![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | ~WRD400.jpg | 2025-11-20 22:11 | 823 | |
![[ ]](/icons/unknown.gif) | relizi sayoveltao.docx | 2025-11-20 22:11 | 22K | |
![[ ]](/icons/unknown.gif) | jandacva (2).docx | 2025-11-20 22:11 | 15K | |
![[ ]](/icons/unknown.gif) | Policy seminar, March 7, 2017_draft agenda.docx | 2025-11-20 22:11 | 43K | |
![[ ]](/icons/unknown.gif) | Policy seminar, March 7, 2017_draft agenda (1).docx | 2025-11-20 22:11 | 43K | |
![[IMG]](/icons/image2.gif) | IMG_0686.JPG | 2025-11-20 22:11 | 188K | |
![[IMG]](/icons/image2.gif) | IMG_0684.JPG | 2025-11-20 22:11 | 189K | |
![[IMG]](/icons/image2.gif) | IMG_0684 (1).JPG | 2025-11-20 22:11 | 189K | |
![[ ]](/icons/layout.gif) | Georgia Participant List.pdf | 2025-11-20 22:11 | 618K | |
![[ ]](/icons/layout.gif) | Georgia Agenda_RUS.pdf | 2025-11-20 22:11 | 634K | |
![[ ]](/icons/layout.gif) | Georgia Agenda_ENG.pdf | 2025-11-20 22:11 | 820K | |
![[ ]](/icons/unknown.gif) | Draft press release for policy seminar_March 7 2017.docx | 2025-11-20 22:11 | 18K | |
![[ ]](/icons/unknown.gif) | Draft press release for policy seminar_March 7, 2017.docx | 2025-11-20 22:11 | 21K | |
![[ ]](/icons/unknown.gif) | Doc3.docx | 2025-11-20 22:11 | 19K | |
![[ ]](/icons/unknown.gif) | Copy of ჯანდაცვა comments EMC.xls | 2025-11-20 22:11 | 2.8M | |
![[ ]](/icons/unknown.gif) | შეთავაზება - ჯანდაცვის სამინისტრო - 07_03_17.xlsx | 2025-11-20 22:11 | 130K | |
![[ ]](/icons/unknown.gif) | სია-7 მარტი.xlsx | 2025-11-20 22:11 | 65K | |
![[ ]](/icons/unknown.gif) | რელიზი- საყოველთაო.docx | 2025-11-20 22:11 | 21K | |
![[ ]](/icons/unknown.gif) | მონაწილეთა სია short list_mails.doc | 2025-11-20 22:11 | 49K | |
![[ ]](/icons/unknown.gif) | მონაწილეთა სია short list.docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/unknown.gif) | მონაწილეთა სია short list (1).docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/unknown.gif) | მონაწილეთა სია.docx | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | ~WRD097.jpg | 2025-11-20 22:11 | 823 | |
![[IMG]](/icons/image2.gif) | image005 (63).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (62).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (74).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (73).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (126).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (125).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image002 (206).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (205).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (204).png | 2025-11-20 22:11 | 1.5K | |
![[IMG]](/icons/image2.gif) | image002 (203).png | 2025-11-20 22:11 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (725).png | 2025-11-20 22:11 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (724).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (723).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (722).png | 2025-11-20 22:11 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (721).png | 2025-11-20 22:11 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (720).png | 2025-11-20 22:11 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (719).png | 2025-11-20 22:11 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (554).jpg | 2025-11-20 22:11 | 3.7K | |
![[IMG]](/icons/image2.gif) | graycol (8).gif | 2025-11-20 22:11 | 105 | |
![[ ]](/icons/unknown.gif) | final AA Subcomm VI OpCons GEO (3).docx | 2025-11-20 22:11 | 24K | |
![[ ]](/icons/unknown.gif) | final AA Subcomm VI OpCons GEO (2).docx | 2025-11-20 22:11 | 24K | |
![[IMG]](/icons/image2.gif) | chven (33).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (32).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (31).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (30).png | 2025-11-20 22:11 | 7.2K | |
![[ ]](/icons/unknown.gif) | asocirebis qvejgufisshexvedra.docx | 2025-11-20 22:11 | 22K | |
![[ ]](/icons/unknown.gif) | WHOEURO2017 Nomin circular letterE.PDF | 2025-11-20 22:11 | 101K | |
![[ ]](/icons/unknown.gif) | UHC in Georgia-Aparnaa Geo.pptx | 2025-11-20 22:11 | 565K | |
![[ ]](/icons/unknown.gif) | UHC in Georgia-Aparnaa.pptx | 2025-11-20 22:11 | 594K | |
![[ ]](/icons/unknown.gif) | Turkey HTP for GEO.pptx | 2025-11-20 22:11 | 1.2M | |
![[ ]](/icons/unknown.gif) | Turkey HTP for GEO-Geo.PPTX | 2025-11-20 22:11 | 1.2M | |
![[ ]](/icons/unknown.gif) | Supporting statement.doc | 2025-11-20 22:11 | 30K | |
![[ ]](/icons/unknown.gif) | Supporting statement (1).doc | 2025-11-20 22:11 | 29K | |
![[ ]](/icons/unknown.gif) | Rev1 Draft - Birth registration.docx | 2025-11-20 22:11 | 25K | |
![[ ]](/icons/unknown.gif) | Policy seminar, March 7, 2017_v2.docx | 2025-11-20 22:11 | 43K | |
![[ ]](/icons/unknown.gif) | Passport - Nino Sergeenko.PDF | 2025-11-20 22:11 | 483K | |
![[ ]](/icons/layout.gif) | Passport - Nino Sergeenko-1.pdf | 2025-11-20 22:11 | 483K | |
![[ ]](/icons/layout.gif) | Passport - Nino Sergeenko-1 (1).pdf | 2025-11-20 22:11 | 483K | |
![[ ]](/icons/layout.gif) | Passport - Ani Sergeenko.pdf | 2025-11-20 22:11 | 486K | |
![[ ]](/icons/unknown.gif) | Passport - Ani Sergeenko (2).PDF | 2025-11-20 22:11 | 486K | |
![[ ]](/icons/layout.gif) | Passport - Ani Sergeenko (1).pdf | 2025-11-20 22:11 | 486K | |
![[ ]](/icons/layout.gif) | Nino Doc - Feb 25 2017 - 2-43PM.pdf | 2025-11-20 22:11 | 246K | |
![[ ]](/icons/layout.gif) | Nino Doc - Feb 25 2017 - 2-43 PM.pdf | 2025-11-20 22:11 | 246K | |
![[ ]](/icons/layout.gif) | Nino Doc - Feb 25 2017 - 2-43PM (1).pdf | 2025-11-20 22:11 | 246K | |
![[IMG]](/icons/image2.gif) | NOTA-DIRECTOR GOBERNANZAGAVI-2-MIEMBRO JUNTA DIRECTIVA DE GAVI.JPG | 2025-11-20 22:11 | 342K | |
![[IMG]](/icons/image2.gif) | NOTA-DIRECTOR GOBERNANZAGAVI-1-MIEMBRO JUNTA DIRECTIVA DE GAVI.JPG | 2025-11-20 22:11 | 365K | |
![[ ]](/icons/unknown.gif) | NINO BERDZULI CV 2017.doc | 2025-11-20 22:11 | 50K | |
![[ ]](/icons/layout.gif) | Mission de-brief Georgia visit 28Feb-2 March 2017.pdf | 2025-11-20 22:11 | 196K | |
![[ ]](/icons/layout.gif) | Letter Representation EURO_PAHOBoard.pdf | 2025-11-20 22:11 | 88K | |
![[ ]](/icons/unknown.gif) | Invitation_Geo (3).docx | 2025-11-20 22:11 | 16K | |
![[ ]](/icons/unknown.gif) | Invitation_Geo (2).docx | 2025-11-20 22:11 | 16K | |
![[ ]](/icons/unknown.gif) | Invitation_Eng (2).docx | 2025-11-20 22:11 | 16K | |
![[ ]](/icons/layout.gif) | Gavi-2017-84 - Letter to HE DavidSergeenko - Minister of LabourHealth and Social Affairs of Georgia.pdf | 2025-11-20 22:11 | 113K | |
![[ ]](/icons/unknown.gif) | EU March 28_2017.docx | 2025-11-20 22:11 | 52K | |
![[ ]](/icons/layout.gif) | EU-MoU signed.pdf | 2025-11-20 22:11 | 586K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_GEO_D5 (3).docx | 2025-11-20 22:11 | 42K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_GEO_D5 (2).docx | 2025-11-20 22:11 | 42K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_ENG_D5 (2).docx | 2025-11-20 22:11 | 33K | |
![[ ]](/icons/unknown.gif) | Compliance Statement (1).docx | 2025-11-20 22:11 | 823K | |
![[ ]](/icons/unknown.gif) | CV_HRP_E_form-N_ Berdzuli.doc | 2025-11-20 22:11 | 103K | |
![[ ]](/icons/unknown.gif) | CV_HRP_E_form-N Berdzuli.doc | 2025-11-20 22:11 | 108K | |
![[ ]](/icons/unknown.gif) | Armenian Delegation visit_draftprogram_20_02_2017.doc | 2025-11-20 22:11 | 39K | |
![[ ]](/icons/layout.gif) | Ani Doc - Feb 25 2017 - 2-44PM.pdf | 2025-11-20 22:11 | 240K | |
![[ ]](/icons/layout.gif) | Ani Doc - Feb 25 2017 - 2-44 PM.pdf | 2025-11-20 22:11 | 240K | |
![[ ]](/icons/layout.gif) | Ani Doc - Feb 25 2017 - 2-44PM (1).pdf | 2025-11-20 22:11 | 240K | |
![[ ]](/icons/unknown.gif) | Agenda gasvliti sxdoma 13-15_03_2017.docx | 2025-11-20 22:11 | 84K | |
![[TXT]](/icons/text.gif) | ATT00002 (98).htm | 2025-11-20 22:11 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (97).htm | 2025-11-20 22:11 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (146).htm | 2025-11-20 22:11 | 608 | |
![[TXT]](/icons/text.gif) | ATT00001 (145).htm | 2025-11-20 22:11 | 608 | |
![[TXT]](/icons/text.gif) | ATT00001 (144).htm | 2025-11-20 22:11 | 168 | |
![[IMG]](/icons/image2.gif) | 24895547.gif | 2025-11-20 22:11 | 354 | |
![[IMG]](/icons/image2.gif) | 24551338.gif | 2025-11-20 22:11 | 246 | |
![[IMG]](/icons/image2.gif) | 24306704.gif | 2025-11-20 22:11 | 582 | |
![[IMG]](/icons/image2.gif) | 24258841.gif | 2025-11-20 22:11 | 358 | |
![[IMG]](/icons/image2.gif) | 24137687.gif | 2025-11-20 22:11 | 4.4K | |
![[ ]](/icons/unknown.gif) | 24_02_2017 - DRAFT ROC RESOLUTION.docx | 2025-11-20 22:11 | 46K | |
![[ ]](/icons/unknown.gif) | 7 აპრილის მოწვეულთა სია_draft3.docx | 2025-11-20 22:11 | 20K | |
![[ ]](/icons/unknown.gif) | 7 აპრილის მოწვეულთა სია_draft3 (1).docx | 2025-11-20 22:11 | 20K | |
![[ ]](/icons/unknown.gif) | 6_3_17 draft agenda.docx | 2025-11-20 22:11 | 28K | |
![[ ]](/icons/unknown.gif) | 6_3_17 draft agenda (3).docx | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/unknown.gif) | 6_3_17 draft agenda (2).docx | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/unknown.gif) | 6_3_17 draft agenda (1).docx | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/unknown.gif) | ტელეფონები 10_03_2017.xlsx | 2025-11-20 22:11 | 53K | |
![[ ]](/icons/unknown.gif) | რელიზი- საყოველთაო (2)ENG.docx | 2025-11-20 22:11 | 21K | |
![[ ]](/icons/unknown.gif) | short.docx | 2025-11-20 22:11 | 15K | |
![[ ]](/icons/layout.gif) | img-317201055.pdf | 2025-11-20 22:11 | 282K | |
![[IMG]](/icons/image2.gif) | image002 (202).png | 2025-11-20 22:11 | 1.5K | |
![[IMG]](/icons/image2.gif) | image002 (201).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | image002 (7).gif | 2025-11-20 22:11 | 1.1K | |
![[IMG]](/icons/image2.gif) | image001 (718).png | 2025-11-20 22:11 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (717).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (716).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (715).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (714).png | 2025-11-20 22:11 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (105).gif | 2025-11-20 22:11 | 1.1K | |
![[IMG]](/icons/image2.gif) | image001 (104).gif | 2025-11-20 22:11 | 7.6K | |
![[ ]](/icons/unknown.gif) | final conclusions AA Labour.docx | 2025-11-20 22:11 | 28K | |
![[ ]](/icons/unknown.gif) | final AA Subcomm VI OpCons GEO.docx | 2025-11-20 22:11 | 24K | |
![[ ]](/icons/unknown.gif) | final AA Subcomm VI OpCons GEO (1).docx | 2025-11-20 22:11 | 24K | |
![[IMG]](/icons/image2.gif) | chven (29).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (28).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (27).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (26).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (25).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-01 (4).png | 2025-11-20 22:11 | 71K | |
![[ ]](/icons/unknown.gif) | MM (2).docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/unknown.gif) | List if invitees_April7_updated.doc | 2025-11-20 22:11 | 51K | |
![[ ]](/icons/unknown.gif) | List if invitees_April 7.doc | 2025-11-20 22:11 | 46K | |
![[ ]](/icons/unknown.gif) | List UNFPA TBD.docx | 2025-11-20 22:11 | 29K | |
![[ ]](/icons/layout.gif) | KOPALA Qartuli.pdf | 2025-11-20 22:11 | 1.1M | |
![[ ]](/icons/unknown.gif) | Invitation_Geo (1).docx | 2025-11-20 22:11 | 16K | |
![[ ]](/icons/unknown.gif) | Invitation_Eng (1).docx | 2025-11-20 22:11 | 16K | |
![[IMG]](/icons/image2.gif) | IMG_2598.JPG | 2025-11-20 22:11 | 726K | |
![[ ]](/icons/unknown.gif) | GEO-Armenian Delegation visitprogram_17_03_2017.doc | 2025-11-20 22:11 | 44K | |
![[ ]](/icons/unknown.gif) | EU March 28 2017.docx | 2025-11-20 22:11 | 24K | |
![[ ]](/icons/unknown.gif) | EU Brussels 28_03.docx | 2025-11-20 22:11 | 22K | |
![[ ]](/icons/unknown.gif) | EU-NATO_CommunicationsStrategy.docx | 2025-11-20 22:11 | 60K | |
![[ ]](/icons/unknown.gif) | ENG_Armenian Delegation visitprogram_17_03_2017.doc | 2025-11-20 22:11 | 40K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_GEO_D5 (1).docx | 2025-11-20 22:11 | 42K | |
![[ ]](/icons/unknown.gif) | Brussels labour.docx | 2025-11-20 22:11 | 23K | |
![[ ]](/icons/unknown.gif) | Armenian Delegation visit_draftprogram_16_03_2017.doc | 2025-11-20 22:11 | 40K | |
![[ ]](/icons/unknown.gif) | Armenian Delegation visit_draftprogram_15_03_2017.doc | 2025-11-20 22:11 | 39K | |
![[ ]](/icons/unknown.gif) | Amb_ Tarek MAATY - EGYPT.docx | 2025-11-20 22:11 | 22K | |
![[ ]](/icons/layout.gif) | AA NAP-2016-მოკლე ანგარიში (1).pdf | 2025-11-20 22:11 | 761K | |
![[ ]](/icons/unknown.gif) | 20170222 AA Agenda-EUfeedback-confidential.doc | 2025-11-20 22:11 | 375K | |
![[ ]](/icons/layout.gif) | 170313_Gavi-Georgia-HPVinformation letter.pdf | 2025-11-20 22:11 | 69K | |
![[ ]](/icons/unknown.gif) | 20_03 jandacvis saministro.xls | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/unknown.gif) | 7აპრილის მოსაწვევი სია.docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/unknown.gif) | 7 აპრილის განახლებული.docx | 2025-11-20 22:11 | 24K | |
![[ ]](/icons/unknown.gif) | საყოველთაო_ENG.ppt | 2025-11-20 22:11 | 5.4M | |
![[ ]](/icons/unknown.gif) | საყოველთაო.pptx | 2025-11-20 22:11 | 3.2M | |
![[ ]](/icons/unknown.gif) | პროგრამა-სამეგრელო.docx | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/unknown.gif) | პროგრამა-სამეგრელო.doc | 2025-11-20 22:11 | 55K | |
![[ ]](/icons/unknown.gif) | კატარი_მემორანდუმი_GEO.doc | 2025-11-20 22:11 | 48K | |
![[ ]](/icons/unknown.gif) | კატარი_მემორანდუმი_GEO (1).doc | 2025-11-20 22:11 | 48K | |
![[ ]](/icons/unknown.gif) | კატარი_მემორანდუმი_ENG.doc | 2025-11-20 22:11 | 34K | |
![[ ]](/icons/unknown.gif) | კატარი_მემორანდუმი_ENG (1).doc | 2025-11-20 22:11 | 34K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი (6).docx | 2025-11-20 22:11 | 18K | |
![[ ]](/icons/unknown.gif) | ანგარიში - კომუნიკაციის სტრატეგია - 15_03_2017 FINAL.docx | 2025-11-20 22:11 | 521K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (5).jpg | 2025-11-20 22:11 | 823 | |
![[IMG]](/icons/image2.gif) | image006 (21).jpg | 2025-11-20 22:11 | 823 | |
![[IMG]](/icons/image2.gif) | image006 (20).jpg | 2025-11-20 22:11 | 823 | |
![[IMG]](/icons/image2.gif) | image006 (19).jpg | 2025-11-20 22:11 | 823 | |
![[IMG]](/icons/image2.gif) | image005 (61).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (60).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (59).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (58).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (57).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (56).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (72).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (71).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (70).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (69).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (68).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (67).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (144).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (124).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (123).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (122).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (121).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (120).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (119).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image002 (256).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (200).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (199).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (198).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (197).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (196).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (195).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image001 (713).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (712).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (711).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (710).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (709).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (708).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (707).png | 2025-11-20 22:11 | 23K | |
![[ ]](/icons/layout.gif) | ScannedDocumentPreview[3].pdf | 2025-11-20 22:11 | 120K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-03.png | 2025-11-20 22:11 | 63K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-02 (3).png | 2025-11-20 22:11 | 74K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-02 (2).png | 2025-11-20 22:11 | 74K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-01 (3).png | 2025-11-20 22:11 | 73K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-01 (2).png | 2025-11-20 22:11 | 73K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_ENG-02.png | 2025-11-20 22:11 | 62K | |
![[ ]](/icons/unknown.gif) | MNH AP_final draft (1).docx | 2025-11-20 22:11 | 86K | |
![[ ]](/icons/unknown.gif) | LoP_MoLHSA (1).docx | 2025-11-20 22:11 | 30K | |
![[ ]](/icons/unknown.gif) | Georgia MNH Strategy_final draft (1).docx | 2025-11-20 22:11 | 156K | |
![[ ]](/icons/unknown.gif) | უკრაინა შესრულება (2).docx | 2025-11-20 22:11 | 43K | |
![[ ]](/icons/unknown.gif) | Повестка дня (2).doc | 2025-11-20 22:11 | 34K | |
![[ ]](/icons/unknown.gif) | ПРОТОКОЛ (2).doc | 2025-11-20 22:11 | 78K | |
![[IMG]](/icons/image2.gif) | utf-8''%E1%83%94%E1%83%99%E1%83%A0%E1%83%90%E1%83%9C%E1%83%98%E1%83%A1%E1%83%97%E1%83%95%E1%83%98%E1%83%A1.png | 2025-11-20 22:11 | 117K | |
![[IMG]](/icons/image2.gif) | image006 (18).jpg | 2025-11-20 22:11 | 823 | |
![[IMG]](/icons/image2.gif) | image005 (55).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (54).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (66).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (65).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (118).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (117).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image002 (255).jpg | 2025-11-20 22:11 | 923 | |
![[IMG]](/icons/image2.gif) | image002 (254).jpg | 2025-11-20 22:11 | 923 | |
![[IMG]](/icons/image2.gif) | image002 (194).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (193).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image001 (706).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (705).png | 2025-11-20 22:11 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (704).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (703).png | 2025-11-20 22:11 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (702).png | 2025-11-20 22:11 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (553).jpg | 2025-11-20 22:11 | 4.9K | |
![[IMG]](/icons/image2.gif) | image001 (552).jpg | 2025-11-20 22:11 | 876 | |
![[IMG]](/icons/image2.gif) | image001 (551).jpg | 2025-11-20 22:11 | 876 | |
![[ ]](/icons/layout.gif) | Summary of American Health Care Act (2).pdf | 2025-11-20 22:11 | 447K | |
![[ ]](/icons/layout.gif) | Summary of American Health Care Act (1).pdf | 2025-11-20 22:11 | 447K | |
![[ ]](/icons/layout.gif) | Summary of Afordable Care Act (2).pdf | 2025-11-20 22:11 | 349K | |
![[ ]](/icons/layout.gif) | Summary of Afordable Care Act (1).pdf | 2025-11-20 22:11 | 349K | |
![[ ]](/icons/unknown.gif) | SPL mision agenda_27_03_2017.doc | 2025-11-20 22:11 | 42K | |
![[ ]](/icons/unknown.gif) | SPL mision agenda_27_03_2017 (2).doc | 2025-11-20 22:11 | 42K | |
![[ ]](/icons/unknown.gif) | SPL mision agenda_27_03_2017 (1).doc | 2025-11-20 22:11 | 42K | |
![[ ]](/icons/unknown.gif) | Pension Reform MoE.docx | 2025-11-20 22:11 | 16K | |
![[IMG]](/icons/image2.gif) | OutlookEmoji-1488296537377_PastedImage.png | 2025-11-20 22:11 | 11K | |
![[IMG]](/icons/image2.gif) | OutlookEmoji-1488296537377_PastedImage (2).png | 2025-11-20 22:11 | 11K | |
![[IMG]](/icons/image2.gif) | OutlookEmoji-1488296537377_PastedImage (1).png | 2025-11-20 22:11 | 11K | |
![[ ]](/icons/unknown.gif) | MoES Talking Points for 2nd subcommittee meeting on Employment,Social Policy, Equal Rights and Public Health.docx | 2025-11-20 22:11 | 46K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti_MAR-02.png | 2025-11-20 22:11 | 74K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti_MAR-01.png | 2025-11-20 22:11 | 64K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-02.png | 2025-11-20 22:11 | 73K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-02 (1).png | 2025-11-20 22:11 | 75K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-01.png | 2025-11-20 22:11 | 64K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-01 (1).png | 2025-11-20 22:11 | 64K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-007-02.png | 2025-11-20 22:11 | 73K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-007-01.png | 2025-11-20 22:11 | 64K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-005-02.png | 2025-11-20 22:11 | 74K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI_marti-005-01.png | 2025-11-20 22:11 | 64K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI - GEO.png | 2025-11-20 22:11 | 75K | |
![[IMG]](/icons/image2.gif) | MOSACVEVI - GEO (1).png | 2025-11-20 22:11 | 75K | |
![[ ]](/icons/layout.gif) | MNH AP_final draft.pdf | 2025-11-20 22:11 | 452K | |
![[ ]](/icons/unknown.gif) | MNH AP_final draft.docx | 2025-11-20 22:11 | 86K | |
![[ ]](/icons/unknown.gif) | LoP_MoLHSA.docx | 2025-11-20 22:11 | 31K | |
![[ ]](/icons/unknown.gif) | LoP 28-29_03_2017.docx | 2025-11-20 22:11 | 20K | |
![[ ]](/icons/unknown.gif) | Invitation_Geo.docx | 2025-11-20 22:11 | 16K | |
![[ ]](/icons/unknown.gif) | Invitation_Eng.docx | 2025-11-20 22:11 | 16K | |
![[ ]](/icons/unknown.gif) | Information MRA.docx | 2025-11-20 22:11 | 36K | |
![[ ]](/icons/layout.gif) | Georgia MNH Strategy_final draft.pdf | 2025-11-20 22:11 | 1.0M | |
![[ ]](/icons/unknown.gif) | Georgia MNH Strategy_final draft.docx | 2025-11-20 22:11 | 156K | |
![[ ]](/icons/layout.gif) | GEO ENG signed.pdf | 2025-11-20 22:11 | 86K | |
![[ ]](/icons/layout.gif) | ENG 2017_Scope and purpose PQTm RUS workshop.pdf | 2025-11-20 22:11 | 217K | |
![[ ]](/icons/layout.gif) | ENG 2017_Provisional agenda PQTm RUS workshop.pdf | 2025-11-20 22:11 | 248K | |
![[ ]](/icons/unknown.gif) | ENG 2016-წლის-AA-სამოქმედო-გეგმის-მოკლე-ანგარიში 6 თვე.docx | 2025-11-20 22:11 | 140K | |
![[ ]](/icons/unknown.gif) | ENG 2016-წლის-AA-სამოქმედო-გეგმის-მოკლე-ანგარიში 6 თვე (1).docx | 2025-11-20 22:11 | 140K | |
![[ ]](/icons/unknown.gif) | ENG 02 Scope and purpose_draft.docx | 2025-11-20 22:11 | 86K | |
![[ ]](/icons/unknown.gif) | Draft MoU with MoLSHA ENG Final 27March2017.doc | 2025-11-20 22:11 | 84K | |
![[ ]](/icons/unknown.gif) | Draft MoU with MoLSHA ENG Final 27March2017 (2).doc | 2025-11-20 22:11 | 84K | |
![[ ]](/icons/unknown.gif) | Draft MoU with MoLSHA ENG Final 27March2017 (1).doc | 2025-11-20 22:11 | 84K | |
![[IMG]](/icons/image2.gif) | DEDATA DA BAVSHVTA_80 x 200_PREVIEW-01.png | 2025-11-20 22:11 | 5.7M | |
![[IMG]](/icons/image2.gif) | DEDATA DA BAVHVTA_150 x 200_PREVIEW-01.png | 2025-11-20 22:11 | 4.5M | |
![[ ]](/icons/layout.gif) | Concept_Note.pdf | 2025-11-20 22:11 | 218K | |
![[ ]](/icons/layout.gif) | Concept_Note (2).pdf | 2025-11-20 22:11 | 218K | |
![[ ]](/icons/layout.gif) | Concept_Note (1).pdf | 2025-11-20 22:11 | 218K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_GEO_D5.docx | 2025-11-20 22:11 | 42K | |
![[ ]](/icons/layout.gif) | Concept_HL-Mtng_7Apr2017_GEO_D5 (2).pdf | 2025-11-20 22:11 | 219K | |
![[ ]](/icons/layout.gif) | Concept_HL-Mtng_7Apr2017_ENG_D5.pdf | 2025-11-20 22:11 | 381K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_ENG_D5.docx | 2025-11-20 22:11 | 33K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_ENG_D5 (1).docx | 2025-11-20 22:11 | 33K | |
![[ ]](/icons/unknown.gif) | Agenda Draft GEO 28-29 March.docx | 2025-11-20 22:11 | 100K | |
![[ ]](/icons/unknown.gif) | AA NAP-2016-მოკლე ანგარიში-15_03_17.docx | 2025-11-20 22:11 | 222K | |
![[ ]](/icons/unknown.gif) | AA NAP-2016-მოკლე ანგარიში-15_03_17 (1).docx | 2025-11-20 22:11 | 222K | |
![[ ]](/icons/unknown.gif) | 20170222 AA Agenda-EUfeedback-confidential_MoLHSA.doc | 2025-11-20 22:11 | 373K | |
![[ ]](/icons/unknown.gif) | 28_3_17 draft agenda.docx | 2025-11-20 22:11 | 31K | |
![[TXT]](/icons/text.gif) | მოსაწვევი ა_ზოიძე.html | 2025-11-20 22:11 | 57K | |
![[TXT]](/icons/text.gif) | მოსაწვევი ა_ზოიძე (2).html | 2025-11-20 22:11 | 57K | |
![[TXT]](/icons/text.gif) | მოსაწვევი ა_ზოიძე (1).html | 2025-11-20 22:11 | 57K | |
![[ ]](/icons/unknown.gif) | მოკლე ინფორმაცია არსებული მდგომარეობის შესახებ.docx | 2025-11-20 22:11 | 20K | |
![[ ]](/icons/unknown.gif) | მივლინების ანგარიშის ფორმა (3).doc | 2025-11-20 22:11 | 32K | |
![[ ]](/icons/unknown.gif) | მივლინების ანგარიშის ფორმა (2).doc | 2025-11-20 22:11 | 32K | |
![[IMG]](/icons/image2.gif) | image003 (143).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (142).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image002 (253).jpg | 2025-11-20 22:11 | 923 | |
![[IMG]](/icons/image2.gif) | image002 (252).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (251).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (701).png | 2025-11-20 22:11 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (700).png | 2025-11-20 22:11 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (699).png | 2025-11-20 22:11 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (698).png | 2025-11-20 22:11 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (697).png | 2025-11-20 22:11 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (696).png | 2025-11-20 22:11 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (695).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (694).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (550).jpg | 2025-11-20 22:11 | 876 | |
![[ ]](/icons/layout.gif) | Summary of American Health Care Act.pdf | 2025-11-20 22:11 | 447K | |
![[ ]](/icons/layout.gif) | Summary of Afordable Care Act.pdf | 2025-11-20 22:11 | 349K | |
![[ ]](/icons/unknown.gif) | LoP check list anc geo 300317 (4).xlsx | 2025-11-20 22:11 | 19K | |
![[ ]](/icons/unknown.gif) | LoP check list anc geo 300317 (3).xlsx | 2025-11-20 22:11 | 19K | |
![[ ]](/icons/unknown.gif) | LoP check list anc geo 300317 (2).xlsx | 2025-11-20 22:11 | 19K | |
![[ ]](/icons/compressed.gif) | ICGEB Board.zip | 2025-11-20 22:11 | 3.5M | |
![[ ]](/icons/layout.gif) | Georgia (11).pdf | 2025-11-20 22:11 | 255K | |
![[ ]](/icons/unknown.gif) | ENG 2016-წლის-AA-სამოქმედო-გეგმის-მოკლე-ანგარიში_MoLHSA (2).doc | 2025-11-20 22:11 | 196K | |
![[ ]](/icons/unknown.gif) | ENG 2016-წლის-AA-სამოქმედო-გეგმის-მოკლე-ანგარიში_MoLHSA (1).doc | 2025-11-20 22:11 | 196K | |
![[ ]](/icons/unknown.gif) | AGENDA ANC MEETING_ Tbilisi 20170209 (2).docx | 2025-11-20 22:11 | 40K | |
![[ ]](/icons/unknown.gif) | AGENDA ANC MEETING_ Tbilisi 20170209 (2) (2).docx | 2025-11-20 22:11 | 40K | |
![[ ]](/icons/unknown.gif) | AGENDA ANC MEETING_ Tbilisi 20170209 (2) (1).docx | 2025-11-20 22:11 | 40K | |
![[ ]](/icons/unknown.gif) | 20170327draft AA Agenda-EUfeedback-clean-confidential.docx | 2025-11-20 22:11 | 117K | |
![[ ]](/icons/unknown.gif) | 20170327draft AA Agenda-EUfeedback-clean-confidential.doc | 2025-11-20 22:11 | 260K | |
![[ ]](/icons/unknown.gif) | 20170327draft AA Agenda-EUfeedback-clean-confidential (2).docx | 2025-11-20 22:11 | 117K | |
![[ ]](/icons/unknown.gif) | 20170327draft AA Agenda-EUfeedback-clean-confidential (2).doc | 2025-11-20 22:11 | 260K | |
![[ ]](/icons/unknown.gif) | 20170327draft AA Agenda-EUfeedback-clean-confidential (1).docx | 2025-11-20 22:11 | 117K | |
![[ ]](/icons/unknown.gif) | 20170327draft AA Agenda-EUfeedback-clean-confidential (1).doc | 2025-11-20 22:11 | 260K | |
![[ ]](/icons/unknown.gif) | უკრაინა შესრულება.docx | 2025-11-20 22:11 | 43K | |
![[ ]](/icons/unknown.gif) | უკრაინა შესრულება (1).docx | 2025-11-20 22:11 | 43K | |
![[ ]](/icons/unknown.gif) | Повестка дня.doc | 2025-11-20 22:11 | 36K | |
![[ ]](/icons/unknown.gif) | Повестка дня (1).doc | 2025-11-20 22:11 | 36K | |
![[ ]](/icons/unknown.gif) | ПРОТОКОЛ.doc | 2025-11-20 22:11 | 80K | |
![[ ]](/icons/unknown.gif) | ПРОТОКОЛ (1).doc | 2025-11-20 22:11 | 80K | |
![[ ]](/icons/unknown.gif) | kariesis profilaqtika.docx | 2025-11-20 22:11 | 13K | |
![[ ]](/icons/unknown.gif) | kariesis profilaqtika (2).docx | 2025-11-20 22:11 | 13K | |
![[ ]](/icons/unknown.gif) | kariesis profilaqtika (1).docx | 2025-11-20 22:11 | 13K | |
![[IMG]](/icons/image2.gif) | image023.jpg | 2025-11-20 22:11 | 823 | |
![[IMG]](/icons/image2.gif) | image023 (1).jpg | 2025-11-20 22:11 | 823 | |
![[IMG]](/icons/image2.gif) | image021.png | 2025-11-20 22:11 | 2.4K | |
![[IMG]](/icons/image2.gif) | image021 (1).png | 2025-11-20 22:11 | 2.4K | |
![[IMG]](/icons/image2.gif) | image006 (30).png | 2025-11-20 22:11 | 542 | |
![[IMG]](/icons/image2.gif) | image006 (29).png | 2025-11-20 22:11 | 542 | |
![[IMG]](/icons/image2.gif) | image005 (53).png | 2025-11-20 22:11 | 601 | |
![[IMG]](/icons/image2.gif) | image005 (52).png | 2025-11-20 22:11 | 601 | |
![[IMG]](/icons/image2.gif) | image005 (51).png | 2025-11-20 22:11 | 57K | |
![[IMG]](/icons/image2.gif) | image005 (50).png | 2025-11-20 22:11 | 57K | |
![[IMG]](/icons/image2.gif) | image004 (64).png | 2025-11-20 22:11 | 612 | |
![[IMG]](/icons/image2.gif) | image004 (63).png | 2025-11-20 22:11 | 612 | |
![[IMG]](/icons/image2.gif) | image001 (693).png | 2025-11-20 22:11 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (692).png | 2025-11-20 22:11 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (691).png | 2025-11-20 22:11 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (549).jpg | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (548).jpg | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (547).jpg | 2025-11-20 22:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (546).jpg | 2025-11-20 22:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (545).jpg | 2025-11-20 22:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (544).jpg | 2025-11-20 22:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (543).jpg | 2025-11-20 22:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (542).jpg | 2025-11-20 22:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (541).jpg | 2025-11-20 22:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (540).jpg | 2025-11-20 22:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (539).jpg | 2025-11-20 22:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (538).jpg | 2025-11-20 22:11 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (537).jpg | 2025-11-20 22:11 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (536).jpg | 2025-11-20 22:11 | 2.1K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLetterr.pdf | 2025-11-20 22:11 | 124K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLetterr (2).pdf | 2025-11-20 22:11 | 124K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLetterr (1).pdf | 2025-11-20 22:11 | 124K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLetterg.pdf | 2025-11-20 22:11 | 109K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLetterg (2).pdf | 2025-11-20 22:11 | 109K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLetterg (1).pdf | 2025-11-20 22:11 | 109K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLetterf.pdf | 2025-11-20 22:11 | 108K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLetterf (2).pdf | 2025-11-20 22:11 | 108K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLetterf (1).pdf | 2025-11-20 22:11 | 108K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLettere.pdf | 2025-11-20 22:11 | 100K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLettere (2).pdf | 2025-11-20 22:11 | 100K | |
![[ ]](/icons/layout.gif) | WHOEURO ExtensionNominationLettere (1).pdf | 2025-11-20 22:11 | 100K | |
![[ ]](/icons/unknown.gif) | SERGEENKO_David 2629475_rev1.docx | 2025-11-20 22:11 | 80K | |
![[ ]](/icons/unknown.gif) | SERGEENKO_David 2629475_rev1 (1).docx | 2025-11-20 22:11 | 80K | |
![[ ]](/icons/unknown.gif) | Obamacare.docx | 2025-11-20 22:11 | 32K | |
![[ ]](/icons/unknown.gif) | Obamacare (2).docx | 2025-11-20 22:11 | 32K | |
![[ ]](/icons/unknown.gif) | Obamacare (1).docx | 2025-11-20 22:11 | 32K | |
![[ ]](/icons/unknown.gif) | Memorandum WV _MoLHSAcomments.doc | 2025-11-20 22:11 | 113K | |
![[ ]](/icons/unknown.gif) | Memorandum WV _MoLHSAcomments (1).doc | 2025-11-20 22:11 | 113K | |
![[ ]](/icons/unknown.gif) | GTUC.DOCX | 2025-11-20 22:11 | 20K | |
![[ ]](/icons/unknown.gif) | GTUC (2).DOCX | 2025-11-20 22:11 | 20K | |
![[ ]](/icons/unknown.gif) | GTUC (1).DOCX | 2025-11-20 22:11 | 20K | |
![[ ]](/icons/unknown.gif) | ENG 2016-წლის-AA-სამოქმედო-გეგმის-მოკლე-ანგარიში_MoLHSA.doc | 2025-11-20 22:11 | 196K | |
![[ ]](/icons/unknown.gif) | Draft agenda _Forum meeting.docx | 2025-11-20 22:11 | 116K | |
![[ ]](/icons/unknown.gif) | Draft agenda _Forum meeting (2).docx | 2025-11-20 22:11 | 116K | |
![[ ]](/icons/unknown.gif) | Draft agenda _Forum meeting (1).docx | 2025-11-20 22:11 | 116K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_R_form.doc | 2025-11-20 22:11 | 48K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_R_form (2).doc | 2025-11-20 22:11 | 48K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_R_form (1).doc | 2025-11-20 22:11 | 48K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_G_form.doc | 2025-11-20 22:11 | 47K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_G_form (2).doc | 2025-11-20 22:11 | 47K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_G_form (1).doc | 2025-11-20 22:11 | 47K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_F_form.doc | 2025-11-20 22:11 | 49K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_F_form (2).doc | 2025-11-20 22:11 | 49K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_F_form (1).doc | 2025-11-20 22:11 | 49K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_E_form (4).doc | 2025-11-20 22:11 | 94K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_E_form (3).doc | 2025-11-20 22:11 | 94K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_E_form (2).doc | 2025-11-20 22:11 | 94K | |
![[ ]](/icons/layout.gif) | About OGP Georgia.pdf | 2025-11-20 22:11 | 336K | |
![[ ]](/icons/layout.gif) | About OGP Georgia (2).pdf | 2025-11-20 22:11 | 336K | |
![[ ]](/icons/layout.gif) | About OGP Georgia (1).pdf | 2025-11-20 22:11 | 336K | |
![[ ]](/icons/layout.gif) | 01-275o-1.pdf | 2025-11-20 22:11 | 59K | |
![[ ]](/icons/layout.gif) | 01-275o-1 (2).pdf | 2025-11-20 22:11 | 59K | |
![[ ]](/icons/layout.gif) | 01-275o-1 (1).pdf | 2025-11-20 22:11 | 59K | |
![[ ]](/icons/unknown.gif) | ღია მმართველობა საქართველოს 2016-2017 წწ სამოქმედო � (2) | 2025-11-20 22:11 | 270K | |
![[ ]](/icons/unknown.gif) | ღია მმართველობა საქართველოს 2016-2017 წწ სამოქმედო � (1) | 2025-11-20 22:11 | 270K | |
![[ ]](/icons/unknown.gif) | ღია მმართველობა საქართველოს 2016-2017 წწ სამოქმედო � | 2025-11-20 22:11 | 270K | |
![[IMG]](/icons/image2.gif) | image008 (21).png | 2025-11-20 22:11 | 537 | |
![[IMG]](/icons/image2.gif) | image008 (20).png | 2025-11-20 22:11 | 537 | |
![[IMG]](/icons/image2.gif) | image008 (19).png | 2025-11-20 22:11 | 537 | |
![[IMG]](/icons/image2.gif) | image007 (22).png | 2025-11-20 22:11 | 601 | |
![[IMG]](/icons/image2.gif) | image007 (21).png | 2025-11-20 22:11 | 601 | |
![[IMG]](/icons/image2.gif) | image007 (20).png | 2025-11-20 22:11 | 601 | |
![[IMG]](/icons/image2.gif) | image006 (28).png | 2025-11-20 22:11 | 57K | |
![[IMG]](/icons/image2.gif) | image006 (27).png | 2025-11-20 22:11 | 57K | |
![[IMG]](/icons/image2.gif) | image006 (26).png | 2025-11-20 22:11 | 57K | |
![[IMG]](/icons/image2.gif) | image005 (49).png | 2025-11-20 22:11 | 2.4K | |
![[IMG]](/icons/image2.gif) | image005 (48).png | 2025-11-20 22:11 | 2.4K | |
![[IMG]](/icons/image2.gif) | image005 (47).png | 2025-11-20 22:11 | 2.4K | |
![[IMG]](/icons/image2.gif) | image005 (46).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (45).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (44).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image005 (43).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (62).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (61).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (60).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (59).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (116).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (115).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (114).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (113).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image002 (192).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (191).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (190).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (189).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image001 (690).png | 2025-11-20 22:11 | 57K | |
![[IMG]](/icons/image2.gif) | image001 (689).png | 2025-11-20 22:11 | 612 | |
![[IMG]](/icons/image2.gif) | image001 (688).png | 2025-11-20 22:11 | 612 | |
![[IMG]](/icons/image2.gif) | image001 (687).png | 2025-11-20 22:11 | 612 | |
![[IMG]](/icons/image2.gif) | image001 (686).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (685).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (684).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (683).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (535).jpg | 2025-11-20 22:11 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001 (534).jpg | 2025-11-20 22:11 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001 (533).jpg | 2025-11-20 22:11 | 3.3K | |
![[IMG]](/icons/image2.gif) | chven (24).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (23).png | 2025-11-20 22:11 | 7.2K | |
![[ ]](/icons/unknown.gif) | SC VI 28_03_2017 (5).docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/unknown.gif) | SC VI 28_03_2017 (4).docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/unknown.gif) | Program_Georgia_04 04 2017_РУС.doc | 2025-11-20 22:11 | 95K | |
![[ ]](/icons/unknown.gif) | Program_Georgia_04 04 2017_РУС (1).doc | 2025-11-20 22:11 | 95K | |
![[ ]](/icons/layout.gif) | Policy Brief_ The Cost of Free Contraceptives_ Jari Kempers_ UNFPA Georgia (1).pdf | 2025-11-20 22:11 | 380K | |
![[ ]](/icons/unknown.gif) | Policy Brief_ The Cost of Free Contraceptives_Geo (1).docx | 2025-11-20 22:11 | 181K | |
![[ ]](/icons/layout.gif) | Policy Brief FP Georgia_GEO_F (1).pdf | 2025-11-20 22:11 | 672K | |
![[ ]](/icons/layout.gif) | Policy Brief FP Georgia_Eng (1).pdf | 2025-11-20 22:11 | 626K | |
![[ ]](/icons/unknown.gif) | Memorandum WV _MoLHSA_final.doc | 2025-11-20 22:11 | 112K | |
![[ ]](/icons/unknown.gif) | Memorandum WV _MoLHSA_final (2).doc | 2025-11-20 22:11 | 112K | |
![[ ]](/icons/unknown.gif) | Memorandum WV _MoLHSA_final (1).doc | 2025-11-20 22:11 | 112K | |
![[ ]](/icons/unknown.gif) | MNH AP_ENG_31-03-17 (1).docx | 2025-11-20 22:11 | 83K | |
![[ ]](/icons/unknown.gif) | MNH AP_31-03-17_GEO (1).docx | 2025-11-20 22:11 | 143K | |
![[ ]](/icons/unknown.gif) | Georgia MNH Strategy_Geo_31-03-17 (1).docx | 2025-11-20 22:11 | 357K | |
![[ ]](/icons/unknown.gif) | Georgia MNH Strategy_ENG-31-03-17 (1).docx | 2025-11-20 22:11 | 164K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_GEO_F.docx | 2025-11-20 22:11 | 157K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_GEO_F (2).docx | 2025-11-20 22:11 | 157K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_GEO_F (1).docx | 2025-11-20 22:11 | 157K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_ENG_F.DOCX | 2025-11-20 22:11 | 145K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_ENG_F (2).DOCX | 2025-11-20 22:11 | 145K | |
![[ ]](/icons/unknown.gif) | Concept_HL-Mtng_7Apr2017_ENG_F (1).DOCX | 2025-11-20 22:11 | 145K | |
![[ ]](/icons/unknown.gif) | April 7, რელიზი - UNFPA, UNICEF.docx | 2025-11-20 22:11 | 71K | |
![[ ]](/icons/unknown.gif) | April 7, რელიზი - UNFPA, UNICEF (2).docx | 2025-11-20 22:11 | 71K | |
![[ ]](/icons/unknown.gif) | April 7, რელიზი - UNFPA, UNICEF (1).docx | 2025-11-20 22:11 | 71K | |
![[ ]](/icons/unknown.gif) | Agenda (1).docx | 2025-11-20 22:11 | 150K | |
![[IMG]](/icons/image2.gif) | image005 (42).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (58).png | 2025-11-20 22:11 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (141).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (140).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (139).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (112).png | 2025-11-20 22:11 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (111).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | image003 (110).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | image003 (109).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | image002 (250).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (249).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (248).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (188).png | 2025-11-20 22:11 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (187).png | 2025-11-20 22:11 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (186).png | 2025-11-20 22:11 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (185).png | 2025-11-20 22:11 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (184).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (183).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (182).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (181).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (180).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (179).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (178).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (177).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (176).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (175).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (174).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (173).png | 2025-11-20 22:11 | 185 | |
