002 (122).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image002 (121).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image002 (120).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image001 (137).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (136).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (135).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (134).jpg | 2025-11-21 06:24 | 41K | |
![[ ]](/icons/unknown.gif) | _დანართი - მიღება-ჩაბარების აქტი.xls | 2025-11-21 06:24 | 26K | |
![[IMG]](/icons/image2.gif) | Untitled (5).png | 2025-11-21 06:24 | 86K | |
![[ ]](/icons/unknown.gif) | დანართი 11.xls | 2025-11-21 06:24 | 34K | |
![[ ]](/icons/unknown.gif) | user - ყურაშვილი.xlsx | 2025-11-21 06:24 | 12K | |
![[IMG]](/icons/image2.gif) | image009 (1).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image008 (1).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image007 (2).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image006 (2).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image005 (8).jpg | 2025-11-21 06:24 | 50K | |
![[IMG]](/icons/image2.gif) | image005 (7).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image004 (7).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image003 (39).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image002 (119).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (133).jpg | 2025-11-21 06:24 | 50K | |
![[IMG]](/icons/image2.gif) | image002 (118).jpg | 2025-11-21 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (132).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (131).jpg | 2025-11-21 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (70).png | 2025-11-21 06:24 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (69).png | 2025-11-21 06:24 | 25K | |
![[ ]](/icons/unknown.gif) | User management fields blank (1).xlsx | 2025-11-21 06:24 | 15K | |
![[ ]](/icons/unknown.gif) | MERFASGL-AVERSI-GEOFARMI (1).xls | 2025-11-21 06:24 | 353K | |
![[ ]](/icons/unknown.gif) | MERFASGL-AVERSI-FARMA (1).xls | 2025-11-21 06:24 | 359K | |
![[ ]](/icons/unknown.gif) | წამლების ბაზა (1).xlsx | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image005 (6).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image005 (5).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image005 (4).jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image004 (6).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image004 (5).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image004 (4).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image003 (38).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image003 (37).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image003 (36).jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image002 (117).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image002 (116).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image002 (115).jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (130).jpg | 2025-11-21 06:24 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (129).jpg | 2025-11-21 06:24 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (128).jpg | 2025-11-21 06:24 | 50K | |
![[ ]](/icons/unknown.gif) | User management 29_092015 - Copy- Copy.xlsx | 2025-11-21 06:24 | 14K | |
![[IMG]](/icons/image2.gif) | medikamenti.bmp | 2025-11-21 06:24 | 4.1M | |
![[IMG]](/icons/image2.gif) | image011.jpg | 2025-11-21 06:24 | 29K | |
![[IMG]](/icons/image2.gif) | image010.jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image009.jpg | 2025-11-21 06:24 | 45K | |
![[IMG]](/icons/image2.gif) | image008.jpg | 2025-11-21 06:24 | 41K | |
![[IMG]](/icons/image2.gif) | image007 (1).jpg | 2025-11-21 06:24 | 50K | |
![[IMG]](/icons/image2.gif) | image006 (1).jpg | 2025-11-21 06:24 | 45K | |
![[ ]](/icons/unknown.gif) | User management fields - nozadze.xlsx | 2025-11-21 06:24 | 8.8K | |
![[ ]](/icons/unknown.gif) | DoublesForTea (1).xlsx | 2025-11-21 06:24 | 58K | |
![[ ]](/icons/unknown.gif) | მიმწოდებლების ინფო (1).xlsx | 2025-11-21 06:24 | 12K | |
![[IMG]](/icons/image2.gif) | image004 (7).png | 2025-11-21 06:24 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (68).png | 2025-11-21 06:24 | 25K | |
![[ ]](/icons/unknown.gif) | MERFASGL-AVERSI-GEOFARMI.xls | 2025-11-21 06:24 | 353K | |
![[ ]](/icons/unknown.gif) | MERFASGL-AVERSI-FARMA.xls | 2025-11-21 06:24 | 359K | |
![[IMG]](/icons/image2.gif) | image006 (3).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image005 (8).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image002 (114).jpg | 2025-11-21 06:24 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (16).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (67).png | 2025-11-21 06:24 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (25).gif | 2025-11-21 06:24 | 73 | |
![[ ]](/icons/unknown.gif) | User management fields blank.xlsx | 2025-11-21 06:24 | 15K | |
![[ ]](/icons/unknown.gif) | წამლების ბაზა.xlsx | 2025-11-21 06:24 | 29K | |
![[ ]](/icons/unknown.gif) | მიმწოდებლების ინფო.xlsx | 2025-11-21 06:24 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (5).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image003 (10).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image002 (21).png | 2025-11-21 06:24 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (127).jpg | 2025-11-21 06:24 | 3.1K | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work (1).pdf | 2025-11-21 06:24 | 388K | |
![[IMG]](/icons/image2.gif) | image007 (2).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image007 (1).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image006 (2).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image006 (1).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image005 (7).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image005 (6).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image004 (4).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image003 (9).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image002 (15).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (24).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (23).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image002 (14).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (22).gif | 2025-11-21 06:24 | 73 | |
![[ ]](/icons/unknown.gif) | DoublesForTea.xlsx | 2025-11-21 06:24 | 58K | |
![[IMG]](/icons/image2.gif) | image003 (8).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image002 (13).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (21).gif | 2025-11-21 06:24 | 73 | |
![[ ]](/icons/unknown.gif) | MATERMED.xls | 2025-11-21 06:24 | 5.4M | |
![[IMG]](/icons/image2.gif) | image005 (5).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image005 (4).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image004 (3).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image004 (2).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image003 (7).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image003 (6).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image002 (12).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (20).gif | 2025-11-21 06:24 | 73 | |
![[ ]](/icons/unknown.gif) | user - მასხარაშვილი.xlsx | 2025-11-21 06:24 | 12K | |
![[ ]](/icons/unknown.gif) | ivnisi თამთა კომახიძე (1) - копия.xlsx | 2025-11-21 06:24 | 10K | |
![[IMG]](/icons/image2.gif) | image006.png | 2025-11-21 06:24 | 7.0K | |
![[IMG]](/icons/image2.gif) | image005 (3).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (6).png | 2025-11-21 06:24 | 24K | |
![[IMG]](/icons/image2.gif) | image003 (8).png | 2025-11-21 06:24 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (66).png | 2025-11-21 06:24 | 29K | |
![[ ]](/icons/unknown.gif) | იმუნიზაციის სახელმძღვანელო სჯც ცენტრებისათვის_2015_06_23_თკ.docx | 2025-11-21 06:24 | 601K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (6).jpg | 2025-11-21 06:24 | 823 | |
![[IMG]](/icons/image2.gif) | image004 (5).png | 2025-11-21 06:24 | 7.0K | |
![[IMG]](/icons/image2.gif) | image003 (35).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (20).png | 2025-11-21 06:24 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (126).jpg | 2025-11-21 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (125).jpg | 2025-11-21 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (65).png | 2025-11-21 06:24 | 29K | |
![[ ]](/icons/unknown.gif) | WrongPaidBeneficiariesApril.xlsx | 2025-11-21 06:24 | 25K | |
![[ ]](/icons/unknown.gif) | User management 01_07_2015 - Copy- Copy (1).xlsx | 2025-11-21 06:24 | 14K | |
![[ ]](/icons/unknown.gif) | MA4H June 9-10_final.docx | 2025-11-21 06:24 | 48K | |
![[ ]](/icons/unknown.gif) | ATT85030 | 2025-11-21 06:24 | 0 | |
![[ ]](/icons/unknown.gif) | გასაუქმებელი კომბინაციები-ივლისი.xlsx | 2025-11-21 06:24 | 8.9K | |
![[IMG]](/icons/image2.gif) | ადოს (2).png | 2025-11-21 06:24 | 196K | |
![[IMG]](/icons/image2.gif) | image005 (2).jpg | 2025-11-21 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (19).png | 2025-11-21 06:24 | 43K | |
![[ ]](/icons/unknown.gif) | WrongPaidDoubledBeneficiaries.xlsx | 2025-11-21 06:24 | 32K | |
![[ ]](/icons/unknown.gif) | HemoDialysisExcel 2014.xlsx | 2025-11-21 06:24 | 19M | |
![[ ]](/icons/unknown.gif) | 2013-2014 PeritonialDialysis.xlsx | 2025-11-21 06:24 | 36K | |
![[ ]](/icons/unknown.gif) | წერილი.docx | 2025-11-21 06:24 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (113).jpg | 2025-11-21 06:24 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (112).jpg | 2025-11-21 06:24 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (124).jpg | 2025-11-21 06:24 | 67K | |
![[IMG]](/icons/image2.gif) | image001 (123).jpg | 2025-11-21 06:24 | 823 | |
![[IMG]](/icons/image2.gif) | error (5).PNG | 2025-11-21 06:24 | 68K | |
![[IMG]](/icons/image2.gif) | error (4).PNG | 2025-11-21 06:24 | 81K | |
![[ ]](/icons/unknown.gif) | User management fields - globali operatorebi.xls | 2025-11-21 06:24 | 26K | |
![[ ]](/icons/unknown.gif) | User management fields-1-5.xlsx | 2025-11-21 06:24 | 11K | |
![[ ]](/icons/unknown.gif) | User management fields გლობალი - ანალიტიკოსი.xls | 2025-11-21 06:24 | 48K | |
![[ ]](/icons/unknown.gif) | GFATM users (6) - uranti.xls | 2025-11-21 06:24 | 21K | |
![[ ]](/icons/unknown.gif) | მიმწოდებლები.xlsx | 2025-11-21 06:24 | 9.0K | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალების ცნობის სტატუსები (1).docx | 2025-11-21 06:24 | 28K | |
![[IMG]](/icons/image2.gif) | untitled (4).PNG | 2025-11-21 06:24 | 111K | |
![[IMG]](/icons/image2.gif) | image002 (111).jpg | 2025-11-21 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (64).png | 2025-11-21 06:24 | 7.7K | |
![[IMG]](/icons/image2.gif) | forma100.PNG | 2025-11-21 06:24 | 108K | |
![[IMG]](/icons/image2.gif) | error (3).png | 2025-11-21 06:24 | 87K | |
![[ ]](/icons/unknown.gif) | GFATM users (7) - uranti (1).xls | 2025-11-21 06:24 | 21K | |
![[ ]](/icons/unknown.gif) | user - კეჩხუაშვილი.xlsx | 2025-11-21 06:24 | 12K | |
![[IMG]](/icons/image2.gif) | untitled (3).PNG | 2025-11-21 06:24 | 144K | |
![[IMG]](/icons/image2.gif) | pacientis jgufi.png | 2025-11-21 06:24 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (122).jpg | 2025-11-21 06:24 | 823 | |
![[ ]](/icons/unknown.gif) | ganrigi.docx | 2025-11-21 06:24 | 13K | |
![[ ]](/icons/unknown.gif) | User management fields (5).xlsx | 2025-11-21 06:24 | 14K | |
![[ ]](/icons/unknown.gif) | Untitled (3) | 2025-11-21 06:24 | 0 | |
![[ ]](/icons/unknown.gif) | Request.xlsx | 2025-11-21 06:24 | 9.9K | |
![[IMG]](/icons/image2.gif) | ICD10.png | 2025-11-21 06:24 | 27K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 (8).xlsx | 2025-11-21 06:24 | 13K | |
![[IMG]](/icons/image2.gif) | გამოსავალი.png | 2025-11-21 06:24 | 40K | |
![[ ]](/icons/unknown.gif) | MOU Updated_22_06_2015_v5_GEO.docx | 2025-11-21 06:24 | 33K | |
![[ ]](/icons/unknown.gif) | Georgia MOU_updated June 22_06_2015_Abt HO.docx | 2025-11-21 06:24 | 32K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 (7).xlsx | 2025-11-21 06:24 | 17K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 (6).xlsx | 2025-11-21 06:24 | 17K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 (5).xlsx | 2025-11-21 06:24 | 17K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 (4).xlsx | 2025-11-21 06:24 | 17K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 (3).xlsx | 2025-11-21 06:24 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (5).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image002 (11).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image002 (10).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (121).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (19).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (18).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (17).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (16).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | dublirebuli Sesrulebebi.png | 2025-11-21 06:24 | 154K | |
![[ ]](/icons/unknown.gif) | No Name.docx | 2025-11-21 06:24 | 30K | |
![[IMG]](/icons/image2.gif) | MEMORANDUMI.JPG | 2025-11-21 06:24 | 3.0M | |
![[ ]](/icons/unknown.gif) | ხელმოსაწერი ვერსია.docx | 2025-11-21 06:24 | 31K | |
![[IMG]](/icons/image2.gif) | sabechdi.bmp | 2025-11-21 06:24 | 3.7M | |
![[IMG]](/icons/image2.gif) | image004 (4).png | 2025-11-21 06:24 | 25K | |
![[IMG]](/icons/image2.gif) | image003 (4).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image003 (3).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image002 (110).jpg | 2025-11-21 06:24 | 9.6K | |
![[IMG]](/icons/image2.gif) | image002 (9).gif | 2025-11-21 06:24 | 5.8K | |
![[IMG]](/icons/image2.gif) | image002 (8).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image002 (7).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (120).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (119).jpg | 2025-11-21 06:24 | 8.4K | |
![[IMG]](/icons/image2.gif) | image001 (118).jpg | 2025-11-21 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (117).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (116).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (115).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (63).png | 2025-11-21 06:24 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (62).png | 2025-11-21 06:24 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (61).png | 2025-11-21 06:24 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (60).png | 2025-11-21 06:24 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (15).gif | 2025-11-21 06:24 | 73 | |