![[IMG]](/icons/image2.gif) | image001 (682).png | 2025-11-20 22:11 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (681).png | 2025-11-20 22:11 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (680).png | 2025-11-20 22:11 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (679).png | 2025-11-20 22:11 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (678).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (677).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (676).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (675).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (674).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (673).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (672).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (671).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (670).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (669).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (668).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (532).jpg | 2025-11-20 22:11 | 8.6K | |
![[IMG]](/icons/image2.gif) | image001 (531).jpg | 2025-11-20 22:11 | 8.6K | |
![[ ]](/icons/layout.gif) | Zaza Sopromadze - Tbilisi-Barcelona-Tbilisi.pdf | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/layout.gif) | Zaza Sopromadze - Tbilisi-Barcelona-Tbilisi (1).pdf | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/layout.gif) | Sopo Belkania - Tbilisi-Barcelona-Tbilisi.pdf | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/layout.gif) | Sopo Belkania - Tbilisi-Barcelona-Tbilisi (1).pdf | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/layout.gif) | Policy Brief_ The Cost of Free Contraceptives_ Jari Kempers_ UNFPA Georgia.pdf | 2025-11-20 22:11 | 380K | |
![[ ]](/icons/unknown.gif) | Policy Brief_ The Cost of Free Contraceptives_Geo.docx | 2025-11-20 22:11 | 181K | |
![[ ]](/icons/layout.gif) | Policy Brief FP Georgia_GEO_F.pdf | 2025-11-20 22:11 | 672K | |
![[ ]](/icons/layout.gif) | Policy Brief FP Georgia_Eng.pdf | 2025-11-20 22:11 | 626K | |
![[ ]](/icons/layout.gif) | Nino Berdzuli - Tbilisi-Barcelona-Tbilisi.pdf | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/layout.gif) | Nino Berdzuli - Tbilisi-Barcelona-Tbilisi (1).pdf | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze-Tbilisi-Barcelona-Tbilisi.pdf | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze-Tbilisi-Barcelona-Tbilisi (1).pdf | 2025-11-20 22:11 | 27K | |
![[ ]](/icons/unknown.gif) | MNH AP_ENG_31-03-17.docx | 2025-11-20 22:11 | 83K | |
![[ ]](/icons/unknown.gif) | MNH AP_31-03-17_GEO.docx | 2025-11-20 22:11 | 143K | |
![[ ]](/icons/unknown.gif) | Georgia MNH Strategy_Geo_31-03-17.docx | 2025-11-20 22:11 | 357K | |
![[ ]](/icons/unknown.gif) | Georgia MNH Strategy_ENG-31-03-17.docx | 2025-11-20 22:11 | 164K | |
![[ ]](/icons/unknown.gif) | FCTC 2030 thank you letter.docx | 2025-11-20 22:11 | 14K | |
![[ ]](/icons/unknown.gif) | FCTC 2030 thank you letter (1).docx | 2025-11-20 22:11 | 14K | |
![[ ]](/icons/layout.gif) | David Sergeenko - Tbilisi-Barcelona.pdf | 2025-11-20 22:11 | 25K | |
![[ ]](/icons/layout.gif) | David Sergeenko - Tbilisi-Barcelona (1).pdf | 2025-11-20 22:11 | 25K | |
![[ ]](/icons/layout.gif) | DavidSergeenko-Barcelona-Amsterdam.pdf | 2025-11-20 22:11 | 53K | |
![[ ]](/icons/layout.gif) | David Sergeenko-Barcelona-Amsterdam.pdf | 2025-11-20 22:11 | 57K | |
![[ ]](/icons/layout.gif) | David Sergeenko-Barcelona-Amsterdam (1).pdf | 2025-11-20 22:11 | 57K | |
![[ ]](/icons/layout.gif) | David Sergeenko-Amsterdam-Tbilisi.pdf | 2025-11-20 22:11 | 60K | |
![[ ]](/icons/layout.gif) | David Sergeenko-Amsterdam-Tbilisi (1).pdf | 2025-11-20 22:11 | 60K | |
![[ ]](/icons/layout.gif) | CSF HS 17 35 07 (3).pdf | 2025-11-20 22:11 | 140K | |
![[ ]](/icons/layout.gif) | CSF HS 17 35 07 (2).pdf | 2025-11-20 22:11 | 140K | |
![[ ]](/icons/unknown.gif) | Agenda.docx | 2025-11-20 22:11 | 150K | |
![[TXT]](/icons/text.gif) | ATT00009 (6).htm | 2025-11-20 22:11 | 168 | |
![[TXT]](/icons/text.gif) | ATT00009 (5).htm | 2025-11-20 22:11 | 168 | |
![[TXT]](/icons/text.gif) | ATT00008 (8).htm | 2025-11-20 22:11 | 216 | |
![[TXT]](/icons/text.gif) | ATT00008 (7).htm | 2025-11-20 22:11 | 216 | |
![[TXT]](/icons/text.gif) | ATT00007 (8).htm | 2025-11-20 22:11 | 804 | |
![[TXT]](/icons/text.gif) | ATT00007 (7).htm | 2025-11-20 22:11 | 804 | |
![[TXT]](/icons/text.gif) | ATT00006 (22).htm | 2025-11-20 22:11 | 717 | |
![[TXT]](/icons/text.gif) | ATT00006 (21).htm | 2025-11-20 22:11 | 717 | |
![[TXT]](/icons/text.gif) | ATT00005 (29).htm | 2025-11-20 22:11 | 715 | |
![[TXT]](/icons/text.gif) | ATT00005 (28).htm | 2025-11-20 22:11 | 715 | |
![[TXT]](/icons/text.gif) | ATT00004 (37).htm | 2025-11-20 22:11 | 727 | |
![[TXT]](/icons/text.gif) | ATT00004 (36).htm | 2025-11-20 22:11 | 727 | |
![[TXT]](/icons/text.gif) | ATT00003 (54).htm | 2025-11-20 22:11 | 854 | |
![[TXT]](/icons/text.gif) | ATT00003 (53).htm | 2025-11-20 22:11 | 854 | |
![[TXT]](/icons/text.gif) | ATT00002 (96).htm | 2025-11-20 22:11 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00002 (95).htm | 2025-11-20 22:11 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00001 (143).htm | 2025-11-20 22:11 | 1.7K | |
![[TXT]](/icons/text.gif) | ATT00001 (142).htm | 2025-11-20 22:11 | 1.7K | |
![[IMG]](/icons/image2.gif) | 2 (77).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (76).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (75).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (74).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (73).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (72).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (71).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (89).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (88).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (87).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (86).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (85).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (84).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (83).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image007 (19).png | 2025-11-20 22:11 | 536 | |
![[IMG]](/icons/image2.gif) | image007 (18).png | 2025-11-20 22:11 | 536 | |
![[IMG]](/icons/image2.gif) | image006 (25).png | 2025-11-20 22:11 | 601 | |
![[IMG]](/icons/image2.gif) | image006 (24).png | 2025-11-20 22:11 | 601 | |
![[IMG]](/icons/image2.gif) | image005 (41).png | 2025-11-20 22:11 | 612 | |
![[IMG]](/icons/image2.gif) | image005 (40).png | 2025-11-20 22:11 | 612 | |
![[IMG]](/icons/image2.gif) | image004 (57).png | 2025-11-20 22:11 | 2.4K | |
![[IMG]](/icons/image2.gif) | image004 (56).png | 2025-11-20 22:11 | 2.4K | |
![[IMG]](/icons/image2.gif) | image003 (138).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (137).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (136).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (135).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | image002 (247).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (246).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (245).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (244).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (667).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (666).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (665).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (664).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (663).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (662).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (661).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (660).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (659).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (658).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (657).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (656).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (655).png | 2025-11-20 22:11 | 27K | |
![[IMG]](/icons/image2.gif) | idpass.jpg | 2025-11-20 22:11 | 133K | |
![[IMG]](/icons/image2.gif) | idpass (1).jpg | 2025-11-20 22:11 | 133K | |
![[IMG]](/icons/image2.gif) | chven (22).png | 2025-11-20 22:11 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (21).png | 2025-11-20 22:11 | 7.2K | |
![[ ]](/icons/unknown.gif) | SC VI 28_03_2017_1.docx | 2025-11-20 22:11 | 31K | |
![[ ]](/icons/unknown.gif) | SC VI 28_03_2017_1 (1).docx | 2025-11-20 22:11 | 31K | |
![[ ]](/icons/unknown.gif) | SC VI 28_03_2017.docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/unknown.gif) | SC VI 28_03_2017 (3).docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/unknown.gif) | SC VI 28_03_2017 (2).docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/unknown.gif) | SC VI 28_03_2017 (1).docx | 2025-11-20 22:11 | 26K | |
![[ ]](/icons/layout.gif) | Letter to FCTC.pdf | 2025-11-20 22:11 | 95K | |
![[ ]](/icons/unknown.gif) | Draft_PROTOKOL_05042017_LT_V1.doc | 2025-11-20 22:11 | 165K | |
![[ ]](/icons/unknown.gif) | DraftAgenda_05042017_LT_V1.doc | 2025-11-20 22:11 | 37K | |
![[ ]](/icons/unknown.gif) | April 7 Press release - ENG.docx | 2025-11-20 22:11 | 70K | |
![[ ]](/icons/unknown.gif) | Agenda_06-04-17.docx | 2025-11-20 22:11 | 150K | |
![[ ]](/icons/unknown.gif) | Agenda_06-04-17 (1).docx | 2025-11-20 22:11 | 150K | |
![[ ]](/icons/unknown.gif) | 15801.doc | 2025-11-20 22:11 | 469K | |
![[IMG]](/icons/image2.gif) | 2 (70).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (69).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (68).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (67).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (66).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (65).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (64).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (63).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (62).jpg | 2025-11-20 22:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (82).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (81).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (80).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (79).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (78).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (77).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (76).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (75).jpg | 2025-11-20 22:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (74).jpg | 2025-11-20 22:11 | 3.2K | |
![[ ]](/icons/unknown.gif) | უკრაინა ბოლო ბრძანება 2017.doc | 2025-11-20 22:11 | 37K | |
![[ ]](/icons/unknown.gif) | უკრაინა ბოლო ბრძანება 2017 (1).doc | 2025-11-20 22:11 | 37K | |
![[IMG]](/icons/image2.gif) | ზაზას სოფრომაძის პასპორტი.jpg | 2025-11-20 22:11 | 135K | |
![[IMG]](/icons/image2.gif) | ზაზას სოფრომაძის პასპორტი (1).jpg | 2025-11-20 22:11 | 135K | |
![[ ]](/icons/unknown.gif) | Сценарий укр-груз Комиссии рос (2).doc | 2025-11-20 22:11 | 90K | |
![[ ]](/icons/unknown.gif) | Сценарий укр-груз Комиссии рос (1).doc | 2025-11-20 22:11 | 90K | |
![[ ]](/icons/unknown.gif) | Состав укр_ делегации_рус.doc | 2025-11-20 22:11 | 56K | |
![[ ]](/icons/unknown.gif) | samusao SExvedra 23_02_17 -27 marti.docx | 2025-11-20 22:10 | 38K | |
![[ ]](/icons/unknown.gif) | samusao SExvedra 23_02_17 -27 marti (1).docx | 2025-11-20 22:10 | 38K | |
![[ ]](/icons/unknown.gif) | irine javakhadze.docx | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | irine javakhadze - Engy.docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | irine javakhadze - Engy (1).docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | irine javakhadze (1).docx | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | image005 (23).jpg | 2025-11-20 22:10 | 7.3K | |
![[IMG]](/icons/image2.gif) | image003 (134).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (133).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (132).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (108).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (243).jpg | 2025-11-20 22:10 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (242).jpg | 2025-11-20 22:10 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (241).jpg | 2025-11-20 22:10 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (172).png | 2025-11-20 22:10 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (171).png | 2025-11-20 22:10 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (170).png | 2025-11-20 22:10 | 1.3K | |
![[IMG]](/icons/image2.gif) | image001 (654).png | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (653).png | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (652).png | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (651).png | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (650).png | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (649).png | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (648).png | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (647).png | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (530).jpg | 2025-11-20 22:10 | 8.6K | |
![[IMG]](/icons/image2.gif) | image001 (529).jpg | 2025-11-20 22:10 | 8.6K | |
![[ ]](/icons/unknown.gif) | V_getia_ information for PLP2017.docx | 2025-11-20 22:10 | 1.1M | |
![[ ]](/icons/unknown.gif) | V_getia_ information for PLP2017 (1).docx | 2025-11-20 22:10 | 1.1M | |
![[ ]](/icons/layout.gif) | TB.pdf | 2025-11-20 22:10 | 129K | |
![[ ]](/icons/layout.gif) | TB (1).pdf | 2025-11-20 22:10 | 129K | |
![[ ]](/icons/layout.gif) | SOPROMADZE ZAZA MR.pdf | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/layout.gif) | SOPROMADZE ZAZA MR (1).pdf | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | SC VI 20_03_2017.docx | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | SC VI 20_03_2017 (1).docx | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/layout.gif) | Public Lecture_Program.pdf | 2025-11-20 22:10 | 144K | |
![[ ]](/icons/unknown.gif) | Person12.docx | 2025-11-20 22:10 | 652K | |
![[ ]](/icons/layout.gif) | PPC Review of decisionsFINAL.pdf | 2025-11-20 22:10 | 427K | |
![[ ]](/icons/layout.gif) | PPC Review of decisionsFINAL (1).pdf | 2025-11-20 22:10 | 427K | |
![[ ]](/icons/unknown.gif) | L_Jabidze_ information for PLP2017.docx | 2025-11-20 22:10 | 1.1M | |
![[ ]](/icons/unknown.gif) | Invitation Letter Additional Info i_javakhadze.docx | 2025-11-20 22:10 | 1.1M | |
![[ ]](/icons/unknown.gif) | Invitation Letter Additional Info i_javakhadze (1).docx | 2025-11-20 22:10 | 1.1M | |
![[ ]](/icons/layout.gif) | Georgia 3 17.pdf | 2025-11-20 22:10 | 358K | |
![[ ]](/icons/layout.gif) | Georgia 3 17 (1).pdf | 2025-11-20 22:10 | 358K | |
![[ ]](/icons/unknown.gif) | Gavi.docx | 2025-11-20 22:10 | 13K | |
![[ ]](/icons/unknown.gif) | Gavi (1).docx | 2025-11-20 22:10 | 13K | |
![[ ]](/icons/layout.gif) | GEO Nomination Letter (3).pdf | 2025-11-20 22:10 | 71K | |
![[ ]](/icons/unknown.gif) | EkaterineAdamia_CV.docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | Draft_PROTOKOL_07042017_LT_V1.doc | 2025-11-20 22:10 | 208K | |
![[ ]](/icons/unknown.gif) | Draft_PROTOKOL_07042017_LT_V1 (1).doc | 2025-11-20 22:10 | 208K | |
![[ ]](/icons/unknown.gif) | Draft MoU with MoLSHA ENG Final27March2017_MoLHSA comments.doc | 2025-11-20 22:10 | 89K | |
![[ ]](/icons/layout.gif) | CSF HS 17 35 07.pdf | 2025-11-20 22:10 | 140K | |
![[ ]](/icons/layout.gif) | CSF HS 17 35 07 (1).pdf | 2025-11-20 22:10 | 140K | |
![[ ]](/icons/layout.gif) | Board-2016-Mtg-2-Final Minutes - For no objection consent.pdf | 2025-11-20 22:10 | 797K | |
![[ ]](/icons/layout.gif) | Board-2016-Mtg-2-Final Minutes - For no objection consent (1).pdf | 2025-11-20 22:10 | 797K | |
![[ ]](/icons/layout.gif) | 7-279.pdf | 2025-11-20 22:10 | 69K | |
![[ ]](/icons/layout.gif) | 7-279 (1).pdf | 2025-11-20 22:10 | 69K | |
![[IMG]](/icons/image2.gif) | 2 (61).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (60).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (59).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (58).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (57).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (56).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (73).jpg | 2025-11-20 22:10 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (72).jpg | 2025-11-20 22:10 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (71).jpg | 2025-11-20 22:10 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (70).jpg | 2025-11-20 22:10 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (69).jpg | 2025-11-20 22:10 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (68).jpg | 2025-11-20 22:10 | 3.2K | |
![[ ]](/icons/unknown.gif) | ოქმი N2 საბოლოო- სამუშაო შეხვედრა 16 03 20172.docx | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/unknown.gif) | ოქმი N2 საბოლოო- სამუშაო შეხვედრა 16 03 20172 (1).docx | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/unknown.gif) | ოქმი N1 საბოლოო- სამუშაო შეხვედრა 15 03 2017 (2).docx | 2025-11-20 22:10 | 38K | |
![[ ]](/icons/unknown.gif) | ოქმი N1 საბოლოო- სამუშაო შეხვედრა 15 03 2017 (2) (1).docx | 2025-11-20 22:10 | 38K | |
![[ ]](/icons/unknown.gif) | კვოტები_-_სამინისტროებს_10_04_2017.docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | კვოტები_-_სამინისტროებს_10_04_2017 (1).docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი - საბჭოს სხომის 10_04_17w.docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი - საბჭოს სხომის 10_04_17w (1).docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/layout.gif) | transactionconfirmation_Sergeenko_Berdzuli_Belkania_Darakhvelizde.pdf | 2025-11-20 22:10 | 42K | |
![[ ]](/icons/unknown.gif) | sample.xlsx | 2025-11-20 22:10 | 10K | |
![[ ]](/icons/unknown.gif) | list of flights.xlsx | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | list of flights (1).xlsx | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (107).png | 2025-11-20 22:10 | 93K | |
![[IMG]](/icons/image2.gif) | image002 (240).jpg | 2025-11-20 22:10 | 6.6K | |
![[IMG]](/icons/image2.gif) | image002 (239).jpg | 2025-11-20 22:10 | 6.6K | |
![[IMG]](/icons/image2.gif) | image002 (238).jpg | 2025-11-20 22:10 | 2.1K | |
![[IMG]](/icons/image2.gif) | image002 (237).jpg | 2025-11-20 22:10 | 2.1K | |
![[IMG]](/icons/image2.gif) | image002 (169).png | 2025-11-20 22:10 | 288K | |
![[IMG]](/icons/image2.gif) | image001 (646).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (645).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (644).png | 2025-11-20 22:10 | 268 | |
![[IMG]](/icons/image2.gif) | image001 (643).png | 2025-11-20 22:10 | 268 | |
![[IMG]](/icons/image2.gif) | image001 (642).png | 2025-11-20 22:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (528).jpg | 2025-11-20 22:10 | 4.3K | |
![[IMG]](/icons/image2.gif) | image001 (527).jpg | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image001 (526).jpg | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image001 (525).jpg | 2025-11-20 22:10 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001 (524).jpg | 2025-11-20 22:10 | 3.3K | |
![[IMG]](/icons/image2.gif) | graycol (7).gif | 2025-11-20 22:10 | 105 | |
![[IMG]](/icons/image2.gif) | graycol (6).gif | 2025-11-20 22:10 | 105 | |
![[ ]](/icons/layout.gif) | Zaza Sopromadze -Tbilisi-Barcelona-Tbilisi.pdf | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/layout.gif) | Transactionconfirmation_Sopromadze.pdf | 2025-11-20 22:10 | 47K | |
![[ ]](/icons/layout.gif) | Transactionconfirmation_Sergeenko.pdf | 2025-11-20 22:10 | 42K | |
![[ ]](/icons/layout.gif) | Transactionconfirmation_Sergeenko (1).pdf | 2025-11-20 22:10 | 42K | |
![[ ]](/icons/layout.gif) | Sopo Belkania -Tbilisi-Barcelona-Tbilisi.pdf | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | Obamacare-Trumpcare NB.docx | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | Obamacare-Trumpcare NB (1).docx | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/layout.gif) | Nino Berdzuli -Tbilisi-Barcelona-Tbilisi.pdf | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/layout.gif) | MarinaDarakhvelidze-Tbilisi-Barcelona-Tbilisi.pdf | 2025-11-20 22:10 | 27K | |
![[IMG]](/icons/image2.gif) | IMG_1025.PNG | 2025-11-20 22:10 | 137K | |
![[IMG]](/icons/image2.gif) | IMG_1025 (1).PNG | 2025-11-20 22:10 | 137K | |
![[ ]](/icons/unknown.gif) | Georgian - Under Obamacare.docx | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/unknown.gif) | Georgian - Under Obamacare (1).docx | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/layout.gif) | David Sergeenko -Tbilisi-Barcelona.pdf | 2025-11-20 22:10 | 19K | |
![[TXT]](/icons/text.gif) | ATT00001 (12).txt | 2025-11-20 22:10 | 25 | |
![[TXT]](/icons/text.gif) | ATT00001 (11).txt | 2025-11-20 22:10 | 25 | |
![[IMG]](/icons/image2.gif) | 20955683.gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | 20955683 (1).gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | 20354573.gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | 20354573 (1).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | 20126518.gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | 20126518 (1).gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | 20107111.gif | 2025-11-20 22:10 | 358 | |
![[IMG]](/icons/image2.gif) | 20107111 (1).gif | 2025-11-20 22:10 | 358 | |
![[IMG]](/icons/image2.gif) | 20081128.gif | 2025-11-20 22:10 | 354 | |
![[IMG]](/icons/image2.gif) | 20081128 (1).gif | 2025-11-20 22:10 | 354 | |
![[ ]](/icons/layout.gif) | 28_03_17_GEO_NC_E.pdf | 2025-11-20 22:10 | 66K | |
![[ ]](/icons/layout.gif) | 28_03_17_GEO_NC_E (1).pdf | 2025-11-20 22:10 | 66K | |
![[ ]](/icons/unknown.gif) | ჯანდაცვა.xls | 2025-11-20 22:10 | 2.8M | |
![[ ]](/icons/unknown.gif) | ჯანდაცვა (1).xls | 2025-11-20 22:10 | 2.8M | |
![[ ]](/icons/unknown.gif) | უკრაინის კომისია.docx | 2025-11-20 22:10 | 20K | |
![[ ]](/icons/unknown.gif) | უკრაინის კომისია (1).docx | 2025-11-20 22:10 | 20K | |
![[ ]](/icons/unknown.gif) | სხდომის დღის წესრიგი 13 აპრილის.doc | 2025-11-20 22:10 | 93K | |
![[ ]](/icons/unknown.gif) | სხდომის დღის წესრიგი 13 აპრილის (1).doc | 2025-11-20 22:10 | 93K | |
![[ ]](/icons/unknown.gif) | სტრატეგიის დანართი - 29_03_17.docx | 2025-11-20 22:10 | 25K | |
![[ ]](/icons/unknown.gif) | სტრატეგია _FINAL proofreading- 24_03_2017.docx | 2025-11-20 22:10 | 60K | |
![[ ]](/icons/unknown.gif) | თარგმანი Final.docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | თარგმანი Final (1).docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | თარგმანი (2).docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | თარგმანი (1).docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | Сценарий укр-груз Комиссии рос.doc | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/unknown.gif) | users-registration-data.xlsx | 2025-11-20 22:10 | 12K | |
![[ ]](/icons/unknown.gif) | users-registration-data (1).xlsx | 2025-11-20 22:10 | 12K | |
![[ ]](/icons/unknown.gif) | users-dependence.pptx | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/unknown.gif) | users-dependence (1).pptx | 2025-11-20 22:10 | 70K | |
![[IMG]](/icons/image2.gif) | tiff.djvu | 2025-11-20 22:10 | 341K | |
![[IMG]](/icons/image2.gif) | tiff (1).djvu | 2025-11-20 22:10 | 341K | |
![[IMG]](/icons/image2.gif) | image003 (106).png | 2025-11-20 22:10 | 93K | |
![[IMG]](/icons/image2.gif) | image002 (168).png | 2025-11-20 22:10 | 288K | |
![[IMG]](/icons/image2.gif) | image001 (641).png | 2025-11-20 22:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (640).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (639).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (523).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (522).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (521).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (520).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (519).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (518).jpg | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | danarti.docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | danarti (1).docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/layout.gif) | WHO Mental Health Atlas 2017.pdf | 2025-11-20 22:10 | 222K | |
![[ ]](/icons/unknown.gif) | SC VI 20_03_2017-health.docx | 2025-11-20 22:10 | 39K | |
![[ ]](/icons/unknown.gif) | SC VI 20_03_2017-health (1).docx | 2025-11-20 22:10 | 39K | |
![[ ]](/icons/unknown.gif) | Mental Health ATLAS questionnaire ENGLISH.DOCX | 2025-11-20 22:10 | 159K | |
![[ ]](/icons/unknown.gif) | LoP check list anc geo 300317.xlsx | 2025-11-20 22:10 | 19K | |
![[ ]](/icons/unknown.gif) | LoP check list anc geo 300317 (1).xlsx | 2025-11-20 22:10 | 19K | |
![[ ]](/icons/unknown.gif) | LoP ANC mtg GEO v4.doc | 2025-11-20 22:10 | 173K | |
![[ ]](/icons/unknown.gif) | LoP ANC mtg GEO v4 (1).doc | 2025-11-20 22:10 | 173K | |
![[ ]](/icons/unknown.gif) | Letter of candidature EB 2016.doc | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | Letter of candidature EB 2016 (1).doc | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | Gilead AE reporting form_Solicited Sources.doc | 2025-11-20 22:10 | 105K | |
![[ ]](/icons/unknown.gif) | Gilead AE reporting form_Solicited Sources (1).doc | 2025-11-20 22:10 | 105K | |
![[ ]](/icons/unknown.gif) | Georgia - Belarus letterNatia.docx | 2025-11-20 22:10 | 82K | |
![[ ]](/icons/unknown.gif) | Georgia - Belarus letterNatia (3).docx | 2025-11-20 22:10 | 82K | |
![[ ]](/icons/unknown.gif) | Georgia - Belarus letterNatia (2).docx | 2025-11-20 22:10 | 82K | |
![[ ]](/icons/unknown.gif) | Georgia - Belarus letterNatia (1).docx | 2025-11-20 22:10 | 82K | |
![[ ]](/icons/layout.gif) | GEO_NominatedFP_E.pdf | 2025-11-20 22:10 | 66K | |
![[ ]](/icons/unknown.gif) | EB_letter.doc | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | EB_letter (1).doc | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/layout.gif) | C_L_10_2017 (WHA70) (1).pdf | 2025-11-20 22:10 | 165K | |
![[ ]](/icons/layout.gif) | C_L_10_2017 (WHA70) (1) (1).pdf | 2025-11-20 22:10 | 165K | |
![[ ]](/icons/unknown.gif) | AGENDA ANC MEETING_ Tbilisi 20170224 par.docx | 2025-11-20 22:10 | 40K | |
![[ ]](/icons/unknown.gif) | AGENDA ANC MEETING_ Tbilisi 20170224 par (1).docx | 2025-11-20 22:10 | 40K | |
![[ ]](/icons/layout.gif) | უკრაინის 9-ე კომისიის რუსული ტექსტი.pdf | 2025-11-20 22:10 | 5.9M | |
![[ ]](/icons/layout.gif) | უკრაინის 9-ე კომისიის რუსული ტექსტი (1).pdf | 2025-11-20 22:10 | 5.9M | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსია.doc | 2025-11-20 22:10 | 54K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსია (6).doc | 2025-11-20 22:10 | 47K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსია (5).doc | 2025-11-20 22:10 | 64K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსია (4).doc | 2025-11-20 22:10 | 64K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსია (3).doc | 2025-11-20 22:10 | 54K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსია (2).doc | 2025-11-20 22:10 | 54K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსია (1).doc | 2025-11-20 22:10 | 54K | |
![[ ]](/icons/unknown.gif) | განკარგულების პროექტი - გილიადი.docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | განკარგულების პროექტი - გილიადი (1).docx | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (638).png | 2025-11-20 22:10 | 208 | |
![[IMG]](/icons/image2.gif) | image001 (637).png | 2025-11-20 22:10 | 208 | |
![[IMG]](/icons/image2.gif) | image001 (636).png | 2025-11-20 22:10 | 208 | |
![[IMG]](/icons/image2.gif) | image001 (635).png | 2025-11-20 22:10 | 208 | |
![[IMG]](/icons/image2.gif) | image001 (517).jpg | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | Story board content (2).docx | 2025-11-20 22:10 | 17K | |
![[ ]](/icons/unknown.gif) | Story board content (1).docx | 2025-11-20 22:10 | 17K | |
![[ ]](/icons/unknown.gif) | SSF Provided by EC.docx | 2025-11-20 22:10 | 121K | |
![[ ]](/icons/unknown.gif) | SSF Provided by EC (3).docx | 2025-11-20 22:10 | 121K | |
![[ ]](/icons/unknown.gif) | SSF Provided by EC (2).docx | 2025-11-20 22:10 | 121K | |
![[ ]](/icons/unknown.gif) | SSF Provided by EC (1).docx | 2025-11-20 22:10 | 121K | |
![[ ]](/icons/unknown.gif) | MoU_MOHLSA_Annex 2017 last updated.doc | 2025-11-20 22:10 | 55K | |
![[ ]](/icons/unknown.gif) | MoU_MOHLSA_Annex 2017 last updated.doc | 2025-11-20 22:10 | 55K | |
![[ ]](/icons/unknown.gif) | MoU_MOHLSA_Annex 2017 last updated (1).doc | 2025-11-20 22:10 | 55K | |
![[ ]](/icons/unknown.gif) | MoU_MOHLSA_Annex 2017 last updated (1).doc | 2025-11-20 22:10 | 55K | |
![[ ]](/icons/unknown.gif) | MoU OncologicalDiseases_2015.PDF | 2025-11-20 22:10 | 452K | |
![[ ]](/icons/unknown.gif) | MoU Oncological Diseases_2015.PDF | 2025-11-20 22:10 | 452K | |
![[ ]](/icons/unknown.gif) | MoU OncologicalDiseases_2015 (1).PDF | 2025-11-20 22:10 | 452K | |
![[ ]](/icons/unknown.gif) | MoU Oncological Diseases_2015 (1).PDF | 2025-11-20 22:10 | 452K | |
![[ ]](/icons/unknown.gif) | Key messages ANC Georgia 7 April.docx | 2025-11-20 22:10 | 19K | |
![[ ]](/icons/unknown.gif) | Key messages ANC Georgia 7 April (1).docx | 2025-11-20 22:10 | 19K | |
![[ ]](/icons/layout.gif) | DRAFT Provisional Programme ANC Tbilisi 200417_RUS.pdf | 2025-11-20 22:10 | 138K | |
![[ ]](/icons/layout.gif) | DRAFT Provisional Programme ANC Tbilisi 200417_RUS (1).pdf | 2025-11-20 22:10 | 138K | |
![[ ]](/icons/layout.gif) | DRAFT Provisional Programme ANC Tbilisi 200417 (3).pdf | 2025-11-20 22:10 | 106K | |
![[ ]](/icons/layout.gif) | DRAFT Provisional Programme ANC Tbilisi 200417 (2).pdf | 2025-11-20 22:10 | 106K | |
![[ ]](/icons/unknown.gif) | DRAFT Provisional Programme ANC Tbilisi 060417 (2).docx | 2025-11-20 22:10 | 103K | |
![[ ]](/icons/unknown.gif) | Agreement ofDonation_GEO_20_04_2017.doc | 2025-11-20 22:10 | 57K | |
![[ ]](/icons/unknown.gif) | Agreement of Donation_GEO_20_04_2017.doc | 2025-11-20 22:10 | 57K | |
![[ ]](/icons/unknown.gif) | Agreement of Donation_GEO_20_04_2017 (1).doc | 2025-11-20 22:10 | 57K | |
![[ ]](/icons/unknown.gif) | Agreement ofDonation_ENG_20_04_2017.doc | 2025-11-20 22:10 | 38K | |
![[ ]](/icons/unknown.gif) | Agreement of Donation_ENG_20_04_2017.doc | 2025-11-20 22:10 | 38K | |
![[ ]](/icons/unknown.gif) | Agreement of Donation_ENG_20_04_2017 (1).doc | 2025-11-20 22:10 | 38K | |
![[TXT]](/icons/text.gif) | ATT00002 (94).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (93).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (141).htm | 2025-11-20 22:10 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (140).htm | 2025-11-20 22:10 | 216 | |
![[ ]](/icons/unknown.gif) | ANC MEETING (2).docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | ANC MEETING (1).docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | 13122-21_04_2017.PDF | 2025-11-20 22:10 | 60K | |
![[ ]](/icons/unknown.gif) | 13122-21_04_2017 (1).PDF | 2025-11-20 22:10 | 60K | |
![[ ]](/icons/unknown.gif) | 21_04_2017 EU-GEO AssociationAgreement shared version-with GE comments.docx | 2025-11-20 22:10 | 131K | |
![[ ]](/icons/unknown.gif) | 21_04_2017 EU-GEO AssociationAgreement shared version-with GE comments (1).docx | 2025-11-20 22:10 | 131K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__GEO_doc_docx-1 (5).docx | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__GEO_doc_docx-1 (4).docx | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__GEO_doc_docx-1 (3).docx | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__GEO_doc_docx-1 (2).docx | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__ENG-1.doc | 2025-11-20 22:10 | 108K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__ENG-1 (3).doc | 2025-11-20 22:10 | 108K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__ENG-1 (2).doc | 2025-11-20 22:10 | 108K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__ENG-1 (1).doc | 2025-11-20 22:10 | 108K | |
![[ ]](/icons/unknown.gif) | საჯარო სამსახურის შესახებ.rtf | 2025-11-20 22:10 | 1.3M | |
![[ ]](/icons/unknown.gif) | საქართველო-ევროკავშირის ასოცირების მე-6 ქვე-კომიტეტის სხდომაზე მოთხოვნილი ინფორმაცია.doc | 2025-11-20 22:10 | 93K | |
![[ ]](/icons/unknown.gif) | საქართველო-ევროკავშირის ასოცირების მე-6 ქვე-კომიტეტის სხდომაზე მოთხოვნილი ინფორმაცია (1).doc | 2025-11-20 22:10 | 93K | |
![[ ]](/icons/unknown.gif) | საქართველო-ევროკავშირის ასოცირების მე-6 ქვეკომიტეტი_MoLHSA.doc | 2025-11-20 22:10 | 88K | |
![[ ]](/icons/unknown.gif) | სამოტივაციო 1.docx | 2025-11-20 22:10 | 21K | |
![[ ]](/icons/unknown.gif) | საერთაშორ_ ხელშეკ_ შესახ_.rtf | 2025-11-20 22:10 | 591K | |
![[ ]](/icons/unknown.gif) | რეკომენდაცია.docx | 2025-11-20 22:10 | 229K | |
![[ ]](/icons/unknown.gif) | მთავრ_ სტრუქტურის შესახებ.rtf | 2025-11-20 22:10 | 493K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსი_trans.doc | 2025-11-20 22:10 | 87K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსი_trans (3).doc | 2025-11-20 22:10 | 79K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსი_trans (2).doc | 2025-11-20 22:10 | 79K | |
![[ ]](/icons/unknown.gif) | მემო_ბელორუსი_trans (1).doc | 2025-11-20 22:10 | 87K | |
![[ ]](/icons/unknown.gif) | მემო_ბელარუსი_trans-20_04_2017_ვ2.doc | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | მემო_ბელარუსი_trans-20_04_2017_ვ2 (1).doc | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | მემო_ბელარუსია_დანართი2.doc | 2025-11-20 22:10 | 105K | |
![[ ]](/icons/unknown.gif) | მემო_ბელარუსია_დანართი2 (1).doc | 2025-11-20 22:10 | 105K | |
![[ ]](/icons/unknown.gif) | მემო_ბელარუსია_დანართი1.docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | მემო_ბელარუსია_დანართი1 (1).docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | კორუფციისა და შეუთავსებლ.rtf | 2025-11-20 22:10 | 504K | |
![[ ]](/icons/unknown.gif) | კონსტიტუცია.rtf | 2025-11-20 22:10 | 1.2M | |
![[ ]](/icons/unknown.gif) | დებულება.rtf | 2025-11-20 22:10 | 281K | |
![[ ]](/icons/layout.gif) | qatar shroma eng.pdf | 2025-11-20 22:10 | 2.6M | |
![[ ]](/icons/layout.gif) | qatar shroma eng (1).pdf | 2025-11-20 22:10 | 2.6M | |
![[ ]](/icons/layout.gif) | qatar shroma.pdf | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/layout.gif) | qatar shroma (1).pdf | 2025-11-20 22:10 | 68K | |
![[IMG]](/icons/image2.gif) | image003 (105).png | 2025-11-20 22:10 | 4.5K | |
![[IMG]](/icons/image2.gif) | image003 (104).png | 2025-11-20 22:10 | 4.5K | |
![[IMG]](/icons/image2.gif) | image003 (103).png | 2025-11-20 22:10 | 4.5K | |
![[IMG]](/icons/image2.gif) | image003 (102).png | 2025-11-20 22:10 | 4.5K | |
![[IMG]](/icons/image2.gif) | image003 (101).png | 2025-11-20 22:10 | 4.5K | |
![[IMG]](/icons/image2.gif) | image003 (100).png | 2025-11-20 22:10 | 4.5K | |
![[IMG]](/icons/image2.gif) | image002 (167).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (166).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (165).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (164).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (163).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (162).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (634).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (633).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (632).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (631).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (630).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (629).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (628).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (627).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (103).gif | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (102).gif | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | Untitled (6) | 2025-11-20 22:10 | 0 | |
![[ ]](/icons/unknown.gif) | Story board content.docx | 2025-11-20 22:10 | 17K | |
![[ ]](/icons/layout.gif) | Reception Menus - Copy.pdf | 2025-11-20 22:10 | 403K | |
![[ ]](/icons/layout.gif) | Reception Menus - Copy (1).pdf | 2025-11-20 22:10 | 403K | |
![[ ]](/icons/layout.gif) | Ministry.pdf | 2025-11-20 22:10 | 181K | |
![[ ]](/icons/layout.gif) | Ministry (1).pdf | 2025-11-20 22:10 | 181K | |
![[ ]](/icons/unknown.gif) | LoP ANC mtg GEO v5 (1).doc | 2025-11-20 22:10 | 179K | |
![[ ]](/icons/unknown.gif) | Implementation of the 2nd Protocol_April 2017.docx | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/layout.gif) | Geo-Cz Joint Committee 2nd session.pdf | 2025-11-20 22:10 | 5.7M | |
![[ ]](/icons/layout.gif) | Geo-Cz Joint Committee 2nd session (1).pdf | 2025-11-20 22:10 | 5.7M | |
![[ ]](/icons/layout.gif) | GEO (5).pdf | 2025-11-20 22:10 | 221K | |
![[ ]](/icons/layout.gif) | GEO (4).pdf | 2025-11-20 22:10 | 221K | |
![[ ]](/icons/layout.gif) | DRAFT Provisional Programme ANC Tbilisi 200417 (1).pdf | 2025-11-20 22:10 | 106K | |
![[ ]](/icons/layout.gif) | Beverage Packages - Copy.pdf | 2025-11-20 22:10 | 398K | |
![[ ]](/icons/layout.gif) | Beverage Packages - Copy (1).pdf | 2025-11-20 22:10 | 398K | |
![[ ]](/icons/unknown.gif) | ATT00001 (1) | 2025-11-20 22:10 | 102 | |
![[ ]](/icons/unknown.gif) | ATT00001 | 2025-11-20 22:10 | 102 | |
![[ ]](/icons/unknown.gif) | 2016 წლის სახელფასო ცნობა.msg | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | 21_04_2017 EU-GEOAssociation_Agreement shared version-with GE comments_MoLHSA.doc | 2025-11-20 22:10 | 302K | |
![[ ]](/icons/unknown.gif) | 21_04_2017 EU-GEOAssociation_Agreement shared version-with GE comments_MoLHSA (1).doc | 2025-11-20 22:10 | 302K | |
![[ ]](/icons/unknown.gif) | 21_04_2017 EU-GEO AssociationAgreement shared version-with GE comments (2).docx | 2025-11-20 22:10 | 132K | |
![[ ]](/icons/unknown.gif) | 21_04_2017 EU-GEO AssociationAgreement shared version-with GE comments (2) (1).docx | 2025-11-20 22:10 | 132K | |
![[ ]](/icons/layout.gif) | 02-Provisional Prog FP IHSD ENG 180417c.pdf | 2025-11-20 22:10 | 367K | |
![[ ]](/icons/layout.gif) | 02-Provisional Prog FP IHSD ENG 180417c (1).pdf | 2025-11-20 22:10 | 367K | |
![[ ]](/icons/layout.gif) | 01-SP FP IHSD ENG 12042017.pdf | 2025-11-20 22:10 | 394K | |
![[ ]](/icons/layout.gif) | 01-SP FP IHSD ENG 12042017 (1).pdf | 2025-11-20 22:10 | 394K | |
![[ ]](/icons/layout.gif) | ჯანდაცვის წერილი კატარის შრომაზე.pdf | 2025-11-20 22:10 | 482K | |
![[ ]](/icons/layout.gif) | ჯანდაცვის წერილი კატარის შრომაზე (1).pdf | 2025-11-20 22:10 | 482K | |
![[ ]](/icons/layout.gif) | წერილი კაქტარის შრომაზე.pdf | 2025-11-20 22:10 | 383K | |
![[ ]](/icons/layout.gif) | წერილი კაქტარის შრომაზე (1).pdf | 2025-11-20 22:10 | 383K | |
![[ ]](/icons/layout.gif) | ცნობა (1).pdf | 2025-11-20 22:10 | 124K | |
![[ ]](/icons/unknown.gif) | press release medical equipment.docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | press release medical equipment (1).docx | 2025-11-20 22:10 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (626).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (625).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (624).png | 2025-11-20 22:10 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (516).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (515).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (514).jpg | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image001 (513).jpg | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image001 (512).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (511).jpg | 2025-11-20 22:10 | 4.4K | |
![[ ]](/icons/unknown.gif) | LoP ANC mtg GEO v5.doc | 2025-11-20 22:10 | 179K | |
![[ ]](/icons/layout.gif) | Invation_Program_VWS_FPF2017 (3).pdf | 2025-11-20 22:10 | 589K | |
![[ ]](/icons/layout.gif) | Invation_Program_VWS_FPF2017 (2).pdf | 2025-11-20 22:10 | 589K | |
![[ ]](/icons/unknown.gif) | Geo version_ AgreementofDonation_GEO_v8.doc | 2025-11-20 22:10 | 76K | |
![[ ]](/icons/unknown.gif) | Geo version_ Agreement ofDonation_GEO_v8.doc | 2025-11-20 22:10 | 82K | |
![[ ]](/icons/unknown.gif) | Geo version_ Agreement ofDonation_GEO_v8 (1).doc | 2025-11-20 22:10 | 82K | |
![[ ]](/icons/unknown.gif) | Geo version_ Agreement ofDonation_GEO_26_04_2017.doc | 2025-11-20 22:10 | 73K | |
![[ ]](/icons/unknown.gif) | Georgia - Belarus letter.docx | 2025-11-20 22:10 | 82K | |
![[ ]](/icons/unknown.gif) | Georgia - Belarus letter (1).docx | 2025-11-20 22:10 | 82K | |
![[ ]](/icons/unknown.gif) | Geo Version_ Agreement ofDonation_ENG_26_04_2017.doc | 2025-11-20 22:10 | 49K | |
![[ ]](/icons/layout.gif) | Final Provisional Programme ANC Tbilisi 250417_RUS.pdf | 2025-11-20 22:10 | 152K | |
![[ ]](/icons/layout.gif) | Final Provisional Programme ANC Tbilisi 250417.pdf | 2025-11-20 22:10 | 116K | |
![[ ]](/icons/layout.gif) | DRAFT Provisional Programme ANC Tbilisi 200417.pdf | 2025-11-20 22:10 | 106K | |
![[ ]](/icons/unknown.gif) | Agreement ofDonation_GEO_26_04_2017_ვ7.doc | 2025-11-20 22:10 | 75K | |
![[ ]](/icons/unknown.gif) | Agreement ofDonation_GEO_26_04_2017_ვ7 (1).doc | 2025-11-20 22:10 | 75K | |
![[ ]](/icons/unknown.gif) | Agreement ofDonation_26_04_2017.doc | 2025-11-20 22:10 | 58K | |
![[ ]](/icons/unknown.gif) | Agreement ofDonation_26_04_2017 (2).doc | 2025-11-20 22:10 | 58K | |
![[ ]](/icons/unknown.gif) | Agreement ofDonation_26_04_2017 (1).doc | 2025-11-20 22:10 | 58K | |
![[TXT]](/icons/text.gif) | ATT00001 (139).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (138).htm | 2025-11-20 22:10 | 168 | |
![[ ]](/icons/unknown.gif) | ANC MEETING.docx | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/unknown.gif) | 25042017 EU-GEO AssociationAgreement shared version.docx | 2025-11-20 22:10 | 129K | |
![[ ]](/icons/unknown.gif) | 25042017 EU-GEO AssociationAgreement shared version - kg.docx | 2025-11-20 22:10 | 132K | |
![[ ]](/icons/unknown.gif) | 25042017 EU-GEO AssociationAgreement shared version - kg (1).docx | 2025-11-20 22:10 | 132K | |
![[ ]](/icons/unknown.gif) | 25042017 EU-GEOAssociationAgreement shared version - MoLHSA comments.doc | 2025-11-20 22:10 | 304K | |
![[ ]](/icons/unknown.gif) | 25042017 EU-GEOAssociationAgreement shared version - MoLHSA comments (1).doc | 2025-11-20 22:10 | 304K | |
![[ ]](/icons/unknown.gif) | 25042017 EU-GEO AssociationAgreement shared version (1).docx | 2025-11-20 22:10 | 129K | |
![[ ]](/icons/unknown.gif) | 2017-05-05 LOI.docx | 2025-11-20 22:10 | 19K | |
![[ ]](/icons/unknown.gif) | 2017-05-05 Addendum 2 List of invitees (1).docx | 2025-11-20 22:10 | 21K | |
![[ ]](/icons/unknown.gif) | 2017-05-05 Addendum 1 agenda (3).docx | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | 17-03-22 ESA draft.docx | 2025-11-20 22:10 | 86K | |
![[ ]](/icons/unknown.gif) | 17-03-22 ESA draft (1).docx | 2025-11-20 22:10 | 86K | |
![[ ]](/icons/unknown.gif) | 17-03-22 დასაქმების სერვისების შესახებ აქტი.docx | 2025-11-20 22:10 | 190K | |
![[ ]](/icons/unknown.gif) | 17-03-22 დასაქმების სერვისების შესახებ აქტი (1).docx | 2025-11-20 22:10 | 190K | |
![[ ]](/icons/unknown.gif) | მემო_ბელარუსია_დანართი2_doc.docx | 2025-11-20 22:10 | 349K | |