![[ ]](/icons/unknown.gif) | gasauqmebeli.xlsx | 2025-11-21 06:24 | 44K | |
![[ ]](/icons/unknown.gif) | c hepatitis monitoringisforma.xlsx | 2025-11-21 06:24 | 15K | |
![[ ]](/icons/unknown.gif) | Med Tables (1).docx | 2025-11-21 06:24 | 20K | |
![[ ]](/icons/unknown.gif) | MedCertificatesTables (1).rar | 2025-11-21 06:24 | 1.2M | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2.xlsx | 2025-11-21 06:24 | 17K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 (2).xlsx | 2025-11-21 06:24 | 17K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 (1).xlsx | 2025-11-21 06:24 | 17K | |
![[ ]](/icons/unknown.gif) | BirthDeath Registration.docx | 2025-11-21 06:24 | 16K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (2).xlsx | 2025-11-21 06:24 | 12K | |
![[ ]](/icons/unknown.gif) | status_cross.xlsx | 2025-11-21 06:24 | 11K | |
![[IMG]](/icons/image2.gif) | sagarantio.png | 2025-11-21 06:24 | 192K | |
![[ ]](/icons/unknown.gif) | registracion_form (2).xlsx | 2025-11-21 06:24 | 11K | |
![[IMG]](/icons/image2.gif) | image005 (3).gif | 2025-11-21 06:24 | 73 | |
![[IMG]](/icons/image2.gif) | image004 (3).png | 2025-11-21 06:24 | 25K | |
![[IMG]](/icons/image2.gif) | image004 (2).png | 2025-11-21 06:24 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (7).png | 2025-11-21 06:24 | 25K | |
![[IMG]](/icons/image2.gif) | image003 (6).png | 2025-11-21 06:24 | 49K | |
![[IMG]](/icons/image2.gif) | image002 (18).png | 2025-11-21 06:24 | 96K | |
![[IMG]](/icons/image2.gif) | image001 (114).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (113).jpg | 2025-11-21 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (112).jpg | 2025-11-21 06:24 | 55K | |
![[IMG]](/icons/image2.gif) | image001 (59).png | 2025-11-21 06:24 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (58).png | 2025-11-21 06:24 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (57).png | 2025-11-21 06:24 | 21K | |
![[IMG]](/icons/image2.gif) | DSC_0032.jpg | 2025-11-21 06:24 | 2.8M | |
![[IMG]](/icons/image2.gif) | DSC_0031.jpg | 2025-11-21 06:24 | 2.6M | |
![[IMG]](/icons/image2.gif) | DSC_0030.jpg | 2025-11-21 06:24 | 2.7M | |
![[IMG]](/icons/image2.gif) | DSC_0029.jpg | 2025-11-21 06:24 | 2.6M | |
![[IMG]](/icons/image2.gif) | DSC_0028.jpg | 2025-11-21 06:24 | 2.7M | |
![[IMG]](/icons/image2.gif) | DSC_0027.jpg | 2025-11-21 06:24 | 2.7M | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 aversi-geofarmi.xlsx | 2025-11-21 06:24 | 46K | |
![[ ]](/icons/unknown.gif) | CloudDrugsFields-version2 aversi-farma.xlsx | 2025-11-21 06:24 | 46K | |
![[ ]](/icons/unknown.gif) | დაბადება-გარდაცვალების ცნობის სტატუსები.docx | 2025-11-21 06:24 | 28K | |
![[ ]](/icons/unknown.gif) | user - ასათიანი (1).xlsx | 2025-11-21 06:24 | 12K | |
![[IMG]](/icons/image2.gif) | untitled (4).bmp | 2025-11-21 06:24 | 3.7M | |
![[IMG]](/icons/image2.gif) | untitled (3).bmp | 2025-11-21 06:24 | 3.7M | |
![[IMG]](/icons/image2.gif) | image001 (56).png | 2025-11-21 06:24 | 21K | |
![[IMG]](/icons/image2.gif) | error.bmp | 2025-11-21 06:24 | 3.7M | |
![[ ]](/icons/unknown.gif) | User management 01_07_2015 - Copy- Copy.xlsx | 2025-11-21 06:24 | 14K | |
![[IMG]](/icons/image2.gif) | ATT00001 (1).png | 2025-11-21 06:24 | 21K | |
![[IMG]](/icons/image2.gif) | შეტყობინება.bmp | 2025-11-21 06:24 | 3.7M | |
![[ ]](/icons/unknown.gif) | ლაბორატორია_არასტანდარტული.docx | 2025-11-21 06:24 | 3.5M | |
![[ ]](/icons/unknown.gif) | ექსპორტის ფორმები_ნებათვა_ლიცენზია_შეტყობინება.xlsx | 2025-11-21 06:24 | 240K | |
![[IMG]](/icons/image2.gif) | motxovna 339278.png | 2025-11-21 06:24 | 165K | |
![[IMG]](/icons/image2.gif) | image001 (111).jpg | 2025-11-21 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (55).png | 2025-11-21 06:24 | 697K | |
![[ ]](/icons/unknown.gif) | User management fields - HotLine (1).xlsx | 2025-11-21 06:24 | 9.8K | |
![[IMG]](/icons/image2.gif) | ATT00001.png | 2025-11-21 06:24 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (54).png | 2025-11-21 06:24 | 697K | |
![[IMG]](/icons/image2.gif) | image001 (53).png | 2025-11-21 06:24 | 16K | |
![[IMG]](/icons/image2.gif) | er.png | 2025-11-21 06:24 | 206K | |
![[ ]](/icons/unknown.gif) | Med Tables.docx | 2025-11-21 06:24 | 20K | |
![[ ]](/icons/unknown.gif) | MedCertificatesTables.rar | 2025-11-21 06:24 | 1.2M | |
![[ ]](/icons/unknown.gif) | სახალხო აფთიაქი 09_07_.xls | 2025-11-21 06:24 | 54K | |
![[ ]](/icons/unknown.gif) | პსპ 10_07.xlsx | 2025-11-21 06:24 | 41K | |
![[ ]](/icons/unknown.gif) | მარჯი 09_07.xlsx | 2025-11-21 06:24 | 19K | |
![[ ]](/icons/unknown.gif) | ეი ბი ფარმაცია10_07.xlsx | 2025-11-21 06:24 | 47K | |
![[ ]](/icons/unknown.gif) | დანართი.xlsx | 2025-11-21 06:24 | 11K | |
![[ ]](/icons/unknown.gif) | ავერსი ფარმა 09_07.xlsx | 2025-11-21 06:24 | 46K | |
![[ ]](/icons/unknown.gif) | ავერსი გეოფარმი 09_07.xlsx | 2025-11-21 06:24 | 46K | |
![[IMG]](/icons/image2.gif) | image002 (17).png | 2025-11-21 06:24 | 47K | |
![[IMG]](/icons/image2.gif) | image001 (110).jpg | 2025-11-21 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (109).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (108).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (107).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (52).png | 2025-11-21 06:24 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (51).png | 2025-11-21 06:24 | 58K | |
![[ ]](/icons/unknown.gif) | სამშობიარო დაწესებულება.xlsx | 2025-11-21 06:24 | 11K | |
![[IMG]](/icons/image2.gif) | image004 (3).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (5).png | 2025-11-21 06:24 | 704K | |
![[IMG]](/icons/image2.gif) | image002 (109).jpg | 2025-11-21 06:24 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (16).png | 2025-11-21 06:24 | 898K | |
![[IMG]](/icons/image2.gif) | image001 (106).jpg | 2025-11-21 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (105).jpg | 2025-11-21 06:24 | 3.6K | |
![[IMG]](/icons/image2.gif) | image001 (104).jpg | 2025-11-21 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (34).jpg | 2025-11-21 06:23 | 20K | |
![[IMG]](/icons/image2.gif) | image002 (15).png | 2025-11-21 06:23 | 25K | |
![[IMG]](/icons/image2.gif) | image002 (14).png | 2025-11-21 06:23 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (103).jpg | 2025-11-21 06:23 | 35K | |
![[IMG]](/icons/image2.gif) | image001 (50).png | 2025-11-21 06:23 | 123K | |
![[IMG]](/icons/image2.gif) | image001 (49).png | 2025-11-21 06:23 | 603K | |
![[IMG]](/icons/image2.gif) | image001 (48).png | 2025-11-21 06:23 | 603K | |
![[IMG]](/icons/image2.gif) | image001 (47).png | 2025-11-21 06:23 | 16K | |
![[IMG]](/icons/image2.gif) | ITSC Banner (1).jpg | 2025-11-21 06:23 | 8.4K | |
![[ ]](/icons/unknown.gif) | All Contracted Providers - 2015-Jul-15.xlsx | 2025-11-21 06:23 | 1.2M | |
![[IMG]](/icons/image2.gif) | ~WRD000 (5).jpg | 2025-11-21 06:23 | 823 | |
![[ ]](/icons/unknown.gif) | user - ასათიანი.xlsx | 2025-11-21 06:23 | 12K | |
![[IMG]](/icons/image2.gif) | untitled (2).bmp | 2025-11-21 06:23 | 3.7M | |
![[IMG]](/icons/image2.gif) | untitled (1).bmp | 2025-11-21 06:23 | 3.7M | |
![[IMG]](/icons/image2.gif) | image002 (108).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (102).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (101).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (100).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (46).png | 2025-11-21 06:23 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (45).png | 2025-11-21 06:23 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (14).gif | 2025-11-21 06:23 | 32K | |
![[IMG]](/icons/image2.gif) | image001 (13).gif | 2025-11-21 06:23 | 32K | |
![[ ]](/icons/unknown.gif) | User management fields - HotLine.xlsx | 2025-11-21 06:23 | 9.8K | |
![[ ]](/icons/unknown.gif) | User management fields (4).xlsx | 2025-11-21 06:23 | 13K | |
![[ ]](/icons/unknown.gif) | Saxalxo.xlsx | 2025-11-21 06:23 | 9.5K | |
![[ ]](/icons/unknown.gif) | PSP.xlsx | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | ITSC Banner.jpg | 2025-11-21 06:23 | 8.4K | |
![[IMG]](/icons/image2.gif) | Error (2).png | 2025-11-21 06:23 | 554K | |
![[ ]](/icons/unknown.gif) | AversiPharma.xlsx | 2025-11-21 06:23 | 16K | |
![[ ]](/icons/unknown.gif) | AversiGeoPharma.xlsx | 2025-11-21 06:23 | 15K | |
![[ ]](/icons/unknown.gif) | ABC.xlsx | 2025-11-21 06:23 | 15K | |
![[IMG]](/icons/image2.gif) | 353718.png | 2025-11-21 06:23 | 177K | |
![[IMG]](/icons/image2.gif) | 1 (2).png | 2025-11-21 06:23 | 170K | |
![[IMG]](/icons/image2.gif) | image004 (2).jpg | 2025-11-21 06:23 | 411 | |
![[IMG]](/icons/image2.gif) | image003 (33).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (32).jpg | 2025-11-21 06:23 | 423 | |
![[IMG]](/icons/image2.gif) | image002 (107).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (106).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (105).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (104).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (103).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (102).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (101).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (100).jpg | 2025-11-21 06:23 | 406 | |
![[IMG]](/icons/image2.gif) | image001 (99).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (98).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (97).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (96).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (95).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (94).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (44).png | 2025-11-21 06:23 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (43).png | 2025-11-21 06:23 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (42).png | 2025-11-21 06:23 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (41).png | 2025-11-21 06:23 | 2.6K | |
![[ ]](/icons/unknown.gif) | User management 20_07_2015 - Copy- Copy.xlsx | 2025-11-21 06:23 | 14K | |
![[IMG]](/icons/image2.gif) | Untitled (2).png | 2025-11-21 06:23 | 202K | |
![[ ]](/icons/unknown.gif) | RE | 2025-11-21 06:23 | 0 | |
![[ ]](/icons/layout.gif) | HFG PD External.pdf | 2025-11-21 06:23 | 110K | |
![[ ]](/icons/unknown.gif) | დანართი 20_07_15.xlsx | 2025-11-21 06:23 | 12K | |
![[ ]](/icons/unknown.gif) | დანართი 20_07_15 (1).xlsx | 2025-11-21 06:23 | 11K | |
![[ ]](/icons/unknown.gif) | დანართი 13_07_2015.xlsx | 2025-11-21 06:23 | 12K | |
![[IMG]](/icons/image2.gif) | გაუთვალისწინებელი შეცდომა.png | 2025-11-21 06:23 | 127K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (4).jpg | 2025-11-21 06:23 | 823 | |
![[IMG]](/icons/image2.gif) | image003 (31).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (30).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (29).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (28).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (99).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (98).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (97).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (96).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (95).jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (94).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (93).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (92).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (91).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (90).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (89).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (88).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (93).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (92).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (91).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (90).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (89).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (88).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (87).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (86).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (85).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (40).png | 2025-11-21 06:23 | 24K | |
![[IMG]](/icons/image2.gif) | image001 (39).png | 2025-11-21 06:23 | 24K | |
![[ ]](/icons/unknown.gif) | User management 20_07_2015 - Copy_- Copy.xlsx | 2025-11-21 06:23 | 14K | |
![[ ]](/icons/unknown.gif) | User management 20 07 2015.xlsx | 2025-11-21 06:23 | 15K | |
![[IMG]](/icons/image2.gif) | MED.png | 2025-11-21 06:23 | 237K | |
![[IMG]](/icons/image2.gif) | Capture (8).PNG | 2025-11-21 06:23 | 36K | |
![[ ]](/icons/unknown.gif) | 20150101-20152107 Submissions.xlsx | 2025-11-21 06:23 | 1.9M | |
![[ ]](/icons/unknown.gif) | მოთხოვნები -30246.xlsx | 2025-11-21 06:23 | 34K | |
![[ ]](/icons/unknown.gif) | მოთხოვნები (89).xlsx | 2025-11-21 06:23 | 36K | |
![[IMG]](/icons/image2.gif) | image003 (27).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (87).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (86).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (85).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (84).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (83).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (82).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (38).png | 2025-11-21 06:23 | 24K | |
![[IMG]](/icons/image2.gif) | Capture (7).PNG | 2025-11-21 06:23 | 188K | |
![[IMG]](/icons/image2.gif) | image003 (26).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (84).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (83).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (81).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | Capture (6).PNG | 2025-11-21 06:23 | 70K | |
![[IMG]](/icons/image2.gif) | image002 (82).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (81).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (80).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (79).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (80).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (79).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (78).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (37).png | 2025-11-21 06:23 | 7.7K | |
![[IMG]](/icons/image2.gif) | მომს_ ღირ_.png | 2025-11-21 06:23 | 188K | |