![[ ]](/icons/unknown.gif) | მემო_ბელარუსია_დანართი2_doc (1).docx | 2025-11-20 22:10 | 349K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia.doc | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia-v8.doc | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia-v8 (2).doc | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia-v8 (1).doc | 2025-11-20 22:10 | 35K | |
![[IMG]](/icons/image2.gif) | image003 (99).png | 2025-11-20 22:10 | 4.5K | |
![[IMG]](/icons/image2.gif) | image003 (98).png | 2025-11-20 22:10 | 4.5K | |
![[IMG]](/icons/image2.gif) | image002 (161).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (160).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (623).png | 2025-11-20 22:10 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (622).png | 2025-11-20 22:10 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (621).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (620).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (510).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (509).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (508).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (507).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (506).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (505).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (101).gif | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (100).gif | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (99).gif | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (98).gif | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/layout.gif) | Scope and purpose ENG AMC.pdf | 2025-11-20 22:10 | 218K | |
![[ ]](/icons/layout.gif) | Scope and purpose ENG AMC (1).pdf | 2025-11-20 22:10 | 218K | |
![[ ]](/icons/unknown.gif) | Scan10001.PDF | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/unknown.gif) | Scan10001 (1).PDF | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/layout.gif) | Scan1.pdf | 2025-11-20 22:10 | 481K | |
![[ ]](/icons/layout.gif) | Scan1 (1).pdf | 2025-11-20 22:10 | 481K | |
![[ ]](/icons/layout.gif) | Provisional agenda ENG.pdf | 2025-11-20 22:10 | 311K | |
![[ ]](/icons/layout.gif) | Provisional agenda ENG (1).pdf | 2025-11-20 22:10 | 311K | |
![[ ]](/icons/layout.gif) | Protocol II Session_28 October 2004 Tbilisi.pdf | 2025-11-20 22:10 | 2.6M | |
![[ ]](/icons/layout.gif) | Protocol II Session_28 October 2004 Tbilisi (1).pdf | 2025-11-20 22:10 | 2.6M | |
![[ ]](/icons/unknown.gif) | MOU GDD Georgia_2017 final clean draft.docx | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | MOU GDD Georgia_2017 final clean draft (1).docx | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | MOU.doc | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | MOU (1).doc | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/layout.gif) | Letter to the Minister.pdf | 2025-11-20 22:10 | 142K | |
![[ ]](/icons/layout.gif) | Letter to the Minister (1).pdf | 2025-11-20 22:10 | 142K | |
![[ ]](/icons/layout.gif) | Invite to nominate.pdf | 2025-11-20 22:10 | 81K | |
![[ ]](/icons/layout.gif) | Invite to nominate (1).pdf | 2025-11-20 22:10 | 81K | |
![[ ]](/icons/layout.gif) | Invitation to nominate.pdf | 2025-11-20 22:10 | 189K | |
![[ ]](/icons/layout.gif) | Invitation to nominate (1).pdf | 2025-11-20 22:10 | 189K | |
![[ ]](/icons/unknown.gif) | Geo Version_AgreementofDonation_Armenia_ENG_v1.doc | 2025-11-20 22:10 | 46K | |
![[ ]](/icons/unknown.gif) | Geo Version_ AgreementofDonation_Armenia_ENG_v1.doc | 2025-11-20 22:10 | 44K | |
![[ ]](/icons/unknown.gif) | Geo Version_AgreementofDonation_Armenia_ENG_v1 (1).doc | 2025-11-20 22:10 | 46K | |
![[ ]](/icons/unknown.gif) | Final DRAFT_DVH Appendix to Georgia MOU.docx | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | Final DRAFT_DVH Appendix to Georgia MOU (1).docx | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | Draft MoU with MoLSHA ENGFinal_MoLHSA comments_27_04_2017.doc | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/unknown.gif) | Contract ofDonation_ENG_GEO_27_04_2017.doc | 2025-11-20 22:10 | 93K | |
![[ ]](/icons/unknown.gif) | Contract ofDonation_ENG_GEO_27_04_2017 (3).doc | 2025-11-20 22:10 | 91K | |
![[ ]](/icons/unknown.gif) | Contract ofDonation_ENG_GEO_27_04_2017 (2).doc | 2025-11-20 22:10 | 91K | |
![[ ]](/icons/unknown.gif) | Contract ofDonation_ENG_GEO_27_04_2017 (1).doc | 2025-11-20 22:10 | 91K | |
![[ ]](/icons/unknown.gif) | Contract of Donation.doc | 2025-11-20 22:10 | 94K | |
![[ ]](/icons/unknown.gif) | Contract of Donation (1).doc | 2025-11-20 22:10 | 94K | |
![[ ]](/icons/unknown.gif) | Attachment.doc | 2025-11-20 22:10 | 59K | |
![[ ]](/icons/unknown.gif) | Attachment (4).doc | 2025-11-20 22:10 | 58K | |
![[ ]](/icons/unknown.gif) | Attachment (3).doc | 2025-11-20 22:10 | 59K | |
![[ ]](/icons/unknown.gif) | Attachment (2).doc | 2025-11-20 22:10 | 59K | |
![[ ]](/icons/unknown.gif) | Attachment (1).doc | 2025-11-20 22:10 | 59K | |
![[ ]](/icons/unknown.gif) | Agreement of Donation.doc | 2025-11-20 22:10 | 48K | |
![[ ]](/icons/layout.gif) | 2017V1_Provisional programme_ENG AMC.pdf | 2025-11-20 22:10 | 530K | |
![[ ]](/icons/layout.gif) | 2017V1_Provisional programme_ENG AMC (1).pdf | 2025-11-20 22:10 | 530K | |
![[ ]](/icons/unknown.gif) | მოსაწვევი - სამუშაო შეხვედრა.docx | 2025-11-20 22:10 | 51K | |
![[ ]](/icons/unknown.gif) | მოსაწვევი - სამუშაო შეხვედრა (1).docx | 2025-11-20 22:10 | 51K | |
![[ ]](/icons/unknown.gif) | კონცეფცია - სამუშაო შეხვედრა.docx | 2025-11-20 22:10 | 61K | |
![[ ]](/icons/unknown.gif) | კონცეფცია - სამუშაო შეხვედრა (1).docx | 2025-11-20 22:10 | 61K | |
![[ ]](/icons/unknown.gif) | იაპონიის გრანტის თაობაზე.doc | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი - სამუშაო შეხვედრა.docx | 2025-11-20 22:10 | 76K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი - სამუშაო შეხვედრა (1).docx | 2025-11-20 22:10 | 76K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_GEO_27_04_2017.doc | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_GEO_27_04_2017 (2).doc | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_GEO_27_04_2017 (1).doc | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_ENG_27_04_2017.doc | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_ENG_27_04_2017 (3).doc | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_ENG_27_04_2017 (2).doc | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_ENG_27_04_2017 (1).doc | 2025-11-20 22:10 | 34K | |
![[IMG]](/icons/image2.gif) | image001 (619).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (618).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (617).png | 2025-11-20 22:10 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (616).png | 2025-11-20 22:10 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (97).gif | 2025-11-20 22:10 | 1.1K | |
![[IMG]](/icons/image2.gif) | image001 (96).gif | 2025-11-20 22:10 | 1.1K | |
![[ ]](/icons/layout.gif) | details for plenary meeting.pdf | 2025-11-20 22:10 | 753K | |
![[IMG]](/icons/image2.gif) | chven (20).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (19).png | 2025-11-20 22:10 | 7.2K | |
![[ ]](/icons/unknown.gif) | Untitled (5) | 2025-11-20 22:10 | 0 | |
![[ ]](/icons/layout.gif) | SKM_C554e17050218310 (1).pdf | 2025-11-20 22:10 | 3.6M | |
![[ ]](/icons/unknown.gif) | MOU_GEO_Bel Alt_1_05_2017.doc | 2025-11-20 22:10 | 38K | |
![[ ]](/icons/unknown.gif) | MOU _ENG_Bel Alt_1_05_2017.doc | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/layout.gif) | J_Appathurai2Georgia (3).pdf | 2025-11-20 22:10 | 559K | |
![[ ]](/icons/layout.gif) | J_Appathurai2Georgia (3) (1).pdf | 2025-11-20 22:10 | 559K | |
![[ ]](/icons/unknown.gif) | Geo version_ AgreementofDonation_GEO_v9.doc | 2025-11-20 22:10 | 80K | |
![[ ]](/icons/unknown.gif) | Geo version_ AgreementofDonation_GEO_v9 (1).doc | 2025-11-20 22:10 | 80K | |
![[ ]](/icons/unknown.gif) | Georgia - Belarus letter-v9.docx | 2025-11-20 22:10 | 79K | |
![[ ]](/icons/unknown.gif) | Georgia - Belarus letter-v9 (1).docx | 2025-11-20 22:10 | 79K | |
![[ ]](/icons/unknown.gif) | GDSC, SCSF 2015 Program 23 october.docx | 2025-11-20 22:10 | 533K | |
![[ ]](/icons/unknown.gif) | GDSC, SCSF 2015 Program 23 october (1).docx | 2025-11-20 22:10 | 533K | |
![[ ]](/icons/unknown.gif) | FW Embassy of Kazakhstan in Georgia - Very Urgent.msg | 2025-11-20 22:10 | 13K | |
![[IMG]](/icons/image2.gif) | Contracr_Gilead.djvu | 2025-11-20 22:10 | 341K | |
![[IMG]](/icons/image2.gif) | Contracr_Gilead (1).djvu | 2025-11-20 22:10 | 341K | |
![[ ]](/icons/unknown.gif) | Contarct of Donation_Sovaldi (3).doc | 2025-11-20 22:10 | 40K | |
![[ ]](/icons/unknown.gif) | Contarct of Donation_Sovaldi (2).doc | 2025-11-20 22:10 | 40K | |
![[ ]](/icons/unknown.gif) | CMR Map 12-4-12.doc | 2025-11-20 22:10 | 42K | |
![[ ]](/icons/unknown.gif) | CMR Map 12-4-12 (1).doc | 2025-11-20 22:10 | 42K | |
![[TXT]](/icons/text.gif) | ATT00001 (137).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (136).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (10).txt | 2025-11-20 22:10 | 42 | |
![[TXT]](/icons/text.gif) | ATT00001 (9).txt | 2025-11-20 22:10 | 42 | |
![[ ]](/icons/unknown.gif) | 2017 Ministerial Seminar on Vocational Education Macro Policy for Developing Countries.doc | 2025-11-20 22:10 | 72K | |
![[ ]](/icons/unknown.gif) | 2017 Ministerial Seminar on Vocational Education Macro Policy for Developing Countries (1).doc | 2025-11-20 22:10 | 72K | |
![[ ]](/icons/unknown.gif) | 2017-05-05 Addendum 2 List of invitees.docx | 2025-11-20 22:10 | 21K | |
![[ ]](/icons/unknown.gif) | 2017-05-05 Addendum 1 agenda.docx | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | 2017-05-05 Addendum 1 agenda (2).docx | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | 2017-05-05 Addendum 1 agenda (1).docx | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | 26_04_17 draft operational conclusions.doc | 2025-11-20 22:10 | 48K | |
![[ ]](/icons/unknown.gif) | 26_04_17 draft operational conclusions (1).doc | 2025-11-20 22:10 | 48K | |
![[ ]](/icons/layout.gif) | 14-5_1681.pdf | 2025-11-20 22:10 | 160K | |
![[ ]](/icons/layout.gif) | 14-5_1681 (5).pdf | 2025-11-20 22:10 | 160K | |
![[ ]](/icons/layout.gif) | 14-5_1681 (4).pdf | 2025-11-20 22:10 | 160K | |
![[ ]](/icons/layout.gif) | 14-5_1681 (3).pdf | 2025-11-20 22:10 | 160K | |
![[ ]](/icons/layout.gif) | 14-5_1681 (2).pdf | 2025-11-20 22:10 | 160K | |
![[ ]](/icons/layout.gif) | 14-5_1681 (1).pdf | 2025-11-20 22:10 | 160K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__GEO_doc_docx-1.docx | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/unknown.gif) | ხელშეკრულება_-_HCV__GEO_doc_docx-1 (1).docx | 2025-11-20 22:10 | 90K | |
![[ ]](/icons/layout.gif) | ყაზახეთი_ჯანდაცვის_მინისტრის_ვიზიტი.pdf | 2025-11-20 22:10 | 2.7M | |
![[ ]](/icons/layout.gif) | ყაზახეთი_ჯანდაცვის_მინისტრის_ვიზიტი (1).pdf | 2025-11-20 22:10 | 2.7M | |
![[ ]](/icons/layout.gif) | ჟარკოს ვიზიტი.pdf | 2025-11-20 22:10 | 246K | |
![[ ]](/icons/layout.gif) | ჟარკოს ვიზიტი (2).pdf | 2025-11-20 22:10 | 246K | |
![[ ]](/icons/layout.gif) | ჟარკოს ვიზიტი (1).pdf | 2025-11-20 22:10 | 246K | |
![[ ]](/icons/unknown.gif) | მოხსენებითი ბარათი.docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | მოხსენებითი ბარათი (1).docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | განკარგულება_დონაციაზე_ვ10.docx | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | განკარგულება_დონაციაზე_ვ10 (1).docx | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | განკარგულება_დონაციაზე_ვ9.docx | 2025-11-20 22:10 | 26K | |
![[ ]](/icons/unknown.gif) | განკარგულება_დონაციაზე_ვ9 (1).docx | 2025-11-20 22:10 | 26K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru (7).docx | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru (6).docx | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/layout.gif) | Министру Грузии скан 3-5,05.pdf | 2025-11-20 22:10 | 940K | |
![[ ]](/icons/layout.gif) | Министру Грузии скан 3-5,05 (4).pdf | 2025-11-20 22:10 | 940K | |
![[ ]](/icons/layout.gif) | Министру Грузии скан 3-5,05 (3).pdf | 2025-11-20 22:10 | 940K | |
![[ ]](/icons/layout.gif) | Министру Грузии скан 3-5,05 (2).pdf | 2025-11-20 22:10 | 940K | |
![[ ]](/icons/layout.gif) | Министру Грузии скан 3-5,05 (1).pdf | 2025-11-20 22:10 | 940K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_GEO_27_04_2017_v9.doc | 2025-11-20 22:10 | 37K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_GEO_27_04_2017_v9 (2).doc | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/unknown.gif) | Меморандум MOU - Georgia_GEO_27_04_2017_v9 (1).doc | 2025-11-20 22:10 | 37K | |
![[ ]](/icons/unknown.gif) | Меморандум с Грузией перевод.docx | 2025-11-20 22:10 | 13K | |
![[ ]](/icons/unknown.gif) | Меморандум с Грузией перевод (1).docx | 2025-11-20 22:10 | 13K | |
![[ ]](/icons/layout.gif) | sovaldi (TZDND, TZDPD) (2).pdf | 2025-11-20 22:10 | 2.2M | |
![[ ]](/icons/layout.gif) | sovaldi (TZDND, TZDPD) (1).pdf | 2025-11-20 22:10 | 2.2M | |
![[IMG]](/icons/image2.gif) | image004 (55).png | 2025-11-20 22:10 | 1.1K | |
![[IMG]](/icons/image2.gif) | image004 (54).png | 2025-11-20 22:10 | 1.1K | |
![[IMG]](/icons/image2.gif) | image004 (53).png | 2025-11-20 22:10 | 7.7K | |
![[IMG]](/icons/image2.gif) | image004 (52).png | 2025-11-20 22:10 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (131).jpg | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (130).jpg | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (236).jpg | 2025-11-20 22:10 | 937 | |
![[IMG]](/icons/image2.gif) | image002 (235).jpg | 2025-11-20 22:10 | 937 | |
![[IMG]](/icons/image2.gif) | image002 (159).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image002 (158).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (615).png | 2025-11-20 22:10 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (614).png | 2025-11-20 22:10 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (613).png | 2025-11-20 22:10 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (612).png | 2025-11-20 22:10 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (504).jpg | 2025-11-20 22:10 | 2.6K | |
![[IMG]](/icons/image2.gif) | image001 (503).jpg | 2025-11-20 22:10 | 2.6K | |
![[IMG]](/icons/image2.gif) | chven (18).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (17).png | 2025-11-20 22:10 | 7.2K | |
![[ ]](/icons/layout.gif) | SKM_C554e17050218310.pdf | 2025-11-20 22:10 | 3.6M | |
![[ ]](/icons/layout.gif) | President-Georgia.pdf | 2025-11-20 22:10 | 1.6M | |
![[ ]](/icons/layout.gif) | President-Georgia (1).pdf | 2025-11-20 22:10 | 1.6M | |
![[ ]](/icons/layout.gif) | Nomination HTA focal point.pdf | 2025-11-20 22:10 | 151K | |
![[ ]](/icons/layout.gif) | Nomination HTA focal point (1).pdf | 2025-11-20 22:10 | 151K | |
![[ ]](/icons/unknown.gif) | Nishtar Resume Long Version.doc | 2025-11-20 22:10 | 221K | |
![[ ]](/icons/unknown.gif) | Nishtar Resume Long Version (1).doc | 2025-11-20 22:10 | 221K | |
![[ ]](/icons/layout.gif) | Mr David Sergeenko_Invitation toa reception on Monday 22 May inhonour of David Nabarro.pdf | 2025-11-20 22:10 | 46K | |
![[ ]](/icons/layout.gif) | Mr David Sergeenko_Invitation toa reception on Monday 22 May in honour of David Nabarro.pdf | 2025-11-20 22:10 | 46K | |
![[ ]](/icons/unknown.gif) | MoU_US CDC.doc | 2025-11-20 22:10 | 84K | |
![[ ]](/icons/unknown.gif) | MoU_US CDC (2).doc | 2025-11-20 22:10 | 84K | |
![[ ]](/icons/unknown.gif) | MoU_US CDC (1).doc | 2025-11-20 22:10 | 84K | |
![[ ]](/icons/layout.gif) | Minister of ForeignAffairs-Georgia.pdf | 2025-11-20 22:10 | 637K | |
![[ ]](/icons/layout.gif) | Minister of ForeignAffairs-Georgia (1).pdf | 2025-11-20 22:10 | 637K | |
![[ ]](/icons/layout.gif) | Minister Of Labour, Health andsocail Affairs-Georgia.pdf | 2025-11-20 22:10 | 564K | |
![[ ]](/icons/layout.gif) | Minister Of Labour, Health andsocail Affairs-Georgia (1).pdf | 2025-11-20 22:10 | 564K | |
![[ ]](/icons/layout.gif) | JAAnalysisGuidance_March2017.pdf | 2025-11-20 22:10 | 886K | |
![[ ]](/icons/layout.gif) | JAAnalysisGuidance_March2017 (1).pdf | 2025-11-20 22:10 | 886K | |
![[ ]](/icons/layout.gif) | Invation_Program_VWS_FPF2017.pdf | 2025-11-20 22:10 | 589K | |
![[ ]](/icons/layout.gif) | Invation_Program_VWS_FPF2017 (1).pdf | 2025-11-20 22:10 | 589K | |
![[ ]](/icons/layout.gif) | InformationLetter_Joint_Appraisal_Update_25April2017_Georgia.pdf | 2025-11-20 22:10 | 139K | |
![[ ]](/icons/layout.gif) | InformationLetter_Joint_Appraisal_Update_25April2017_Georgia (1).pdf | 2025-11-20 22:10 | 139K | |
![[ ]](/icons/layout.gif) | Guidelines_ReportingRenewal_March2017.pdf | 2025-11-20 22:10 | 516K | |
![[ ]](/icons/layout.gif) | Guidelines_ReportingRenewal_March2017 (1).pdf | 2025-11-20 22:10 | 516K | |
![[ ]](/icons/unknown.gif) | Gilead_Belarus_Armenia.docx | 2025-11-20 22:10 | 80K | |
![[ ]](/icons/unknown.gif) | Georgia_JA_Update_report_2016_FINAL.PDF | 2025-11-20 22:10 | 758K | |
![[ ]](/icons/unknown.gif) | Georgia_JA_Update_report_2016_FINAL (1).PDF | 2025-11-20 22:10 | 758K | |
![[ ]](/icons/unknown.gif) | Georgia JAUpdate_template_2017.docx | 2025-11-20 22:10 | 106K | |
![[ ]](/icons/unknown.gif) | Georgia JAUpdate_template_2017 (1).docx | 2025-11-20 22:10 | 106K | |
![[ ]](/icons/unknown.gif) | Draft operationalconclusions.doc | 2025-11-20 22:10 | 62K | |
![[ ]](/icons/unknown.gif) | Draft operationalconclusions (1).doc | 2025-11-20 22:10 | 62K | |
![[ ]](/icons/unknown.gif) | Contarct of Donation_Sovaldi.doc | 2025-11-20 22:10 | 48K | |
![[ ]](/icons/unknown.gif) | Contarct of Donation_Sovaldi (1).doc | 2025-11-20 22:10 | 48K | |
![[ ]](/icons/unknown.gif) | Aide Memoire.docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | Aide Memoire (1).docx | 2025-11-20 22:10 | 18K | |
![[TXT]](/icons/text.gif) | ATT00001 (135).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (134).htm | 2025-11-20 22:10 | 168 | |
![[ ]](/icons/unknown.gif) | საქართველო-ევროკავშირის ასოცირების მე-6 ქვეკომ.doc | 2025-11-20 22:10 | 87K | |
![[ ]](/icons/unknown.gif) | საქართველო-ევროკავშირის ასოცირების მე-6 ქვეკომ (1).doc | 2025-11-20 22:10 | 87K | |
![[ ]](/icons/unknown.gif) | განკარგულება_დონაციაზე_გაერთიანებული_ვ11.docx | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru.docx | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru.doc | 2025-11-20 22:10 | 97K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru (5).docx | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru (4).docx | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru (3).docx | 2025-11-20 22:10 | 37K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru (2).docx | 2025-11-20 22:10 | 37K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru (1).docx | 2025-11-20 22:10 | 36K | |
![[ ]](/icons/unknown.gif) | биография Биртанова.docx | 2025-11-20 22:10 | 66K | |
![[ ]](/icons/unknown.gif) | биография Биртанова (1).docx | 2025-11-20 22:10 | 66K | |
![[ ]](/icons/unknown.gif) | Меморандум с Грузией перевод.doc | 2025-11-20 22:10 | 30K | |
![[ ]](/icons/layout.gif) | sovaldi (TZDND, TZDPD).pdf | 2025-11-20 22:10 | 2.2M | |
![[IMG]](/icons/image2.gif) | image002 (234).jpg | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (233).jpg | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (232).jpg | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (231).jpg | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (611).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (610).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (609).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (608).png | 2025-11-20 22:10 | 26K | |
![[IMG]](/icons/image2.gif) | image001 (607).png | 2025-11-20 22:10 | 26K | |
![[IMG]](/icons/image2.gif) | image001 (606).png | 2025-11-20 22:10 | 26K | |
![[IMG]](/icons/image2.gif) | image001 (605).png | 2025-11-20 22:10 | 26K | |
![[IMG]](/icons/image2.gif) | image001 (604).png | 2025-11-20 22:10 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (603).png | 2025-11-20 22:10 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (502).jpg | 2025-11-20 22:10 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (501).jpg | 2025-11-20 22:10 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (500).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (499).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (498).jpg | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/layout.gif) | Scope and purpose of Hospital Safety Index Assessments.pdf | 2025-11-20 22:10 | 201K | |
![[ ]](/icons/layout.gif) | Scope and purpose of Hospital Safety Index Assessments (1).pdf | 2025-11-20 22:10 | 201K | |
![[ ]](/icons/layout.gif) | Scope and purpose (5).pdf | 2025-11-20 22:10 | 74K | |
![[ ]](/icons/layout.gif) | Scope and purpose (4).pdf | 2025-11-20 22:10 | 74K | |
![[ ]](/icons/layout.gif) | Scanned from a Xerox multifunction device (5).pdf | 2025-11-20 22:10 | 60K | |
![[ ]](/icons/layout.gif) | Scanned from a Xerox multifunction device (4).pdf | 2025-11-20 22:10 | 60K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draft op_ concl (2) (1).doc | 2025-11-20 22:10 | 67K | |
![[ ]](/icons/layout.gif) | RD Letter_05 2017_GEO.pdf | 2025-11-20 22:10 | 75K | |
![[ ]](/icons/layout.gif) | Provisional Agenda_HSI Tbilisi June 2017ANJ.pdf | 2025-11-20 22:10 | 360K | |
![[ ]](/icons/layout.gif) | Provisional Agenda_HSI Tbilisi June 2017ANJ (1).pdf | 2025-11-20 22:10 | 360K | |
![[ ]](/icons/layout.gif) | NOTE VERBALE WHO-MoH_Office new address.pdf | 2025-11-20 22:10 | 57K | |
![[ ]](/icons/layout.gif) | NOTE VERBALE WHO-MoH_Office new address (1).pdf | 2025-11-20 22:10 | 57K | |
![[ ]](/icons/unknown.gif) | MoU with MoLSHAENG_Final8_05_2017.doc | 2025-11-20 22:10 | 87K | |
![[ ]](/icons/unknown.gif) | MoU with MoLSHA ENG_Final8_05_2017.doc | 2025-11-20 22:10 | 87K | |
![[ ]](/icons/unknown.gif) | MoU with MoLSHA ENG_Final8_05_2017 (1).doc | 2025-11-20 22:10 | 87K | |
![[ ]](/icons/unknown.gif) | MOU_RUS_Geo alt.doc | 2025-11-20 22:10 | 30K | |
![[ ]](/icons/unknown.gif) | MOU_RUS_Geo alt (2).doc | 2025-11-20 22:10 | 30K | |
![[ ]](/icons/unknown.gif) | MOU_RUS_Geo alt (1).doc | 2025-11-20 22:10 | 30K | |
![[ ]](/icons/unknown.gif) | MOU_GEO_Geo alt.doc | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | MOU_GEO_Geo alt (2).doc | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | MOU_GEO_Geo alt (1).doc | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | MOU_ENG_Geo alt.doc | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/unknown.gif) | MOU_ENG_Geo alt (2).doc | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/unknown.gif) | MOU_ENG_Geo alt (1).doc | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/unknown.gif) | List of attendees-5May,2017.docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | Invitation Reception_18 05 2017 (002) (1).docx | 2025-11-20 22:10 | 863K | |
![[ ]](/icons/layout.gif) | Host Letter GEO_12-16 June 2017_Signed.pdf | 2025-11-20 22:10 | 85K | |
![[ ]](/icons/layout.gif) | Host Letter GEO_12-16 June 2017_Signed (1).pdf | 2025-11-20 22:10 | 85K | |
![[ ]](/icons/layout.gif) | GEO nomination letter (2).pdf | 2025-11-20 22:10 | 83K | |
![[ ]](/icons/layout.gif) | GEO nomination letter (1).pdf | 2025-11-20 22:10 | 83K | |
![[ ]](/icons/layout.gif) | GEO Diphtheria lab nomin let ENG.pdf | 2025-11-20 22:10 | 161K | |
![[ ]](/icons/layout.gif) | GEO Diphtheria lab nomin let ENG (1).pdf | 2025-11-20 22:10 | 161K | |
![[ ]](/icons/unknown.gif) | Draft letter from MOLHSA to EU LUX UHC Partnership.docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | Draft letter from MOLHSA to EU LUX UHC Partnership (2).docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | Draft letter from MOLHSA to EU LUX UHC Partnership (1).docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | Contract of_Donation_RUS_Geoalt.doc | 2025-11-20 22:10 | 97K | |
![[ ]](/icons/unknown.gif) | Contract of_Donation_RUS_Geoalt (1).doc | 2025-11-20 22:10 | 97K | |
![[ ]](/icons/unknown.gif) | Contract of_Donation_GEO_Geoalt.doc | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/unknown.gif) | Contract of_Donation_GEO_Geoalt (1).doc | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/unknown.gif) | Contract of_Donation_ENG_Geoalt.doc | 2025-11-20 22:10 | 56K | |
![[ ]](/icons/unknown.gif) | Contract of_Donation_ENG_Geoalt (1).doc | 2025-11-20 22:10 | 56K | |
![[ ]](/icons/unknown.gif) | Contract of Donation_RUS_Geoalt.doc | 2025-11-20 22:10 | 97K | |
![[ ]](/icons/unknown.gif) | Contract of Donation_GEO_Geoalt.doc | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/unknown.gif) | Contract of Donation_ENG_Geoalt.doc | 2025-11-20 22:10 | 56K | |
![[ ]](/icons/unknown.gif) | Contract of Donation_ENG_5May.doc | 2025-11-20 22:10 | 52K | |
![[ ]](/icons/unknown.gif) | Auf Georgisch_Teilnehmerprofile WIMI Georgien 2017 - Kopie (Wiederhergestellt) (3).docx | 2025-11-20 22:10 | 174K | |
![[ ]](/icons/unknown.gif) | Auf Georgisch_Teilnehmerprofile WIMI Georgien 2017 - Kopie (Wiederhergestellt) (2).docx | 2025-11-20 22:10 | 174K | |
![[ ]](/icons/unknown.gif) | Auf Georgisch_Teilnehmerprofile WIMI Georgien 2017 - Kopie (Wiederhergestellt) (1).docx | 2025-11-20 22:10 | 174K | |
![[TXT]](/icons/text.gif) | ATT00003 (52).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (51).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (50).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (49).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (92).htm | 2025-11-20 22:10 | 503 | |
![[TXT]](/icons/text.gif) | ATT00002 (91).htm | 2025-11-20 22:10 | 503 | |
![[TXT]](/icons/text.gif) | ATT00002 (90).htm | 2025-11-20 22:10 | 514 | |
![[TXT]](/icons/text.gif) | ATT00002 (89).htm | 2025-11-20 22:10 | 514 | |
![[TXT]](/icons/text.gif) | ATT00001 (133).htm | 2025-11-20 22:10 | 644 | |
![[TXT]](/icons/text.gif) | ATT00001 (132).htm | 2025-11-20 22:10 | 644 | |
![[TXT]](/icons/text.gif) | ATT00001 (131).htm | 2025-11-20 22:10 | 557 | |
![[TXT]](/icons/text.gif) | ATT00001 (130).htm | 2025-11-20 22:10 | 557 | |
![[ ]](/icons/layout.gif) | ANC meeting thanks you letter to MOH.pdf | 2025-11-20 22:10 | 42K | |
![[ ]](/icons/layout.gif) | ANC meeting thanks you letter to MOH (1).pdf | 2025-11-20 22:10 | 42K | |
![[ ]](/icons/unknown.gif) | ცენტ_ აპარატი თარგმნა.xlsx | 2025-11-20 22:10 | 12K | |
![[ ]](/icons/unknown.gif) | რელიზი ბელორუსები.docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | რელიზი ბელორუსები (3).docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | რელიზი ბელორუსები (2).docx | 2025-11-20 22:10 | 22K | |
![[ ]](/icons/unknown.gif) | რელიზი ბელორუსები (1).docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | ავსტრია-საქართველოს ბიზნესფორუმი (3).docx | 2025-11-20 22:10 | 140K | |
![[ ]](/icons/unknown.gif) | ავსტრია-საქართველოს ბიზნესფორუმი (2).docx | 2025-11-20 22:10 | 140K | |
![[ ]](/icons/unknown.gif) | ავსტრია-საქართველოს ბიზნესფორუმი (1).docx | 2025-11-20 22:10 | 140K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru_5May.doc | 2025-11-20 22:10 | 94K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru_5 May.doc | 2025-11-20 22:10 | 94K | |
![[ ]](/icons/unknown.gif) | грузинский контракт_ru_5 May (1).doc | 2025-11-20 22:10 | 97K | |
![[IMG]](/icons/image2.gif) | logos (4).jpg | 2025-11-20 22:10 | 1.1M | |
![[IMG]](/icons/image2.gif) | logos (3).jpg | 2025-11-20 22:10 | 1.1M | |
![[ ]](/icons/layout.gif) | letter to 70th WHA President fromGeorgia.pdf | 2025-11-20 22:10 | 412K | |
![[ ]](/icons/unknown.gif) | letter about the pictorial health warnings-6 05 2017.docx | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (602).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (601).png | 2025-11-20 22:10 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001 (600).png | 2025-11-20 22:10 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001 (599).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (598).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (497).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (95).gif | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (94).gif | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | Non-Pro Medi.pptx | 2025-11-20 22:10 | 468K | |
![[ ]](/icons/unknown.gif) | Nominations for the Ministerial Conference on Environment and Health from Georgia.msg | 2025-11-20 22:10 | 77K | |
![[ ]](/icons/layout.gif) | Nominations for Workshop toUpdate Joint Appraisal and Regional Working Group Meeting.pdf | 2025-11-20 22:10 | 84K | |
![[ ]](/icons/unknown.gif) | Klimiashvili Lika.docx | 2025-11-20 22:10 | 15K | |
![[ ]](/icons/layout.gif) | Invitation_GENVHE.pdf | 2025-11-20 22:10 | 1.0M | |
![[ ]](/icons/unknown.gif) | Invitation Reception_18 05 2017 (002).docx | 2025-11-20 22:10 | 863K | |
![[ ]](/icons/unknown.gif) | From the Ministry of Labour, Health and Social Affairs of Georgia (2).msg | 2025-11-20 22:10 | 200K | |
![[ ]](/icons/layout.gif) | DPOmission.pdf | 2025-11-20 22:10 | 546K | |
![[ ]](/icons/layout.gif) | DPOmission (1).pdf | 2025-11-20 22:10 | 546K | |
![[ ]](/icons/layout.gif) | DOSSIER DE PRESSE MEMOIRE-RED Georgie (2).pdf | 2025-11-20 22:10 | 1.3M | |
![[ ]](/icons/layout.gif) | DOSSIER DE PRESSE MEMOIRE-RED Georgie (1).pdf | 2025-11-20 22:10 | 1.3M | |
![[ ]](/icons/unknown.gif) | Auf Georgisch_Teilnehmerprofile WIMI Georgien 2017 - Kopie (Wiederhergestellt).docx | 2025-11-20 22:10 | 174K | |
![[ ]](/icons/unknown.gif) | 10_05_2017 AAg-EU feedback.docx | 2025-11-20 22:10 | 141K | |
![[ ]](/icons/unknown.gif) | 10_05_2017 AAg-EU feedback (1).docx | 2025-11-20 22:10 | 141K | |
![[ ]](/icons/layout.gif) | სომხეთი დონაციის ხელშეკრულება და მინდობილობა.pdf | 2025-11-20 22:10 | 3.3M | |
![[ ]](/icons/unknown.gif) | სამინისტრო წერილი.docx | 2025-11-20 22:10 | 13K | |
![[ ]](/icons/unknown.gif) | სამინისტრო წერილი (1).docx | 2025-11-20 22:10 | 13K | |
![[ ]](/icons/unknown.gif) | ავსტრია-საქართველოს ბიზნესფორუმი.docx | 2025-11-20 22:10 | 140K | |
![[ ]](/icons/layout.gif) | Министру здравоохранения Грузии визит врачей.pdf | 2025-11-20 22:10 | 39K | |
![[ ]](/icons/layout.gif) | Министру здравоохранения Грузии визит врачей (1).pdf | 2025-11-20 22:10 | 39K | |
![[IMG]](/icons/image2.gif) | image001 (597).png | 2025-11-20 22:10 | 64K | |
![[IMG]](/icons/image2.gif) | image001 (596).png | 2025-11-20 22:10 | 64K | |
![[IMG]](/icons/image2.gif) | image001 (595).png | 2025-11-20 22:10 | 64K | |
![[IMG]](/icons/image2.gif) | image001 (594).png | 2025-11-20 22:10 | 64K | |
![[IMG]](/icons/image2.gif) | image001 (496).jpg | 2025-11-20 22:10 | 23K | |
![[IMG]](/icons/image2.gif) | image001 (495).jpg | 2025-11-20 22:10 | 3.0K | |
![[IMG]](/icons/image2.gif) | image001 (494).jpg | 2025-11-20 22:10 | 3.0K | |
![[IMG]](/icons/image2.gif) | image001 (493).jpg | 2025-11-20 22:10 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (93).gif | 2025-11-20 22:10 | 1.1K | |
![[IMG]](/icons/image2.gif) | image001 (92).gif | 2025-11-20 22:10 | 1.1K | |
![[ ]](/icons/unknown.gif) | for Lexo_1.xlsb | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/layout.gif) | david sergeenko pass.pdf | 2025-11-20 22:10 | 547K | |
![[IMG]](/icons/image2.gif) | david Sergeenko.jpg | 2025-11-20 22:10 | 142K | |
![[ ]](/icons/unknown.gif) | WebEx meeting invitation EURO Twenty-fourth Standing Committee of the Regional Committee (Fourth meeting).msg | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | WebEx meeting invitation EURO Twenty-fourth Standing Committee of the Regional Committee (Fourth meeting) (1).msg | 2025-11-20 22:10 | 34K | |
![[ ]](/icons/unknown.gif) | WHOEUROCL_SCRC24(4)Invite_MSr.PDF | 2025-11-20 22:10 | 85K | |
![[ ]](/icons/unknown.gif) | WHOEUROCL_SCRC24(4)Invite_MSg.PDF | 2025-11-20 22:10 | 77K | |
![[ ]](/icons/unknown.gif) | WHOEUROCL_SCRC24(4)Invite_MSf.PDF | 2025-11-20 22:10 | 75K | |
![[ ]](/icons/unknown.gif) | WHOEUROCL_SCRC24(4)Invite_MSe.PDF | 2025-11-20 22:10 | 52K | |
![[ ]](/icons/unknown.gif) | WHA 70 EU stmt Address Agenda Item 3 - for alignment.doc | 2025-11-20 22:10 | 31K | |
![[ ]](/icons/unknown.gif) | WHA 70 EU stmt Address Agenda Item 3 - for alignment (1).doc | 2025-11-20 22:10 | 31K | |
![[ ]](/icons/layout.gif) | WHA70 Briefing WHO EURO TechnicalAgenda Items batch 1 20170427 rev1.pdf | 2025-11-20 22:10 | 945K | |
![[ ]](/icons/unknown.gif) | State Public Health Programs - 9,_10 May.pptx | 2025-11-20 22:10 | 313K | |
![[ ]](/icons/unknown.gif) | State Public Health Programs - 9,_10 May (1).pptx | 2025-11-20 22:10 | 313K | |
![[ ]](/icons/layout.gif) | Scanned from a Xerox multifunction device (3).pdf | 2025-11-20 22:10 | 74K | |
![[ ]](/icons/layout.gif) | Scanned from a Xerox multifunction device (2).pdf | 2025-11-20 22:10 | 74K | |
![[ ]](/icons/layout.gif) | PartnerLetter_PEF_TCA_April2017final signed.pdf | 2025-11-20 22:10 | 200K | |
![[ ]](/icons/layout.gif) | PartnerLetter_PEF_TCA_April2017final signed (1).pdf | 2025-11-20 22:10 | 200K | |
![[ ]](/icons/layout.gif) | Mitali 2.pdf | 2025-11-20 22:10 | 341K | |
![[ ]](/icons/layout.gif) | Mitali 2 (1).pdf | 2025-11-20 22:10 | 341K | |
![[ ]](/icons/layout.gif) | Mitali 1.pdf | 2025-11-20 22:10 | 688K | |
![[ ]](/icons/layout.gif) | Mitali 1 (1).pdf | 2025-11-20 22:10 | 688K | |
![[ ]](/icons/unknown.gif) | Georgian Portal Presentation.pptx | 2025-11-20 22:10 | 2.6M | |
![[ ]](/icons/unknown.gif) | Georgian Portal Presentation (1).pptx | 2025-11-20 22:10 | 2.6M | |
![[ ]](/icons/unknown.gif) | Georgia 2017 TCA activities only(002).xlsx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | Georgia 2017 TCA activities only(002) (1).xlsx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | Georgia (10).PDF | 2025-11-20 22:10 | 376K | |
![[ ]](/icons/unknown.gif) | Georgia (9).PDF | 2025-11-20 22:10 | 376K | |
![[ ]](/icons/layout.gif) | GEO_2017_01_HPVd_Devices (3).pdf | 2025-11-20 22:10 | 426K | |
![[ ]](/icons/layout.gif) | GEO_2017_01_HPVd_Devices (2).pdf | 2025-11-20 22:10 | 426K | |
![[ ]](/icons/unknown.gif) | EU Statement for WHA 70 on Antimicrobial Resistance - for alignment.docx | 2025-11-20 22:10 | 25K | |
![[ ]](/icons/unknown.gif) | EU Statement for WHA 70 on Antimicrobial Resistance - for alignment (1).docx | 2025-11-20 22:10 | 25K | |
![[ ]](/icons/unknown.gif) | EU Statement for WHA 70 on 13_1 Human Resources for health - for alignme___.docx | 2025-11-20 22:10 | 19K | |
![[ ]](/icons/unknown.gif) | Copy of for Lexo_1.xlsb | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | Copy of for Lexo_1 (1).xlsb | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | CME - accreditation - eng.pptx | 2025-11-20 22:10 | 244K | |
![[ ]](/icons/unknown.gif) | CME - accreditation - eng (1).pptx | 2025-11-20 22:10 | 244K | |
![[ ]](/icons/unknown.gif) | Application IPD SA & 3 MonthCAS-Research Program 2017.doc | 2025-11-20 22:10 | 656K | |
![[ ]](/icons/unknown.gif) | Application IPD SA & 3 MonthCAS-Research Program 2017 (1).doc | 2025-11-20 22:10 | 656K | |
![[TXT]](/icons/text.gif) | ATT00004 (35).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00004 (34).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (48).htm | 2025-11-20 22:10 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (47).htm | 2025-11-20 22:10 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (88).htm | 2025-11-20 22:10 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (87).htm | 2025-11-20 22:10 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (129).htm | 2025-11-20 22:10 | 1.6K | |
![[ ]](/icons/unknown.gif) | 2017 Seminar on Medical and Health Administration for Georgia.docx | 2025-11-20 22:10 | 24K | |
![[ ]](/icons/unknown.gif) | 2017 Seminar on Medical and Health Administration for Georgia (1).docx | 2025-11-20 22:10 | 24K | |
![[ ]](/icons/layout.gif) | ჩინეთის საელჩოს წერილი_13_04_2017.pdf | 2025-11-20 22:10 | 166K | |
![[ ]](/icons/layout.gif) | ჩინეთის ნოტა_ხელმოწერილი.pdf | 2025-11-20 22:10 | 2.4M | |
![[ ]](/icons/unknown.gif) | საპასუხო ნოტა_ქართლი მხარის მოთხოვნის შესაბამისი.doc | 2025-11-20 22:10 | 28K | |
![[IMG]](/icons/image2.gif) | image002 (230).jpg | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (157).png | 2025-11-20 22:10 | 6.6K | |
![[IMG]](/icons/image2.gif) | image001 (593).png | 2025-11-20 22:10 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (592).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (591).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (590).png | 2025-11-20 22:10 | 26K | |
![[IMG]](/icons/image2.gif) | image001 (589).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (588).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (492).jpg | 2025-11-20 22:10 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (491).jpg | 2025-11-20 22:10 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (490).jpg | 2025-11-20 22:10 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (489).jpg | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (91).gif | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | WHA speech_David Sergeenko.doc | 2025-11-20 22:10 | 28K | |
![[ ]](/icons/unknown.gif) | WHA speech_David Sergeenko (1).doc | 2025-11-20 22:10 | 28K | |
![[ ]](/icons/unknown.gif) | Untitled (4) | 2025-11-20 22:10 | 0 | |
![[ ]](/icons/layout.gif) | Tsirkunov Valery.pdf | 2025-11-20 22:10 | 595K | |
![[ ]](/icons/layout.gif) | Tsirkunov Valery (pro forma invoice).pdf | 2025-11-20 22:10 | 128K | |
![[ ]](/icons/layout.gif) | Tsirkunov Valery (pro forma invoice) (1).pdf | 2025-11-20 22:10 | 128K | |
![[ ]](/icons/layout.gif) | Tsirkunov Valery (1).pdf | 2025-11-20 22:10 | 595K | |
![[ ]](/icons/unknown.gif) | State Report FCNM.docx | 2025-11-20 22:10 | 704K | |
![[ ]](/icons/unknown.gif) | State Report FCNM (1).docx | 2025-11-20 22:10 | 704K | |
![[ ]](/icons/layout.gif) | Siamionau Valery pro forma invoice.pdf | 2025-11-20 22:10 | 141K | |
![[ ]](/icons/layout.gif) | Siamionau Valery pro forma invoice (1).pdf | 2025-11-20 22:10 | 141K | |
![[ ]](/icons/layout.gif) | Siamionau Valery.pdf | 2025-11-20 22:10 | 241K | |
![[ ]](/icons/layout.gif) | Siamionau Valery (1).pdf | 2025-11-20 22:10 | 241K | |
![[ ]](/icons/layout.gif) | ScopeAndPurpose_RotavirusMeeting_June2017_ENG.pdf | 2025-11-20 22:10 | 237K | |
![[ ]](/icons/layout.gif) | Règles européennes relatives aux conditions de rétention administrative ___.pdf | 2025-11-20 22:10 | 590K | |
![[ ]](/icons/layout.gif) | Protocol _final_May 24 2017 Prague.pdf | 2025-11-20 22:10 | 4.3M | |
![[ ]](/icons/unknown.gif) | Polio transition 0 draft amendé, 190517.docx | 2025-11-20 22:10 | 13K | |
![[ ]](/icons/unknown.gif) | Polio transition 0 draft amendé, 190517 (1).docx | 2025-11-20 22:10 | 13K | |
![[ ]](/icons/unknown.gif) | NCDC_LATVIA.doc | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | Lettre de la Présidente du CDCJ.PDF | 2025-11-20 22:10 | 393K | |
![[ ]](/icons/layout.gif) | Letter from the CDCJChairperson.pdf | 2025-11-20 22:10 | 359K | |
![[ ]](/icons/layout.gif) | Letter (5).pdf | 2025-11-20 22:10 | 641K | |
![[ ]](/icons/layout.gif) | Letter (4).pdf | 2025-11-20 22:10 | 641K | |
![[ ]](/icons/layout.gif) | Letter (3).pdf | 2025-11-20 22:10 | 641K | |
![[ ]](/icons/layout.gif) | Letter (2).pdf | 2025-11-20 22:10 | 641K | |
![[ ]](/icons/unknown.gif) | Immunization_-FinalText-GVAPResolution-10May2017.doc | 2025-11-20 22:10 | 97K | |
![[ ]](/icons/unknown.gif) | Immunization_-FinalText-GVAPResolution-10May2017 (1).doc | 2025-11-20 22:10 | 97K | |
![[ ]](/icons/layout.gif) | GEO nomination letter.pdf | 2025-11-20 22:10 | 88K | |
![[ ]](/icons/unknown.gif) | From the Ministry of Labour, Health and Social Affairs of Georgia (1).msg | 2025-11-20 22:10 | 246K | |
![[ ]](/icons/layout.gif) | Frolova Maria.pdf | 2025-11-20 22:10 | 595K | |
![[ ]](/icons/layout.gif) | Frolova Maria (pro forma invoice).pdf | 2025-11-20 22:10 | 128K | |
![[ ]](/icons/layout.gif) | Frolova Maria (pro forma invoice) (1).pdf | 2025-11-20 22:10 | 128K | |
![[ ]](/icons/layout.gif) | Frolova Maria (1).pdf | 2025-11-20 22:10 | 595K | |
![[ ]](/icons/layout.gif) | European rules on theadministrative detention of migrants - Draft codif___.pdf | 2025-11-20 22:10 | 491K | |
![[ ]](/icons/unknown.gif) | EU Statement for WHA 70 on 13_1 Human Resources for health - foralignme___.docx | 2025-11-20 22:10 | 19K | |
![[ ]](/icons/unknown.gif) | Draft Res OP OSCE 2017 CDP.docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | Draft Res OP OSCE 2017 CDP (1).docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/layout.gif) | Briefing WHO EURO TechnicalAgenda Items Batch 2 201720005 (3).pdf | 2025-11-20 22:10 | 902K | |
![[TXT]](/icons/text.gif) | ATT00001 (128).htm | 2025-11-20 22:10 | 1.6K | |
![[ ]](/icons/unknown.gif) | AGREEMENT_cyprus-Geo-chastorebuli_16_01_2014.doc | 2025-11-20 22:10 | 44K | |
![[ ]](/icons/unknown.gif) | AGREEMENT_Cyprus-eng-kviprosis_16_01_2014.doc | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | 2017 04 21 Global Vector Control- Draft Resolution.doc | 2025-11-20 22:10 | 60K | |
![[ ]](/icons/unknown.gif) | 2017 04 21 Global Vector Control- Draft Resolution (1).doc | 2025-11-20 22:10 | 60K | |
![[ ]](/icons/unknown.gif) | 4 სამუშაოს აღწერილობის ფორმა (2).docx | 2025-11-20 22:10 | 26K | |
![[ ]](/icons/unknown.gif) | 1 სამუშაო ანალიზის კითხვარი (2).docx | 2025-11-20 22:10 | 63K | |
![[IMG]](/icons/image2.gif) | 001 (2).jpg | 2025-11-20 22:10 | 537K | |
![[IMG]](/icons/image2.gif) | 001 (1).jpg | 2025-11-20 22:10 | 537K | |
![[TXT]](/icons/text.gif) | ძირითადი_დოკუმენტი (4).html | 2025-11-20 22:10 | 44K | |
![[TXT]](/icons/text.gif) | ძირითადი_დოკუმენტი (3).html | 2025-11-20 22:10 | 44K | |
![[ ]](/icons/unknown.gif) | participants of workshop.docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/layout.gif) | md_mffi_cabinn_confirmation_e3273814.pdf | 2025-11-20 22:10 | 7.7K | |
![[ ]](/icons/unknown.gif) | kakaliashvis-axali.docx | 2025-11-20 22:10 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (587).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (586).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (585).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (584).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (583).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (582).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (488).jpg | 2025-11-20 22:10 | 30K | |
![[IMG]](/icons/image2.gif) | image001 (487).jpg | 2025-11-20 22:10 | 3.6K | |
![[IMG]](/icons/image2.gif) | image001 (486).jpg | 2025-11-20 22:10 | 3.6K | |
![[IMG]](/icons/image2.gif) | image001 (485).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (484).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (483).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (482).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (481).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (480).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (479).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (90).gif | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (89).gif | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (88).gif | 2025-11-20 22:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | image001 (87).gif | 2025-11-20 22:10 | 3.8K | |
![[ ]](/icons/layout.gif) | _Summer school provisional programme.pdf | 2025-11-20 22:10 | 386K | |
![[ ]](/icons/layout.gif) | _Summer school provisional programme (1).pdf | 2025-11-20 22:10 | 386K | |
![[ ]](/icons/layout.gif) | Trip on 12 Jun 17 - PNR ref W2L44A.pdf | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/layout.gif) | Transforming our world the 2030Agenda for Sustainable Development.pdf | 2025-11-20 22:10 | 436K | |
![[ ]](/icons/layout.gif) | Report of the SR on the right ofeveryone to enjoyment of the highest attainable standard of physical andmental health.pdf | 2025-11-20 22:10 | 312K | |
![[ ]](/icons/layout.gif) | Report of the SR on the right of everyone to enjoyment of the highest attainable standard of physical and mental health.pdf | 2025-11-20 22:10 | 312K | |
![[ ]](/icons/layout.gif) | Report of the SR on the right ofeveryone to enjoyment of the highest attainable standard of physical andmental health (1).pdf | 2025-11-20 22:10 | 312K | |
![[ ]](/icons/unknown.gif) | RES_Promoting the right ofeveryone to the enjoyment of the highest attainable standard of physicaland mental health through | 2025-11-20 22:10 | 125K | |
![[ ]](/icons/layout.gif) | Itinerary (2).pdf | 2025-11-20 22:10 | 48K | |
![[ ]](/icons/layout.gif) | Invitation letter GEO_ENG.pdf | 2025-11-20 22:10 | 165K | |
![[ ]](/icons/layout.gif) | GEO_2017_01_HPVd_Devices.pdf | 2025-11-20 22:10 | 426K | |
![[ ]](/icons/layout.gif) | GEO_2017_01_HPVd_Devices (1).pdf | 2025-11-20 22:10 | 426K | |
![[ ]](/icons/layout.gif) | GEO Adamia invitation.pdf | 2025-11-20 22:10 | 298K | |
![[ ]](/icons/layout.gif) | GEO (3).pdf | 2025-11-20 22:10 | 236K | |
![[ ]](/icons/layout.gif) | GEO (2).pdf | 2025-11-20 22:10 | 236K | |
![[ ]](/icons/unknown.gif) | DraftCNpublic_health29Mayrev.docx | 2025-11-20 22:10 | 49K | |
![[ ]](/icons/unknown.gif) | DraftCNpublic_health29Mayrev (2).docx | 2025-11-20 22:10 | 49K | |
![[ ]](/icons/unknown.gif) | DraftCNpublic_health29Mayrev (1).docx | 2025-11-20 22:10 | 49K | |
![[ ]](/icons/unknown.gif) | Credit Card Authorization Form.doc | 2025-11-20 22:10 | 152K | |
![[ ]](/icons/unknown.gif) | Credit Card Authorization Form (1).doc | 2025-11-20 22:10 | 152K | |
![[ ]](/icons/layout.gif) | Confirmation_Letter_676C05B1_Adamia.pdf | 2025-11-20 22:10 | 1.0M | |
![[ ]](/icons/unknown.gif) | 31052017 EU-GEO AssociationAgenda Annex REV2.docx | 2025-11-20 22:10 | 176K | |
![[ ]](/icons/unknown.gif) | 31052017 EU-GEO AssociationAgenda Annex REV2 (1).docx | 2025-11-20 22:10 | 176K | |
![[ ]](/icons/layout.gif) | 170607 Swiss-Georgian VETconference_agenda.pdf | 2025-11-20 22:10 | 25K | |
![[ ]](/icons/layout.gif) | 170607 Swiss-Georgian VET conference_agenda.pdf | 2025-11-20 22:10 | 25K | |
![[ ]](/icons/unknown.gif) | პრაღა, ჩეხეთი_22-24_05_2017.docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | პრაღა, ჩეხეთი_22-24_05_2017 (1).docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/layout.gif) | Скан командировочного.pdf | 2025-11-20 22:10 | 2.1M | |
![[ ]](/icons/layout.gif) | Скан командировочного (1).pdf | 2025-11-20 22:10 | 2.1M | |
![[IMG]](/icons/image2.gif) | juli.djvu | 2025-11-20 22:10 | 78K | |
![[IMG]](/icons/image2.gif) | juli (1).djvu | 2025-11-20 22:10 | 78K | |
![[IMG]](/icons/image2.gif) | image003 (129).jpg | 2025-11-20 22:10 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (581).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (580).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (579).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (578).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (577).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (576).png | 2025-11-20 22:10 | 31K | |
![[ ]](/icons/layout.gif) | Provisional programme (5).pdf | 2025-11-20 22:10 | 377K | |
![[ ]](/icons/layout.gif) | Provisional programme (4).pdf | 2025-11-20 22:10 | 377K | |
![[ ]](/icons/layout.gif) | Provisional programme (3).pdf | 2025-11-20 22:10 | 377K | |
![[ ]](/icons/layout.gif) | Provisional programme (2).pdf | 2025-11-20 22:10 | 377K | |
![[ ]](/icons/layout.gif) | Information-Notice-March-2017.pdf | 2025-11-20 22:10 | 326K | |
![[ ]](/icons/layout.gif) | Information-Notice-March-2017 (3).pdf | 2025-11-20 22:10 | 326K | |
![[ ]](/icons/layout.gif) | Information-Notice-March-2017 (2).pdf | 2025-11-20 22:10 | 326K | |
![[ ]](/icons/layout.gif) | Information-Notice-March-2017 (1).pdf | 2025-11-20 22:10 | 326K | |
![[ ]](/icons/unknown.gif) | HF UHC (RUS) course 2017 brochure RUS.PDF | 2025-11-20 22:10 | 772K | |
![[ ]](/icons/unknown.gif) | HF UHC (RUS) course 2017 brochure RUS (1).PDF | 2025-11-20 22:10 | 772K | |
![[ ]](/icons/unknown.gif) | HF UHC (RUS) course 2017 brochure ENG.PDF | 2025-11-20 22:10 | 725K | |
![[ ]](/icons/unknown.gif) | HF UHC (RUS) course 2017 brochure ENG (1).PDF | 2025-11-20 22:10 | 725K | |
![[ ]](/icons/layout.gif) | Georgia (8).pdf | 2025-11-20 22:10 | 552K | |
![[ ]](/icons/layout.gif) | Georgia (7).pdf | 2025-11-20 22:10 | 552K | |
![[ ]](/icons/layout.gif) | Georgia (6).pdf | 2025-11-20 22:10 | 552K | |
![[ ]](/icons/layout.gif) | Georgia (5).pdf | 2025-11-20 22:10 | 552K | |
![[ ]](/icons/unknown.gif) | Draft Ministerial Declaration on Ageing-April 2017.docx | 2025-11-20 22:10 | 681K | |
![[ ]](/icons/layout.gif) | Detailed#2301-02 (6).pdf | 2025-11-20 22:10 | 6.3K | |
![[ ]](/icons/layout.gif) | Detailed#2301-02 (5).pdf | 2025-11-20 22:10 | 6.3K | |
![[ ]](/icons/layout.gif) | Detailed#2301-02 (4).pdf | 2025-11-20 22:10 | 6.3K | |
![[ ]](/icons/layout.gif) | Detailed#2301-02 (3).pdf | 2025-11-20 22:10 | 6.3K | |
![[ ]](/icons/unknown.gif) | China Note_with amendments.doc | 2025-11-20 22:10 | 28K | |
![[ ]](/icons/unknown.gif) | CRDP ENG-last.doc | 2025-11-20 22:10 | 343K | |
![[ ]](/icons/unknown.gif) | CRDP ENG-last (1).doc | 2025-11-20 22:10 | 343K | |
![[TXT]](/icons/text.gif) | ATT00001 (127).htm | 2025-11-20 22:10 | 334 | |
![[TXT]](/icons/text.gif) | ATT00001 (126).htm | 2025-11-20 22:10 | 334 | |
![[IMG]](/icons/image2.gif) | ATT00001 (8).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00001 (7).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00001 (6).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00001 (5).gif | 2025-11-20 22:10 | 4.4K | |
![[ ]](/icons/unknown.gif) | 31052017 EU-GEO AssociationAgenda Annex REV2_MoLHSA.doc | 2025-11-20 22:10 | 407K | |
![[ ]](/icons/unknown.gif) | 31052017 EU-GEO AssociationAgenda Annex REV2_MoLHSA (1).doc | 2025-11-20 22:10 | 407K | |
![[ ]](/icons/unknown.gif) | 31052017 EU-GEO Association Agenda Annex REV2.docx | 2025-11-20 22:10 | 176K | |
![[ ]](/icons/unknown.gif) | 31052017 EU-GEO Association Agenda Annex REV2 (1).docx | 2025-11-20 22:10 | 176K | |
![[IMG]](/icons/image2.gif) | 2301-02 (8).jpg | 2025-11-20 22:10 | 137K | |
![[IMG]](/icons/image2.gif) | 2301-02 (7).jpg | 2025-11-20 22:10 | 137K | |
![[IMG]](/icons/image2.gif) | 2301-02 (6).jpg | 2025-11-20 22:10 | 137K | |
![[IMG]](/icons/image2.gif) | 2301-02 (5).jpg | 2025-11-20 22:10 | 137K | |
![[IMG]](/icons/image2.gif) | 2301-02 (4).jpg | 2025-11-20 22:10 | 137K | |
![[IMG]](/icons/image2.gif) | 2301-02 (3).jpg | 2025-11-20 22:10 | 137K | |
![[IMG]](/icons/image2.gif) | image002 (156).png | 2025-11-20 22:10 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (155).png | 2025-11-20 22:10 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (154).png | 2025-11-20 22:10 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (153).png | 2025-11-20 22:10 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (575).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (574).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (573).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (572).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (571).png | 2025-11-20 22:10 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (478).jpg | 2025-11-20 22:10 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (477).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (476).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (475).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (474).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (473).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (472).jpg | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (471).jpg | 2025-11-20 22:10 | 4.4K | |
![[ ]](/icons/unknown.gif) | czechaid.docx | 2025-11-20 22:10 | 17K | |
![[ ]](/icons/unknown.gif) | czechaid (1).docx | 2025-11-20 22:10 | 17K | |
![[ ]](/icons/layout.gif) | Scan.pdf | 2025-11-20 22:10 | 2.3M | |
![[ ]](/icons/layout.gif) | Scan (3).pdf | 2025-11-20 22:10 | 2.3M | |
![[ ]](/icons/layout.gif) | Scan (2).pdf | 2025-11-20 22:10 | 2.3M | |
![[ ]](/icons/layout.gif) | Scan (1).pdf | 2025-11-20 22:10 | 2.3M | |
![[ ]](/icons/layout.gif) | Resolution on Leprosy.pdf | 2025-11-20 22:10 | 1.0M | |
![[ ]](/icons/layout.gif) | Resolution on Leprosy (1).pdf | 2025-11-20 22:10 | 1.0M | |
![[ ]](/icons/layout.gif) | ReportHLWG-humanrights-health (1).pdf | 2025-11-20 22:10 | 3.3M | |
![[ ]](/icons/unknown.gif) | Program_G.docx | 2025-11-20 22:10 | 138K | |
![[ ]](/icons/unknown.gif) | Program_G (1).docx | 2025-11-20 22:10 | 138K | |
![[ ]](/icons/unknown.gif) | Program-E.docx | 2025-11-20 22:10 | 79K | |
![[ ]](/icons/unknown.gif) | Program-E (2).docx | 2025-11-20 22:10 | 76K | |
![[ ]](/icons/unknown.gif) | Program-E (1).docx | 2025-11-20 22:10 | 76K | |
![[ ]](/icons/unknown.gif) | Joint operational conclusions of_the second EU.docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | JointStatementWGHealthRights_HRC (1).doc | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | HRC 35 - Right to Health - ZERODRAFT 06062017.docx | 2025-11-20 22:10 | 50K | |
![[ ]](/icons/unknown.gif) | HRC 35 - Right to Health - ZERO DRAFT 06062017.docx | 2025-11-20 22:10 | 50K | |
![[ ]](/icons/unknown.gif) | HRC 35 - Right to Health - ZERODRAFT 06062017 (1).docx | 2025-11-20 22:10 | 50K | |
![[IMG]](/icons/image2.gif) | ATT00006 (3).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00006 (2).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00005 (3).gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | ATT00005 (2).gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | ATT00004 (3).gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | ATT00004 (2).gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | ATT00003 (3).gif | 2025-11-20 22:10 | 354 | |
![[IMG]](/icons/image2.gif) | ATT00003 (2).gif | 2025-11-20 22:10 | 354 | |
![[TXT]](/icons/text.gif) | ATT00002 (86).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (85).htm | 2025-11-20 22:10 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00002 (3).gif | 2025-11-20 22:10 | 358 | |
![[IMG]](/icons/image2.gif) | ATT00002 (2).gif | 2025-11-20 22:10 | 358 | |
![[TXT]](/icons/text.gif) | ATT00001 (125).htm | 2025-11-20 22:10 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (124).htm | 2025-11-20 22:10 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (123).htm | 2025-11-20 22:10 | 168 | |
![[IMG]](/icons/image2.gif) | ATT00001 (4).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00001 (3).gif | 2025-11-20 22:10 | 4.4K | |
![[ ]](/icons/unknown.gif) | 20170601(core group Draft )Resolution on Leprosy.docx | 2025-11-20 22:10 | 48K | |
![[ ]](/icons/unknown.gif) | 20170601(core group Draft ) Resolution on Leprosy.docx | 2025-11-20 22:10 | 48K | |
![[IMG]](/icons/image2.gif) | უნგრეთი.djvu | 2025-11-20 22:10 | 643K | |
![[IMG]](/icons/image2.gif) | უნგრეთი (1).djvu | 2025-11-20 22:10 | 643K | |
![[ ]](/icons/unknown.gif) | დაჯილდოების ფურცელი.doc | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | დაჯილდოების ფურცელი (1).doc | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | Список участников сесинара в Грузию.docx | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/unknown.gif) | Список участников сесинара в Грузию (1).docx | 2025-11-20 22:10 | 70K | |
![[IMG]](/icons/image2.gif) | image003 (97).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image003 (96).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image003 (95).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image003 (94).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image002 (229).jpg | 2025-11-20 22:10 | 923 | |
![[IMG]](/icons/image2.gif) | image002 (228).jpg | 2025-11-20 22:10 | 923 | |
![[IMG]](/icons/image2.gif) | image001 (570).png | 2025-11-20 22:10 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (569).png | 2025-11-20 22:10 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (568).png | 2025-11-20 22:10 | 158K | |
![[IMG]](/icons/image2.gif) | image001 (567).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (566).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (565).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (564).png | 2025-11-20 22:10 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (563).png | 2025-11-20 22:10 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (562).png | 2025-11-20 22:10 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (561).png | 2025-11-20 22:10 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (560).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (559).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (470).jpg | 2025-11-20 22:10 | 876 | |
![[IMG]](/icons/image2.gif) | image001 (469).jpg | 2025-11-20 22:10 | 876 | |
![[IMG]](/icons/image2.gif) | image001 (468).jpg | 2025-11-20 22:10 | 9.3K | |
![[IMG]](/icons/image2.gif) | image001 (467).jpg | 2025-11-20 22:10 | 9.3K | |
![[IMG]](/icons/image2.gif) | image001 (466).jpg | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (465).jpg | 2025-11-20 22:10 | 1.5K | |
![[ ]](/icons/layout.gif) | SergeenkoItineraryITFDE0617-3.pdf | 2025-11-20 22:10 | 93K | |
![[ ]](/icons/layout.gif) | SergeenkoItineraryITFDE0617-3 (1).pdf | 2025-11-20 22:10 | 93K | |
![[ ]](/icons/layout.gif) | SERGEENKO DL_ticket.pdf | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/layout.gif) | SERGEENKO DL_ticket (1).pdf | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/layout.gif) | ReportHLWG-humanrights-health.pdf | 2025-11-20 22:10 | 3.3M | |
![[ ]](/icons/unknown.gif) | JointStatementWGHealthRights_HRC.doc | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | Jgerenaia service passport.PDF | 2025-11-20 22:10 | 1.0M | |
![[ ]](/icons/unknown.gif) | Information Note Alliance 8_7 June 29 - 30 2017 Budapest_ILOpays.doc | 2025-11-20 22:10 | 60K | |
![[ ]](/icons/layout.gif) | Detailed#2301-02 (2).pdf | 2025-11-20 22:10 | 6.3K | |
![[ ]](/icons/layout.gif) | Detailed#2301-02 (1).pdf | 2025-11-20 22:10 | 6.3K | |
![[ ]](/icons/layout.gif) | David Sergeenko_US VISA.pdf | 2025-11-20 22:10 | 619K | |
![[ ]](/icons/layout.gif) | David Sergeenko_US VISA (1).pdf | 2025-11-20 22:10 | 619K | |
![[TXT]](/icons/text.gif) | ATT00002 (84).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (83).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (82).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (81).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (122).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (121).htm | 2025-11-20 22:10 | 1.2K | |
![[TXT]](/icons/text.gif) | ATT00001 (120).htm | 2025-11-20 22:10 | 1.2K | |
![[TXT]](/icons/text.gif) | ATT00001 (119).htm | 2025-11-20 22:10 | 4.0K | |
![[TXT]](/icons/text.gif) | ATT00001 (118).htm | 2025-11-20 22:10 | 4.0K | |
![[IMG]](/icons/image2.gif) | 2301-02 (2).jpg | 2025-11-20 22:10 | 137K | |
![[IMG]](/icons/image2.gif) | 2301-02 (1).jpg | 2025-11-20 22:10 | 137K | |
![[ ]](/icons/unknown.gif) | მინისტრის პროგრამა_USA (1).doc | 2025-11-20 22:10 | 55K | |
![[ ]](/icons/layout.gif) | დღის წესრიგი.pdf | 2025-11-20 22:10 | 286K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი - მთის განვითარების ეროვნული საბჭო #6 - 19_06_2017.docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი - მთის განვითარების ეროვნული საბჭო #6 - 19_06_2017 (1).docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/layout.gif) | დღის წესრიგი (1).pdf | 2025-11-20 22:10 | 286K | |
![[ ]](/icons/layout.gif) | jandacvas pasuxi.pdf | 2025-11-20 22:10 | 235K | |
![[ ]](/icons/layout.gif) | jandacvas pasuxi (1).pdf | 2025-11-20 22:10 | 235K | |
![[ ]](/icons/unknown.gif) | information on childrenrights.doc | 2025-11-20 22:10 | 36K | |
![[IMG]](/icons/image2.gif) | image014 (2).jpg | 2025-11-20 22:10 | 867 | |
![[IMG]](/icons/image2.gif) | image013 (2).jpg | 2025-11-20 22:10 | 821 | |
![[IMG]](/icons/image2.gif) | image012 (3).jpg | 2025-11-20 22:10 | 846 | |
![[IMG]](/icons/image2.gif) | image011 (7).jpg | 2025-11-20 22:10 | 901 | |
![[IMG]](/icons/image2.gif) | image010 (5).jpg | 2025-11-20 22:10 | 862 | |
![[IMG]](/icons/image2.gif) | image009 (12).jpg | 2025-11-20 22:10 | 795 | |
![[IMG]](/icons/image2.gif) | image008 (18).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image007 (17).png | 2025-11-20 22:10 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (23).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image005 (39).png | 2025-11-20 22:10 | 1.7K | |
![[IMG]](/icons/image2.gif) | image004 (51).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (128).jpg | 2025-11-20 22:10 | 9.3K | |
![[IMG]](/icons/image2.gif) | image003 (127).jpg | 2025-11-20 22:10 | 9.3K | |
![[IMG]](/icons/image2.gif) | image003 (126).jpg | 2025-11-20 22:10 | 9.3K | |
![[IMG]](/icons/image2.gif) | image003 (93).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image002 (152).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image001 (558).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (557).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (556).png | 2025-11-20 22:10 | 31K | |
![[IMG]](/icons/image2.gif) | image001 (555).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (554).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (553).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (552).png | 2025-11-20 22:10 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (551).png | 2025-11-20 22:10 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (550).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (549).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (548).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (547).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (546).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (545).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (544).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (543).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (542).png | 2025-11-20 22:10 | 1.8K | |
![[ ]](/icons/layout.gif) | cn250BiodataForm (1).pdf | 2025-11-20 22:10 | 135K | |
![[ ]](/icons/layout.gif) | To Dr_ István Mikola.pdf | 2025-11-20 22:10 | 94K | |
![[ ]](/icons/layout.gif) | To Dr_ István Mikola (1).pdf | 2025-11-20 22:10 | 94K | |
![[ ]](/icons/unknown.gif) | TalkingPoints_agenda_22_June_MoLHSA.doc | 2025-11-20 22:10 | 64K | |
![[ ]](/icons/unknown.gif) | TalkingPoints_agenda_22_June_MoLHSA (1).doc | 2025-11-20 22:10 | 62K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draft op_ concl.doc | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draft op_ concl (2).doc | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draft op_ concl (1).doc | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/unknown.gif) | Information onConclusions_MoLHSA.doc | 2025-11-20 22:10 | 73K | |
![[ ]](/icons/unknown.gif) | Information onConclusions_MoLHSA (1).doc | 2025-11-20 22:10 | 71K | |
![[ ]](/icons/layout.gif) | Detailed#2301-02.pdf | 2025-11-20 22:10 | 239K | |
![[TXT]](/icons/text.gif) | ATT00002 (80).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (79).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (78).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (77).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (117).htm | 2025-11-20 22:10 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (116).htm | 2025-11-20 22:10 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (115).htm | 2025-11-20 22:10 | 600 | |
![[TXT]](/icons/text.gif) | ATT00001 (114).htm | 2025-11-20 22:10 | 600 | |
![[IMG]](/icons/image2.gif) | 2301-02.jpg | 2025-11-20 22:10 | 238K | |
![[ ]](/icons/layout.gif) | 251 სოფრომაძეს.pdf | 2025-11-20 22:10 | 344K | |
![[ ]](/icons/layout.gif) | 251 სოფრომაძეს (1).pdf | 2025-11-20 22:10 | 344K | |
![[ ]](/icons/layout.gif) | 251 გაცემის ბლანკი.pdf | 2025-11-20 22:10 | 172K | |
![[ ]](/icons/layout.gif) | 251 გაცემის ბლანკი (1).pdf | 2025-11-20 22:10 | 172K | |
![[ ]](/icons/layout.gif) | ჯანდაცვის სამინისტროს წერილი.pdf | 2025-11-20 22:10 | 82K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი 17_18 ივნისი.docx | 2025-11-20 22:10 | 96K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი 17_18 ივნისი (1).docx | 2025-11-20 22:10 | 96K | |
![[IMG]](/icons/image2.gif) | logos (2).jpg | 2025-11-20 22:10 | 1.1M | |
![[IMG]](/icons/image2.gif) | image014 (1).jpg | 2025-11-20 22:10 | 867 | |
![[IMG]](/icons/image2.gif) | image013 (1).jpg | 2025-11-20 22:10 | 821 | |
![[IMG]](/icons/image2.gif) | image012 (2).jpg | 2025-11-20 22:10 | 846 | |
![[IMG]](/icons/image2.gif) | image011 (6).jpg | 2025-11-20 22:10 | 901 | |
![[IMG]](/icons/image2.gif) | image010 (4).jpg | 2025-11-20 22:10 | 862 | |
![[IMG]](/icons/image2.gif) | image009 (11).jpg | 2025-11-20 22:10 | 795 | |
![[IMG]](/icons/image2.gif) | image008 (17).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image007 (16).png | 2025-11-20 22:10 | 13K | |
![[IMG]](/icons/image2.gif) | image006 (22).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image005 (38).png | 2025-11-20 22:10 | 1.7K | |
![[IMG]](/icons/image2.gif) | image004 (50).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (92).png | 2025-11-20 22:10 | 2.0K | |
![[IMG]](/icons/image2.gif) | image003 (91).png | 2025-11-20 22:10 | 9.8K | |
![[IMG]](/icons/image2.gif) | image003 (90).png | 2025-11-20 22:10 | 9.8K | |
![[IMG]](/icons/image2.gif) | image002 (151).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image001 (541).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image001 (540).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (539).png | 2025-11-20 22:10 | 8.9K | |
![[IMG]](/icons/image2.gif) | image001 (538).png | 2025-11-20 22:10 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (464).jpg | 2025-11-20 22:10 | 5.2K | |
![[ ]](/icons/layout.gif) | cn250BiodataForm.pdf | 2025-11-20 22:10 | 135K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draft operationalconclusions_MoLHSA_15_06_2017.doc | 2025-11-20 22:10 | 77K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draft operationalconclusions_MoLHSA_15_06_2017 (1).doc | 2025-11-20 22:10 | 77K | |
![[IMG]](/icons/image2.gif) | Picture (Device Independent Bitmap) 1 (2).jpg | 2025-11-20 22:10 | 5.1K | |
![[IMG]](/icons/image2.gif) | Picture (Device Independent Bitmap) 1 (1).jpg | 2025-11-20 22:10 | 5.1K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze (4).pdf | 2025-11-20 22:10 | 54K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze (3).pdf | 2025-11-20 22:10 | 54K | |
![[ ]](/icons/layout.gif) | M_Darakkhvelidze.pdf | 2025-11-20 22:10 | 949K | |
![[ ]](/icons/layout.gif) | M_Darakkhvelidze (1).pdf | 2025-11-20 22:10 | 949K | |
![[ ]](/icons/layout.gif) | DOSSIER DE PRESSE MEMOIRE-RED Georgie.pdf | 2025-11-20 22:10 | 1.3M | |
![[ ]](/icons/layout.gif) | DOC112.pdf | 2025-11-20 22:10 | 72K | |
![[ ]](/icons/layout.gif) | DOC112 (3).pdf | 2025-11-20 22:10 | 72K | |
![[ ]](/icons/layout.gif) | DOC112 (2).pdf | 2025-11-20 22:10 | 72K | |
![[ ]](/icons/layout.gif) | DOC112 (1).pdf | 2025-11-20 22:10 | 72K | |
![[ ]](/icons/layout.gif) | DOC111.pdf | 2025-11-20 22:10 | 88K | |
![[ ]](/icons/layout.gif) | DOC111 (3).pdf | 2025-11-20 22:10 | 88K | |
![[ ]](/icons/layout.gif) | DOC111 (2).pdf | 2025-11-20 22:10 | 88K | |
![[ ]](/icons/layout.gif) | DOC111 (1).pdf | 2025-11-20 22:10 | 88K | |
![[ ]](/icons/layout.gif) | CN250_LogisticsLetter_R1.pdf | 2025-11-20 22:10 | 151K | |
![[ ]](/icons/layout.gif) | CN250_LogisticsLetter_R1 (3).pdf | 2025-11-20 22:10 | 151K | |
![[ ]](/icons/layout.gif) | CN250_LogisticsLetter_R1 (2).pdf | 2025-11-20 22:10 | 151K | |
![[ ]](/icons/layout.gif) | CN250_LogisticsLetter_R1 (1).pdf | 2025-11-20 22:10 | 151K | |
![[ ]](/icons/layout.gif) | AFD - Aide Mémoire Budget support to Georgia May 2017 vf.pdf | 2025-11-20 22:10 | 304K | |
![[ ]](/icons/layout.gif) | 42 AFD - TA on pension reform - letter to Mr_ D_ Sergeenko.pdf | 2025-11-20 22:10 | 334K | |
![[ ]](/icons/layout.gif) | 6_ Кызылординская область.pdf | 2025-11-20 22:10 | 42K | |
![[ ]](/icons/layout.gif) | 6_ Кызылординская область (1).pdf | 2025-11-20 22:10 | 42K | |
![[ ]](/icons/layout.gif) | 5_ Алматинская.pdf | 2025-11-20 22:10 | 356K | |
![[ ]](/icons/layout.gif) | 5_ Алматинская (1).pdf | 2025-11-20 22:10 | 356K | |
![[ ]](/icons/layout.gif) | 4_ Атырауская область.pdf | 2025-11-20 22:10 | 131K | |
![[ ]](/icons/layout.gif) | 4_ Атырауская область (1).pdf | 2025-11-20 22:10 | 131K | |
![[ ]](/icons/layout.gif) | 3_ Павлодарская область.pdf | 2025-11-20 22:10 | 1.4M | |
![[ ]](/icons/layout.gif) | 3_ Павлодарская область (1).pdf | 2025-11-20 22:10 | 1.4M | |
![[ ]](/icons/layout.gif) | 2_ Карагандинская область.pdf | 2025-11-20 22:10 | 280K | |
![[ ]](/icons/layout.gif) | 2_ Карагандинская область (1).pdf | 2025-11-20 22:10 | 280K | |
![[ ]](/icons/layout.gif) | 1_ Мангистауская область.pdf | 2025-11-20 22:10 | 2.3M | |
![[ ]](/icons/layout.gif) | 1_ Мангистауская область (1).pdf | 2025-11-20 22:10 | 2.3M | |
![[IMG]](/icons/image2.gif) | image004 (41).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image003 (89).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (88).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (87).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (86).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (85).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (227).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image002 (226).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image002 (225).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image002 (224).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image001 (537).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (536).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (535).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (534).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (533).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (463).jpg | 2025-11-20 22:10 | 1.0K | |
![[IMG]](/icons/image2.gif) | Picture (Device IndependentBitmap) 1.jpg | 2025-11-20 22:10 | 5.1K | |
![[IMG]](/icons/image2.gif) | Picture (Device IndependentBitmap) 1 (3).jpg | 2025-11-20 22:10 | 5.1K | |
![[IMG]](/icons/image2.gif) | Picture (Device IndependentBitmap) 1 (2).jpg | 2025-11-20 22:10 | 5.1K | |
![[IMG]](/icons/image2.gif) | Picture (Device IndependentBitmap) 1 (1).jpg | 2025-11-20 22:10 | 5.1K | |
![[ ]](/icons/layout.gif) | Letter for Minister Sergeenko.pdf | 2025-11-20 22:10 | 95K | |
![[ ]](/icons/layout.gif) | Letter for Minister Sergeenko (1).pdf | 2025-11-20 22:10 | 95K | |
![[ ]](/icons/unknown.gif) | Georgia MOH Visit Agenda (5).docx | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | Georgia MOH Visit Agenda (4).docx | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | Georgia MOH Visit Agenda (3).docx | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | Georgia MOH Visit Agenda (2).docx | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/layout.gif) | 2017HotelList.pdf | 2025-11-20 22:10 | 612K | |
![[ ]](/icons/unknown.gif) | რეჟიმის ობიექტი.docx | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | marina darakhvelidze pasporti.PDF | 2025-11-20 22:10 | 322K | |
![[ ]](/icons/unknown.gif) | marina darakhvelidze pasporti (1).PDF | 2025-11-20 22:10 | 322K | |
![[IMG]](/icons/image2.gif) | image010 (3).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image010 (2).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image009 (10).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image009 (9).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image009 (8).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image009 (7).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image008 (11).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image008 (10).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image008 (9).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image008 (8).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image007 (9).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image007 (8).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image007 (7).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image007 (6).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image006 (21).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image006 (20).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image006 (17).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image006 (16).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image006 (15).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image006 (14).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image005 (37).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image005 (36).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image005 (22).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image005 (21).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image005 (20).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image005 (19).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image004 (40).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image004 (39).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image004 (38).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image004 (37).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image004 (36).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image004 (35).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image003 (84).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (83).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (82).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (81).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (80).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (79).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (223).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image002 (222).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image002 (221).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image002 (220).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image001 (532).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (531).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (530).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (529).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (528).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (527).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (526).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (525).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (524).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (523).png | 2025-11-20 22:10 | 60K | |
![[ ]](/icons/unknown.gif) | Georgia MOH Visit Agenda_1 (2).doc | 2025-11-20 22:10 | 121K | |
![[ ]](/icons/unknown.gif) | Georgia MOH Visit Agenda.docx | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | Georgia MOH Visit Agenda (1).docx | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | მინისტრის პროგრამა_USA.doc | 2025-11-20 22:10 | 59K | |
![[IMG]](/icons/image2.gif) | image017 (2).png | 2025-11-20 22:10 | 1.0K | |
![[IMG]](/icons/image2.gif) | image017 (1).png | 2025-11-20 22:10 | 1.0K | |
![[IMG]](/icons/image2.gif) | image016 (3).png | 2025-11-20 22:10 | 851 | |
![[IMG]](/icons/image2.gif) | image016 (2).png | 2025-11-20 22:10 | 851 | |
![[IMG]](/icons/image2.gif) | image015.png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image015 (3).png | 2025-11-20 22:10 | 1.0K | |
![[IMG]](/icons/image2.gif) | image015 (2).png | 2025-11-20 22:10 | 1.0K | |
![[IMG]](/icons/image2.gif) | image015 (1).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image014 (4).png | 2025-11-20 22:10 | 851 | |
![[IMG]](/icons/image2.gif) | image014 (3).png | 2025-11-20 22:10 | 851 | |
![[IMG]](/icons/image2.gif) | image014 (2).png | 2025-11-20 22:10 | 841 | |
![[IMG]](/icons/image2.gif) | image014 (1).png | 2025-11-20 22:10 | 841 | |
![[IMG]](/icons/image2.gif) | image013 (4).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image013 (3).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image013 (2).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image013 (1).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image012.png | 2025-11-20 22:10 | 841 | |
![[IMG]](/icons/image2.gif) | image012.gif | 2025-11-20 22:10 | 177 | |
![[IMG]](/icons/image2.gif) | image012 (1).png | 2025-11-20 22:10 | 841 | |
![[IMG]](/icons/image2.gif) | image012 (1).gif | 2025-11-20 22:10 | 177 | |
![[IMG]](/icons/image2.gif) | image011 (5).jpg | 2025-11-20 22:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | image011 (4).jpg | 2025-11-20 22:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | image011 (2).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image011 (1).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image010 (8).png | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image010 (7).png | 2025-11-20 22:10 | 14K | |
![[IMG]](/icons/image2.gif) | image010 (6).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image010 (5).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image009 (6).jpg | 2025-11-20 22:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | image009 (5).jpg | 2025-11-20 22:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | image009 (4).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image009 (3).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image008 (16).png | 2025-11-20 22:10 | 1.0K | |
![[IMG]](/icons/image2.gif) | image008 (15).png | 2025-11-20 22:10 | 1.0K | |
![[IMG]](/icons/image2.gif) | image008 (7).jpg | 2025-11-20 22:10 | 35K | |
![[IMG]](/icons/image2.gif) | image008 (6).jpg | 2025-11-20 22:10 | 35K | |
![[IMG]](/icons/image2.gif) | image007 (15).png | 2025-11-20 22:10 | 851 | |
![[IMG]](/icons/image2.gif) | image007 (14).png | 2025-11-20 22:10 | 851 | |
![[IMG]](/icons/image2.gif) | image006 (19).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image006 (18).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image005 (35).png | 2025-11-20 22:10 | 841 | |
![[IMG]](/icons/image2.gif) | image005 (34).png | 2025-11-20 22:10 | 841 | |
![[IMG]](/icons/image2.gif) | image004 (49).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image004 (48).png | 2025-11-20 22:10 | 21K | |
![[IMG]](/icons/image2.gif) | image003 (78).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (77).png | 2025-11-20 22:10 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (11).gif | 2025-11-20 22:10 | 177 | |
![[IMG]](/icons/image2.gif) | image003 (10).gif | 2025-11-20 22:10 | 177 | |
![[IMG]](/icons/image2.gif) | image002 (219).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image002 (218).jpg | 2025-11-20 22:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | image002 (217).jpg | 2025-11-20 22:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | image002 (216).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image001 (522).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (521).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (520).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (519).png | 2025-11-20 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | image001 (518).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (462).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | image001 (461).jpg | 2025-11-20 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | image001 (86).gif | 2025-11-20 22:10 | 177 | |
![[IMG]](/icons/image2.gif) | image001 (85).gif | 2025-11-20 22:10 | 177 | |
![[IMG]](/icons/image2.gif) | cover C (1).jpg | 2025-11-20 22:10 | 3.7M | |
![[IMG]](/icons/image2.gif) | cover C (1) (1).jpg | 2025-11-20 22:10 | 3.7M | |
![[ ]](/icons/layout.gif) | Iran Commission_Dep.pdf | 2025-11-20 22:10 | 80K | |
![[ ]](/icons/layout.gif) | Iran Commission_Dep (1).pdf | 2025-11-20 22:10 | 80K | |
![[ ]](/icons/layout.gif) | Iran Commission_უწყებებს (2).pdf | 2025-11-20 22:10 | 189K | |
![[ ]](/icons/layout.gif) | Iran Commission_უწყებებს (1).pdf | 2025-11-20 22:10 | 189K | |
![[ ]](/icons/unknown.gif) | Implementation Iran Commission_June_2017.docx | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | Implementation Iran Commission_June_2017 (1).docx | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/layout.gif) | ICARO2 - Official invitation letter - Darakhvelidze.pdf | 2025-11-20 22:10 | 1.0M | |
![[ ]](/icons/unknown.gif) | GEORGIA Presentation 13 06 2017FINAL FINAL.PDF | 2025-11-20 22:10 | 2.5M | |
![[ ]](/icons/unknown.gif) | GEORGIA Presentation 13 06 2017FINAL FINAL (1).PDF | 2025-11-20 22:10 | 2.5M | |
![[ ]](/icons/unknown.gif) | CV-eka bochorishvili.docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/layout.gif) | 20170620_DARAKHVELIDZE_ULLMZH.pdf | 2025-11-20 22:10 | 103K | |
![[ ]](/icons/layout.gif) | 20170620_DARAKHVELIDZE_ULLMZH (5).pdf | 2025-11-20 22:10 | 103K | |
![[ ]](/icons/layout.gif) | 20170620_DARAKHVELIDZE_ULLMZH (4).pdf | 2025-11-20 22:10 | 103K | |
![[ ]](/icons/layout.gif) | 20170620_DARAKHVELIDZE_ULLMZH (3).pdf | 2025-11-20 22:10 | 103K | |
![[ ]](/icons/layout.gif) | 20170620_DARAKHVELIDZE_ULLMZH (2).pdf | 2025-11-20 22:10 | 103K | |
![[ ]](/icons/layout.gif) | 20170620_DARAKHVELIDZE_ULLMZH (1).pdf | 2025-11-20 22:10 | 103K | |
![[ ]](/icons/unknown.gif) | სამთავრობათშორისი_კომისია_1-3.doc | 2025-11-20 22:10 | 84K | |
![[ ]](/icons/unknown.gif) | სამთავრობათშორისი_კომისია_1-3 (1).doc | 2025-11-20 22:10 | 84K | |
![[ ]](/icons/layout.gif) | ირანის მე–5 ეკ_ კომისიაზე.pdf | 2025-11-20 22:10 | 84K | |
![[ ]](/icons/layout.gif) | ირანის მე–5 ეკ_ კომისიაზე (1).pdf | 2025-11-20 22:10 | 84K | |
![[ ]](/icons/layout.gif) | mou_original.pdf | 2025-11-20 22:10 | 14M | |
![[ ]](/icons/layout.gif) | mou_original (1).pdf | 2025-11-20 22:10 | 14M | |
![[IMG]](/icons/image2.gif) | logos (1).jpg | 2025-11-20 22:10 | 1.1M | |
![[IMG]](/icons/image2.gif) | image001 (517).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | Georgia_Minister_of Health_Visit_2017__0002.jpg | 2025-11-20 22:10 | 7.0M | |
![[IMG]](/icons/image2.gif) | Georgia_Minister_of Health_Visit_2017__0002 (1).jpg | 2025-11-20 22:10 | 7.0M | |
![[ ]](/icons/unknown.gif) | Georgia MOU Appendix forHepatitis final (4).docx | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | Georgia MOU Appendix for Hepatitis final (4).docx | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | Georgia MOU Appendix forHepatitis final (4) (1).docx | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | Georgia MOU Appendix for Hepatitis final (4) (1).docx | 2025-11-20 22:10 | 29K | |
![[ ]](/icons/unknown.gif) | Georgia MOH Visit Agenda_1.doc | 2025-11-20 22:10 | 121K | |
![[ ]](/icons/unknown.gif) | Georgia MOH Visit Agenda_1 (1).doc | 2025-11-20 22:10 | 121K | |
![[ ]](/icons/layout.gif) | DOSSIER DE PRESSE MEMOIRE-REDGeorgie (1).pdf | 2025-11-20 22:10 | 1.3M | |
![[ ]](/icons/unknown.gif) | AgendaITFDE0617-1.doc | 2025-11-20 22:10 | 54K | |
![[ ]](/icons/unknown.gif) | AgendaITFDE0617-1 (1).doc | 2025-11-20 22:10 | 54K | |
![[TXT]](/icons/text.gif) | ATT00001 (113).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (112).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (111).htm | 2025-11-20 22:10 | 334 | |
![[TXT]](/icons/text.gif) | ATT00001 (110).htm | 2025-11-20 22:10 | 334 | |
![[ ]](/icons/unknown.gif) | 4 სამუშაოს აღწერილობის ფორმა (1).docx | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | 1 სამუშაო ანალიზის კითხვარი (1).docx | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/unknown.gif) | ინფო მინისტრის აშშ ვიზიტის თაობაზე.doc | 2025-11-20 22:10 | 25K | |
![[ ]](/icons/unknown.gif) | ინფო მინისტრის აშშ ვიზიტის თაობაზე (1).doc | 2025-11-20 22:10 | 25K | |
![[ ]](/icons/layout.gif) | ბ-ნ-სერგეენკოს.pdf | 2025-11-20 22:10 | 485K | |
![[ ]](/icons/layout.gif) | ბ-ნ-სერგეენკოს (1).pdf | 2025-11-20 22:10 | 485K | |
![[ ]](/icons/unknown.gif) | users-registration-data_MoLHSA (3).xlsb | 2025-11-20 22:10 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (516).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (515).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (514).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (513).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (512).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (511).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (460).jpg | 2025-11-20 22:10 | 350 | |
![[IMG]](/icons/image2.gif) | image001 (459).jpg | 2025-11-20 22:10 | 350 | |
![[ ]](/icons/layout.gif) | WHO Letter to Minister of Labour, Health and social Affairs Georgia on final priority setting for PB18-19.pdf | 2025-11-20 22:10 | 85K | |
![[ ]](/icons/layout.gif) | WHO Letter to Minister of Labour, Health and social Affairs Georgia on final priority setting for PB18-19 (1).pdf | 2025-11-20 22:10 | 85K | |
![[ ]](/icons/unknown.gif) | WHE_Country Model_EURO.PDF | 2025-11-20 22:10 | 41K | |
![[ ]](/icons/unknown.gif) | WHE_Country Model_EURO (1).PDF | 2025-11-20 22:10 | 41K | |
![[ ]](/icons/unknown.gif) | Registration form_CAPSCA_BLR_E.docx | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/unknown.gif) | Registration form_CAPSCA_BLR_E (1).docx | 2025-11-20 22:10 | 35K | |
![[ ]](/icons/layout.gif) | PB1819 Health outcomes WHA-version-31May2017.pdf | 2025-11-20 22:10 | 21K | |
![[ ]](/icons/layout.gif) | PB1819 Health outcomes WHA-version-31May2017 (1).pdf | 2025-11-20 22:10 | 21K | |
![[ ]](/icons/unknown.gif) | Info-Sovaldi (3).docx | 2025-11-20 22:10 | 17K | |