![[ ]](/icons/unknown.gif) | მოთხოვნები-30249.xlsx | 2025-11-21 06:23 | 153K | |
![[IMG]](/icons/image2.gif) | ინტერფეისი.png | 2025-11-21 06:23 | 132K | |
![[IMG]](/icons/image2.gif) | image002 (78).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (77).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (76).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (77).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (76).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (75).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (36).png | 2025-11-21 06:23 | 195K | |
![[IMG]](/icons/image2.gif) | image001 (35).png | 2025-11-21 06:23 | 195K | |
![[IMG]](/icons/image2.gif) | image001 (34).png | 2025-11-21 06:23 | 195K | |
![[IMG]](/icons/image2.gif) | image001 (12).gif | 2025-11-21 06:23 | 7.9K | |
![[ ]](/icons/unknown.gif) | დანართი 24_07_2015 (2).xlsx | 2025-11-21 06:23 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (75).jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (74).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (74).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (73).jpg | 2025-11-21 06:23 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (72).jpg | 2025-11-21 06:23 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (71).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (11).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | error (1).png | 2025-11-21 06:23 | 253K | |
![[IMG]](/icons/image2.gif) | SentToPrescription.JPG | 2025-11-21 06:23 | 156K | |
![[IMG]](/icons/image2.gif) | SentToPrescription (1).JPG | 2025-11-21 06:23 | 156K | |
![[IMG]](/icons/image2.gif) | Capture (5).PNG | 2025-11-21 06:23 | 284K | |
![[ ]](/icons/unknown.gif) | მოთხოვნები-30258.xlsx | 2025-11-21 06:23 | 58K | |
![[ ]](/icons/unknown.gif) | დანართი 24_07_2015.xlsx | 2025-11-21 06:23 | 10K | |
![[ ]](/icons/unknown.gif) | დანართი 24_07_2015 (1).xlsx | 2025-11-21 06:23 | 10K | |
![[IMG]](/icons/image2.gif) | დაზღვევა.PNG | 2025-11-21 06:23 | 64K | |
![[ ]](/icons/unknown.gif) | user - კეზევაძე.xlsx | 2025-11-21 06:23 | 12K | |
![[ ]](/icons/unknown.gif) | registracion_form.xlsx | 2025-11-21 06:23 | 9.9K | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri (1).xls | 2025-11-21 06:23 | 26K | |
![[IMG]](/icons/image2.gif) | image002 (73).jpg | 2025-11-21 06:23 | 5.2K | |
![[IMG]](/icons/image2.gif) | image002 (72).jpg | 2025-11-21 06:23 | 5.2K | |
![[IMG]](/icons/image2.gif) | image002 (71).jpg | 2025-11-21 06:23 | 5.2K | |
![[IMG]](/icons/image2.gif) | image002 (13).png | 2025-11-21 06:23 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (70).jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (69).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (68).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (67).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (66).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (33).png | 2025-11-21 06:23 | 550K | |
![[IMG]](/icons/image2.gif) | image001 (32).png | 2025-11-21 06:23 | 550K | |
![[IMG]](/icons/image2.gif) | image001 (31).png | 2025-11-21 06:23 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (10).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (9).gif | 2025-11-21 06:23 | 3.5K | |
![[ ]](/icons/unknown.gif) | ATT42511 | 2025-11-21 06:23 | 0 | |
![[ ]](/icons/unknown.gif) | ATT39542 | 2025-11-21 06:23 | 0 | |
![[ ]](/icons/unknown.gif) | მერიის რეცეპტის სერვისის აღწერა.docx | 2025-11-21 06:23 | 21K | |
![[ ]](/icons/unknown.gif) | დანართი 27_ 06 2015.xlsx | 2025-11-21 06:23 | 10K | |
![[IMG]](/icons/image2.gif) | image007.jpg | 2025-11-21 06:23 | 5.2K | |
![[IMG]](/icons/image2.gif) | image006.jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image005 (1).jpg | 2025-11-21 06:23 | 5.2K | |
![[IMG]](/icons/image2.gif) | image004 (1).png | 2025-11-21 06:23 | 682 | |
![[IMG]](/icons/image2.gif) | image003 (4).png | 2025-11-21 06:23 | 690 | |
![[IMG]](/icons/image2.gif) | image001 (65).jpg | 2025-11-21 06:23 | 3.1K | |
![[ ]](/icons/unknown.gif) | All Contracted Providers - 2015-Jul-29.xls | 2025-11-21 06:23 | 4.8M | |
![[ ]](/icons/unknown.gif) | 29_07_2015.xlsx | 2025-11-21 06:23 | 33K | |
![[ ]](/icons/unknown.gif) | 0607_WMS_functional requirements_UPDATED.xlsx | 2025-11-21 06:23 | 35K | |
![[IMG]](/icons/image2.gif) | ექსპორტი.png | 2025-11-21 06:23 | 230K | |
![[IMG]](/icons/image2.gif) | ioane lagidze.png | 2025-11-21 06:23 | 104K | |
![[IMG]](/icons/image2.gif) | image005.jpg | 2025-11-21 06:23 | 5.2K | |
![[IMG]](/icons/image2.gif) | image004 (1).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image003 (3).png | 2025-11-21 06:23 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (8).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (7).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (6).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (5).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (4).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | List.png | 2025-11-21 06:23 | 23K | |
![[ ]](/icons/unknown.gif) | იმუნიზაციის საკითხები (1).docx | 2025-11-21 06:23 | 22K | |
![[IMG]](/icons/image2.gif) | ადოს (1).png | 2025-11-21 06:23 | 192K | |
![[ ]](/icons/unknown.gif) | qobuleti-fizik _piri.xls | 2025-11-21 06:23 | 27K | |
![[IMG]](/icons/image2.gif) | image004.jpg | 2025-11-21 06:23 | 9.8K | |
![[IMG]](/icons/image2.gif) | image003 (2).png | 2025-11-21 06:23 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (2).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image002 (70).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (69).jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (68).jpg | 2025-11-21 06:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (12).png | 2025-11-21 06:23 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (64).jpg | 2025-11-21 06:23 | 1.4M | |
![[IMG]](/icons/image2.gif) | image001 (30).png | 2025-11-21 06:23 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (29).png | 2025-11-21 06:23 | 397K | |
![[IMG]](/icons/image2.gif) | image001 (3).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (2).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (1).gif | 2025-11-21 06:23 | 7.9K | |
![[ ]](/icons/unknown.gif) | ადოს.xlsx | 2025-11-21 06:23 | 21K | |
![[ ]](/icons/unknown.gif) | user - maia chonashvili.xlsx | 2025-11-21 06:23 | 12K | |
![[IMG]](/icons/image2.gif) | unikaluri kodi.png | 2025-11-21 06:23 | 195K | |
![[ ]](/icons/unknown.gif) | kontroli_damateba.docx | 2025-11-21 06:23 | 12K | |
![[IMG]](/icons/image2.gif) | image003 (25).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (1).png | 2025-11-21 06:23 | 678K | |
![[IMG]](/icons/image2.gif) | image002 (67).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (66).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (65).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (64).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (63).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (62).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (28).png | 2025-11-21 06:23 | 397K | |
![[IMG]](/icons/image2.gif) | image001 (27).png | 2025-11-21 06:23 | 678K | |
![[ ]](/icons/unknown.gif) | User management fields (3).xlsx | 2025-11-21 06:23 | 12K | |
![[ ]](/icons/unknown.gif) | User management fields (2).xlsx | 2025-11-21 06:23 | 12K | |
![[ ]](/icons/unknown.gif) | KONTR.xls | 2025-11-21 06:23 | 27K | |
![[IMG]](/icons/image2.gif) | Capture (4).PNG | 2025-11-21 06:23 | 133K | |
![[ ]](/icons/unknown.gif) | qobuleti+mestia-fizik piri.xls | 2025-11-21 06:23 | 20K | |
![[IMG]](/icons/image2.gif) | image002 (63).jpg | 2025-11-21 06:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (6).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image002 (5).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (61).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (60).jpg | 2025-11-21 06:23 | 103K | |
![[IMG]](/icons/image2.gif) | image001 (26).png | 2025-11-21 06:23 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (25).png | 2025-11-21 06:23 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (24).png | 2025-11-21 06:23 | 29K | |
![[ ]](/icons/unknown.gif) | User management fields.xlsx | 2025-11-21 06:23 | 13K | |
![[ ]](/icons/unknown.gif) | User management fields (1).xlsx | 2025-11-21 06:23 | 14K | |
![[ ]](/icons/unknown.gif) | Tetritskaro.xls | 2025-11-21 06:23 | 20K | |
![[ ]](/icons/unknown.gif) | სისტემაზე დაშვება.xlsx | 2025-11-21 06:23 | 14K | |
![[ ]](/icons/unknown.gif) | user - შაბლონი.xlsx | 2025-11-21 06:23 | 12K | |
![[IMG]](/icons/image2.gif) | untitled.bmp | 2025-11-21 06:23 | 3.7M | |
![[IMG]](/icons/image2.gif) | image003 (24).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (62).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (61).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (60).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (59).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (4).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (59).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (58).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (57).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (23).png | 2025-11-21 06:23 | 29K | |
![[IMG]](/icons/image2.gif) | 62006027231.PNG | 2025-11-21 06:23 | 149K | |
![[IMG]](/icons/image2.gif) | image002 (58).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (3).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (22).png | 2025-11-21 06:23 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (21).png | 2025-11-21 06:23 | 754K | |
![[ ]](/icons/unknown.gif) | export.xls | 2025-11-21 06:23 | 26K | |
![[ ]](/icons/unknown.gif) | Untitled (2) | 2025-11-21 06:23 | 0 | |
![[ ]](/icons/unknown.gif) | Untitled (1) | 2025-11-21 06:23 | 0 | |
![[IMG]](/icons/image2.gif) | image005 (2).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image005 (1).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image004.gif | 2025-11-21 06:23 | 8.4K | |
![[IMG]](/icons/image2.gif) | image004 (1).gif | 2025-11-21 06:23 | 8.4K | |
![[IMG]](/icons/image2.gif) | image003.gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image003 (1).gif | 2025-11-21 06:23 | 73 | |
![[IMG]](/icons/image2.gif) | image002.gif | 2025-11-21 06:23 | 8.4K | |
![[IMG]](/icons/image2.gif) | image002 (2).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image002 (1).gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001.gif | 2025-11-21 06:23 | 73 | |
![[IMG]](/icons/image2.gif) | image001 (20).png | 2025-11-21 06:23 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (19).png | 2025-11-21 06:23 | 29K | |
![[ ]](/icons/layout.gif) | aversi-farmas sagarantio.pdf | 2025-11-21 06:23 | 492K | |
![[ ]](/icons/unknown.gif) | სხვა სოციალურის საანგარიშგებო ფორმები ბოლო.xlsx | 2025-11-21 06:23 | 24K | |
![[ ]](/icons/layout.gif) | recepti.pdf | 2025-11-21 06:23 | 343K | |
![[IMG]](/icons/image2.gif) | recepti (1).png | 2025-11-21 06:23 | 132K | |
![[ ]](/icons/layout.gif) | invoisi.pdf | 2025-11-21 06:23 | 348K | |
![[IMG]](/icons/image2.gif) | image007.gif | 2025-11-21 06:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | image006.gif | 2025-11-21 06:23 | 8.4K | |
![[IMG]](/icons/image2.gif) | image005.gif | 2025-11-21 06:23 | 73 | |
![[IMG]](/icons/image2.gif) | image004.png | 2025-11-21 06:23 | 29K | |
![[IMG]](/icons/image2.gif) | image003 (23).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (22).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (57).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (56).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (55).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (54).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (11).png | 2025-11-21 06:23 | 625K | |
![[IMG]](/icons/image2.gif) | image002 (10).png | 2025-11-21 06:23 | 625K | |
![[IMG]](/icons/image2.gif) | image002 (9).png | 2025-11-21 06:23 | 625K | |
![[IMG]](/icons/image2.gif) | image001 (56).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (55).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (54).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (53).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (52).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (51).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (18).png | 2025-11-21 06:23 | 267K | |
![[IMG]](/icons/image2.gif) | image001 (17).png | 2025-11-21 06:23 | 267K | |
![[IMG]](/icons/image2.gif) | image001 (16).png | 2025-11-21 06:23 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (15).png | 2025-11-21 06:23 | 29K | |
![[IMG]](/icons/image2.gif) | image001 (14).png | 2025-11-21 06:23 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (13).png | 2025-11-21 06:23 | 60K | |
![[IMG]](/icons/image2.gif) | error.png | 2025-11-21 06:23 | 71K | |
![[IMG]](/icons/image2.gif) | IMG_1570.PNG | 2025-11-21 06:23 | 190K | |
![[TXT]](/icons/text.gif) | ATT00001 (1).txt | 2025-11-21 06:23 | 25 | |
![[ ]](/icons/unknown.gif) | 2015 08 08 იმუნიზაციის საკითხები (1).docx | 2025-11-21 06:23 | 20K | |
![[ ]](/icons/unknown.gif) | იმუნიზაციის საკითხები.docx | 2025-11-21 06:23 | 22K | |
![[IMG]](/icons/image2.gif) | ვერ გადაიგზავნა.png | 2025-11-21 06:23 | 202K | |
![[IMG]](/icons/image2.gif) | image003 (21).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (20).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (19).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (18).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (53).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (52).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (51).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (50).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (49).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (48).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (47).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (46).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (45).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (44).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (8).png | 2025-11-21 06:23 | 181K | |