![[ ]](/icons/unknown.gif) | Info-Sovaldi (2).docx | 2025-11-20 22:10 | 17K | |
![[ ]](/icons/unknown.gif) | Georgia MOU Appendix forHepatitisfinal_from MoLHSA_1.doc | 2025-11-20 22:10 | 45K | |
![[ ]](/icons/unknown.gif) | Georgia MOU Appendix forHepatitisfinal_from MoLHSA_1 (1).doc | 2025-11-20 22:10 | 45K | |
![[ ]](/icons/unknown.gif) | Georgia MOU Appendix forHepatitis final_from MoLHSA.doc | 2025-11-20 22:10 | 43K | |
![[ ]](/icons/unknown.gif) | Georgia MOU Appendix forHepatitis final_from MoLHSA (1).doc | 2025-11-20 22:10 | 43K | |
![[ ]](/icons/layout.gif) | GEO_Invitation Letter_Martiashvili.pdf | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/layout.gif) | GEO_Invitation Letter_Martiashvili (1).pdf | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/layout.gif) | Filled contribution form byMoLHSA.pdf | 2025-11-20 22:10 | 720K | |
![[ ]](/icons/layout.gif) | CAPSCA-EUR06 Draft Agenda_invitation_ENG.pdf | 2025-11-20 22:10 | 89K | |
![[ ]](/icons/layout.gif) | CAPSCA-EUR06 Draft Agenda_invitation_ENG (1).pdf | 2025-11-20 22:10 | 89K | |
![[ ]](/icons/layout.gif) | 170601 17-0120 CAPSCA-EUR06 inv.pdf | 2025-11-20 22:10 | 465K | |
![[ ]](/icons/layout.gif) | 170601 17-0120 CAPSCA-EUR06 inv (1).pdf | 2025-11-20 22:10 | 465K | |
![[ ]](/icons/unknown.gif) | 2017 16 06 AC Opconclusions-EUproposed_MoLHSA.doc | 2025-11-20 22:10 | 106K | |
![[ ]](/icons/unknown.gif) | 2017 16 06 AC Opconclusions-EUproposed_MoLHSA (1).doc | 2025-11-20 22:10 | 106K | |
![[ ]](/icons/unknown.gif) | 2017 16 06 AC Op conclusions-EUproposed.docx | 2025-11-20 22:10 | 43K | |
![[ ]](/icons/unknown.gif) | 2017 16 06 AC Op conclusions-EUproposed (2).docx | 2025-11-20 22:10 | 45K | |
![[ ]](/icons/unknown.gif) | 2017 16 06 AC Op conclusions-EUproposed (2) (1).docx | 2025-11-20 22:10 | 45K | |
![[ ]](/icons/unknown.gif) | 2017 16 06 AC Op conclusions-EUproposed (1).docx | 2025-11-20 22:10 | 43K | |
![[ ]](/icons/layout.gif) | 39_1784407_e (3).pdf | 2025-11-20 22:10 | 217K | |
![[ ]](/icons/layout.gif) | 39_1784407_e (2).pdf | 2025-11-20 22:10 | 217K | |
![[ ]](/icons/unknown.gif) | 4 სამუშაოს აღწერილობის ფორმა.docx | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | 1 სამუშაო ანალიზის კითხვარი.docx | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/unknown.gif) | სამუშაო ანალიზის კითხვარი თელია.docx | 2025-11-20 22:10 | 68K | |
![[IMG]](/icons/image2.gif) | image001 (510).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (509).png | 2025-11-20 22:10 | 15K | |
![[ ]](/icons/unknown.gif) | Untitled (3) | 2025-11-20 22:10 | 0 | |
![[ ]](/icons/layout.gif) | Trip on 06 Jul 17 - PNR refW9UKQ2.pdf | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/layout.gif) | Trip on 06 Jul 17 - PNR refW9UKQ2 (1).pdf | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/unknown.gif) | Ministry's Letter to Sheba Medical Center.docx | 2025-11-20 22:10 | 11K | |
![[ ]](/icons/unknown.gif) | Ministry's Letter to Sheba Medical Center (1).docx | 2025-11-20 22:10 | 11K | |
![[ ]](/icons/unknown.gif) | Ministry's Letter to Loewenstein Hospital.docx | 2025-11-20 22:10 | 12K | |
![[ ]](/icons/unknown.gif) | Ministry's Letter to Loewenstein Hospital (1).docx | 2025-11-20 22:10 | 12K | |
![[ ]](/icons/unknown.gif) | Mental Health ATLAS questionnaire ENGLISH-04_07_17.docx | 2025-11-20 22:10 | 163K | |
![[ ]](/icons/unknown.gif) | Mental Health ATLAS questionnaire ENGLISH-04_07_17 (1).docx | 2025-11-20 22:10 | 163K | |
![[ ]](/icons/layout.gif) | Invitation_Gamkrelidze.pdf | 2025-11-20 22:10 | 116K | |
![[ ]](/icons/layout.gif) | Invitation_Gamkrelidze (1).pdf | 2025-11-20 22:10 | 116K | |
![[ ]](/icons/unknown.gif) | Georgia (1).xlsx | 2025-11-20 22:10 | 10K | |
![[ ]](/icons/unknown.gif) | From the Ministry of Labour, Health and Social Affairs of Georgia.msg | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | Copy of EMS-Activities-all_GE.xlsm | 2025-11-20 22:10 | 58K | |
![[ ]](/icons/unknown.gif) | Annex 2 (1).docx | 2025-11-20 22:10 | 31K | |
![[ ]](/icons/unknown.gif) | Annex 1 (3).docx | 2025-11-20 22:10 | 28K | |
![[IMG]](/icons/image2.gif) | ATT00011.gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00011 (1).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00010.gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | ATT00010 (1).gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | ATT00009.gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | ATT00009 (1).gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | ATT00008.gif | 2025-11-20 22:10 | 354 | |
![[IMG]](/icons/image2.gif) | ATT00008 (1).gif | 2025-11-20 22:10 | 354 | |
![[IMG]](/icons/image2.gif) | ATT00007.gif | 2025-11-20 22:10 | 358 | |
![[IMG]](/icons/image2.gif) | ATT00007 (1).gif | 2025-11-20 22:10 | 358 | |
![[IMG]](/icons/image2.gif) | ATT00006.gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00006 (1).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00005.gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | ATT00005 (1).gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | ATT00004.gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | ATT00004 (1).gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | ATT00003.gif | 2025-11-20 22:10 | 354 | |
![[IMG]](/icons/image2.gif) | ATT00003 (1).gif | 2025-11-20 22:10 | 354 | |
![[IMG]](/icons/image2.gif) | ATT00002.gif | 2025-11-20 22:10 | 358 | |
![[IMG]](/icons/image2.gif) | ATT00002 (1).gif | 2025-11-20 22:10 | 358 | |
![[IMG]](/icons/image2.gif) | ATT00001 (2).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | ATT00001 (1).gif | 2025-11-20 22:10 | 4.4K | |
![[ ]](/icons/unknown.gif) | 26062017 EU-GEO AssociationAgenda draft.docx | 2025-11-20 22:10 | 124K | |
![[ ]](/icons/unknown.gif) | 2017 NAP Final.xls | 2025-11-20 22:10 | 826K | |
![[ ]](/icons/unknown.gif) | 2017 NAP Final - ealth care department.xls | 2025-11-20 22:10 | 837K | |
![[ ]](/icons/unknown.gif) | 2017 NAP Final - ealth care department (2).xls | 2025-11-20 22:10 | 852K | |
![[ ]](/icons/unknown.gif) | 2017 NAP Final - ealth care department (1).xls | 2025-11-20 22:10 | 842K | |
![[ ]](/icons/layout.gif) | 39_1784407_e.pdf | 2025-11-20 22:10 | 217K | |
![[ ]](/icons/layout.gif) | 39_1784407_e (1).pdf | 2025-11-20 22:10 | 217K | |
![[ ]](/icons/layout.gif) | 3-1-24_2518.pdf | 2025-11-20 22:10 | 107K | |
![[ ]](/icons/layout.gif) | 3-1-24_2518 (1).pdf | 2025-11-20 22:10 | 107K | |
![[ ]](/icons/unknown.gif) | წერილის პროექტი.docx | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | წერილის პროექტი (1).docx | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | შეხვედრა - 03_07_2017.pptx | 2025-11-20 22:10 | 284K | |
![[ ]](/icons/unknown.gif) | შეხვედრა - 03_07_2017 (1).pptx | 2025-11-20 22:10 | 284K | |
![[ ]](/icons/layout.gif) | ტრენინგის დღის წესრიგი_7-9 ივლ^J 2017.pdf | 2025-11-20 22:10 | 148K | |
![[ ]](/icons/unknown.gif) | საქართველოს_მთავრობის_დადგენილება_N218,_28_04_2017.rtf | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | საქართველოს_მთავრობის_დადგენილება_N215,_26_04_2017-1.rtf | 2025-11-20 22:10 | 382K | |
![[ ]](/icons/unknown.gif) | სამუშაო_ანალიზის_კითხვარი_ახალი_მაია ნიკოლეიშვილი (1).doc | 2025-11-20 22:10 | 197K | |
![[ ]](/icons/unknown.gif) | სამუშაო_ანალიზის_კითხვარი.doc | 2025-11-20 22:10 | 162K | |
![[ ]](/icons/unknown.gif) | სამუშაოს_აღწერილობის_ფორმა_ახალი_მაია ნიკოლეიშვილი (1).doc | 2025-11-20 22:10 | 119K | |
![[ ]](/icons/unknown.gif) | სამუშაოს_აღწერილობის_ფორმა.doc | 2025-11-20 22:10 | 91K | |
![[ ]](/icons/layout.gif) | მოსაწვევი ტრენინგზე_ATIPFUND & UNFPA_7-9 ივლ, 2017.pdf | 2025-11-20 22:10 | 85K | |
![[ ]](/icons/unknown.gif) | კიბოს_სტრატეგია_2017_ministry_short.pptx | 2025-11-20 22:10 | 4.0M | |
![[ ]](/icons/unknown.gif) | კიბოს_სტრატეგია_2017_ministry_short (1).pptx | 2025-11-20 22:10 | 4.0M | |
![[ ]](/icons/unknown.gif) | კიბოს_სტრატეგია_2017_ministry.pptx | 2025-11-20 22:10 | 5.2M | |
![[ ]](/icons/unknown.gif) | კიბოს_სტრატეგია_2017_ministry (1).pptx | 2025-11-20 22:10 | 5.2M | |
![[ ]](/icons/unknown.gif) | თამუნა ბერიძე კითხვარი (2).docx | 2025-11-20 22:10 | 66K | |
![[ ]](/icons/unknown.gif) | თამუნა ბერიძე აღწერილობა (2).docx | 2025-11-20 22:10 | 36K | |
![[IMG]](/icons/image2.gif) | დადგენილება 274.djvu | 2025-11-20 22:10 | 81K | |
![[ ]](/icons/layout.gif) | გამყრელიძე.pdf | 2025-11-20 22:10 | 104K | |
![[ ]](/icons/layout.gif) | გამყრელიძე (1).pdf | 2025-11-20 22:10 | 104K | |
![[IMG]](/icons/image2.gif) | image005 (33).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image005 (32).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image003 (76).png | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (75).png | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (74).png | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (73).png | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (508).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (507).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (506).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (505).png | 2025-11-20 22:10 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (504).png | 2025-11-20 22:10 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (503).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (502).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (458).jpg | 2025-11-20 22:10 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (457).jpg | 2025-11-20 22:10 | 4.2K | |
![[ ]](/icons/unknown.gif) | belarus.docx | 2025-11-20 22:10 | 16K | |
![[ ]](/icons/unknown.gif) | belarus (1).docx | 2025-11-20 22:10 | 15K | |
![[ ]](/icons/unknown.gif) | _NHMs_Meeting_25-26Sep2017_prov_Outline_ENG.DOC | 2025-11-20 22:10 | 156K | |
![[ ]](/icons/unknown.gif) | Terms of Reference New Bulk Purchasing.doc | 2025-11-20 22:10 | 41K | |
![[ ]](/icons/unknown.gif) | Terms of Reference New Bulk Purchasing (1).doc | 2025-11-20 22:10 | 41K | |
![[ ]](/icons/layout.gif) | Survey informationapproval_ENG_v15032017.pdf | 2025-11-20 22:10 | 37K | |
![[ ]](/icons/layout.gif) | Survey Letter.pdf | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/layout.gif) | Scope and purpose Survey_ENG.pdf | 2025-11-20 22:10 | 69K | |
![[ ]](/icons/unknown.gif) | Questionnaire_A_BdqNO_DlmNO_30032017_2.docx | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | Questionnaire_A_BdqNO_DlmNO_30032017_2-1 GEORGIA.docx | 2025-11-20 22:10 | 40K | |
![[ ]](/icons/unknown.gif) | NOMINATION FORM.docx | 2025-11-20 22:10 | 14K | |
![[ ]](/icons/unknown.gif) | MoU_Ukraine_GEO.doc | 2025-11-20 22:10 | 42K | |
![[ ]](/icons/unknown.gif) | MoU_Ukraine_ENG.doc | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | Jica.docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | Jica (2).docx | 2025-11-20 22:10 | 25K | |
![[ ]](/icons/unknown.gif) | Jica (1).docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/layout.gif) | JANDACVA_LOGO (1).pdf | 2025-11-20 22:10 | 137K | |
![[ ]](/icons/layout.gif) | JANDACVA_LOGO (1) (1).pdf | 2025-11-20 22:10 | 137K | |
![[ ]](/icons/layout.gif) | INVESBIO cATALOGUE.pdf | 2025-11-20 22:10 | 2.1M | |
![[ ]](/icons/layout.gif) | GEO_NominationLetter_HIVprgMgrs MeetingENG.pdf | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | Belarus Report Form.docx | 2025-11-20 22:10 | 101K | |
![[ ]](/icons/unknown.gif) | Belarus Report Form (1).docx | 2025-11-20 22:10 | 101K | |
![[IMG]](/icons/image2.gif) | ATT00001.gif | 2025-11-20 22:10 | 4.4K | |
![[TXT]](/icons/text.gif) | ATT00001 (109).htm | 2025-11-20 22:10 | 334 | |
![[TXT]](/icons/text.gif) | ATT00001 (108).htm | 2025-11-20 22:10 | 334 | |
![[ ]](/icons/unknown.gif) | APPLICATION FORM FOR MINI - NCDC.docx | 2025-11-20 22:10 | 19K | |
![[ ]](/icons/unknown.gif) | APPLICATION FORM FOR MINI - NCDC (1).docx | 2025-11-20 22:10 | 19K | |
![[ ]](/icons/unknown.gif) | 2017 NAPFinal_MoLHSA_7_07_2017.xls | 2025-11-20 22:10 | 833K | |
![[ ]](/icons/unknown.gif) | 2-2 A1 Form (1).doc | 2025-11-20 22:10 | 45K | |
![[ ]](/icons/unknown.gif) | 2-2 A1 Form (1) (1).doc | 2025-11-20 22:10 | 45K | |
![[ ]](/icons/unknown.gif) | 2-1 Application Form (1).docx | 2025-11-20 22:10 | 63K | |
![[ ]](/icons/unknown.gif) | 2-1 Application Form (1) (1).docx | 2025-11-20 22:10 | 63K | |
![[ ]](/icons/unknown.gif) | დაჯილდოების ფურცელი_გრეგ ალტონი.doc | 2025-11-20 22:10 | 43K | |
![[ ]](/icons/unknown.gif) | დაჯილდოების ფურცელი_გრეგ ალტონი (3).doc | 2025-11-20 22:10 | 43K | |
![[ ]](/icons/unknown.gif) | დაჯილდოების ფურცელი_გრეგ ალტონი (2).doc | 2025-11-20 22:10 | 43K | |
![[ ]](/icons/unknown.gif) | დაჯილდოების ფურცელი_გრეგ ალტონი (1).doc | 2025-11-20 22:10 | 43K | |
![[IMG]](/icons/image2.gif) | ბათუმი მოწვევა.djvu | 2025-11-20 22:10 | 415K | |
![[IMG]](/icons/image2.gif) | ბათუმი მოწვევა (1).djvu | 2025-11-20 22:10 | 415K | |
![[ ]](/icons/unknown.gif) | support letter (2).doc | 2025-11-20 22:10 | 26K | |
![[ ]](/icons/unknown.gif) | support letter (2) (1).doc | 2025-11-20 22:10 | 26K | |
![[IMG]](/icons/image2.gif) | image002 (215).jpg | 2025-11-20 22:10 | 4.6K | |
![[IMG]](/icons/image2.gif) | image002 (214).jpg | 2025-11-20 22:10 | 4.6K | |
![[IMG]](/icons/image2.gif) | image001 (501).png | 2025-11-20 22:10 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (500).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (499).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (456).jpg | 2025-11-20 22:10 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (455).jpg | 2025-11-20 22:10 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (454).jpg | 2025-11-20 22:10 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (453).jpg | 2025-11-20 22:10 | 16K | |
![[IMG]](/icons/image2.gif) | chven (16).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (15).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (14).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (13).png | 2025-11-20 22:10 | 7.2K | |
![[ ]](/icons/unknown.gif) | bolo proeqti (1).docx | 2025-11-20 22:10 | 86K | |
![[ ]](/icons/unknown.gif) | bolo proeqti (1) (1).docx | 2025-11-20 22:10 | 86K | |
![[ ]](/icons/layout.gif) | WHO TB-080317-RU-P.pdf | 2025-11-20 22:10 | 1.3M | |
![[ ]](/icons/layout.gif) | WHO BAR HSS TB course 2017 flyer ENG.pdf | 2025-11-20 22:10 | 480K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draftoperationalconclusions 15_06_2017 _ with Track-Changes (4).doc | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draft operationalconclusions 15_06_2017 _ with Track-Changes (4).doc | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draftoperationalconclusions 15_06_2017 _ with Track-Changes (4) (1).doc | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draft operationalconclusions 15_06_2017 _ with Track-Changes (4) (1).doc | 2025-11-20 22:10 | 70K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draftoperationalconclusions 15_06_2017 _ MoLHSA.doc | 2025-11-20 22:10 | 72K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draftoperationalconclusions 15_06_2017 _ MoLHSA (1).doc | 2025-11-20 22:10 | 72K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draftoperationalconclusions 15 06 2017 _ with Track-Changes_NCD dep (4) (2).doc | 2025-11-20 22:10 | 71K | |
![[ ]](/icons/unknown.gif) | SC VI-2 draftoperationalconclusions 15 06 2017 _ with Track-Changes_NCD dep (4) (2) (1).doc | 2025-11-20 22:10 | 71K | |
![[IMG]](/icons/image2.gif) | Image_image001_jpg@01D2FFCF_E5E551D0.jpg | 2025-11-20 22:10 | 335 | |
![[IMG]](/icons/image2.gif) | Image_image001_jpg@01D2FFCF_E5E551D0 (1).jpg | 2025-11-20 22:10 | 335 | |
![[ ]](/icons/unknown.gif) | Gilead 2017 NB (3).docx | 2025-11-20 22:10 | 24K | |
![[ ]](/icons/unknown.gif) | Gilead 2017 NB (2).docx | 2025-11-20 22:10 | 24K | |
![[ ]](/icons/unknown.gif) | Georgia.xlsx | 2025-11-20 22:10 | 10K | |
![[ ]](/icons/unknown.gif) | GEO (1).PDF | 2025-11-20 22:10 | 102K | |
![[ ]](/icons/unknown.gif) | Annex 2.docx | 2025-11-20 22:10 | 31K | |
![[ ]](/icons/unknown.gif) | Annex 1 (2).docx | 2025-11-20 22:10 | 28K | |
![[ ]](/icons/layout.gif) | 184 (1).pdf | 2025-11-20 22:10 | 65K | |
![[ ]](/icons/unknown.gif) | გილიადი-17_07_17.docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | გილიადი-17_07_17-1_2-3.doc | 2025-11-20 22:10 | 30K | |
![[ ]](/icons/unknown.gif) | გილიადი-17_07_17 (2).docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | გილიადი-17_07_17 (1).docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | letter.doc | 2025-11-20 22:10 | 133K | |
![[ ]](/icons/unknown.gif) | letter (3).doc | 2025-11-20 22:10 | 133K | |
![[ ]](/icons/unknown.gif) | letter (2).doc | 2025-11-20 22:10 | 133K | |
![[ ]](/icons/unknown.gif) | letter (1).doc | 2025-11-20 22:10 | 133K | |
![[IMG]](/icons/image2.gif) | image004 (47).png | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (46).png | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (150).png | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (149).png | 2025-11-20 22:10 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (498).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (497).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (496).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (495).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (494).png | 2025-11-20 22:10 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (493).png | 2025-11-20 22:10 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (492).png | 2025-11-20 22:10 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (491).png | 2025-11-20 22:10 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (490).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (489).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (488).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (487).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | graycol (5).gif | 2025-11-20 22:10 | 105 | |
![[IMG]](/icons/image2.gif) | graycol (4).gif | 2025-11-20 22:10 | 105 | |
![[IMG]](/icons/image2.gif) | chven (12).png | 2025-11-20 22:10 | 7.2K | |
![[ ]](/icons/layout.gif) | WHO Bar HSS TB course Geo.pdf | 2025-11-20 22:10 | 137K | |
![[ ]](/icons/unknown.gif) | John Martin and Gregg AltonInvitations.doc | 2025-11-20 22:10 | 27K | |
![[ ]](/icons/layout.gif) | Invitation letter toMr_Martin.pdf | 2025-11-20 22:10 | 95K | |
![[ ]](/icons/layout.gif) | Invitation letter to Mr_Alton.pdf | 2025-11-20 22:10 | 95K | |
![[ ]](/icons/layout.gif) | COUNCIL DIRECTIVE 2004113EC (3).pdf | 2025-11-20 22:10 | 59K | |
![[TXT]](/icons/text.gif) | ATT00001 (107).htm | 2025-11-20 22:10 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (106).htm | 2025-11-20 22:10 | 168 | |
![[ ]](/icons/unknown.gif) | AMR_NCDC.docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | AMR_NCDC (1).docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/layout.gif) | AA NAP-2016-მოკლე ანგარიში.pdf | 2025-11-20 22:10 | 786K | |
![[ ]](/icons/layout.gif) | AA NAP-2015-მოკლე ანგარიში.pdf | 2025-11-20 22:10 | 383K | |
![[IMG]](/icons/image2.gif) | 10823250.gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | 10823250 (1).gif | 2025-11-20 22:10 | 246 | |
![[IMG]](/icons/image2.gif) | 10795485.gif | 2025-11-20 22:10 | 358 | |
![[IMG]](/icons/image2.gif) | 10795485 (1).gif | 2025-11-20 22:10 | 358 | |
![[IMG]](/icons/image2.gif) | 10691139.gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | 10691139 (1).gif | 2025-11-20 22:10 | 582 | |
![[IMG]](/icons/image2.gif) | 10625908.gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | 10625908 (1).gif | 2025-11-20 22:10 | 4.4K | |
![[IMG]](/icons/image2.gif) | 10324298.gif | 2025-11-20 22:10 | 354 | |
![[IMG]](/icons/image2.gif) | 10324298 (1).gif | 2025-11-20 22:10 | 354 | |
![[IMG]](/icons/image2.gif) | 10269388.gif | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | 10269388 (1).gif | 2025-11-20 22:10 | 7.5K | |
![[ ]](/icons/layout.gif) | წერილი_ჯანდაცვა_ 2004113 დირექტივაზე_გენდერი (3).pdf | 2025-11-20 22:10 | 115K | |
![[ ]](/icons/layout.gif) | წერილი მომხსენებლებს.pdf | 2025-11-20 22:10 | 332K | |
![[ ]](/icons/layout.gif) | წერილი მომხსენებლებს (1).pdf | 2025-11-20 22:10 | 332K | |
![[ ]](/icons/layout.gif) | საქართველოს იუსტიციის სამინისტრო directive 2004_13 (1).pdf | 2025-11-20 22:10 | 145K | |
![[ ]](/icons/unknown.gif) | საკომიტეტო მოსმენისთვის შრომა.docx | 2025-11-20 22:10 | 26K | |
![[ ]](/icons/unknown.gif) | საკომიტეტო მოსმენისთვის შრომა (3).docx | 2025-11-20 22:10 | 26K | |
![[ ]](/icons/unknown.gif) | საკომიტეტო მოსმენისთვის შრომა (2).docx | 2025-11-20 22:10 | 26K | |
![[ ]](/icons/unknown.gif) | საკომიტეტო მოსმენისთვის შრომა (1).docx | 2025-11-20 22:10 | 26K | |
![[ ]](/icons/unknown.gif) | ასოცირების და დღის წესრიგის 2016 წ_ ეროვნული სამოქ | 2025-11-20 22:10 | 3.4M | |
![[ ]](/icons/unknown.gif) | ასოცირებისა და ასოცირების დღის წესრიგის 2015 წლი� | 2025-11-20 22:10 | 3.0M | |
![[ ]](/icons/layout.gif) | ანგარიში 2014-2016.pdf | 2025-11-20 22:10 | 440K | |
![[ ]](/icons/layout.gif) | ანგარიში 2014-2016 (1).pdf | 2025-11-20 22:10 | 440K | |
![[ ]](/icons/unknown.gif) | ამონარიდი გეგმიდან_2004113EC (3).xlsx | 2025-11-20 22:10 | 11K | |
![[ ]](/icons/unknown.gif) | visa-support-letter final.docx | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image008 (14).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image008 (13).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (13).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (12).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image006 (17).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image006 (16).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image005 (31).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (18).jpg | 2025-11-20 22:10 | 2.7K | |
![[IMG]](/icons/image2.gif) | image004 (45).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image004 (34).jpg | 2025-11-20 22:10 | 731 | |
![[IMG]](/icons/image2.gif) | image003 (125).jpg | 2025-11-20 22:10 | 769 | |
![[IMG]](/icons/image2.gif) | image003 (72).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image002 (213).jpg | 2025-11-20 22:10 | 771 | |
![[IMG]](/icons/image2.gif) | image002 (148).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image002 (147).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image002 (146).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (486).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (485).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (484).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (483).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (482).png | 2025-11-20 22:10 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (481).png | 2025-11-20 22:10 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (480).png | 2025-11-20 22:10 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (452).jpg | 2025-11-20 22:10 | 4.9K | |
![[IMG]](/icons/image2.gif) | image001 (451).jpg | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | chven (11).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (10).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (9).png | 2025-11-20 22:10 | 7.2K | |
![[ ]](/icons/unknown.gif) | Info-Sovaldi.docx | 2025-11-20 22:10 | 17K | |
![[ ]](/icons/unknown.gif) | Info-Sovaldi (1).docx | 2025-11-20 22:10 | 17K | |
![[ ]](/icons/layout.gif) | COUNCIL DIRECTIVE 2004113EC.pdf | 2025-11-20 22:10 | 59K | |
![[ ]](/icons/layout.gif) | COUNCIL DIRECTIVE 2004113EC (2).pdf | 2025-11-20 22:10 | 59K | |
![[ ]](/icons/layout.gif) | COUNCIL DIRECTIVE 2004113EC (1).pdf | 2025-11-20 22:10 | 59K | |
![[ ]](/icons/unknown.gif) | Annex_2-1.docx | 2025-11-20 22:10 | 32K | |
![[ ]](/icons/unknown.gif) | Annex_2-1 (1).docx | 2025-11-20 22:10 | 32K | |
![[TXT]](/icons/text.gif) | 01-238(1).html | 2025-11-20 22:10 | 124K | |
![[TXT]](/icons/text.gif) | 01-238(1) (1).html | 2025-11-20 22:10 | 124K | |
![[ ]](/icons/layout.gif) | წერილი_ჯანდაცვა_ 2004113 დირექტივაზე_გენდერი.pdf | 2025-11-20 22:10 | 115K | |
![[ ]](/icons/layout.gif) | წერილი_ჯანდაცვა_ 2004113 დირექტივაზე_გენდერი (2).pdf | 2025-11-20 22:10 | 115K | |
![[ ]](/icons/layout.gif) | წერილი_ჯანდაცვა_ 2004113 დირექტივაზე_გენდერი (1).pdf | 2025-11-20 22:10 | 115K | |
![[ ]](/icons/layout.gif) | საქართველოს იუსტიციის სამინისტროdirective 2004_13.pdf | 2025-11-20 22:10 | 145K | |
![[ ]](/icons/layout.gif) | საქართველოს იუსტიციის სამინისტრო directive 2004_13.pdf | 2025-11-20 22:10 | 145K | |
![[ ]](/icons/layout.gif) | საქართველოს იუსტიციის სამინისტროdirective 2004_13 (1).pdf | 2025-11-20 22:10 | 145K | |
![[ ]](/icons/unknown.gif) | მივლინების ბრძანება.docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | მივლინების ბრძანება (1).docx | 2025-11-20 22:10 | 23K | |
![[ ]](/icons/unknown.gif) | მივლინების ანგარიშის ფორმა.doc | 2025-11-20 22:10 | 28K | |
![[ ]](/icons/unknown.gif) | მივლინების ანგარიშის ფორმა (1).doc | 2025-11-20 22:10 | 28K | |
![[ ]](/icons/unknown.gif) | ამონარიდი გეგმიდან_2004113EC.xlsx | 2025-11-20 22:10 | 11K | |
![[ ]](/icons/unknown.gif) | ამონარიდი გეგმიდან_2004113EC (2).xlsx | 2025-11-20 22:10 | 11K | |
![[ ]](/icons/unknown.gif) | ამონარიდი გეგმიდან_2004113EC (1).xlsx | 2025-11-20 22:10 | 11K | |
![[ ]](/icons/unknown.gif) | Дорожная+карта.doc | 2025-11-20 22:10 | 135K | |
![[ ]](/icons/unknown.gif) | Дорожная карта.doc | 2025-11-20 22:10 | 135K | |
![[ ]](/icons/layout.gif) | letter to Mr_ Wan Lianpo.pdf | 2025-11-20 22:10 | 86K | |
![[ ]](/icons/layout.gif) | letter to Mr_ Wan Lianpo (1).pdf | 2025-11-20 22:10 | 86K | |
![[IMG]](/icons/image2.gif) | image008 (12).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image008 (11).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image008 (10).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (11).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (10).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (9).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image006 (15).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image006 (14).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image006 (13).png | 2025-11-20 22:10 | 1.8K | |
![[IMG]](/icons/image2.gif) | image005 (30).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (29).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (28).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (27).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image004 (44).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image004 (43).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image004 (42).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image004 (41).png | 2025-11-20 22:10 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (71).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (70).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (69).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (68).png | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image002 (145).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (144).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (143).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (142).png | 2025-11-20 22:10 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (479).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (478).png | 2025-11-20 22:10 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (477).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (476).png | 2025-11-20 22:10 | 7.2K | |
![[IMG]](/icons/image2.gif) | image001 (475).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (474).png | 2025-11-20 22:10 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (473).png | 2025-11-20 22:10 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (472).png | 2025-11-20 22:10 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (471).png | 2025-11-20 22:10 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (470).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (469).png | 2025-11-20 22:10 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (468).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (467).png | 2025-11-20 22:10 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (450).jpg | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image001 (449).jpg | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image001 (448).jpg | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image001 (447).jpg | 2025-11-20 22:10 | 1.4K | |
![[IMG]](/icons/image2.gif) | image001 (446).jpg | 2025-11-20 22:10 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (445).jpg | 2025-11-20 22:10 | 7.7K | |
![[ ]](/icons/unknown.gif) | SC VI draft operational conclusions - CLEAN.doc | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/unknown.gif) | SC VI draft operational conclusions - CLEAN (1).doc | 2025-11-20 22:10 | 68K | |
![[ ]](/icons/unknown.gif) | Non-Paper_MoLHSA_31_07_2017.doc | 2025-11-20 22:10 | 173K | |
![[ ]](/icons/unknown.gif) | Non-Paper_MoLHSA_31_07_2017 (1).doc | 2025-11-20 22:10 | 173K | |
![[ ]](/icons/unknown.gif) | Non-Paper_15 05 2017.docx | 2025-11-20 22:10 | 73K | |
![[ ]](/icons/unknown.gif) | Non-Paper_15 05 2017 (3).docx | 2025-11-20 22:10 | 71K | |
![[ ]](/icons/unknown.gif) | Non-Paper_15 05 2017 (2).docx | 2025-11-20 22:10 | 71K | |
![[ ]](/icons/unknown.gif) | Non-Paper_15 05 2017 (1).docx | 2025-11-20 22:10 | 73K | |
![[ ]](/icons/layout.gif) | JANDACVA_LOGO.pdf | 2025-11-20 22:10 | 137K | |
![[ ]](/icons/unknown.gif) | Copy of UIS_RD_2017- NCDC 2016.xlsx | 2025-11-20 22:10 | 281K | |
![[ ]](/icons/unknown.gif) | Copy of UIS_RD_2017- NCDC 2016 (1).xlsx | 2025-11-20 22:10 | 281K | |
![[ ]](/icons/unknown.gif) | Annex (4).docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | Annex (3).docx | 2025-11-20 22:10 | 18K | |
![[ ]](/icons/unknown.gif) | 8,08 ჯანდაცვა.xls | 2025-11-20 22:10 | 80K | |
![[ ]](/icons/unknown.gif) | 8,08 ჯანდაცვა (1).xls | 2025-11-20 22:10 | 80K | |
![[ ]](/icons/layout.gif) | 2-1 Application Form (1)MOLHSA (3).pdf | 2025-11-20 22:10 | 430K | |
![[ ]](/icons/layout.gif) | 2-1 Application Form (1)MOLHSA (2).pdf | 2025-11-20 22:10 | 430K | |
![[ ]](/icons/unknown.gif) | წისქვილი 100 ლარიანი მენიუ (3).xls | 2025-11-20 22:10 | 77K | |
![[ ]](/icons/unknown.gif) | წისქვილი 100 ლარიანი მენიუ (2).xls | 2025-11-20 22:10 | 77K | |
![[ ]](/icons/unknown.gif) | წისქვილი 90 ლარიანი მენიუ (3).xls | 2025-11-20 22:10 | 77K | |
![[ ]](/icons/unknown.gif) | წისქვილი 90 ლარიანი მენიუ (2).xls | 2025-11-20 22:10 | 77K | |
![[ ]](/icons/unknown.gif) | წისქვილი 80 ლარიანი მენიუ (3).xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 80 ლარიანი მენიუ (2).xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 70 ლარიანი მენიუ (3).xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 70 ლარიანი მენიუ (2).xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 60 ლარიანი მენიუ (3).xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 60 ლარიანი მენიუ (2).xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 50 ლარიანი მენიუ (3).xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 50 ლარიანი მენიუ (2).xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილის სრული მენიუ.xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილის სრული მენიუ (1).xls | 2025-11-20 22:10 | 78K | |
![[ ]](/icons/layout.gif) | ეთნო წისქვილი სასმლის მენიუ (3).pdf | 2025-11-20 22:10 | 3.3M | |
![[ ]](/icons/layout.gif) | ეთნო წისქვილი სასმლის მენიუ (2).pdf | 2025-11-20 22:10 | 3.3M | |
![[ ]](/icons/layout.gif) | nomination from MoLHSA.pdf | 2025-11-20 22:09 | 94K | |
![[ ]](/icons/unknown.gif) | mediagegma-tavdacva.docx | 2025-11-20 22:09 | 18K | |
![[IMG]](/icons/image2.gif) | image003 (124).jpg | 2025-11-20 22:09 | 4.6K | |
![[IMG]](/icons/image2.gif) | image003 (123).jpg | 2025-11-20 22:09 | 4.6K | |
![[IMG]](/icons/image2.gif) | image003 (122).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (212).jpg | 2025-11-20 22:09 | 2.9K | |
![[IMG]](/icons/image2.gif) | image002 (211).jpg | 2025-11-20 22:09 | 2.9K | |
![[IMG]](/icons/image2.gif) | image002 (141).png | 2025-11-20 22:09 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (466).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (465).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (464).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (463).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (462).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (461).png | 2025-11-20 22:09 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (444).jpg | 2025-11-20 22:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001 (443).jpg | 2025-11-20 22:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001 (442).jpg | 2025-11-20 22:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | image001 (441).jpg | 2025-11-20 22:09 | 3.3K | |
![[ ]](/icons/unknown.gif) | eleqtronuli (2).docx | 2025-11-20 22:09 | 16K | |
![[IMG]](/icons/image2.gif) | chven (8).png | 2025-11-20 22:09 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (7).png | 2025-11-20 22:09 | 7.2K | |
![[ ]](/icons/layout.gif) | World Health Summit at a Glance.pdf | 2025-11-20 22:09 | 181K | |
![[ ]](/icons/layout.gif) | World Health Summit 2017 Preliminary Program Overview.pdf | 2025-11-20 22:09 | 164K | |
![[ ]](/icons/unknown.gif) | Protocol turkmen 2016_ჩასწორებებით.doc | 2025-11-20 22:09 | 107K | |
![[ ]](/icons/unknown.gif) | Protocol turkmen 2016_ჩასწორებებით (1).doc | 2025-11-20 22:09 | 107K | |
![[ ]](/icons/layout.gif) | Practical-information Unece.pdf | 2025-11-20 22:09 | 334K | |
![[ ]](/icons/layout.gif) | Practical-information Unece (1).pdf | 2025-11-20 22:09 | 334K | |
![[ ]](/icons/layout.gif) | LNCT_LaunchMeetingReport-14July2017 (3).pdf | 2025-11-20 22:09 | 763K | |
![[ ]](/icons/layout.gif) | Georgia_MoH_Country core group confirmation 3AUG2017 (3).pdf | 2025-11-20 22:09 | 183K | |
![[ ]](/icons/layout.gif) | Georgia_MoF_Country core group confirmation 3AUG2017 (3).pdf | 2025-11-20 22:09 | 183K | |
![[ ]](/icons/unknown.gif) | Draft - 21 July.docx | 2025-11-20 22:09 | 486K | |
![[ ]](/icons/unknown.gif) | Dear Dr Joao Breda-from Nino Berdzuli.docx | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | Dear Dr Joao Breda-from Nino Berdzuli (1).docx | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/layout.gif) | DOC019[3].pdf | 2025-11-20 22:09 | 5.1M | |
![[ ]](/icons/layout.gif) | DOC019[3] (1).pdf | 2025-11-20 22:09 | 5.1M | |
![[ ]](/icons/layout.gif) | 2-1 Application Form (1)MOLHSA.pdf | 2025-11-20 22:09 | 426K | |
![[ ]](/icons/layout.gif) | 2-1 Application Form (1)MOLHSA (1).pdf | 2025-11-20 22:09 | 426K | |
![[ ]](/icons/layout.gif) | ჯანდაცვის სამინისტრო_წერილი.pdf | 2025-11-20 22:09 | 245K | |
![[ ]](/icons/layout.gif) | ჯანდაცვის სამინისტრო_წერილი (1).pdf | 2025-11-20 22:09 | 245K | |
![[ ]](/icons/layout.gif) | ჯანდაცვა - წერილი.pdf | 2025-11-20 22:09 | 204K | |
![[ ]](/icons/layout.gif) | ჯანდაცვა - წერილი (1).pdf | 2025-11-20 22:09 | 204K | |
![[ ]](/icons/unknown.gif) | გილიადი დაჯილდოება.docx | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | irani.djvu | 2025-11-20 22:09 | 33K | |
![[IMG]](/icons/image2.gif) | irani (1).djvu | 2025-11-20 22:09 | 33K | |
![[IMG]](/icons/image2.gif) | image007 (8).png | 2025-11-20 22:09 | 258K | |
![[IMG]](/icons/image2.gif) | image004 (40).png | 2025-11-20 22:09 | 3.0K | |
![[IMG]](/icons/image2.gif) | image003 (67).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image003 (66).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image003 (65).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image002 (140).png | 2025-11-20 22:09 | 2.0K | |
![[IMG]](/icons/image2.gif) | image002 (139).png | 2025-11-20 22:09 | 2.0K | |
![[IMG]](/icons/image2.gif) | image002 (138).png | 2025-11-20 22:09 | 2.0K | |
![[IMG]](/icons/image2.gif) | image002 (137).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (136).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (135).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (134).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (133).png | 2025-11-20 22:09 | 1.3K | |
![[IMG]](/icons/image2.gif) | image001 (460).png | 2025-11-20 22:09 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (459).png | 2025-11-20 22:09 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (458).png | 2025-11-20 22:09 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (457).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (456).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (455).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (454).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (453).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (452).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (451).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (450).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (449).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (448).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (447).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (446).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (445).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (440).jpg | 2025-11-20 22:09 | 5.5K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania - Passport New.pdf | 2025-11-20 22:09 | 516K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania - Passport New (1).pdf | 2025-11-20 22:09 | 516K | |
![[ ]](/icons/layout.gif) | N_ Odisharia - Passport.pdf | 2025-11-20 22:09 | 544K | |
![[ ]](/icons/layout.gif) | N_ Odisharia - Passport (1).pdf | 2025-11-20 22:09 | 544K | |
![[ ]](/icons/unknown.gif) | Mindobiloba NEW.PDF | 2025-11-20 22:09 | 2.1M | |
![[ ]](/icons/unknown.gif) | List (2).docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/layout.gif) | LNCT_LaunchMeetingReport-14July2017.pdf | 2025-11-20 22:09 | 763K | |
![[ ]](/icons/layout.gif) | LNCT_LaunchMeetingReport-14July2017 (2).pdf | 2025-11-20 22:09 | 763K | |
![[ ]](/icons/layout.gif) | LNCT_LaunchMeetingReport-14July2017 (1).pdf | 2025-11-20 22:09 | 763K | |
![[ ]](/icons/layout.gif) | Georgia_MoH_Country core group confirmation 3AUG2017.pdf | 2025-11-20 22:09 | 183K | |
![[ ]](/icons/layout.gif) | Georgia_MoH_Country core group confirmation 3AUG2017 (2).pdf | 2025-11-20 22:09 | 183K | |
![[ ]](/icons/layout.gif) | Georgia_MoH_Country core group confirmation 3AUG2017 (1).pdf | 2025-11-20 22:09 | 183K | |
![[ ]](/icons/layout.gif) | Georgia_MoF_Country core group confirmation 3AUG2017.pdf | 2025-11-20 22:09 | 183K | |
![[ ]](/icons/layout.gif) | Georgia_MoF_Country core group confirmation 3AUG2017 (2).pdf | 2025-11-20 22:09 | 183K | |
![[ ]](/icons/layout.gif) | Georgia_MoF_Country core group confirmation 3AUG2017 (1).pdf | 2025-11-20 22:09 | 183K | |
![[ ]](/icons/unknown.gif) | GEL.PDF | 2025-11-20 22:09 | 8.9K | |
![[ ]](/icons/unknown.gif) | Final Agenda.docx | 2025-11-20 22:09 | 487K | |
![[ ]](/icons/unknown.gif) | Final Agenda (1).docx | 2025-11-20 22:09 | 487K | |
![[ ]](/icons/unknown.gif) | Draft Agenda Gilead As of AUGUST 3RD.docx | 2025-11-20 22:09 | 487K | |
![[ ]](/icons/unknown.gif) | Draft Agenda Gilead As of AUGUST 3RD (1).docx | 2025-11-20 22:09 | 487K | |
![[ ]](/icons/layout.gif) | Company Details New.pdf | 2025-11-20 22:09 | 61K | |
![[ ]](/icons/unknown.gif) | CREDENTIALS 67 session.doc | 2025-11-20 22:09 | 27K | |
![[TXT]](/icons/text.gif) | ATT00005 (27).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005 (26).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00004 (33).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (32).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (46).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (45).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (76).htm | 2025-11-20 22:09 | 3.9K | |
![[TXT]](/icons/text.gif) | ATT00002 (75).htm | 2025-11-20 22:09 | 3.9K | |
![[TXT]](/icons/text.gif) | ATT00001 (105).htm | 2025-11-20 22:09 | 483 | |
![[TXT]](/icons/text.gif) | ATT00001 (104).htm | 2025-11-20 22:09 | 483 | |
![[ ]](/icons/layout.gif) | 67 Session Credential_MoLHSA.pdf | 2025-11-20 22:09 | 608K | |
![[ ]](/icons/unknown.gif) | ღვინის ბარათი.rtf | 2025-11-20 22:09 | 158K | |
![[ ]](/icons/unknown.gif) | ღვინის ბარათი (1).rtf | 2025-11-20 22:09 | 158K | |
![[ ]](/icons/unknown.gif) | ქართული მენიუ.rtf | 2025-11-20 22:09 | 170K | |
![[ ]](/icons/unknown.gif) | ქართული მენიუ (1).rtf | 2025-11-20 22:09 | 170K | |
![[ ]](/icons/layout.gif) | გილიადის დელეგაციის დახვედრა–გაცილება.pdf | 2025-11-20 22:09 | 96K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (4).jpg | 2025-11-20 22:09 | 823 | |
![[IMG]](/icons/image2.gif) | ~WRD000 (3).jpg | 2025-11-20 22:09 | 823 | |
![[IMG]](/icons/image2.gif) | image006 (12).png | 2025-11-20 22:09 | 258K | |
![[IMG]](/icons/image2.gif) | image006 (11).png | 2025-11-20 22:09 | 258K | |
![[IMG]](/icons/image2.gif) | image004 (39).png | 2025-11-20 22:09 | 3.0K | |
![[IMG]](/icons/image2.gif) | image004 (38).png | 2025-11-20 22:09 | 3.0K | |
![[IMG]](/icons/image2.gif) | image003 (64).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (63).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image002 (210).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image002 (132).png | 2025-11-20 22:09 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (131).png | 2025-11-20 22:09 | 1.3K | |
![[IMG]](/icons/image2.gif) | image001 (444).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (443).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (442).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (441).png | 2025-11-20 22:09 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (440).png | 2025-11-20 22:09 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (439).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (439).jpg | 2025-11-20 22:09 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (438).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (438).jpg | 2025-11-20 22:09 | 5.5K | |
![[ ]](/icons/unknown.gif) | XXX დანართი_ევროკავშირის დირექტივები ვადებით.doc | 2025-11-20 22:09 | 258K | |
![[ ]](/icons/unknown.gif) | Ticket booking (2).doc | 2025-11-20 22:09 | 22K | |
![[ ]](/icons/unknown.gif) | Ticket booking (1).doc | 2025-11-20 22:09 | 22K | |
![[ ]](/icons/unknown.gif) | Tentative Agenda_Pandemic simulation_Revised.docx | 2025-11-20 22:09 | 208K | |
![[ ]](/icons/unknown.gif) | Tentative Agenda_Pandemic simulation_Revised (1).docx | 2025-11-20 22:09 | 208K | |
![[ ]](/icons/unknown.gif) | Talking point_2.doc | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/unknown.gif) | Talking point_1.doc | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | Talking point_1 (1).doc | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | Report Form and Questionnaire.doc | 2025-11-20 22:09 | 123K | |