![[IMG]](/icons/image2.gif) | image001 (50).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (49).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (48).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (47).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (46).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (45).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (44).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (43).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (42).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (41).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (12).png | 2025-11-21 06:23 | 53K | |
![[IMG]](/icons/image2.gif) | image001 (11).png | 2025-11-21 06:23 | 59K | |
![[IMG]](/icons/image2.gif) | image001 (10).png | 2025-11-21 06:23 | 59K | |
![[IMG]](/icons/image2.gif) | Secdoma.png | 2025-11-21 06:23 | 158K | |
![[ ]](/icons/unknown.gif) | Doc1.docx | 2025-11-21 06:23 | 210K | |
![[IMG]](/icons/image2.gif) | Capture (3).PNG | 2025-11-21 06:23 | 119K | |
![[IMG]](/icons/image2.gif) | Capture (2).PNG | 2025-11-21 06:23 | 247K | |
![[ ]](/icons/unknown.gif) | ATT58895 | 2025-11-21 06:23 | 0 | |
![[IMG]](/icons/image2.gif) | ATT00001.jpg | 2025-11-21 06:23 | 2.6K | |
![[ ]](/icons/unknown.gif) | გეა.xlsx | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | recepti.PNG | 2025-11-21 06:23 | 155K | |
![[ ]](/icons/unknown.gif) | questions - V2 A_T comments.docx | 2025-11-21 06:23 | 26K | |
![[IMG]](/icons/image2.gif) | image003.png | 2025-11-21 06:23 | 67K | |
![[IMG]](/icons/image2.gif) | image003 (17).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (16).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (15).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (14).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (43).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (42).jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (41).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (40).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (39).jpg | 2025-11-21 06:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (38).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (37).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (36).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (35).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (40).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (39).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (38).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (37).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (36).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (9).png | 2025-11-21 06:23 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (8).png | 2025-11-21 06:23 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (7).png | 2025-11-21 06:23 | 21K | |
![[ ]](/icons/unknown.gif) | forma ##1 8 2 8 -ipv.xlsx | 2025-11-21 06:23 | 20K | |
![[ ]](/icons/layout.gif) | TSs & CoEs slipsheet July 2015.pdf | 2025-11-21 06:23 | 60K | |
![[ ]](/icons/layout.gif) | CV - Graham Teskey.pdf | 2025-11-21 06:23 | 271K | |
![[ ]](/icons/unknown.gif) | Annex_3 (1).docx | 2025-11-21 06:23 | 13K | |
![[ ]](/icons/unknown.gif) | Annex_2 (1).docx | 2025-11-21 06:23 | 60K | |
![[ ]](/icons/unknown.gif) | Annex_1 (1).docx | 2025-11-21 06:23 | 90K | |
![[ ]](/icons/unknown.gif) | ATT81662 | 2025-11-21 06:23 | 0 | |
![[ ]](/icons/unknown.gif) | ATT69707 | 2025-11-21 06:23 | 0 | |
![[IMG]](/icons/image2.gif) | image003 (13).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (12).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (34).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (33).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image002 (32).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (31).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (30).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (29).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (28).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (35).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (34).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (33).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (32).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (6).png | 2025-11-21 06:23 | 7.7K | |
![[ ]](/icons/unknown.gif) | filialebis modultanwvdoma.xlsx | 2025-11-21 06:23 | 9.3K | |
![[IMG]](/icons/image2.gif) | Untitled (1).png | 2025-11-21 06:23 | 127K | |
![[ ]](/icons/unknown.gif) | IHD Target Journals 7_31_15.docx | 2025-11-21 06:23 | 37K | |
![[ ]](/icons/unknown.gif) | 2015 08 08 იმუნიზაციის საკითხები.docx | 2025-11-21 06:23 | 25K | |
![[ ]](/icons/unknown.gif) | user - გაუქმება.xlsx | 2025-11-21 06:23 | 12K | |
![[IMG]](/icons/image2.gif) | nikushas.png | 2025-11-21 06:23 | 126K | |
![[IMG]](/icons/image2.gif) | image002 (7).png | 2025-11-21 06:23 | 8.1K | |
![[IMG]](/icons/image2.gif) | image002 (6).png | 2025-11-21 06:23 | 8.1K | |
![[IMG]](/icons/image2.gif) | image002 (5).png | 2025-11-21 06:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (31).jpg | 2025-11-21 06:23 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (5).png | 2025-11-21 06:23 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (4).png | 2025-11-21 06:23 | 33K | |
![[IMG]](/icons/image2.gif) | image001 (3).png | 2025-11-21 06:23 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (2).png | 2025-11-21 06:23 | 8.1K | |
![[ ]](/icons/unknown.gif) | Untitled | 2025-11-21 06:23 | 0 | |
![[ ]](/icons/layout.gif) | RCDB Quick Facts Guide to Submitting and Editing Your Work.pdf | 2025-11-21 06:23 | 388K | |
![[IMG]](/icons/image2.gif) | FullSizeRender.jpg | 2025-11-21 06:23 | 968K | |
![[IMG]](/icons/image2.gif) | FullSizeRender (3).jpg | 2025-11-21 06:23 | 785K | |
![[IMG]](/icons/image2.gif) | FullSizeRender (2).jpg | 2025-11-21 06:23 | 785K | |
![[IMG]](/icons/image2.gif) | FullSizeRender (1).jpg | 2025-11-21 06:23 | 775K | |
![[ ]](/icons/unknown.gif) | Abt Five Golden Rules for Corporate Blogs.docx | 2025-11-21 06:23 | 17K | |
![[TXT]](/icons/text.gif) | ATT00004.txt | 2025-11-21 06:23 | 25 | |
![[TXT]](/icons/text.gif) | ATT00003.txt | 2025-11-21 06:23 | 6 | |
![[TXT]](/icons/text.gif) | ATT00002.txt | 2025-11-21 06:23 | 6 | |
![[TXT]](/icons/text.gif) | ATT00001.txt | 2025-11-21 06:23 | 6 | |
![[ ]](/icons/unknown.gif) | 17-aug.xlsx | 2025-11-21 06:23 | 11K | |
![[ ]](/icons/unknown.gif) | 7-20 Editorial Guidelines (2).docx | 2025-11-21 06:23 | 16K | |
![[ ]](/icons/unknown.gif) | თამთას აგვისტო.xlsx | 2025-11-21 06:23 | 11K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (3).jpg | 2025-11-21 06:23 | 823 | |
![[IMG]](/icons/image2.gif) | ~WRD000 (2).jpg | 2025-11-21 06:23 | 823 | |
![[IMG]](/icons/image2.gif) | ~WRD000 (1).jpg | 2025-11-21 06:23 | 823 | |