![[ ]](/icons/unknown.gif) | Report Form and Questionnaire (1).doc | 2025-11-20 22:09 | 123K | |
![[ ]](/icons/layout.gif) | Prof GAMKRELIDZE ticket_2 (2).pdf | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/layout.gif) | Prof GAMKRELIDZE ticket_2 (1).pdf | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/layout.gif) | Prof GAMKRELIDZE ticket_1 (2).pdf | 2025-11-20 22:09 | 150K | |
![[ ]](/icons/layout.gif) | Prof GAMKRELIDZE ticket_1 (1).pdf | 2025-11-20 22:09 | 150K | |
![[ ]](/icons/unknown.gif) | NORWAY Legal Framework GEO.DOC | 2025-11-20 22:09 | 55K | |
![[ ]](/icons/unknown.gif) | NORWAY Legal Framework GEO (1).DOC | 2025-11-20 22:09 | 55K | |
![[ ]](/icons/unknown.gif) | MIA_PP_GEO_V03_01_MIASA_OSMEEI_2017-03-28.docx | 2025-11-20 22:09 | 151K | |
![[ ]](/icons/unknown.gif) | MIA_PP_GEO_V03_01_MIASA_OSMEEI_2017-03-28 (1).docx | 2025-11-20 22:09 | 151K | |
![[ ]](/icons/unknown.gif) | Letter.PDF | 2025-11-20 22:09 | 221K | |
![[ ]](/icons/unknown.gif) | Letter (1).PDF | 2025-11-20 22:09 | 221K | |
![[ ]](/icons/unknown.gif) | Invoice 130 - ჯანდაცვა - 08_08_17.doc | 2025-11-20 22:09 | 233K | |
![[ ]](/icons/unknown.gif) | Invoice 130 - ჯანდაცვა - 08_08_17 (3).doc | 2025-11-20 22:09 | 233K | |
![[ ]](/icons/unknown.gif) | Invoice 130 - ჯანდაცვა - 08_08_17 (2).doc | 2025-11-20 22:09 | 233K | |
![[ ]](/icons/unknown.gif) | Invoice 130 - ჯანდაცვა - 08_08_17 (1).doc | 2025-11-20 22:09 | 233K | |
![[ ]](/icons/unknown.gif) | INFORMATION FOR DELEGATIONS.PDF | 2025-11-20 22:09 | 808K | |
![[ ]](/icons/unknown.gif) | INFORMATION FOR DELEGATIONS (1).PDF | 2025-11-20 22:09 | 808K | |
![[ ]](/icons/unknown.gif) | From the Ministry of Labour, Health and Social Affairs of Georgia - Tickets and Accomodation.msg | 2025-11-20 22:09 | 258K | |
![[ ]](/icons/unknown.gif) | 02 INVITACIÓN GOBIERNOS TRADUCCION CORTESIA ENG (1).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | 02 INVITACIÓN GOBIERNOS TRADUCCION CORTESIA ENG (1) (1).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | მთავრობის ანგარიში (2).docx | 2025-11-20 22:09 | 56K | |
![[ ]](/icons/unknown.gif) | დანართი XXXI_ევროკავშირის დირექტივები_საზოგადოებრივი ჯანდაცვა.doc | 2025-11-20 22:09 | 138K | |
![[ ]](/icons/unknown.gif) | დანართი XXXI_ევროკავშირის დირექტივები_საზოგადოებრივი ჯანდაცვა (1).doc | 2025-11-20 22:09 | 138K | |
![[IMG]](/icons/image2.gif) | logos.jpg | 2025-11-20 22:09 | 1.1M | |
![[IMG]](/icons/image2.gif) | image005 (17).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image004 (37).png | 2025-11-20 22:09 | 2.0K | |
![[IMG]](/icons/image2.gif) | image004 (33).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image003 (121).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image003 (62).png | 2025-11-20 22:09 | 176 | |
![[IMG]](/icons/image2.gif) | image002 (130).png | 2025-11-20 22:09 | 2.0K | |
![[IMG]](/icons/image2.gif) | image002 (129).png | 2025-11-20 22:09 | 2.0K | |
![[IMG]](/icons/image2.gif) | image002 (128).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (127).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (126).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (125).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (437).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (437).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (436).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (436).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (435).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (435).jpg | 2025-11-20 22:09 | 1.2K | |
![[IMG]](/icons/image2.gif) | image001 (434).png | 2025-11-20 22:09 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (434).jpg | 2025-11-20 22:09 | 1.2K | |
![[IMG]](/icons/image2.gif) | image001 (433).png | 2025-11-20 22:09 | 176 | |
![[IMG]](/icons/image2.gif) | image001 (432).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (431).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (430).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (429).png | 2025-11-20 22:09 | 7.5K | |
![[ ]](/icons/unknown.gif) | filled Supplier's BankDetails_Mr_ David Sergeenko.xlsb | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/unknown.gif) | filled Supplier's BankDetails_Mr_ David Sergeenko (1).xlsb | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/layout.gif) | WHO EURO RC67_SDG_Sergeenko.pdf | 2025-11-20 22:09 | 82K | |
![[ ]](/icons/layout.gif) | WHO EURO RC67_SDG_Sergeenko (1).pdf | 2025-11-20 22:09 | 82K | |
![[ ]](/icons/unknown.gif) | Supplier's Bank Details template (2).xls | 2025-11-20 22:09 | 85K | |
![[ ]](/icons/unknown.gif) | Supplier's Bank Details template (2) (1).xls | 2025-11-20 22:09 | 85K | |
![[ ]](/icons/layout.gif) | SERGEENKO_DAVID_MR_ticket_2.pdf | 2025-11-20 22:09 | 6.8K | |
![[ ]](/icons/layout.gif) | SERGEENKO_DAVID_MR_ticket_2 (1).pdf | 2025-11-20 22:09 | 6.8K | |
![[ ]](/icons/layout.gif) | OstravaDeclaration_SIGNED.pdf | 2025-11-20 22:09 | 1.5M | |
![[ ]](/icons/layout.gif) | OstravaDeclaration_SIGNED (1).pdf | 2025-11-20 22:09 | 1.5M | |
![[ ]](/icons/layout.gif) | LNCT Meeting Report - final - rus.pdf | 2025-11-20 22:09 | 1.0M | |
![[ ]](/icons/layout.gif) | Georgia_MoH_Country core group confirmation 3AUG2017-rus.pdf | 2025-11-20 22:09 | 219K | |
![[ ]](/icons/layout.gif) | Georgia_MoF_Country core group confirmation 3AUG2017-rus.pdf | 2025-11-20 22:09 | 218K | |
![[ ]](/icons/layout.gif) | DOSSIER DE PRESSE MEMOIRE-REDGeorgie.pdf | 2025-11-20 22:09 | 1.3M | |
![[ ]](/icons/layout.gif) | Annex2.pdf | 2025-11-20 22:09 | 369K | |
![[ ]](/icons/layout.gif) | Annex2 (1).pdf | 2025-11-20 22:09 | 369K | |
![[ ]](/icons/layout.gif) | Annex1.pdf | 2025-11-20 22:09 | 681K | |
![[ ]](/icons/layout.gif) | Annex1 (1).pdf | 2025-11-20 22:09 | 681K | |
![[ ]](/icons/layout.gif) | 170756English_Ostrava follow upwith MoH and MoE final ENG.pdf | 2025-11-20 22:09 | 117K | |
![[ ]](/icons/layout.gif) | 170756English_Ostrava follow upwith MoH and MoE final ENG (1).pdf | 2025-11-20 22:09 | 117K | |
![[ ]](/icons/layout.gif) | 67wd03e_ProvProgramme_170645.pdf | 2025-11-20 22:09 | 76K | |
![[ ]](/icons/layout.gif) | 67wd03e_ProvProgramme_170645 (1).pdf | 2025-11-20 22:09 | 76K | |
![[ ]](/icons/layout.gif) | 67wd02e_ProvAgenda_170643.pdf | 2025-11-20 22:09 | 54K | |
![[ ]](/icons/layout.gif) | 67wd02e_ProvAgenda_170643 (1).pdf | 2025-11-20 22:09 | 54K | |
![[ ]](/icons/layout.gif) | 7-418 eur-1_invoice.pdf | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/layout.gif) | 7-418 eur-1_invoice (1).pdf | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამის ანგარიში_MoLHSA_)1.doc | 2025-11-20 22:09 | 183K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამის ანგარიში_MoLHSA-16_07.doc | 2025-11-20 22:09 | 188K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამის ანგარიში_MoLHSA-16_07 (1).doc | 2025-11-20 22:09 | 188K | |
![[ ]](/icons/unknown.gif) | პრემიერის გამოსვლა პარლამენტში.docx | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/unknown.gif) | პრემიერის გამოსვლა პარლამენტში (1).docx | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/unknown.gif) | მთავრობის ანგარიში.docx | 2025-11-20 22:09 | 42K | |
![[ ]](/icons/unknown.gif) | მთავრობის ანგარიში (1).docx | 2025-11-20 22:09 | 42K | |
![[ ]](/icons/layout.gif) | letter to Dr_ Kluge.pdf | 2025-11-20 22:09 | 88K | |
![[ ]](/icons/layout.gif) | letter to Dr_ Kluge (1).pdf | 2025-11-20 22:09 | 88K | |
![[IMG]](/icons/image2.gif) | image001 (428).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (427).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (426).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (425).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (424).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (423).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | WHO_67 Session_Round tablediscussion.djvu | 2025-11-20 22:09 | 121K | |
![[ ]](/icons/layout.gif) | TA_1240113.pdf | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/layout.gif) | TA_1240113 (1).pdf | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/layout.gif) | Scope and purpose (3).pdf | 2025-11-20 22:09 | 27K | |
![[ ]](/icons/layout.gif) | SERGEENKO DAVID MR (3).pdf | 2025-11-20 22:09 | 7.2K | |
![[ ]](/icons/layout.gif) | SERGEENKO DAVID MR (2).pdf | 2025-11-20 22:09 | 7.2K | |
![[ ]](/icons/unknown.gif) | Regform 25-26 notcov HIVprgMgrs ENG.DOC | 2025-11-20 22:09 | 116K | |
![[ ]](/icons/unknown.gif) | Regform 25-26 notcov HIVprgMgrs ENG (1).DOC | 2025-11-20 22:09 | 116K | |
![[ ]](/icons/unknown.gif) | NHMs_Meeting_25-26Sep2017_Scope and Purpose_ENG.PDF | 2025-11-20 22:09 | 330K | |
![[ ]](/icons/unknown.gif) | NHMs_Meeting_25-26Sep2017_Scope and Purpose_ENG (1).PDF | 2025-11-20 22:09 | 330K | |
![[ ]](/icons/unknown.gif) | Let to Deputy MoH GEO.PDF | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/unknown.gif) | Let to Deputy MoH GEO (1).PDF | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/layout.gif) | Georgia (4).pdf | 2025-11-20 22:09 | 228K | |
![[ ]](/icons/layout.gif) | GEO PHS mission report May 2017 final.pdf | 2025-11-20 22:09 | 105K | |
![[ ]](/icons/layout.gif) | GEO PHS mission report May 2017 final (1).pdf | 2025-11-20 22:09 | 105K | |
![[ ]](/icons/layout.gif) | Bilhete-1119-2017-ODISHARIA_NINOMRS (3).pdf | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/layout.gif) | Bilhete-1119-2017-ODISHARIA_NINOMRS (2).pdf | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/layout.gif) | Bilhete-1118-2017-BELKANIA_SOFIKOMRS (3).pdf | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/layout.gif) | Bilhete-1118-2017-BELKANIA_SOFIKOMRS (2).pdf | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/layout.gif) | BERDZULI NINO MRS (3).pdf | 2025-11-20 22:09 | 7.1K | |
![[ ]](/icons/layout.gif) | BERDZULI NINO MRS (2).pdf | 2025-11-20 22:09 | 7.1K | |
![[ ]](/icons/layout.gif) | BELKANIA SOFIKO MRS (3).pdf | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/layout.gif) | BELKANIA SOFIKO MRS (2).pdf | 2025-11-20 22:09 | 14K | |
![[TXT]](/icons/text.gif) | ATT00002 (74).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (103).htm | 2025-11-20 22:09 | 216 | |
![[ ]](/icons/unknown.gif) | 2017 19 07 AC OpC-EU consolidatedcomments on GE demands (2)_MOHLSA_25_08_2017.doc | 2025-11-20 22:09 | 60K | |
![[ ]](/icons/unknown.gif) | 2017 19 07 AC OpC-EU consolidatedcomments on GE demands (2)_MOHLSA_25_08_2017 (1).doc | 2025-11-20 22:09 | 60K | |
![[ ]](/icons/unknown.gif) | 2017 19 07 AC OpC-EU consolidated comments on GE demands (2)_MOHLSA.docx | 2025-11-20 22:09 | 37K | |
![[ ]](/icons/unknown.gif) | 2017 19 07 AC OpC-EU consolidated comments on GE demands (2)_MOHLSA (1).docx | 2025-11-20 22:09 | 37K | |
![[ ]](/icons/layout.gif) | 25-26 InvLet cov HIVprgMgrs ENG_Dr Maia Tsereteli_GEO.pdf | 2025-11-20 22:09 | 234K | |
![[ ]](/icons/layout.gif) | 25-26 InvLet cov HIVprgMgrs ENG_Dr Ketevan Stvilia_GEO.pdf | 2025-11-20 22:09 | 235K | |
![[ ]](/icons/layout.gif) | 7-821 (3).pdf | 2025-11-20 22:09 | 70K | |
![[ ]](/icons/layout.gif) | 7-821 (2).pdf | 2025-11-20 22:09 | 70K | |
![[IMG]](/icons/image2.gif) | 2 (55).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (54).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (67).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (66).jpg | 2025-11-20 22:09 | 3.2K | |
![[ ]](/icons/unknown.gif) | ტრეფიკინგის მსხვერპლთა სტატისტიკა (2006-2012 წწ).docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | ოჯახში ძალადობის მსხვერპლთა სტატისტიკა (2010-2012 წწ_).docx | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image002 (124).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (123).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (122).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (121).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (120).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (119).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (118).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (117).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (116).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (115).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (114).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (113).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (422).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (421).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (420).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (419).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (418).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (417).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (416).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (415).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (414).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (413).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (412).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (411).png | 2025-11-20 22:09 | 6.0K | |
![[ ]](/icons/layout.gif) | Voucher-246--2017-Nino Odisharia e Sofiko Belkania (2).pdf | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/layout.gif) | Scope and purpose (2).pdf | 2025-11-20 22:09 | 27K | |
![[ ]](/icons/layout.gif) | Letter Signed By Deputy Min.pdf | 2025-11-20 22:09 | 211K | |
![[ ]](/icons/layout.gif) | Letter Signed By Deputy Min (1).pdf | 2025-11-20 22:09 | 211K | |
![[ ]](/icons/layout.gif) | Georgia (3).pdf | 2025-11-20 22:09 | 228K | |
![[ ]](/icons/unknown.gif) | Bilhete-1119-2017-ODISHARIA_NINOMRS.PDF | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/unknown.gif) | Bilhete-1119-2017-ODISHARIA_NINOMRS (1).PDF | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/unknown.gif) | Bilhete-1118-2017-BELKANIA_SOFIKOMRS.PDF | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/unknown.gif) | Bilhete-1118-2017-BELKANIA_SOFIKOMRS (1).PDF | 2025-11-20 22:09 | 66K | |
![[TXT]](/icons/text.gif) | ATT00002 (73).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (102).htm | 2025-11-20 22:09 | 216 | |
![[IMG]](/icons/image2.gif) | image003 (61).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image003 (60).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image003 (59).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image003 (58).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (112).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (111).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (110).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (109).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image002 (108).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (107).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (106).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (410).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (409).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (408).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (407).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (84).gif | 2025-11-20 22:09 | 3.4K | |
![[ ]](/icons/layout.gif) | Voucher-246--2017-Nino Odisharia e Sofiko Belkania.pdf | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/layout.gif) | Voucher-246--2017-Nino Odisharia e Sofiko Belkania (1).pdf | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/unknown.gif) | REMA ggp_application_form.docx | 2025-11-20 22:09 | 68K | |
![[ ]](/icons/unknown.gif) | REMA ggp_application_form (1).docx | 2025-11-20 22:09 | 68K | |
![[ ]](/icons/unknown.gif) | Payment_Advice_60746235.PDF | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | Payment_Advice_60746235 (1).PDF | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/layout.gif) | MOH Recommendation Letter.pdf | 2025-11-20 22:09 | 199K | |
![[ ]](/icons/layout.gif) | MOH Recommendation Letter (1).pdf | 2025-11-20 22:09 | 199K | |
![[ ]](/icons/layout.gif) | GEO_nomin.pdf | 2025-11-20 22:09 | 3.6M | |
![[ ]](/icons/layout.gif) | Booking - Vip Grand Lisboa Hotel & Spa.pdf | 2025-11-20 22:09 | 145K | |
![[ ]](/icons/unknown.gif) | 02_ScopeAndPurpose_E_final.doc | 2025-11-20 22:09 | 113K | |
![[ ]](/icons/layout.gif) | samaxs.pdf | 2025-11-20 22:09 | 772K | |
![[ ]](/icons/layout.gif) | samaxs (1).pdf | 2025-11-20 22:09 | 772K | |
![[ ]](/icons/layout.gif) | piradoba1.pdf | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/layout.gif) | piradoba1 (1).pdf | 2025-11-20 22:09 | 35K | |
![[IMG]](/icons/image2.gif) | image003 (120).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (119).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (118).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (117).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (116).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (115).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image002 (209).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (208).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (207).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (206).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (205).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (204).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (105).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (433).jpg | 2025-11-20 22:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (406).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (405).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (404).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (403).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (402).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (401).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (400).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (399).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (398).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (397).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (396).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (395).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (394).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (393).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (392).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (391).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (390).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (389).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (388).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (387).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (386).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (385).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (384).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (383).png | 2025-11-20 22:09 | 27K | |
![[ ]](/icons/unknown.gif) | WHO Euro MD questionnaire.docx | 2025-11-20 22:09 | 284K | |
![[ ]](/icons/unknown.gif) | WHO Euro MD questionnaire (1).docx | 2025-11-20 22:09 | 284K | |
![[ ]](/icons/unknown.gif) | Ticket booking.doc | 2025-11-20 22:09 | 22K | |
![[ ]](/icons/layout.gif) | SERGEENKO DAVID MR (1).pdf | 2025-11-20 22:09 | 7.2K | |
![[ ]](/icons/layout.gif) | Prof GAMKRELIDZE ticket_2.pdf | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/layout.gif) | Prof GAMKRELIDZE ticket_1.pdf | 2025-11-20 22:09 | 150K | |
![[ ]](/icons/unknown.gif) | Draft Ministerial Declaration on Ageing-15 Aug 2017.docx | 2025-11-20 22:09 | 685K | |
![[ ]](/icons/layout.gif) | BERDZULI NINO MRS (1).pdf | 2025-11-20 22:09 | 7.1K | |
![[ ]](/icons/layout.gif) | BELKANIA SOFIKO MRS (1).pdf | 2025-11-20 22:09 | 14K | |
![[TXT]](/icons/text.gif) | ATT00040 (1).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00039 (1).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00038 (1).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00037 (1).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00036 (1).htm | 2025-11-20 22:09 | 30K | |
![[TXT]](/icons/text.gif) | ATT00035 (1).htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00034 (1).htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00033 (1).htm | 2025-11-20 22:09 | 28K | |
![[TXT]](/icons/text.gif) | ATT00032 (1).htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00031 (1).htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00030 (1).htm | 2025-11-20 22:09 | 20K | |
![[TXT]](/icons/text.gif) | ATT00029 (1).htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00028 (1).htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00027 (1).htm | 2025-11-20 22:09 | 17K | |
![[TXT]](/icons/text.gif) | ATT00026 (3).htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00025 (3).htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00024 (3).htm | 2025-11-20 22:09 | 13K | |
![[TXT]](/icons/text.gif) | ATT00023 (3).htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00022 (3).htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00021 (3).htm | 2025-11-20 22:09 | 66K | |
![[TXT]](/icons/text.gif) | ATT00020 (3).htm | 2025-11-20 22:09 | 857 | |
![[TXT]](/icons/text.gif) | ATT00019 (3).htm | 2025-11-20 22:09 | 4.7K | |
![[TXT]](/icons/text.gif) | ATT00018 (3).htm | 2025-11-20 22:09 | 12K | |
![[TXT]](/icons/text.gif) | ATT00017 (4).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00016 (4).htm | 2025-11-20 22:09 | 4.2K | |
![[TXT]](/icons/text.gif) | ATT00015 (4).htm | 2025-11-20 22:09 | 6.7K | |
![[TXT]](/icons/text.gif) | ATT00014 (4).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00013 (4).htm | 2025-11-20 22:09 | 4.2K | |
![[TXT]](/icons/text.gif) | ATT00012 (4).htm | 2025-11-20 22:09 | 6.8K | |
![[TXT]](/icons/text.gif) | ATT00011 (4).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00010 (4).htm | 2025-11-20 22:09 | 4.2K | |
![[TXT]](/icons/text.gif) | ATT00009 (4).htm | 2025-11-20 22:09 | 4.6K | |
![[TXT]](/icons/text.gif) | ATT00008 (6).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00007 (6).htm | 2025-11-20 22:09 | 4.2K | |
![[TXT]](/icons/text.gif) | ATT00006 (20).htm | 2025-11-20 22:09 | 4.7K | |
![[TXT]](/icons/text.gif) | ATT00005 (25).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00004 (31).htm | 2025-11-20 22:09 | 4.0K | |
![[TXT]](/icons/text.gif) | ATT00003 (44).htm | 2025-11-20 22:09 | 9.2K | |
![[TXT]](/icons/text.gif) | ATT00002 (72).htm | 2025-11-20 22:09 | 518 | |
![[TXT]](/icons/text.gif) | ATT00001 (101).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (100).htm | 2025-11-20 22:09 | 168 | |
![[ ]](/icons/layout.gif) | 7-821 (1).pdf | 2025-11-20 22:09 | 70K | |
![[IMG]](/icons/image2.gif) | 2 (53).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (52).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (51).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (50).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (49).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (48).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1C950635.gif | 2025-11-20 22:09 | 358 | |
![[IMG]](/icons/image2.gif) | 1C739347.gif | 2025-11-20 22:09 | 4.4K | |
![[IMG]](/icons/image2.gif) | 1C576948.gif | 2025-11-20 22:09 | 582 | |
![[IMG]](/icons/image2.gif) | 1C247860.gif | 2025-11-20 22:09 | 246 | |
![[IMG]](/icons/image2.gif) | 1C200867.gif | 2025-11-20 22:09 | 354 | |
![[IMG]](/icons/image2.gif) | 1 (65).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (64).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (63).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (62).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (61).jpg | 2025-11-20 22:09 | 3.2K | |
![[ ]](/icons/layout.gif) | პირადობა.pdf | 2025-11-20 22:09 | 37K | |
![[IMG]](/icons/image2.gif) | image008 (9).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image008 (8).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (7).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (6).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (5).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image006 (13).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image006 (10).png | 2025-11-20 22:09 | 1.8K | |
![[IMG]](/icons/image2.gif) | image006 (9).png | 2025-11-20 22:09 | 1.8K | |
![[IMG]](/icons/image2.gif) | image005 (26).png | 2025-11-20 22:09 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (25).png | 2025-11-20 22:09 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (16).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image004 (36).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image004 (35).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (114).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (113).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (112).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (111).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (110).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (109).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (108).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (107).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (57).png | 2025-11-20 22:09 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (56).png | 2025-11-20 22:09 | 1.4K | |
![[IMG]](/icons/image2.gif) | image002 (203).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (202).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (201).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (200).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (199).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (198).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (197).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (196).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (195).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image002 (194).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image002 (104).png | 2025-11-20 22:09 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (103).png | 2025-11-20 22:09 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (432).jpg | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (431).jpg | 2025-11-20 22:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (430).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (429).jpg | 2025-11-20 22:09 | 1.4K | |
![[IMG]](/icons/image2.gif) | image001 (428).jpg | 2025-11-20 22:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (427).jpg | 2025-11-20 22:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (382).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (381).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (380).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (379).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (378).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (377).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (376).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (375).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (374).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (373).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (372).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (371).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (370).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (369).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (368).png | 2025-11-20 22:09 | 38K | |
![[ ]](/icons/layout.gif) | SERGEENKO DAVID MR.pdf | 2025-11-20 22:09 | 7.2K | |
![[ ]](/icons/unknown.gif) | SDG session TP Final.docx | 2025-11-20 22:09 | 29K | |
![[ ]](/icons/unknown.gif) | SDG session TP Final (1).docx | 2025-11-20 22:09 | 29K | |
![[ ]](/icons/unknown.gif) | RC67 12 Sep SDG session_briefing short.docx | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/unknown.gif) | RC67 12 Sep SDG session_briefing short (1).docx | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/layout.gif) | BERDZULI NINO MRS.pdf | 2025-11-20 22:09 | 7.1K | |
![[ ]](/icons/layout.gif) | BELKANIA SOFIKO MRS.pdf | 2025-11-20 22:09 | 14K | |
![[TXT]](/icons/text.gif) | ATT00040.htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00039.htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00038.htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00037.htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00036.htm | 2025-11-20 22:09 | 30K | |
![[TXT]](/icons/text.gif) | ATT00035.htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00034.htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00033.htm | 2025-11-20 22:09 | 28K | |
![[TXT]](/icons/text.gif) | ATT00032.htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00031.htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00030.htm | 2025-11-20 22:09 | 20K | |
![[TXT]](/icons/text.gif) | ATT00029.htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00028.htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00027.htm | 2025-11-20 22:09 | 17K | |
![[TXT]](/icons/text.gif) | ATT00026 (2).htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00025 (2).htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00024 (2).htm | 2025-11-20 22:09 | 13K | |
![[TXT]](/icons/text.gif) | ATT00023 (2).htm | 2025-11-20 22:09 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00022 (2).htm | 2025-11-20 22:09 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00021 (2).htm | 2025-11-20 22:09 | 66K | |
![[TXT]](/icons/text.gif) | ATT00020 (2).htm | 2025-11-20 22:09 | 857 | |
![[TXT]](/icons/text.gif) | ATT00019 (2).htm | 2025-11-20 22:09 | 4.7K | |
![[TXT]](/icons/text.gif) | ATT00018 (2).htm | 2025-11-20 22:09 | 12K | |
![[TXT]](/icons/text.gif) | ATT00017 (3).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00016 (3).htm | 2025-11-20 22:09 | 4.2K | |
![[TXT]](/icons/text.gif) | ATT00015 (3).htm | 2025-11-20 22:09 | 6.7K | |
![[TXT]](/icons/text.gif) | ATT00014 (3).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00013 (3).htm | 2025-11-20 22:09 | 4.2K | |
![[TXT]](/icons/text.gif) | ATT00012 (3).htm | 2025-11-20 22:09 | 6.8K | |
![[TXT]](/icons/text.gif) | ATT00011 (3).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00010 (3).htm | 2025-11-20 22:09 | 4.2K | |
![[TXT]](/icons/text.gif) | ATT00009 (3).htm | 2025-11-20 22:09 | 4.6K | |
![[TXT]](/icons/text.gif) | ATT00008 (5).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00007 (5).htm | 2025-11-20 22:09 | 4.2K | |
![[TXT]](/icons/text.gif) | ATT00006 (19).htm | 2025-11-20 22:09 | 4.7K | |
![[TXT]](/icons/text.gif) | ATT00005 (24).htm | 2025-11-20 22:09 | 802 | |
![[TXT]](/icons/text.gif) | ATT00004 (30).htm | 2025-11-20 22:09 | 4.0K | |
![[TXT]](/icons/text.gif) | ATT00003 (43).htm | 2025-11-20 22:09 | 9.2K | |
![[TXT]](/icons/text.gif) | ATT00002 (71).htm | 2025-11-20 22:09 | 518 | |
![[TXT]](/icons/text.gif) | ATT00002 (70).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (69).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (99).htm | 2025-11-20 22:09 | 3.7K | |
![[TXT]](/icons/text.gif) | ATT00001 (98).htm | 2025-11-20 22:09 | 3.7K | |
![[TXT]](/icons/text.gif) | ATT00001 (97).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (96).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (95).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (94).htm | 2025-11-20 22:09 | 216 | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU statement_Governance in the WHO European Region_rev1_A___.docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU statement_Governance in the WHO European Region_rev1_A___ (1).docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU Statement on GPW consolidated NL FI LU EI CZBE SE_AL___.docx | 2025-11-20 22:09 | 33K | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU Statement on GPW consolidated NL FI LU EI CZ BE SE_AL___.docx | 2025-11-20 22:09 | 33K | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU Statement_human resources consolidated_ALIGNMENT.DOCX | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU Statement_human resources consolidated_ALIGNMENT (1).DOCX | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU Statement_Matters Arising from WHA and EB - IHR_ALIGNM___.docx | 2025-11-20 22:09 | 19K | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU Statement_Matters Arising from WHA and EB - IHR_ALIGNM___ (1).docx | 2025-11-20 22:09 | 19K | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU Statement_Address by the Regional Director_consolidate___.docx | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | 2017-0906_RC67_EU Statement_Address by the Regional Director_consolidate___ (1).docx | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/layout.gif) | 7-821.pdf | 2025-11-20 22:09 | 70K | |
![[IMG]](/icons/image2.gif) | 2 (47).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (46).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (45).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (44).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (43).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (42).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (60).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (59).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (58).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (57).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (56).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (55).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (54).jpg | 2025-11-20 22:09 | 3.2K | |
![[TXT]](/icons/text.gif) | 01-176 ბრძანება.html | 2025-11-20 22:09 | 60K | |
![[ ]](/icons/layout.gif) | ჯანდაცვას CAHDPH 26-28 სექტ.pdf | 2025-11-20 22:09 | 365K | |
![[ ]](/icons/layout.gif) | ჯანდაცვას ბერნის შეხვედრა 11-12 სექტ.pdf | 2025-11-20 22:09 | 365K | |
![[ ]](/icons/unknown.gif) | ცნობა მინისტრს.docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | ცნობა მინისტრს (1).docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/layout.gif) | სამუშაო_დოკუმენტიTAIEX.pdf | 2025-11-20 22:09 | 320K | |
![[ ]](/icons/layout.gif) | სამუშაო_დოკუმენტიTAIEX (1).pdf | 2025-11-20 22:09 | 320K | |
![[ ]](/icons/unknown.gif) | მოხსენებითი ნუცი.docx | 2025-11-20 22:09 | 16K | |
![[ ]](/icons/unknown.gif) | დანართი 01-176 (1).doc | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | untitled_job12-2.djvu | 2025-11-20 22:09 | 256K | |
![[IMG]](/icons/image2.gif) | untitled_job12-2 (1).djvu | 2025-11-20 22:09 | 256K | |
![[ ]](/icons/unknown.gif) | panel speech Lisboa.docx | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/unknown.gif) | panel speech Lisboa (1).docx | 2025-11-20 22:09 | 20K | |
![[IMG]](/icons/image2.gif) | mime-attachment.gif | 2025-11-20 22:09 | 4.4K | |
![[IMG]](/icons/image2.gif) | mime-attachment (4).gif | 2025-11-20 22:09 | 582 | |
![[IMG]](/icons/image2.gif) | mime-attachment (3).gif | 2025-11-20 22:09 | 246 | |
![[IMG]](/icons/image2.gif) | mime-attachment (2).gif | 2025-11-20 22:09 | 354 | |
![[IMG]](/icons/image2.gif) | mime-attachment (1).gif | 2025-11-20 22:09 | 358 | |
![[IMG]](/icons/image2.gif) | image001 (367).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (366).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (365).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | graycol (3).gif | 2025-11-20 22:09 | 105 | |
![[IMG]](/icons/image2.gif) | graycol (2).gif | 2025-11-20 22:09 | 105 | |
![[IMG]](/icons/image2.gif) | graycol (1).gif | 2025-11-20 22:09 | 105 | |
![[ ]](/icons/unknown.gif) | final_panel speech Lisboa.docx | 2025-11-20 22:09 | 23K | |
![[ ]](/icons/unknown.gif) | final_panel speech Lisboa (1).docx | 2025-11-20 22:09 | 23K | |
![[ ]](/icons/unknown.gif) | UN პაქტი შესწორებული.docx | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/unknown.gif) | UN პაქტი შესწორებული (2).docx | 2025-11-20 22:09 | 80K | |
![[ ]](/icons/unknown.gif) | UN პაქტი შესწორებული (1).docx | 2025-11-20 22:09 | 80K | |
![[ ]](/icons/layout.gif) | Tobacco Tb.pdf | 2025-11-20 22:09 | 151K | |
![[ ]](/icons/layout.gif) | Tobacco Tb (1).pdf | 2025-11-20 22:09 | 151K | |
![[ ]](/icons/unknown.gif) | Panel speech Lisboa_LB inputs.docx | 2025-11-20 22:09 | 21K | |
![[ ]](/icons/unknown.gif) | Panel speech Lisboa_LB inputs (1).docx | 2025-11-20 22:09 | 21K | |
![[ ]](/icons/unknown.gif) | KSP.PDF | 2025-11-20 22:09 | 2.0M | |
![[ ]](/icons/unknown.gif) | KSP (1).PDF | 2025-11-20 22:09 | 2.0M | |
![[TXT]](/icons/text.gif) | GenerateDocument.htm | 2025-11-20 22:09 | 44K | |
![[TXT]](/icons/text.gif) | GenerateDocument (1).htm | 2025-11-20 22:09 | 44K | |
![[ ]](/icons/unknown.gif) | EU ongoing project.doc | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/unknown.gif) | EU ongoing project (1).doc | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/unknown.gif) | Annex 1.docx | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/unknown.gif) | Annex 1 (1).docx | 2025-11-20 22:09 | 36K | |
![[TXT]](/icons/text.gif) | ATT00001 (93).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (92).htm | 2025-11-20 22:09 | 168 | |
![[IMG]](/icons/image2.gif) | 37704749.gif | 2025-11-20 22:09 | 582 | |
![[IMG]](/icons/image2.gif) | 37704749 (1).gif | 2025-11-20 22:09 | 582 | |
![[IMG]](/icons/image2.gif) | 37512090.gif | 2025-11-20 22:09 | 246 | |
![[IMG]](/icons/image2.gif) | 37512090 (1).gif | 2025-11-20 22:09 | 246 | |
![[IMG]](/icons/image2.gif) | 37246220.gif | 2025-11-20 22:09 | 354 | |
![[IMG]](/icons/image2.gif) | 37246220 (1).gif | 2025-11-20 22:09 | 354 | |
![[IMG]](/icons/image2.gif) | 37143875.gif | 2025-11-20 22:09 | 4.4K | |
![[IMG]](/icons/image2.gif) | 37143875 (1).gif | 2025-11-20 22:09 | 4.4K | |
![[IMG]](/icons/image2.gif) | 37110294.gif | 2025-11-20 22:09 | 358 | |
![[IMG]](/icons/image2.gif) | 37110294 (1).gif | 2025-11-20 22:09 | 358 | |
![[IMG]](/icons/image2.gif) | 35914030 (1).gif | 2025-11-20 22:09 | 4.4K | |
![[IMG]](/icons/image2.gif) | 35804798 (1).gif | 2025-11-20 22:09 | 358 | |
![[IMG]](/icons/image2.gif) | 35707691 (1).gif | 2025-11-20 22:09 | 582 | |
![[IMG]](/icons/image2.gif) | 35438846 (1).gif | 2025-11-20 22:09 | 246 | |
![[IMG]](/icons/image2.gif) | 35348328 (1).gif | 2025-11-20 22:09 | 354 | |
![[ ]](/icons/layout.gif) | ჯანდაცვა (2).pdf | 2025-11-20 22:09 | 394K | |
![[ ]](/icons/layout.gif) | ჯანდაცვა (1).pdf | 2025-11-20 22:09 | 394K | |
![[ ]](/icons/unknown.gif) | მინისტრის გამოსვლა ბუდაპეშტში.docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | დანართი ბარსელონა.doc | 2025-11-20 22:09 | 46K | |
![[ ]](/icons/unknown.gif) | არ ვიცი მარიანა მარა მგონი ეს ჯობია.docx | 2025-11-20 22:09 | 373K | |
![[ ]](/icons/unknown.gif) | არ ვიცი მარიანა მარა მგონი ეს ჯობია (1).docx | 2025-11-20 22:09 | 373K | |
![[ ]](/icons/unknown.gif) | matsne-3360809-0.doc | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | matsne-3360809-0 (1).doc | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image002 (102).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image002 (101).png | 2025-11-20 22:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | image001 (426).jpg | 2025-11-20 22:09 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (425).jpg | 2025-11-20 22:09 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (364).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (363).png | 2025-11-20 22:09 | 7.5K | |
![[IMG]](/icons/image2.gif) | image001 (362).png | 2025-11-20 22:09 | 2.5K | |
![[IMG]](/icons/image2.gif) | image001 (361).png | 2025-11-20 22:09 | 2.5K | |
![[IMG]](/icons/image2.gif) | image001 (360).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (359).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | graycol.gif | 2025-11-20 22:09 | 105 | |
![[ ]](/icons/layout.gif) | ThaiCV.pdf | 2025-11-20 22:09 | 29K | |
![[ ]](/icons/layout.gif) | ThaiCV (1).pdf | 2025-11-20 22:09 | 29K | |
![[ ]](/icons/layout.gif) | SOM Chair's Report at MC-as of 14 September.pdf | 2025-11-20 22:09 | 230K | |
![[ ]](/icons/layout.gif) | SOM Chair's Report at MC-as of 14 September (1).pdf | 2025-11-20 22:09 | 230K | |
![[ ]](/icons/unknown.gif) | MOLSHA-Zugdidi Carryover grantagreement_ENG.docx | 2025-11-20 22:09 | 53K | |
![[ ]](/icons/unknown.gif) | MOLSHA-Zugdidi Carryover grantagreement_ENG (1).docx | 2025-11-20 22:09 | 53K | |
![[ ]](/icons/layout.gif) | Invitation for WWC2017.pdf | 2025-11-20 22:09 | 469K | |
![[ ]](/icons/layout.gif) | Grant Final.pdf | 2025-11-20 22:09 | 329K | |
![[ ]](/icons/layout.gif) | Grant Final (1).pdf | 2025-11-20 22:09 | 329K | |
![[ ]](/icons/unknown.gif) | Gilead 2017 NB.docx | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | Gilead 2017 NB (1).docx | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | Gilead - 25_08_17_ENG.doc | 2025-11-20 22:09 | 53K | |
![[ ]](/icons/unknown.gif) | Gilead - 25_08_17_ENG (1).doc | 2025-11-20 22:09 | 53K | |
![[ ]](/icons/unknown.gif) | GEORGIA TAIEX presentation (3).pptx | 2025-11-20 22:09 | 4.0M | |
![[ ]](/icons/unknown.gif) | GEORGIA TAIEX presentation (2).pptx | 2025-11-20 22:09 | 4.0M | |
![[ ]](/icons/unknown.gif) | FINAL PROGRAM 13 OCT.PDF | 2025-11-20 22:09 | 343K | |
![[ ]](/icons/unknown.gif) | FINAL PROGRAM 13 OCT (1).PDF | 2025-11-20 22:09 | 343K | |
![[ ]](/icons/layout.gif) | Dushanbe Declaration Draft 13 Sept 2017.pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | Dushanbe Declaration Draft 13 Sept 2017 (1).pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/unknown.gif) | Compact revised.docx | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/unknown.gif) | Compact revised (1).docx | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/unknown.gif) | CAREC 2030_Draft_6September2017 - clean.docx | 2025-11-20 22:09 | 192K | |
![[ ]](/icons/unknown.gif) | CAREC 2030_Draft_6September2017 - clean (1).docx | 2025-11-20 22:09 | 192K | |
![[TXT]](/icons/text.gif) | ATT00001 (91).htm | 2025-11-20 22:09 | 1.5K | |
![[TXT]](/icons/text.gif) | ATT00001 (8).txt | 2025-11-20 22:09 | 42 | |
![[TXT]](/icons/text.gif) | ATT00001 (7).txt | 2025-11-20 22:09 | 42 | |
![[IMG]](/icons/image2.gif) | 35914030.gif | 2025-11-20 22:09 | 4.4K | |
![[IMG]](/icons/image2.gif) | 35804798.gif | 2025-11-20 22:09 | 358 | |
![[IMG]](/icons/image2.gif) | 35707691.gif | 2025-11-20 22:09 | 582 | |
![[IMG]](/icons/image2.gif) | 35438846.gif | 2025-11-20 22:09 | 246 | |
![[IMG]](/icons/image2.gif) | 35348328.gif | 2025-11-20 22:09 | 354 | |
![[ ]](/icons/unknown.gif) | დირექტივების ჩამონათვალი_MoLHSA_urgent.doc | 2025-11-20 22:09 | 47K | |
![[ ]](/icons/unknown.gif) | sagareos-21,09,205 მდგომარეობით.xls | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/unknown.gif) | sagareos-21,09,205 მდგომარეობით (1).xls | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/unknown.gif) | sagareo.rar | 2025-11-20 22:09 | 342K | |
![[ ]](/icons/unknown.gif) | sagareo (1).rar | 2025-11-20 22:09 | 342K | |
![[ ]](/icons/layout.gif) | muhamedi.pdf | 2025-11-20 22:09 | 507K | |
![[IMG]](/icons/image2.gif) | image004 (32).jpg | 2025-11-20 22:09 | 39K | |
![[IMG]](/icons/image2.gif) | image004 (31).jpg | 2025-11-20 22:09 | 39K | |
![[IMG]](/icons/image2.gif) | image002 (193).jpg | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image002 (192).jpg | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (424).jpg | 2025-11-20 22:09 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (423).jpg | 2025-11-20 22:09 | 71K | |
![[IMG]](/icons/image2.gif) | image001 (358).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (357).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (356).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (355).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (354).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (353).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (352).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (351).png | 2025-11-20 22:09 | 38K | |
![[ ]](/icons/unknown.gif) | Q2 2017 Ministry of Health_v2_0.xlsx | 2025-11-20 22:09 | 16K | |
![[ ]](/icons/unknown.gif) | Q2 2017 Ministry of Health_v2_0 (1).xlsx | 2025-11-20 22:09 | 16K | |
![[ ]](/icons/unknown.gif) | MOLSHA-Zugdidi Carryovergrantagreement_ENG_19_09_2017.doc | 2025-11-20 22:09 | 103K | |
![[ ]](/icons/unknown.gif) | MOLSHA-Zugdidi Carryovergrantagreement_ENG_19_09_2017 (1).doc | 2025-11-20 22:09 | 103K | |
![[ ]](/icons/unknown.gif) | List of Speakers.docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | List of Speakers (1).docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | Invitation to Talaat.doc | 2025-11-20 22:09 | 63K | |
![[ ]](/icons/unknown.gif) | Invitation to Talaat (1).doc | 2025-11-20 22:09 | 63K | |
![[ ]](/icons/unknown.gif) | HRC 36 - resolution on mental health and human rights - zero draft - 11 September 2017.docx | 2025-11-20 22:09 | 37K | |
![[ ]](/icons/layout.gif) | GSP_Georgia_2017.pdf | 2025-11-20 22:09 | 352K | |
![[ ]](/icons/layout.gif) | GSP (4).pdf | 2025-11-20 22:09 | 369K | |
![[ ]](/icons/layout.gif) | GSP (3).pdf | 2025-11-20 22:09 | 369K | |
![[ ]](/icons/unknown.gif) | GEORGIA TAIEX presentation.pptx | 2025-11-20 22:09 | 4.0M | |
![[ ]](/icons/unknown.gif) | GEORGIA TAIEX presentation (1).pptx | 2025-11-20 22:09 | 4.0M | |
![[ ]](/icons/layout.gif) | GC(2017)17_136CG_OJann_E (1).pdf | 2025-11-20 22:09 | 216K | |
![[ ]](/icons/layout.gif) | Explanatory Memorandum - drowningprevention - EB142 - Cover note and criteria - Sept 2017.pdf | 2025-11-20 22:09 | 418K | |
![[ ]](/icons/unknown.gif) | Copy of სოფლის_განვითარების_2018-2020_წლების_სამოქმედო_გეგმის_პროექტი ჩასწორებული.xlsx | 2025-11-20 22:09 | 46K | |
![[ ]](/icons/unknown.gif) | Copy of სოფლის_განვითარების_2018-2020_წლების_სამოქმედო_გეგმის_პროექტი ჩასწორებული (1).xlsx | 2025-11-20 22:09 | 46K | |
![[ ]](/icons/layout.gif) | Agenda (2).pdf | 2025-11-20 22:09 | 402K | |
![[ ]](/icons/layout.gif) | Agenda (1).pdf | 2025-11-20 22:09 | 402K | |
![[ ]](/icons/unknown.gif) | ჯანდაცვის სამ_ მასალა 2015 oqt 2016 mart.xlsx | 2025-11-20 22:09 | 134K | |
![[ ]](/icons/unknown.gif) | ჯანდაცვის სამ_ მასალა 2015 oqt 2016 mart (1).xlsx | 2025-11-20 22:09 | 134K | |
![[ ]](/icons/unknown.gif) | სარეაბილიტაციო ცენტრი 1.docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | სარეაბილიტაციო ცენტრი 1 (7).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | სარეაბილიტაციო ცენტრი 1 (6).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | სარეაბილიტაციო ცენტრი 1 (5).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | სარეაბილიტაციო ცენტრი 1 (4).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | სარეაბილიტაციო ცენტრი 1 (3).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | სარეაბილიტაციო ცენტრი 1 (2).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | სარეაბილიტაციო ცენტრი 1 (1).docx | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image002 (191).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (190).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image001 (350).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (349).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (348).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (347).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (346).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (345).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (344).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (343).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (342).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (341).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (340).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (339).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (338).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (337).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (336).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (335).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (334).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (333).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (332).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (83).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (82).gif | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | annex B 2 (3).doc | 2025-11-20 22:09 | 53K | |
![[ ]](/icons/unknown.gif) | annex B 2 (2).doc | 2025-11-20 22:09 | 53K | |
![[IMG]](/icons/image2.gif) | Service Passport_elzajgerenaia.jpg | 2025-11-20 22:09 | 724K | |
![[ ]](/icons/unknown.gif) | September 26_27 Hearing Agenda.docx | 2025-11-20 22:09 | 28K | |
![[ ]](/icons/unknown.gif) | September 26_27 Hearing Agenda (2).docx | 2025-11-20 22:09 | 28K | |
![[ ]](/icons/unknown.gif) | September 26_27 Hearing Agenda (1).docx | 2025-11-20 22:09 | 28K | |
![[ ]](/icons/layout.gif) | MOLSHA-Zugdidi Carry_over_grant_agreement_09_22_17.pdf | 2025-11-20 22:09 | 43K | |
![[ ]](/icons/layout.gif) | MOLSHA-Zugdidi Carry_over_grant_agreement_09_22_17 (1).pdf | 2025-11-20 22:09 | 43K | |
![[ ]](/icons/layout.gif) | GSP.pdf | 2025-11-20 22:09 | 366K | |
![[ ]](/icons/layout.gif) | GSP (2).pdf | 2025-11-20 22:09 | 366K | |
![[ ]](/icons/layout.gif) | GSP (1).pdf | 2025-11-20 22:09 | 366K | |
![[ ]](/icons/unknown.gif) | GC(2017)17_136CG_OJann_F(1).docx | 2025-11-20 22:09 | 121K | |
![[ ]](/icons/layout.gif) | GC(2017)17_136CG_OJann_E.pdf | 2025-11-20 22:09 | 216K | |
![[ ]](/icons/unknown.gif) | Draft_Geo_Iran_6th Eco_Commision_eng.docx | 2025-11-20 22:09 | 42K | |
![[ ]](/icons/unknown.gif) | Draft_Geo_Iran_6th Eco_Commision_eng (1).docx | 2025-11-20 22:09 | 42K | |
![[ ]](/icons/layout.gif) | Confirmation Page_ElzaJgerenaia.pdf | 2025-11-20 22:09 | 89K | |
![[ ]](/icons/layout.gif) | Confirmation Page_ElzaJgerenaia (2).pdf | 2025-11-20 22:09 | 89K | |
![[ ]](/icons/layout.gif) | Confirmation Page_ElzaJgerenaia (1).pdf | 2025-11-20 22:09 | 89K | |
![[ ]](/icons/unknown.gif) | Annex B (3).DOCX | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | Annex B (2).DOCX | 2025-11-20 22:09 | 24K | |
![[TXT]](/icons/text.gif) | ATT00003 (42).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (41).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (68).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (67).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (90).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (89).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (88).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (87).htm | 2025-11-20 22:09 | 168 | |
![[IMG]](/icons/image2.gif) | 2 (41).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (40).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (39).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (38).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (37).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (36).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (53).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (52).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (51).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (50).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (49).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (48).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (47).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (46).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (45).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (44).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (43).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (42).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (41).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (40).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (39).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (38).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (37).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (36).jpg | 2025-11-20 22:09 | 3.2K | |
![[ ]](/icons/unknown.gif) | სოფლის მეურნეობა ჩასწორებული.xlsx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/layout.gif) | ელზა ჯგერენაიას ვიზის შუამდგომლობა.pdf | 2025-11-20 22:09 | 86K | |
![[ ]](/icons/layout.gif) | ელზა ჯგერენაიას ვიზის შუამდგომლობა (2).pdf | 2025-11-20 22:09 | 86K | |
![[ ]](/icons/layout.gif) | ელზა ჯგერენაიას ვიზის შუამდგომლობა (1).pdf | 2025-11-20 22:09 | 86K | |
![[ ]](/icons/unknown.gif) | ბილეთის ჯავშანი.doc | 2025-11-20 22:09 | 22K | |
![[IMG]](/icons/image2.gif) | image002 (189).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (188).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (187).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (186).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (185).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (184).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image001 (331).png | 2025-11-20 22:09 | 7.4K | |
![[IMG]](/icons/image2.gif) | image001 (330).png | 2025-11-20 22:09 | 7.4K | |
![[IMG]](/icons/image2.gif) | image001 (329).png | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (328).png | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (327).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (326).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (325).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (324).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (323).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (322).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (81).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (80).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (79).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (78).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (77).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (76).gif | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | Untitled (2) | 2025-11-20 22:09 | 0 | |
![[ ]](/icons/unknown.gif) | ODISHARIA NINO MRS 15OCT2017 TBS IST.msg | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/layout.gif) | MOH_Iran Commission_position.pdf | 2025-11-20 22:09 | 113K | |
![[ ]](/icons/layout.gif) | MAL Georgia Poverty and Gender assessment TA OCt_2017.pdf | 2025-11-20 22:09 | 214K | |
![[ ]](/icons/layout.gif) | MAL Georgia Poverty and Gender assessment TA OCt_2017 (1).pdf | 2025-11-20 22:09 | 214K | |
![[ ]](/icons/layout.gif) | Iran Commission_უწყებებს.pdf | 2025-11-20 22:09 | 189K | |
![[ ]](/icons/unknown.gif) | Draft_Geo_Iran_Labour.docx | 2025-11-20 22:09 | 54K | |
![[ ]](/icons/unknown.gif) | Draft_Geo_Iran_Labour (1).docx | 2025-11-20 22:09 | 54K | |
![[ ]](/icons/unknown.gif) | Draft_Geo_Iran_6thEco_Commision_eng (Pharmaceutical department comments).docx | 2025-11-20 22:09 | 52K | |
![[ ]](/icons/unknown.gif) | Draft_Geo_Iran_6thEco_Commision_eng (Pharmaceutical department comments) (1).docx | 2025-11-20 22:09 | 52K | |
![[ ]](/icons/unknown.gif) | Draft_Geo_Iran_6th Eco_Commision_eng (3).docx | 2025-11-20 22:09 | 54K | |
![[ ]](/icons/unknown.gif) | Draft_Geo_Iran_6th Eco_Commision_eng (3) (1).docx | 2025-11-20 22:09 | 54K | |
![[ ]](/icons/unknown.gif) | Copy of დანართი_2-აფხაზეთი-მედიკამენტები-2016-2017წწ (002).xlsx | 2025-11-20 22:09 | 12K | |
![[ ]](/icons/unknown.gif) | Copy of დანართი_1-აფხაზეთი-ვაქცინები-2016-2017წწ_ (002).xlsx | 2025-11-20 22:09 | 23K | |
![[ ]](/icons/unknown.gif) | Agenda and Concept Note SP Conference _ND edits.docx | 2025-11-20 22:09 | 648K | |
![[ ]](/icons/unknown.gif) | Agenda and Concept Note SP Conference _ND edits (1).docx | 2025-11-20 22:09 | 648K | |
![[ ]](/icons/layout.gif) | Agenda_October_4.pdf | 2025-11-20 22:09 | 426K | |
![[ ]](/icons/unknown.gif) | ATT79226.docx | 2025-11-20 22:09 | 16K | |
![[TXT]](/icons/text.gif) | ATT00008 (4).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00008 (3).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00007 (4).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00007 (3).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00006 (18).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00006 (17).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (23).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (22).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (29).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (28).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (40).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (39).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (66).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (65).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (86).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (85).htm | 2025-11-20 22:09 | 216 | |
![[ ]](/icons/layout.gif) | 25_09_2017_PF_125_Sub-regional Conference.pdf | 2025-11-20 22:09 | 55K | |
![[ ]](/icons/layout.gif) | 25_09_2017_PF_125_Sub-regional Conference (1).pdf | 2025-11-20 22:09 | 55K | |
![[ ]](/icons/unknown.gif) | 25_09_2017_ Geo_Iran Protocol_6th_w_tracks.docx | 2025-11-20 22:09 | 59K | |
![[ ]](/icons/unknown.gif) | 25_09_2017_ Geo_Iran Protocol_6th_w_tracks (1).docx | 2025-11-20 22:09 | 59K | |
![[ ]](/icons/unknown.gif) | წისქვილი 100 ლარიანი მენიუ.xls | 2025-11-20 22:09 | 77K | |
![[ ]](/icons/unknown.gif) | წისქვილი 100 ლარიანი მენიუ (1).xls | 2025-11-20 22:09 | 77K | |
![[ ]](/icons/unknown.gif) | წისქვილი 90 ლარიანი მენიუ.xls | 2025-11-20 22:09 | 80K | |
![[ ]](/icons/unknown.gif) | წისქვილი 90 ლარიანი მენიუ (1).xls | 2025-11-20 22:09 | 80K | |
![[ ]](/icons/unknown.gif) | წისქვილი 80 ლარიანი მენიუ.xls | 2025-11-20 22:09 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 80 ლარიანი მენიუ (1).xls | 2025-11-20 22:09 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 70 ლარიანი მენიუ.xls | 2025-11-20 22:09 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 70 ლარიანი მენიუ (1).xls | 2025-11-20 22:09 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 60 ლარიანი მენიუ.xls | 2025-11-20 22:09 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 60 ლარიანი მენიუ (1).xls | 2025-11-20 22:09 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 50 ლარიანი მენიუ.xls | 2025-11-20 22:09 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი 50 ლარიანი მენიუ (1).xls | 2025-11-20 22:09 | 78K | |
![[ ]](/icons/unknown.gif) | წისქვილი სრული მენიუ.xls | 2025-11-20 22:09 | 77K | |
![[ ]](/icons/unknown.gif) | წისქვილი სრული მენიუ (1).xls | 2025-11-20 22:09 | 77K | |
![[ ]](/icons/unknown.gif) | სოფლის მეურნეობა ჩასწორებული_11.xlsx | 2025-11-20 22:09 | 19K | |
![[ ]](/icons/unknown.gif) | სოფლის მეურნეობა ჩასწორებული _11.xlsx | 2025-11-20 22:09 | 19K | |
![[ ]](/icons/layout.gif) | საქართველოს_შრომის,_ჯანმრთელობისა_და_სოციალური_დაცვის_მინისტრს.pdf | 2025-11-20 22:09 | 534K | |
![[ ]](/icons/layout.gif) | მოსაწვევი.pdf | 2025-11-20 22:09 | 238K | |
![[ ]](/icons/layout.gif) | მოსაწვევი (1).pdf | 2025-11-20 22:09 | 238K | |
![[ ]](/icons/unknown.gif) | ირანის ეკონომიკური.docx | 2025-11-20 22:09 | 16K | |
![[ ]](/icons/unknown.gif) | ირანის ეკონომიკური (1).docx | 2025-11-20 22:09 | 16K | |
![[ ]](/icons/layout.gif) | ეთნო წისქვილი სასმლის მენიუ.pdf | 2025-11-20 22:09 | 3.3M | |
![[ ]](/icons/layout.gif) | ეთნო წისქვილი სასმლის მენიუ (1).pdf | 2025-11-20 22:09 | 3.3M | |
![[ ]](/icons/layout.gif) | Пождравление с Днем рождения.pdf | 2025-11-20 22:09 | 47K | |
![[ ]](/icons/unknown.gif) | zahtjev_za_vizu_doc.doc | 2025-11-20 22:09 | 300K | |
![[IMG]](/icons/image2.gif) | wordpress.gif | 2025-11-20 22:09 | 3.8K | |
![[IMG]](/icons/image2.gif) | wordpress (1).gif | 2025-11-20 22:09 | 3.8K | |
![[ ]](/icons/layout.gif) | to Ministries.pdf | 2025-11-20 22:09 | 222K | |
![[ ]](/icons/layout.gif) | to Ministries (1).pdf | 2025-11-20 22:09 | 222K | |
![[IMG]](/icons/image2.gif) | image008 (7).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image008 (6).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (5).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (4).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image006 (8).png | 2025-11-20 22:09 | 1.8K | |
![[IMG]](/icons/image2.gif) | image006 (7).png | 2025-11-20 22:09 | 1.8K | |
![[IMG]](/icons/image2.gif) | image005 (24).png | 2025-11-20 22:09 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (23).png | 2025-11-20 22:09 | 1.9K | |
![[IMG]](/icons/image2.gif) | image004 (34).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image004 (33).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (106).jpg | 2025-11-20 22:09 | 350 | |
![[IMG]](/icons/image2.gif) | image003 (55).png | 2025-11-20 22:09 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (54).png | 2025-11-20 22:09 | 1.4K | |
![[IMG]](/icons/image2.gif) | image002 (183).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (182).jpg | 2025-11-20 22:09 | 350 | |
![[IMG]](/icons/image2.gif) | image002 (181).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (180).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (179).jpg | 2025-11-20 22:09 | 350 | |
![[IMG]](/icons/image2.gif) | image002 (178).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (177).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (176).jpg | 2025-11-20 22:09 | 350 | |
![[IMG]](/icons/image2.gif) | image002 (100).png | 2025-11-20 22:09 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (99).png | 2025-11-20 22:09 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (422).jpg | 2025-11-20 22:09 | 1.4K | |
![[IMG]](/icons/image2.gif) | image001 (421).jpg | 2025-11-20 22:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (420).jpg | 2025-11-20 22:09 | 1.4K | |
![[IMG]](/icons/image2.gif) | image001 (419).jpg | 2025-11-20 22:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (418).jpg | 2025-11-20 22:09 | 6.4K | |
![[IMG]](/icons/image2.gif) | image001 (417).jpg | 2025-11-20 22:09 | 6.4K | |
![[IMG]](/icons/image2.gif) | image001 (321).png | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (320).png | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (319).png | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (318).png | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (75).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (74).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (73).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (72).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (71).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | Zenit.bmp | 2025-11-20 22:09 | 40K | |
![[IMG]](/icons/image2.gif) | Zenit (1).bmp | 2025-11-20 22:09 | 40K | |
![[ ]](/icons/unknown.gif) | TSApresentationsENG.pptx | 2025-11-20 22:09 | 425K | |
![[ ]](/icons/unknown.gif) | Georgian Delegation draft01062016.docx | 2025-11-20 22:09 | 21K | |
![[ ]](/icons/unknown.gif) | Georgian Delegation draft01062016 (1).docx | 2025-11-20 22:09 | 21K | |
![[ ]](/icons/unknown.gif) | 28-09-17 3rd Co EU Socicial Development_final.docx | 2025-11-20 22:09 | 22K | |
![[ ]](/icons/unknown.gif) | 28-09-17 3rd Co EU Socicial Development_final (2).docx | 2025-11-20 22:09 | 22K | |
![[ ]](/icons/unknown.gif) | 28-09-17 3rd Co EU Socicial Development_final (1).docx | 2025-11-20 22:09 | 22K | |
![[ ]](/icons/unknown.gif) | 27_09_2017_ Geo_Iran Protocol_6th_w_tracks - GEOSTM.docx | 2025-11-20 22:09 | 60K | |
![[ ]](/icons/unknown.gif) | 27_09_2017_ Geo_Iran Protocol_6th_w_tracks - GEOSTM (1).docx | 2025-11-20 22:09 | 60K | |
![[IMG]](/icons/image2.gif) | 8googleplus.gif | 2025-11-20 22:09 | 4.3K | |
![[IMG]](/icons/image2.gif) | 8googleplus (1).gif | 2025-11-20 22:09 | 4.3K | |
![[IMG]](/icons/image2.gif) | 7instagram.gif | 2025-11-20 22:09 | 2.8K | |
![[IMG]](/icons/image2.gif) | 7instagram (1).gif | 2025-11-20 22:09 | 2.8K | |
![[IMG]](/icons/image2.gif) | 6pinterest.gif | 2025-11-20 22:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | 6pinterest (1).gif | 2025-11-20 22:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | 5youtube.gif | 2025-11-20 22:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | 5youtube (1).gif | 2025-11-20 22:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | 4twitter.gif | 2025-11-20 22:09 | 2.8K | |
![[IMG]](/icons/image2.gif) | 4twitter (1).gif | 2025-11-20 22:09 | 2.8K | |
![[IMG]](/icons/image2.gif) | 3facebook.gif | 2025-11-20 22:09 | 2.6K | |
![[IMG]](/icons/image2.gif) | 3facebook (1).gif | 2025-11-20 22:09 | 2.6K | |
![[ ]](/icons/unknown.gif) | სამუშაო_ანალიზის_კითხვარი_ახალი_მაია ნიკოლეიშვილი.doc | 2025-11-20 22:09 | 200K | |
![[ ]](/icons/unknown.gif) | სამუშაოს_აღწერილობის_ფორმა_ახალი_მაია ნიკოლეიშვილი.doc | 2025-11-20 22:09 | 121K | |
![[ ]](/icons/unknown.gif) | თამუნა ბერიძე კითხვარი.docx | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/unknown.gif) | თამუნა ბერიძე კითხვარი (1).docx | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/unknown.gif) | თამუნა ბერიძე აღწერილობა.docx | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/unknown.gif) | თამუნა ბერიძე აღწერილობა (1).docx | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/unknown.gif) | ეკონომიკური რუმინეთი (3).docx | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/unknown.gif) | ეკონომიკური რუმინეთი (2).docx | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/unknown.gif) | ეკონომიკური რუმინეთის დელეგაციაში მონაწილეთა სია.docx | 2025-11-20 22:09 | 26K | |
![[ ]](/icons/unknown.gif) | ეკონომიკური რუმინეთის დელეგაციაში მონაწილეთა სია (1).docx | 2025-11-20 22:09 | 26K | |
![[ ]](/icons/layout.gif) | აპარატის გაგზავნილი.pdf | 2025-11-20 22:09 | 43K | |
![[ ]](/icons/layout.gif) | აპარატის გაგზავნილი (1).pdf | 2025-11-20 22:09 | 43K | |
![[IMG]](/icons/image2.gif) | image004 (32).png | 2025-11-20 22:09 | 1.2K | |
![[IMG]](/icons/image2.gif) | image004 (31).png | 2025-11-20 22:09 | 1.2K | |
![[IMG]](/icons/image2.gif) | image004 (30).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image004 (29).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image003 (53).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (52).png | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (51).png | 2025-11-20 22:09 | 170 | |
![[IMG]](/icons/image2.gif) | image003 (50).png | 2025-11-20 22:09 | 170 | |
![[IMG]](/icons/image2.gif) | image002 (98).png | 2025-11-20 22:09 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (97).png | 2025-11-20 22:09 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (96).png | 2025-11-20 22:09 | 185 | |
![[IMG]](/icons/image2.gif) | image002 (95).png | 2025-11-20 22:09 | 185 | |
![[IMG]](/icons/image2.gif) | image001 (416).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (415).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (414).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (413).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (412).jpg | 2025-11-20 22:09 | 10K | |
![[IMG]](/icons/image2.gif) | image001 (317).png | 2025-11-20 22:09 | 54K | |
![[IMG]](/icons/image2.gif) | image001 (316).png | 2025-11-20 22:09 | 54K | |
![[IMG]](/icons/image2.gif) | image001 (315).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (314).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (313).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (312).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | chven (6).png | 2025-11-20 22:09 | 7.2K | |
![[ ]](/icons/layout.gif) | Protocol_GEO-China_7th Session_Beijing_December 10 2015.pdf | 2025-11-20 22:09 | 2.6M | |
![[ ]](/icons/unknown.gif) | Implementation China Commission -2017.docx | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/unknown.gif) | HDI.docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | 02_Протокол_new.doc | 2025-11-20 22:09 | 144K | |
![[ ]](/icons/unknown.gif) | 02_Протокол_new (7).doc | 2025-11-20 22:09 | 144K | |
![[ ]](/icons/unknown.gif) | 02_Протокол_new (6).doc | 2025-11-20 22:09 | 146K | |
![[ ]](/icons/unknown.gif) | 02_Протокол_new (5).doc | 2025-11-20 22:09 | 147K | |
![[ ]](/icons/unknown.gif) | 02_Протокол_new (4).doc | 2025-11-20 22:09 | 147K | |
![[ ]](/icons/unknown.gif) | 02_Протокол_new (3).doc | 2025-11-20 22:09 | 149K | |
![[ ]](/icons/unknown.gif) | 02_Протокол_new (2).doc | 2025-11-20 22:09 | 149K | |
![[ ]](/icons/unknown.gif) | 02_Протокол_new (1).doc | 2025-11-20 22:09 | 144K | |
![[ ]](/icons/unknown.gif) | ეკონომიკური რუმინეთი.docx | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/unknown.gif) | ეკონომიკური რუმინეთი (1).docx | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/unknown.gif) | ეკონომიკური რუმინეთი შესწორებული.docx | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/layout.gif) | გამოფენა ინდოეთში.pdf | 2025-11-20 22:09 | 14M | |
![[ ]](/icons/layout.gif) | გამოფენა ინდოეთში (1).pdf | 2025-11-20 22:09 | 14M | |
![[ ]](/icons/unknown.gif) | users-registration-data_MoLHSA (2).xlsb | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | users-registration-data_MoLHSA (1).xlsb | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/layout.gif) | untitled_job12-5.pdf | 2025-11-20 22:09 | 292K | |
![[ ]](/icons/layout.gif) | untitled_job12-5 (1).pdf | 2025-11-20 22:09 | 292K | |
![[IMG]](/icons/image2.gif) | untitled_job12-3.djvu | 2025-11-20 22:09 | 132K | |
![[IMG]](/icons/image2.gif) | untitled_job12-3 (1).djvu | 2025-11-20 22:09 | 132K | |
![[ ]](/icons/unknown.gif) | letter (2).docx | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image003 (49).png | 2025-11-20 22:09 | 59K | |
![[IMG]](/icons/image2.gif) | image003 (48).png | 2025-11-20 22:09 | 59K | |
![[IMG]](/icons/image2.gif) | image002 (175).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (174).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image001 (411).jpg | 2025-11-20 22:09 | 2.7K | |
![[IMG]](/icons/image2.gif) | image001 (410).jpg | 2025-11-20 22:09 | 2.7K | |
![[IMG]](/icons/image2.gif) | image001 (311).png | 2025-11-20 22:09 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (310).png | 2025-11-20 22:09 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (309).png | 2025-11-20 22:09 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (70).gif | 2025-11-20 22:09 | 49 | |
![[IMG]](/icons/image2.gif) | image001 (69).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (68).gif | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | flight itinirary.docx | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | flight itinirary (1).docx | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | Version.docx | 2025-11-20 22:09 | 107K | |
![[ ]](/icons/unknown.gif) | Version (1).docx | 2025-11-20 22:09 | 107K | |
![[IMG]](/icons/image2.gif) | Tamta Tvalavadze.jpg | 2025-11-20 22:09 | 205K | |
![[IMG]](/icons/image2.gif) | Tamta Tvalavadze (1).jpg | 2025-11-20 22:09 | 205K | |
![[ ]](/icons/unknown.gif) | Report Form and Questionnaire.docx | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/unknown.gif) | Report Form and Questionnaire (1).docx | 2025-11-20 22:09 | 98K | |
![[IMG]](/icons/image2.gif) | Nugzar Janjgava.jpg | 2025-11-20 22:09 | 679K | |
![[IMG]](/icons/image2.gif) | Nugzar Janjgava (3).jpg | 2025-11-20 22:09 | 679K | |
![[IMG]](/icons/image2.gif) | Nugzar Janjgava (2).jpg | 2025-11-20 22:09 | 679K | |
![[IMG]](/icons/image2.gif) | Nugzar Janjgava (1).jpg | 2025-11-20 22:09 | 679K | |
![[ ]](/icons/layout.gif) | Nino Vardia.pdf | 2025-11-20 22:09 | 29K | |
![[ ]](/icons/layout.gif) | Nino Vardia (1).pdf | 2025-11-20 22:09 | 29K | |
![[ ]](/icons/unknown.gif) | Meetings.docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | Meetings (1).docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/layout.gif) | Iran_GEO_JIC_Protocol final_10_10_2017 (3).pdf | 2025-11-20 22:09 | 3.8M | |
![[ ]](/icons/layout.gif) | Iran_GEO_JIC_Protocol final_10_10_2017 (2).pdf | 2025-11-20 22:09 | 3.8M | |
![[ ]](/icons/unknown.gif) | GEO_Letter_Agreement_Ministry_of_Health.docx | 2025-11-20 22:09 | 63K | |
![[ ]](/icons/unknown.gif) | GEO_Letter_Agreement_Ministry_of_Health (1).docx | 2025-11-20 22:09 | 63K | |
![[ ]](/icons/unknown.gif) | Final_Report_Template_-_CorporateGrants_-_FINAL_101215.docx | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/unknown.gif) | Final_Report_Template_-_CorporateGrants_-_FINAL_101215 (1).docx | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/unknown.gif) | ANNEX_B2-ENG.doc | 2025-11-20 22:09 | 72K | |
![[ ]](/icons/unknown.gif) | ANNEX_B2-ENG (1).doc | 2025-11-20 22:09 | 72K | |
![[ ]](/icons/unknown.gif) | ANNEX_B2-1.docx | 2025-11-20 22:09 | 44K | |
![[ ]](/icons/unknown.gif) | ANNEX_B2-1 (1).docx | 2025-11-20 22:09 | 44K | |
![[ ]](/icons/unknown.gif) | ANNEX_B1.docx | 2025-11-20 22:09 | 44K | |
![[ ]](/icons/unknown.gif) | ANNEX_B1-ENG.docx | 2025-11-20 22:09 | 45K | |
![[ ]](/icons/unknown.gif) | ANNEX_B1-ENG (1).docx | 2025-11-20 22:09 | 45K | |
![[ ]](/icons/unknown.gif) | ANNEX_B1 (1).docx | 2025-11-20 22:09 | 44K | |
![[ ]](/icons/layout.gif) | 2068.pdf | 2025-11-20 22:09 | 368K | |
![[ ]](/icons/layout.gif) | 2068 (1).pdf | 2025-11-20 22:09 | 368K | |
![[ ]](/icons/layout.gif) | 267.pdf | 2025-11-20 22:09 | 254K | |
![[ ]](/icons/layout.gif) | 267 (1).pdf | 2025-11-20 22:09 | 254K | |
![[ ]](/icons/layout.gif) | 3-1-9_4061 (1).pdf | 2025-11-20 22:09 | 149K | |
![[IMG]](/icons/image2.gif) | 001.jpg | 2025-11-20 22:09 | 679K | |
![[ ]](/icons/unknown.gif) | პრემიერ - მინისტრის ბრძანება.docx | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | პრემიერ - მინისტრის ბრძანება (1).docx | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/layout.gif) | მიმართვა გილიადი.pdf | 2025-11-20 22:09 | 41K | |
![[ ]](/icons/layout.gif) | მიმართვა გილიადი (1).pdf | 2025-11-20 22:09 | 41K | |
![[ ]](/icons/unknown.gif) | განკარგულების_პროექტი.docx | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/unknown.gif) | განკარგულების_პროექტი (1).docx | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/unknown.gif) | users-registration-data_MoLHSA.xlsb | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image002 (173).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (172).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image001 (409).jpg | 2025-11-20 22:09 | 2.7K | |
![[IMG]](/icons/image2.gif) | image001 (408).jpg | 2025-11-20 22:09 | 2.7K | |
![[IMG]](/icons/image2.gif) | image001 (407).jpg | 2025-11-20 22:09 | 2.7K | |
![[IMG]](/icons/image2.gif) | image001 (406).jpg | 2025-11-20 22:09 | 2.7K | |
![[IMG]](/icons/image2.gif) | image001 (308).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (307).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (306).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (305).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (304).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (67).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (66).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | chven (5).png | 2025-11-20 22:09 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (4).png | 2025-11-20 22:09 | 7.2K | |
![[ ]](/icons/layout.gif) | ap_35260.pdf | 2025-11-20 22:09 | 354K | |
![[ ]](/icons/layout.gif) | ap_35260 (1).pdf | 2025-11-20 22:09 | 354K | |
![[ ]](/icons/unknown.gif) | Speech_for graduationceremony.doc | 2025-11-20 22:09 | 30K | |
![[ ]](/icons/unknown.gif) | Speech_for graduationceremony (1).doc | 2025-11-20 22:09 | 30K | |
![[ ]](/icons/unknown.gif) | Scenario.doc | 2025-11-20 22:09 | 30K | |
![[ ]](/icons/unknown.gif) | Scenario (1).doc | 2025-11-20 22:09 | 30K | |
![[ ]](/icons/layout.gif) | Iran_GEO_JIC_Protocol final_10_10_2017.pdf | 2025-11-20 22:09 | 3.8M | |
![[ ]](/icons/layout.gif) | Iran_GEO_JIC_Protocol final_10_10_2017 (1).pdf | 2025-11-20 22:09 | 3.8M | |
![[ ]](/icons/unknown.gif) | For MOH.docx | 2025-11-20 22:09 | 22K | |
![[ ]](/icons/unknown.gif) | For MOH (1).docx | 2025-11-20 22:09 | 22K | |
![[ ]](/icons/unknown.gif) | FINAL Unified Readout-P2P 2016 Draft-LK Revised.docx | 2025-11-20 22:09 | 166K | |
![[ ]](/icons/unknown.gif) | FINAL Unified Readout-P2P 2016 Draft-LK Revised (1).docx | 2025-11-20 22:09 | 166K | |
![[ ]](/icons/unknown.gif) | Agenda_Georgian German Symposium 2017.docx | 2025-11-20 22:09 | 1.8M | |
![[ ]](/icons/unknown.gif) | Agenda_Georgian German Symposium 2017 (1).docx | 2025-11-20 22:09 | 1.8M | |
![[TXT]](/icons/text.gif) | ATT00002 (64).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (63).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (84).htm | 2025-11-20 22:09 | 35K | |
![[TXT]](/icons/text.gif) | ATT00001 (83).htm | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/unknown.gif) | 2019 წელს შესასრულებელი დირექტივები_MoLHSA.doc | 2025-11-20 22:09 | 48K | |
![[ ]](/icons/unknown.gif) | 2017 16 10 AC OpC-GE feedback on EU consolidated comments.docx | 2025-11-20 22:09 | 61K | |
![[ ]](/icons/unknown.gif) | 2017 16 10 AC OpC-GE feedback on EU consolidated comments (3).docx | 2025-11-20 22:09 | 61K | |
![[ ]](/icons/unknown.gif) | 2017 16 10 AC OpC-GE feedback on EU consolidated comments (2).docx | 2025-11-20 22:09 | 61K | |
![[ ]](/icons/unknown.gif) | 2017 16 10 AC OpC-GE feedback on EU consolidated comments (1).docx | 2025-11-20 22:09 | 61K | |
![[ ]](/icons/unknown.gif) | 19 ოქტომბერი_დღის წესრიგი_I.docx | 2025-11-20 22:09 | 16K | |
![[ ]](/icons/layout.gif) | 3-1-9_4061.pdf | 2025-11-20 22:09 | 149K | |
![[ ]](/icons/unknown.gif) | ტრენინგი.docx | 2025-11-20 22:09 | 17K | |
![[ ]](/icons/unknown.gif) | ტრენინგი (1).docx | 2025-11-20 22:09 | 17K | |
![[ ]](/icons/layout.gif) | სოფელი.pdf | 2025-11-20 22:09 | 336K | |
![[ ]](/icons/unknown.gif) | საქართველოს პრემიერ-მინისტრს.docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | საქართველოს პრემიერ-მინისტრს (1).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | საქართველოს პარლამენტის თავმჯდომარეს.docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | საქართველოს პარლამენტის თავმჯდომარეს (1).docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/layout.gif) | კაჭრეთის განრიგი.pdf | 2025-11-20 22:09 | 136K | |
![[ ]](/icons/unknown.gif) | ეკონ კომ final GE.docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი (5).docx | 2025-11-20 22:09 | 17K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი (4).docx | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (171).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (170).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (169).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (168).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (167).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (166).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image002 (94).png | 2025-11-20 22:09 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (93).png | 2025-11-20 22:09 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (92).png | 2025-11-20 22:09 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (303).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (302).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (301).png | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (300).png | 2025-11-20 22:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | image001 (299).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (298).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (297).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (65).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (64).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (63).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (62).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (61).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (60).gif | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | annex B 2.doc | 2025-11-20 22:09 | 53K | |
![[ ]](/icons/unknown.gif) | annex B 2 (1).doc | 2025-11-20 22:09 | 53K | |
![[ ]](/icons/unknown.gif) | OSH - MoESD Comments.rar | 2025-11-20 22:09 | 84K | |
![[ ]](/icons/unknown.gif) | OSH - MoESD Comments (1).rar | 2025-11-20 22:09 | 84K | |
![[ ]](/icons/unknown.gif) | Non-Paper_07_08_2017.docx | 2025-11-20 22:09 | 85K | |
![[ ]](/icons/unknown.gif) | Non-Paper_07_08_2017 (1).docx | 2025-11-20 22:09 | 85K | |
![[ ]](/icons/unknown.gif) | NHR-2014-2015-15_05-review-eng_1.docx | 2025-11-20 22:09 | 165K | |
![[ ]](/icons/unknown.gif) | NHR-2014-2015-15_05-review-eng_1 (1).docx | 2025-11-20 22:09 | 165K | |
![[ ]](/icons/unknown.gif) | July 2017 (2).rar | 2025-11-20 22:09 | 1.3M | |
![[ ]](/icons/layout.gif) | Grant Letter of Agreement.pdf | 2025-11-20 22:09 | 457K | |
![[ ]](/icons/layout.gif) | Grant Letter of Agreement (1).pdf | 2025-11-20 22:09 | 457K | |
![[ ]](/icons/layout.gif) | Fully executed Agreement_MOHSocial Affairs of Georgia_10_16_17.pdf | 2025-11-20 22:09 | 308K | |
![[ ]](/icons/layout.gif) | Fully executed Agreement_MOH Social Affairs of Georgia_10_16_17.pdf | 2025-11-20 22:09 | 308K | |
![[ ]](/icons/unknown.gif) | Final Report Template - CorporateGrants - FINAL_101215.docx | 2025-11-20 22:09 | 46K | |
![[ ]](/icons/unknown.gif) | Final Report Template - Corporate Grants - FINAL_101215.docx | 2025-11-20 22:09 | 46K | |
![[ ]](/icons/unknown.gif) | Annex B.DOCX | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | Annex B (1).DOCX | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | Annex (2).docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | Annex (1).docx | 2025-11-20 22:09 | 18K | |
![[TXT]](/icons/text.gif) | ATT00002 (62).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (61).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (82).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (81).htm | 2025-11-20 22:09 | 216 | |
![[ ]](/icons/layout.gif) | AE 9.pdf | 2025-11-20 22:09 | 97K | |
![[ ]](/icons/layout.gif) | AE 9 (1).pdf | 2025-11-20 22:09 | 97K | |
![[ ]](/icons/layout.gif) | AE 8.pdf | 2025-11-20 22:09 | 97K | |
![[ ]](/icons/layout.gif) | AE 8 (1).pdf | 2025-11-20 22:09 | 97K | |
![[ ]](/icons/layout.gif) | AE 7.pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/layout.gif) | AE 7 (1).pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/layout.gif) | AE 6.pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 6 (1).pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 5.pdf | 2025-11-20 22:09 | 58K | |
![[ ]](/icons/layout.gif) | AE 5 (1).pdf | 2025-11-20 22:09 | 58K | |
![[ ]](/icons/layout.gif) | AE 4.pdf | 2025-11-20 22:09 | 58K | |
![[ ]](/icons/layout.gif) | AE 4 (1).pdf | 2025-11-20 22:09 | 58K | |
![[ ]](/icons/layout.gif) | AE 3.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 3 (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 2.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 2 (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 1.pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/layout.gif) | AE 1 (1).pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/layout.gif) | 20170724- Save the date -Solution Summit 3_0.pdf | 2025-11-20 22:09 | 272K | |
![[ ]](/icons/unknown.gif) | 3rd report August 2017 -Copy (2).rar | 2025-11-20 22:09 | 911K | |
![[ ]](/icons/unknown.gif) | ქბრბ 1.docx | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/unknown.gif) | ქბრბ 1 (1).docx | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/layout.gif) | ქბრბ.pdf | 2025-11-20 22:09 | 72K | |
![[ ]](/icons/layout.gif) | ქბრბ (1).pdf | 2025-11-20 22:09 | 72K | |
![[ ]](/icons/unknown.gif) | ქბრბ ფორმა.xlsx | 2025-11-20 22:09 | 9.9K | |
![[ ]](/icons/unknown.gif) | ქბრბ ფორმა- NCDC.xlsx | 2025-11-20 22:09 | 11K | |
![[ ]](/icons/unknown.gif) | ქბრბ ფორმა- NCDC (1).xlsx | 2025-11-20 22:09 | 11K | |
![[ ]](/icons/unknown.gif) | ქბრბ ფორმა (1).xlsx | 2025-11-20 22:09 | 9.9K | |
![[ ]](/icons/unknown.gif) | ქბრბ ფორმა ზვიადი და ეკა.xlsx | 2025-11-20 22:09 | 11K | |
![[ ]](/icons/unknown.gif) | ქბრბ ფორმა ზვიადი და ეკა (1).xlsx | 2025-11-20 22:09 | 11K | |
![[ ]](/icons/unknown.gif) | ტრენინგები თურქეთში.docx | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | ტრენინგები თურქეთში (1).docx | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | რუმინეთი-ოქმი.docx | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/unknown.gif) | რუმინეთი-ოქმი (1).docx | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/layout.gif) | რუმინეთის ეკონომიკური.pdf | 2025-11-20 22:09 | 168K | |
![[ ]](/icons/layout.gif) | რუმინეთის ეკონომიკური (1).pdf | 2025-11-20 22:09 | 168K | |
![[IMG]](/icons/image2.gif) | pass.PNG | 2025-11-20 22:09 | 1.4M | |
![[ ]](/icons/layout.gif) | letter from Gilead_1.pdf | 2025-11-20 22:09 | 57K | |
![[IMG]](/icons/image2.gif) | image005 (22).png | 2025-11-20 22:09 | 5.8K | |
![[IMG]](/icons/image2.gif) | image005 (21).png | 2025-11-20 22:09 | 5.8K | |
![[IMG]](/icons/image2.gif) | image003 (47).png | 2025-11-20 22:09 | 5.1K | |
![[IMG]](/icons/image2.gif) | image003 (46).png | 2025-11-20 22:09 | 5.1K | |
![[IMG]](/icons/image2.gif) | image002 (165).jpg | 2025-11-20 22:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | image002 (164).jpg | 2025-11-20 22:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | image001 (405).jpg | 2025-11-20 22:09 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (404).jpg | 2025-11-20 22:09 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (296).png | 2025-11-20 22:09 | 38K | |
![[ ]](/icons/layout.gif) | final 15 consolidate report.pdf | 2025-11-20 22:09 | 47K | |
![[IMG]](/icons/image2.gif) | chven (3).png | 2025-11-20 22:09 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (2).png | 2025-11-20 22:09 | 7.2K | |
![[ ]](/icons/layout.gif) | april, 2017 (1).pdf | 2025-11-20 22:09 | 1.4M | |
![[ ]](/icons/layout.gif) | Supra offer Geo.pdf | 2025-11-20 22:09 | 673K | |