![[IMG]](/icons/image2.gif) | image003 (11).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (10).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (9).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (8).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (27).jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (26).jpg | 2025-11-21 06:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (25).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (24).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (23).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (22).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (21).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (20).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (4).png | 2025-11-21 06:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (30).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (29).jpg | 2025-11-21 06:23 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (28).jpg | 2025-11-21 06:23 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (27).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (26).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (25).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (1).png | 2025-11-21 06:23 | 43K | |
![[ ]](/icons/unknown.gif) | დანართი #1 (1).xlsx | 2025-11-21 06:23 | 12K | |
![[ ]](/icons/unknown.gif) | user - რაჭა.xlsx | 2025-11-21 06:23 | 12K | |
![[IMG]](/icons/image2.gif) | imereti.png | 2025-11-21 06:23 | 238K | |
![[IMG]](/icons/image2.gif) | image003 (7).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (19).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (18).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001.png | 2025-11-21 06:23 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (24).jpg | 2025-11-21 06:23 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (23).jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (22).jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (21).jpg | 2025-11-21 06:23 | 13K | |
![[ ]](/icons/unknown.gif) | Drugs.xlsx | 2025-11-21 06:23 | 1.2M | |
![[IMG]](/icons/image2.gif) | 123.JPG | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | 3 (1).png | 2025-11-21 06:23 | 241K | |
![[IMG]](/icons/image2.gif) | 2 (1).png | 2025-11-21 06:23 | 259K | |
![[IMG]](/icons/image2.gif) | 1 (1).png | 2025-11-21 06:23 | 284K | |
![[IMG]](/icons/image2.gif) | image003 (6).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (17).jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (16).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (15).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (3).png | 2025-11-21 06:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | image002 (2).png | 2025-11-21 06:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (20).jpg | 2025-11-21 06:23 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (19).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (18).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (17).jpg | 2025-11-21 06:23 | 57K | |
![[ ]](/icons/unknown.gif) | User management 25_08_2015 - Copy- Copy.xlsx | 2025-11-21 06:23 | 14K | |
![[ ]](/icons/unknown.gif) | Annex_3.docx | 2025-11-21 06:23 | 13K | |
![[ ]](/icons/unknown.gif) | Annex_2.docx | 2025-11-21 06:23 | 60K | |
![[ ]](/icons/unknown.gif) | Annex_1.docx | 2025-11-21 06:23 | 90K | |
![[ ]](/icons/unknown.gif) | ATT97625 | 2025-11-21 06:23 | 0 | |
![[ ]](/icons/unknown.gif) | ATT74197 | 2025-11-21 06:23 | 0 | |
![[IMG]](/icons/image2.gif) | 4.png | 2025-11-21 06:23 | 157K | |
![[IMG]](/icons/image2.gif) | 3.png | 2025-11-21 06:23 | 165K | |
![[IMG]](/icons/image2.gif) | 2.png | 2025-11-21 06:23 | 167K | |
![[IMG]](/icons/image2.gif) | 1.png | 2025-11-21 06:23 | 168K | |
![[IMG]](/icons/image2.gif) | ~WRD000.jpg | 2025-11-21 06:23 | 823 | |
![[IMG]](/icons/image2.gif) | image003 (5).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (4).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (14).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (13).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (12).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (11).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (1).png | 2025-11-21 06:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (16).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (15).jpg | 2025-11-21 06:23 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (14).jpg | 2025-11-21 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (13).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (12).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (11).jpg | 2025-11-21 06:23 | 18K | |
![[ ]](/icons/unknown.gif) | User management 26_08_2015 - Copy- Copy.xlsx | 2025-11-21 06:23 | 14K | |
![[ ]](/icons/unknown.gif) | User management 26_08_2015 - Copy- Copy (1).xlsx | 2025-11-21 06:23 | 14K | |
![[IMG]](/icons/image2.gif) | Capture (1).PNG | 2025-11-21 06:23 | 63K | |
![[IMG]](/icons/image2.gif) | image003 (3).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (10).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (9).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (8).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (7).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (10).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (9).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (8).jpg | 2025-11-21 06:23 | 18K | |
![[ ]](/icons/unknown.gif) | დანართი #1.xlsx | 2025-11-21 06:23 | 14K | |
![[ ]](/icons/unknown.gif) | user - 27_08.xlsx | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image003 (2).jpg | 2025-11-21 06:23 | 99K | |
![[IMG]](/icons/image2.gif) | image003 (1).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002.png | 2025-11-21 06:23 | 724K | |
![[IMG]](/icons/image2.gif) | image002 (6).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (5).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (4).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (3).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (7).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (6).jpg | 2025-11-21 06:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (5).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (4).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (3).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | Capture.PNG | 2025-11-21 06:23 | 117K | |
![[IMG]](/icons/image2.gif) | image003.jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002.jpg | 2025-11-21 06:23 | 13K | |
![[IMG]](/icons/image2.gif) | image002 (2).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image002 (1).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (2).jpg | 2025-11-21 06:23 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (1).jpg | 2025-11-21 06:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | Untitled.png | 2025-11-21 06:23 | 39K | |
![[ ]](/icons/unknown.gif) | A-25 New Timesheet_Blank.xls | 2025-11-21 06:23 | 310K | |
![[ ]](/icons/unknown.gif) | 2015 08 28 იმუნიზაციის საკითხები.docx | 2025-11-21 06:23 | 18K | |
![[ ]](/icons/unknown.gif) | შპს სამკურნალო-დიაგნოსტიკური ცენტრი ესკულაპი.xlsx | 2025-11-21 06:23 | 15K | |
![[ ]](/icons/unknown.gif) | პაროლის აღდგენა კახეთი.xlsx | 2025-11-21 06:23 | 11K | |
![[ ]](/icons/unknown.gif) | დანართი 31_08_2015.xlsx | 2025-11-21 06:23 | 10K | |
![[ ]](/icons/unknown.gif) | დანართი 31_08_2015 (3).xlsx | 2025-11-21 06:23 | 9.6K | |
![[ ]](/icons/unknown.gif) | დანართი 31_08_2015 (2).xlsx | 2025-11-21 06:23 | 9.6K | |
![[ ]](/icons/unknown.gif) | დანართი 31_08_2015 (1).xlsx | 2025-11-21 06:23 | 10K | |
![[IMG]](/icons/image2.gif) | ადოს.png | 2025-11-21 06:23 | 159K | |
![[IMG]](/icons/image2.gif) | image001.jpg | 2025-11-21 06:22 | 3.1K | |
![[IMG]](/icons/image2.gif) | კონტრაქტი.bmp | 2025-11-21 06:22 | 3.7M | |
|