![[ ]](/icons/layout.gif) | Supra offer Geo (1).pdf | 2025-11-20 22:09 | 673K | |
![[ ]](/icons/unknown.gif) | N169-ცვლილება 23,10,2017.docx | 2025-11-20 22:09 | 64K | |
![[ ]](/icons/unknown.gif) | N169-ცვლილება 23,10,2017 (1).docx | 2025-11-20 22:09 | 64K | |
![[ ]](/icons/unknown.gif) | July 2017.rar | 2025-11-20 22:09 | 1.3M | |
![[ ]](/icons/unknown.gif) | July 2017 (1).rar | 2025-11-20 22:09 | 1.3M | |
![[ ]](/icons/layout.gif) | Georgian Wine Georgian (2).pdf | 2025-11-20 22:09 | 198K | |
![[ ]](/icons/layout.gif) | Georgian Wine Georgian (1).pdf | 2025-11-20 22:09 | 198K | |
![[ ]](/icons/unknown.gif) | Georgian Supra Style Menu Reception Style Menu.xlsx | 2025-11-20 22:09 | 1.0M | |
![[ ]](/icons/unknown.gif) | Georgian Supra Style Menu Reception Style Menu (1).xlsx | 2025-11-20 22:09 | 1.0M | |
![[ ]](/icons/layout.gif) | Fully executedAgreement_MOHSocial Affairs of Georgia_10_16_17.pdf | 2025-11-20 22:09 | 308K | |
![[ ]](/icons/unknown.gif) | Final Report Template -CorporateGrants - FINAL_101215.docx | 2025-11-20 22:09 | 46K | |
![[ ]](/icons/unknown.gif) | Draft Consolidated Report Georgia October 2017.docx | 2025-11-20 22:09 | 92K | |
![[ ]](/icons/unknown.gif) | Draft Consolidated Report Georgia October 2017 (1).docx | 2025-11-20 22:09 | 92K | |
![[ ]](/icons/layout.gif) | AE 38_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 38_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 37_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 37_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 36_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 36_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 35_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 35_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 34_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 34_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 33_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 33_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 32_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 32_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 31_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 31_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 30_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 30_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 29_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 29_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 28_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 28_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 27_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 27_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 26_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 26_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 25_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 25_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 24_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 24_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 23_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 23_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 22_Armenia July.pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 22_Armenia July (1).pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 21_Armenia July.pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 21_Armenia July (1).pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 20_Armenia July.pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 20_Armenia July (1).pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 19_Armenia July.pdf | 2025-11-20 22:09 | 102K | |
![[ ]](/icons/layout.gif) | AE 19_Armenia July (1).pdf | 2025-11-20 22:09 | 102K | |
![[ ]](/icons/layout.gif) | AE 18_Armenia July.pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 18_Armenia July (1).pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 17_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 17_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 17_Armenia July.pdf | 2025-11-20 22:09 | 103K | |
![[ ]](/icons/layout.gif) | AE 17_Armenia July (1).pdf | 2025-11-20 22:09 | 103K | |
![[ ]](/icons/layout.gif) | AE 16_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 16_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 16_Armenia July.pdf | 2025-11-20 22:09 | 102K | |
![[ ]](/icons/layout.gif) | AE 16_Armenia July (1).pdf | 2025-11-20 22:09 | 102K | |
![[ ]](/icons/layout.gif) | AE 15_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 15_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 15_Armenia July.pdf | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/layout.gif) | AE 15_Armenia July (1).pdf | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/layout.gif) | AE 14_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 14_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 14_Armenia July.pdf | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/layout.gif) | AE 14_Armenia July (1).pdf | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/layout.gif) | AE 13_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 13_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 13_Armenia July.pdf | 2025-11-20 22:09 | 103K | |
![[ ]](/icons/layout.gif) | AE 13_Armenia July (1).pdf | 2025-11-20 22:09 | 103K | |
![[ ]](/icons/layout.gif) | AE 12_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 12_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 12_Armenia July.pdf | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/layout.gif) | AE 12_Armenia July (1).pdf | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/layout.gif) | AE 11_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 11_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 11_Armenia July.pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 11_Armenia July (1).pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 10_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 10_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 10_Armenia July.pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 10_Armenia July (1).pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 9_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 9_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 9_Armenia July.pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 9_Armenia July (1).pdf | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | AE 8_Armenia_August.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 8_Armenia_August (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 8_Armenia July.pdf | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/layout.gif) | AE 8_Armenia July (1).pdf | 2025-11-20 22:09 | 95K | |
![[ ]](/icons/layout.gif) | AE 7_Armenia_August.pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | AE 7_Armenia_August (1).pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | AE 7_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 7_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 6_Armenia_August.pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | AE 6_Armenia_August (1).pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | AE 6_Armenia July.pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 6_Armenia July (1).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia_August.pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia_August (1).pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia July (2).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia July (1).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 4_Armenia_August.pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/layout.gif) | AE 4_Armenia_August (1).pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/layout.gif) | AE 4_Armenia July.pdf | 2025-11-20 22:09 | 58K | |
![[ ]](/icons/layout.gif) | AE 4_Armenia July (1).pdf | 2025-11-20 22:09 | 58K | |
![[ ]](/icons/layout.gif) | AE 3_Armenia_August.pdf | 2025-11-20 22:09 | 108K | |
![[ ]](/icons/layout.gif) | AE 3_Armenia_August (1).pdf | 2025-11-20 22:09 | 108K | |
![[ ]](/icons/layout.gif) | AE 3_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 3_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 2_Armenia_August.pdf | 2025-11-20 22:09 | 110K | |
![[ ]](/icons/layout.gif) | AE 2_Armenia_August (1).pdf | 2025-11-20 22:09 | 110K | |
![[ ]](/icons/layout.gif) | AE 2_Armenia July.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 2_Armenia July (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 1_Armenia_August.pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/layout.gif) | AE 1_Armenia_August (1).pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/layout.gif) | AE 1_Armenia July.pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/layout.gif) | AE 1_Armenia July (1).pdf | 2025-11-20 22:09 | 106K | |
![[ ]](/icons/unknown.gif) | 9_თვის_შერულების_ანგარიში_xlsx-საგანგებო.xlsx | 2025-11-20 22:09 | 28K | |
![[ ]](/icons/unknown.gif) | 5 years summary_V5.docx | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | 5 years summary_V5 (1).docx | 2025-11-20 22:09 | 24K | |
![[ ]](/icons/unknown.gif) | 3rd report August 2017 -Copy.rar | 2025-11-20 22:09 | 911K | |
![[ ]](/icons/unknown.gif) | 3rd report August 2017 -Copy (1).rar | 2025-11-20 22:09 | 911K | |
![[IMG]](/icons/image2.gif) | წერილი_N102406,_12_10_2017 (2).djvu | 2025-11-20 22:09 | 34K | |
![[ ]](/icons/unknown.gif) | მოხსენებითი გილიადი.docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/layout.gif) | Письмо Белфармпром о переговорах.pdf | 2025-11-20 22:09 | 511K | |
![[IMG]](/icons/image2.gif) | untitled_job1_19 (1).djvu | 2025-11-20 22:09 | 101K | |
![[ ]](/icons/unknown.gif) | smr comments 2017.docx | 2025-11-20 22:09 | 17K | |
![[ ]](/icons/unknown.gif) | reforms -qetos.docx | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/unknown.gif) | reforms -qetos (1).docx | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/unknown.gif) | programme_tentative.doc | 2025-11-20 22:09 | 108K | |
![[ ]](/icons/unknown.gif) | programme_tentative (1).doc | 2025-11-20 22:09 | 108K | |
![[IMG]](/icons/image2.gif) | image005 (20).png | 2025-11-20 22:09 | 1.2K | |
![[IMG]](/icons/image2.gif) | image005 (19).png | 2025-11-20 22:09 | 1.2K | |
![[IMG]](/icons/image2.gif) | image005 (18).png | 2025-11-20 22:09 | 1.2K | |
![[IMG]](/icons/image2.gif) | image005 (17).png | 2025-11-20 22:09 | 1.2K | |
![[IMG]](/icons/image2.gif) | image004 (30).png | 2025-11-20 22:09 | 824 | |
![[IMG]](/icons/image2.gif) | image004 (29).png | 2025-11-20 22:09 | 824 | |
![[IMG]](/icons/image2.gif) | image004 (28).png | 2025-11-20 22:09 | 824 | |
![[IMG]](/icons/image2.gif) | image004 (27).png | 2025-11-20 22:09 | 824 | |
![[IMG]](/icons/image2.gif) | image003 (45).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image003 (44).png | 2025-11-20 22:09 | 830 | |
![[IMG]](/icons/image2.gif) | image003 (43).png | 2025-11-20 22:09 | 830 | |
![[IMG]](/icons/image2.gif) | image003 (42).png | 2025-11-20 22:09 | 830 | |
![[IMG]](/icons/image2.gif) | image003 (41).png | 2025-11-20 22:09 | 830 | |
![[IMG]](/icons/image2.gif) | image002 (91).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (90).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (89).png | 2025-11-20 22:09 | 817 | |
![[IMG]](/icons/image2.gif) | image002 (88).png | 2025-11-20 22:09 | 817 | |
![[IMG]](/icons/image2.gif) | image002 (87).png | 2025-11-20 22:09 | 817 | |
![[IMG]](/icons/image2.gif) | image002 (86).png | 2025-11-20 22:09 | 817 | |
![[IMG]](/icons/image2.gif) | image002 (85).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (6).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (295).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (294).png | 2025-11-20 22:09 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (293).png | 2025-11-20 22:09 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (292).png | 2025-11-20 22:09 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (291).png | 2025-11-20 22:09 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (290).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (289).png | 2025-11-20 22:09 | 6.6K | |
![[IMG]](/icons/image2.gif) | image001 (288).png | 2025-11-20 22:09 | 6.6K | |
![[IMG]](/icons/image2.gif) | image001 (59).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (58).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (57).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (56).gif | 2025-11-20 22:09 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (55).gif | 2025-11-20 22:09 | 4.4K | |
![[ ]](/icons/layout.gif) | draft-concept-note_13th-programme-work.pdf | 2025-11-20 22:09 | 638K | |
![[ ]](/icons/layout.gif) | draft-concept-note_13th-programme-work (1).pdf | 2025-11-20 22:09 | 638K | |
![[ ]](/icons/layout.gif) | South-South_Cooperation.pdf | 2025-11-20 22:09 | 358K | |
![[ ]](/icons/unknown.gif) | SDGs_country nationalization document_GEO.xlsx | 2025-11-20 22:09 | 100K | |
![[ ]](/icons/unknown.gif) | SDGs_country nationalization document_GEO (1).xlsx | 2025-11-20 22:09 | 100K | |
![[ ]](/icons/unknown.gif) | SDGs Council 1st Meeting Agenda_GEO_Draft.docx | 2025-11-20 22:09 | 644K | |
![[ ]](/icons/unknown.gif) | SDGs Council 1st Meeting Agenda_GEO_Draft (1).docx | 2025-11-20 22:09 | 644K | |
![[ ]](/icons/unknown.gif) | SDGs Council 1st Meeting Agenda_ENG Draft.docx | 2025-11-20 22:09 | 643K | |
![[ ]](/icons/unknown.gif) | SDGs Council 1st Meeting Agenda_ENG Draft (1).docx | 2025-11-20 22:09 | 643K | |
![[ ]](/icons/layout.gif) | Nutsi Ticket.pdf | 2025-11-20 22:09 | 56K | |
![[ ]](/icons/unknown.gif) | Nino S booking.docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/layout.gif) | National Matrix Explanatory Paper Georgia.pdf | 2025-11-20 22:09 | 607K | |
![[ ]](/icons/layout.gif) | National Matrix Explanatory Paper Georgia (1).pdf | 2025-11-20 22:09 | 607K | |
![[ ]](/icons/layout.gif) | NFR_EB Bureau 7 October.pdf | 2025-11-20 22:09 | 343K | |
![[ ]](/icons/layout.gif) | Ms_ Odisharia invitation.pdf | 2025-11-20 22:09 | 80K | |
![[ ]](/icons/layout.gif) | Handbook for the mission on Agenda 2030_Germany.pdf | 2025-11-20 22:09 | 782K | |
![[ ]](/icons/layout.gif) | Handbook for the mission on Agenda 2030_Germany (1).pdf | 2025-11-20 22:09 | 782K | |
![[ ]](/icons/layout.gif) | GIZ-Letter.pdf | 2025-11-20 22:09 | 512K | |
![[ ]](/icons/layout.gif) | GIZ-Letter (3).pdf | 2025-11-20 22:09 | 512K | |
![[ ]](/icons/layout.gif) | GIZ-Letter (2).pdf | 2025-11-20 22:09 | 512K | |
![[ ]](/icons/layout.gif) | GIZ-Letter (1).pdf | 2025-11-20 22:09 | 512K | |
![[ ]](/icons/layout.gif) | FR_Newsletter_October 2017issue.pdf | 2025-11-20 22:09 | 633K | |
![[ ]](/icons/layout.gif) | FR_Newsletter_October 2017issue (1).pdf | 2025-11-20 22:09 | 633K | |
![[ ]](/icons/layout.gif) | EN_Newsletter_October 2017issue.pdf | 2025-11-20 22:09 | 617K | |
![[ ]](/icons/layout.gif) | EN_Newsletter_October 2017issue (1).pdf | 2025-11-20 22:09 | 617K | |
![[ ]](/icons/layout.gif) | EB.pdf | 2025-11-20 22:09 | 323K | |
![[IMG]](/icons/image2.gif) | 2 (35).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (35).jpg | 2025-11-20 22:09 | 3.2K | |
![[ ]](/icons/layout.gif) | სლოვენიის დანართი.pdf | 2025-11-20 22:09 | 182K | |
![[ ]](/icons/layout.gif) | სლოვენია წერილი.pdf | 2025-11-20 22:09 | 362K | |
![[ ]](/icons/unknown.gif) | საჯარო ბიურო_.docx | 2025-11-20 22:09 | 16K | |
![[ ]](/icons/layout.gif) | ევროკავშირსა_და_ნატოში_იტნეგრაციის_კომისიების_ერთობლივი_სხდომის_ოქმი.pdf | 2025-11-20 22:09 | 1.5M | |
![[ ]](/icons/unknown.gif) | social inculsion.docx | 2025-11-20 22:09 | 207K | |
![[IMG]](/icons/image2.gif) | image003 (105).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (104).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image002 (163).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (162).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (84).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (403).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image001 (402).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image001 (401).jpg | 2025-11-20 22:09 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (400).jpg | 2025-11-20 22:09 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (287).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (286).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (285).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (284).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (283).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (282).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (281).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (280).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (279).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (278).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (277).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (276).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (54).gif | 2025-11-20 22:09 | 6.9K | |
![[ ]](/icons/unknown.gif) | _EU statement_POL4 workplace compliance (alignment).docx | 2025-11-20 22:09 | 41K | |
![[ ]](/icons/unknown.gif) | _EU statement_POL4 workplace compliance (alignment) (1).docx | 2025-11-20 22:09 | 41K | |
![[ ]](/icons/unknown.gif) | Thank you ltr MOH GEO.PDF | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/unknown.gif) | Thank you ltr MOH GEO (1).PDF | 2025-11-20 22:09 | 96K | |
![[ ]](/icons/layout.gif) | PROGRAMME_mission Agenda 2030 Germany.pdf | 2025-11-20 22:09 | 415K | |
![[ ]](/icons/layout.gif) | ODISHARIA.pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | ODISHARIA (1).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/unknown.gif) | Novo-Nordisk.docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/layout.gif) | HANDBOOK_Agenda 2030 mission Germany.pdf | 2025-11-20 22:09 | 1.2M | |
![[ ]](/icons/unknown.gif) | Answer.docx | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | Answer-1.docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | Answer-1 (1).docx | 2025-11-20 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | Answer (1).docx | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | Agenda_Multi-AnnualPlanning.docx | 2025-11-20 22:09 | 86K | |
![[ ]](/icons/unknown.gif) | Agenda Gudauri.docx | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | 2 (34).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (33).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (32).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (31).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (30).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (34).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (33).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (32).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (31).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (30).jpg | 2025-11-20 22:09 | 3.2K | |
![[ ]](/icons/layout.gif) | ტრენინგის შესახებ.pdf | 2025-11-20 22:09 | 48K | |
![[ ]](/icons/layout.gif) | ტრენინგის შესახებ (1).pdf | 2025-11-20 22:09 | 48K | |
![[ ]](/icons/unknown.gif) | რეგულირება.docx | 2025-11-20 22:09 | 36K | |
![[ ]](/icons/layout.gif) | განხორციელებული_რეფორმების_შესახებ_ინფორმაციის_მოთხოვნა.pdf | 2025-11-20 22:09 | 381K | |
![[IMG]](/icons/image2.gif) | განკარგულება-რუმინეთი.djvu | 2025-11-20 22:09 | 80K | |
![[IMG]](/icons/image2.gif) | image003 (103).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image002 (161).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (83).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (82).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (81).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (80).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (79).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (78).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (77).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (76).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (75).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (399).jpg | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (398).jpg | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (275).png | 2025-11-20 22:09 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (274).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (273).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (272).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (53).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (52).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (51).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (50).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (49).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (48).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (47).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (46).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (45).gif | 2025-11-20 22:09 | 6.9K | |
![[ ]](/icons/layout.gif) | Trip on 21 Nov 17 - PNR ref WLHDW8.pdf | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/layout.gif) | Trip on 21 Nov 17 - PNR refWLHDW8-5 (2).pdf | 2025-11-20 22:09 | 32K | |
![[ ]](/icons/unknown.gif) | Recommended Hotels.docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/unknown.gif) | Recommended Hotels (1).docx | 2025-11-20 22:09 | 14K | |
![[ ]](/icons/layout.gif) | Letter reply RD to MoH GEO (v2) (181017)_hkl_18102017_clean ne.pdf | 2025-11-20 22:09 | 55K | |
![[ ]](/icons/layout.gif) | Letter reply RD to MoH GEO (v2) (181017)_hkl_18102017_clean ne (1).pdf | 2025-11-20 22:09 | 55K | |
![[ ]](/icons/unknown.gif) | GF-21045H (6_0)_AE_SSR ReportForm.docx | 2025-11-20 22:09 | 68K | |
![[ ]](/icons/unknown.gif) | GF-21045H (6_0)_AE_SSR ReportForm (1).docx | 2025-11-20 22:09 | 68K | |
![[ ]](/icons/layout.gif) | GEO_official letter_01_11_17.pdf | 2025-11-20 22:09 | 86K | |
![[ ]](/icons/layout.gif) | GEO_official letter_01_11_17 (1).pdf | 2025-11-20 22:09 | 86K | |
![[ ]](/icons/layout.gif) | David Sergeenko_new passprot.pdf | 2025-11-20 22:09 | 130K | |
![[ ]](/icons/unknown.gif) | Copy of filled Supplier's BankDetails_Mr_ David Sergeenko.xlsb | 2025-11-20 22:09 | 66K | |
![[TXT]](/icons/text.gif) | ATT00001 (80).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (79).htm | 2025-11-20 22:09 | 168 | |
![[ ]](/icons/layout.gif) | 2017 unog hotels list with preferential rates.pdf | 2025-11-20 22:09 | 191K | |
![[ ]](/icons/layout.gif) | 2017 unog hotels list with preferential rates (1).pdf | 2025-11-20 22:09 | 191K | |
![[ ]](/icons/layout.gif) | 25s2e04_ProgrammeVisitGeorgia partB_170962.pdf | 2025-11-20 22:09 | 172K | |
![[ ]](/icons/layout.gif) | 25s2e03_ProgrammeVisitGeorgia partA_170938 (4).pdf | 2025-11-20 22:09 | 177K | |
![[IMG]](/icons/image2.gif) | 2 (29).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (28).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (29).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (28).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image004 (28).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image004 (27).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image004 (26).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image004 (25).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image004 (24).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image003 (102).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (101).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (100).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (99).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (98).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (97).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image002 (160).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (159).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (158).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (157).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (156).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (155).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (74).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (73).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (72).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (71).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (70).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (69).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (68).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image002 (67).png | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (271).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (270).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (269).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (268).png | 2025-11-20 22:09 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (267).png | 2025-11-20 22:09 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (44).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (43).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (42).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (41).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (40).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (39).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (38).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (37).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (36).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (35).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (34).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (33).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (32).gif | 2025-11-20 22:09 | 6.9K | |
![[ ]](/icons/unknown.gif) | agenda 12-14 November.docx | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/unknown.gif) | agenda 12-14 November (1).docx | 2025-11-20 22:09 | 66K | |
![[ ]](/icons/unknown.gif) | TB ანდრეი მოშნიაგას პრეზენტაცია პარლამენტში.pptx | 2025-11-20 22:09 | 1.7M | |
![[ ]](/icons/unknown.gif) | Reforms_MoLHSA_6 Nov.docx | 2025-11-20 22:09 | 47K | |
![[ ]](/icons/unknown.gif) | MoH Talking Points.docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | MoH Talking Points (1).docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/layout.gif) | FORMULA DAVILA CAMILO.pdf | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/layout.gif) | FORMULA DAVILA CAMILO (1).pdf | 2025-11-20 22:09 | 67K | |
![[ ]](/icons/unknown.gif) | CAPT Nancy Knight Bio.docx | 2025-11-20 22:09 | 33K | |
![[ ]](/icons/unknown.gif) | CAPT Nancy Knight Bio (1).docx | 2025-11-20 22:09 | 33K | |
![[IMG]](/icons/image2.gif) | ATT00002 (3).png | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | ATT00002 (2).png | 2025-11-20 22:09 | 17K | |
![[ ]](/icons/layout.gif) | AE 18_Armenia (2).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 17_Armenia (2).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 16_Armenia (2).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 15_Armenia (2).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 14_Armenia (2).pdf | 2025-11-20 22:09 | 65K | |
![[ ]](/icons/layout.gif) | AE 13_Armenia (2).pdf | 2025-11-20 22:09 | 69K | |
![[ ]](/icons/layout.gif) | AE 12_Armenia (2).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 11_Armenia (2).pdf | 2025-11-20 22:09 | 88K | |
![[ ]](/icons/layout.gif) | AE 10_Armenia (2).pdf | 2025-11-20 22:09 | 51K | |
![[ ]](/icons/layout.gif) | AE 9_Armenia (2).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 8_Armenia (2).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 7_Armenia (2).pdf | 2025-11-20 22:09 | 51K | |
![[ ]](/icons/layout.gif) | AE 6_Armenia (4).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia (4).pdf | 2025-11-20 22:09 | 83K | |
![[ ]](/icons/layout.gif) | AE 4_Armenia (2).pdf | 2025-11-20 22:09 | 113K | |
![[ ]](/icons/layout.gif) | AE 3_Armenia (2).pdf | 2025-11-20 22:09 | 104K | |
![[ ]](/icons/layout.gif) | AE 2_Armenia (2).pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | AE 1_Armenia (2).pdf | 2025-11-20 22:09 | 105K | |
![[IMG]](/icons/image2.gif) | 2 (27).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (26).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (27).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (26).jpg | 2025-11-20 22:09 | 3.2K | |
![[ ]](/icons/unknown.gif) | სტატისტიკა.docx | 2025-11-20 22:09 | 28K | |
![[ ]](/icons/unknown.gif) | twinning - transplantation2.docx | 2025-11-20 22:09 | 28K | |
![[ ]](/icons/unknown.gif) | twinnig- medical devices2.docx | 2025-11-20 22:09 | 27K | |
![[ ]](/icons/layout.gif) | letter of nomination of Ms_Khatuna Zakhashvili.pdf | 2025-11-20 22:09 | 153K | |
![[IMG]](/icons/image2.gif) | image004 (23).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image004 (22).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image004 (21).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image004 (20).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image003 (96).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (95).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (94).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (93).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (92).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (91).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (9).gif | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image002 (154).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (153).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (152).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (151).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (150).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (149).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (5).gif | 2025-11-20 22:09 | 420 | |
![[IMG]](/icons/image2.gif) | image001 (397).jpg | 2025-11-20 22:09 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (396).jpg | 2025-11-20 22:09 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (266).png | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (265).png | 2025-11-20 22:09 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (264).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (263).png | 2025-11-20 22:09 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (262).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (261).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (260).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (259).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (258).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (257).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (256).png | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (31).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (30).gif | 2025-11-20 22:09 | 256 | |
![[IMG]](/icons/image2.gif) | image001 (29).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (28).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (27).gif | 2025-11-20 22:09 | 6.9K | |
![[ ]](/icons/layout.gif) | april, 2017.pdf | 2025-11-20 22:09 | 1.4M | |
![[ ]](/icons/unknown.gif) | NINO BERDZULI (2).docx | 2025-11-20 22:09 | 60K | |
![[ ]](/icons/unknown.gif) | NCDC Project proposal blood Safeti-ks.docx | 2025-11-20 22:09 | 333K | |
![[ ]](/icons/layout.gif) | Georgian Wine Georgian.pdf | 2025-11-20 22:09 | 198K | |
![[ ]](/icons/unknown.gif) | GEO RD draft programme 2017-11-27 v3 w-o comm.docx | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/unknown.gif) | GEO RD draft programme 2017-11-27 v3 w-o comm (1).docx | 2025-11-20 22:09 | 35K | |
![[ ]](/icons/unknown.gif) | CurriculumVitae-KhatunaZakhashvili-1.docx | 2025-11-20 22:09 | 29K | |
![[ ]](/icons/layout.gif) | CONSLEG_1993L0042_20071011_en_TXT.pdf | 2025-11-20 22:09 | 261K | |
![[ ]](/icons/layout.gif) | CONSLEG_1990L0385_20071011_en_TXT.pdf | 2025-11-20 22:09 | 155K | |
![[ ]](/icons/layout.gif) | CELEX_31998L0079_EN_TXT.pdf | 2025-11-20 22:09 | 276K | |
![[IMG]](/icons/image2.gif) | ATT00002.png | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | ATT00002 (1).png | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | 2 (25).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (24).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (23).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (22).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (25).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (24).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (23).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (22).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 ვარიანტი.png | 2025-11-20 22:09 | 1.9M | |
![[ ]](/icons/unknown.gif) | კომენტარებისთვის_შეფასების შუალედური ანგარიშ (1) | 2025-11-20 22:09 | 217K | |
![[ ]](/icons/unknown.gif) | კომენტარებისთვის_შეფასების შუალედური ანგარიშ | 2025-11-20 22:09 | 217K | |
![[ ]](/icons/layout.gif) | ვანკუვერი_თავდაცვის მინისტერიალი_UN peacekeeping.pdf | 2025-11-20 22:09 | 913K | |
![[IMG]](/icons/image2.gif) | image004 (19).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image004 (18).jpg | 2025-11-20 22:09 | 771 | |
![[IMG]](/icons/image2.gif) | image003 (90).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (89).jpg | 2025-11-20 22:09 | 734 | |
![[IMG]](/icons/image2.gif) | image003 (88).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (87).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image003 (86).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | image002 (148).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (147).jpg | 2025-11-20 22:09 | 721 | |
![[IMG]](/icons/image2.gif) | image002 (146).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (145).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image002 (144).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (395).jpg | 2025-11-20 22:09 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (394).jpg | 2025-11-20 22:09 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (255).png | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (254).png | 2025-11-20 22:09 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (253).png | 2025-11-20 22:09 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (252).png | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (251).png | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (250).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (249).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (248).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (247).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (246).png | 2025-11-20 22:09 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (26).gif | 2025-11-20 22:09 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (25).gif | 2025-11-20 22:09 | 6.9K | |
![[ ]](/icons/layout.gif) | Your Electronic Ticket Receipt.pdf | 2025-11-20 22:09 | 11K | |
![[ ]](/icons/layout.gif) | Your Electronic Ticket Receipt (1).pdf | 2025-11-20 22:09 | 11K | |
![[ ]](/icons/layout.gif) | Trip on 21 Nov 17 - PNR refWLHDW8-5.pdf | 2025-11-20 22:09 | 32K | |
![[ ]](/icons/layout.gif) | Trip on 21 Nov 17 - PNR refWLHDW8-5 (1).pdf | 2025-11-20 22:09 | 32K | |
![[ ]](/icons/layout.gif) | Scanned from a Xerox multifunction device (1).pdf | 2025-11-20 22:09 | 107K | |
![[ ]](/icons/layout.gif) | SSC - programme - visit toGeorgia.pdf | 2025-11-20 22:09 | 83K | |
![[ ]](/icons/layout.gif) | SSC - programme - visit toGeorgia (1).pdf | 2025-11-20 22:09 | 83K | |
![[ ]](/icons/layout.gif) | Nedret Emiroglu special turkish passport till 2021.pdf | 2025-11-20 22:09 | 656K | |
![[ ]](/icons/layout.gif) | Mr Sopromadze.pdf | 2025-11-20 22:09 | 174K | |
![[ ]](/icons/layout.gif) | Mr Sopromadze (3).pdf | 2025-11-20 22:09 | 174K | |
![[ ]](/icons/layout.gif) | Mr Sopromadze (2).pdf | 2025-11-20 22:09 | 174K | |
![[ ]](/icons/layout.gif) | Mr Sopromadze (1).pdf | 2025-11-20 22:09 | 174K | |
![[ ]](/icons/unknown.gif) | ICRC Study list of invitees.docx | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/unknown.gif) | ICRC Study list of invitees (3).docx | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/unknown.gif) | ICRC Study list of invitees (2).docx | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/unknown.gif) | ICRC Study list of invitees (1).docx | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/unknown.gif) | ICRC Agenda.docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | ICRC Agenda (3).docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | ICRC Agenda (2).docx | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/unknown.gif) | ICRC Agenda (1).docx | 2025-11-20 22:09 | 18K | |
![[IMG]](/icons/image2.gif) | 2 (21).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (20).jpg | 2025-11-20 22:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (21).jpg | 2025-11-20 22:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (20).jpg | 2025-11-20 22:09 | 3.2K | |
![[ ]](/icons/unknown.gif) | ინფორმაცია პროექტის შესახებ - ნუცისთვის.docx | 2025-11-20 22:09 | 28K | |
![[ ]](/icons/unknown.gif) | twinning -transplantation2_clean.docx | 2025-11-20 22:09 | 327K | |
![[ ]](/icons/unknown.gif) | twinnig- medicaldevices2_clean.docx | 2025-11-20 22:09 | 326K | |
![[IMG]](/icons/image2.gif) | image005 (16).png | 2025-11-20 22:09 | 1.3K | |
![[IMG]](/icons/image2.gif) | image005 (15).png | 2025-11-20 22:09 | 1.3K | |
![[IMG]](/icons/image2.gif) | image004 (26).png | 2025-11-20 22:09 | 824 | |
![[IMG]](/icons/image2.gif) | image004 (25).png | 2025-11-20 22:09 | 824 | |
![[IMG]](/icons/image2.gif) | image003 (40).png | 2025-11-20 22:09 | 830 | |
![[IMG]](/icons/image2.gif) | image003 (39).png | 2025-11-20 22:09 | 830 | |
![[IMG]](/icons/image2.gif) | image002 (66).png | 2025-11-20 22:09 | 817 | |
![[IMG]](/icons/image2.gif) | image002 (65).png | 2025-11-20 22:09 | 817 | |
![[IMG]](/icons/image2.gif) | image001 (393).jpg | 2025-11-20 22:09 | 350 | |
![[IMG]](/icons/image2.gif) | image001 (392).jpg | 2025-11-20 22:09 | 350 | |
![[IMG]](/icons/image2.gif) | image001 (391).jpg | 2025-11-20 22:09 | 350 | |
![[IMG]](/icons/image2.gif) | image001 (390).jpg | 2025-11-20 22:09 | 350 | |
![[IMG]](/icons/image2.gif) | image001 (245).png | 2025-11-20 22:09 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (244).png | 2025-11-20 22:09 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (243).png | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/unknown.gif) | hepatit.doc | 2025-11-20 22:09 | 34K | |
![[ ]](/icons/unknown.gif) | hepatit (1).doc | 2025-11-20 22:09 | 34K | |
![[ ]](/icons/unknown.gif) | agenda 12-14 November GEO.docx | 2025-11-20 22:09 | 250K | |
![[ ]](/icons/unknown.gif) | agenda 12-14 November GEO (1).docx | 2025-11-20 22:09 | 250K | |
![[ ]](/icons/unknown.gif) | _________ ________ 2016-2020_________ __________.docx | 2025-11-20 22:09 | 384K | |
![[ ]](/icons/unknown.gif) | _________ ________ 2016-2020_________ __________ (1).docx | 2025-11-20 22:09 | 384K | |
![[ ]](/icons/unknown.gif) | Report Form and Questionnaire (3) (1).docx | 2025-11-20 22:09 | 173K | |
![[ ]](/icons/unknown.gif) | Report Form and Questionnaire (3) (1) (1).docx | 2025-11-20 22:09 | 173K | |
![[ ]](/icons/layout.gif) | Project support letter fromMoLHSA.pdf | 2025-11-20 22:09 | 200K | |
![[ ]](/icons/layout.gif) | Project support letter fromMoLHSA (1).pdf | 2025-11-20 22:09 | 200K | |
![[ ]](/icons/unknown.gif) | NINO BERDZULI.DOCX | 2025-11-20 22:09 | 61K | |
![[ ]](/icons/unknown.gif) | NINO BERDZULI (1).DOCX | 2025-11-20 22:09 | 61K | |
![[ ]](/icons/unknown.gif) | NCDC Project proposal bloodSafeti-ks-1.docx | 2025-11-20 22:09 | 333K | |
![[ ]](/icons/unknown.gif) | MOU_palliative care_final.doc | 2025-11-20 22:09 | 69K | |
![[ ]](/icons/unknown.gif) | MOU_palliative care_final (5).doc | 2025-11-20 22:09 | 69K | |
![[ ]](/icons/unknown.gif) | MOU_palliative care_final (4).doc | 2025-11-20 22:09 | 69K | |
![[ ]](/icons/unknown.gif) | MOU_palliative care_final (3).doc | 2025-11-20 22:09 | 72K | |
![[ ]](/icons/unknown.gif) | MOU_palliative care_final (2).doc | 2025-11-20 22:09 | 72K | |
![[ ]](/icons/unknown.gif) | MOU_palliative care_final (1).doc | 2025-11-20 22:09 | 69K | |
![[ ]](/icons/layout.gif) | Implementation Report 2017.pdf | 2025-11-20 22:09 | 2.7M | |
![[ ]](/icons/layout.gif) | Implementation Report 2017 (1).pdf | 2025-11-20 22:09 | 2.7M | |
![[ ]](/icons/unknown.gif) | David Sergeenko - Bio (4).docx | 2025-11-20 22:09 | 64K | |
![[ ]](/icons/unknown.gif) | David Sergeenko - Bio (3).docx | 2025-11-20 22:09 | 64K | |
![[ ]](/icons/layout.gif) | 14073.pdf | 2025-11-20 22:09 | 277K | |
![[ ]](/icons/layout.gif) | 14073 (1).pdf | 2025-11-20 22:09 | 277K | |
![[ ]](/icons/unknown.gif) | სოციალურ_და_კულტურულ_უფლებათა_შესახებ_საერთაშორისო_პაქტი_(2) (1).docx | 2025-11-20 22:09 | 459K | |
![[ ]](/icons/unknown.gif) | სოციალურ_და_კულტურულ_უფლებათა_შესახებ_საერთაშორისო_პაქტი_(2) (1) (1).docx | 2025-11-20 22:09 | 459K | |
![[ ]](/icons/layout.gif) | прилож_членам Совета.pdf | 2025-11-20 22:09 | 41K | |
![[ ]](/icons/layout.gif) | прилож_членам Совета (1).pdf | 2025-11-20 22:09 | 41K | |
![[ ]](/icons/layout.gif) | прилож_Повестка.pdf | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/layout.gif) | прилож_Повестка (1).pdf | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/layout.gif) | прилож_Грузия.pdf | 2025-11-20 22:09 | 767K | |
![[ ]](/icons/layout.gif) | прилож_Грузия (1).pdf | 2025-11-20 22:09 | 767K | |
![[ ]](/icons/layout.gif) | повестка.pdf | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/layout.gif) | повестка (1).pdf | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/layout.gif) | визы.pdf | 2025-11-20 22:09 | 45K | |
![[ ]](/icons/layout.gif) | визы (1).pdf | 2025-11-20 22:09 | 45K | |
![[ ]](/icons/layout.gif) | визы Грузия.pdf | 2025-11-20 22:09 | 21K | |
![[ ]](/icons/layout.gif) | визы Грузия (7).pdf | 2025-11-20 22:09 | 37K | |
![[ ]](/icons/layout.gif) | визы Грузия (6).pdf | 2025-11-20 22:09 | 37K | |
![[ ]](/icons/layout.gif) | визы Грузия (5).pdf | 2025-11-20 22:09 | 23K | |
![[ ]](/icons/layout.gif) | визы Грузия (4).pdf | 2025-11-20 22:09 | 23K | |
![[ ]](/icons/layout.gif) | визы Грузия (3).pdf | 2025-11-20 22:09 | 21K | |
![[ ]](/icons/layout.gif) | визы Грузия (2).pdf | 2025-11-20 22:09 | 21K | |
![[ ]](/icons/layout.gif) | визы Грузия (1).pdf | 2025-11-20 22:09 | 21K | |
![[ ]](/icons/layout.gif) | Грузия прилож_.pdf | 2025-11-20 22:09 | 332K | |
![[ ]](/icons/layout.gif) | Грузия прилож_ (1).pdf | 2025-11-20 22:09 | 332K | |
![[ ]](/icons/unknown.gif) | samtavrobo programa jandacva.docx | 2025-11-20 22:09 | 446K | |
![[ ]](/icons/unknown.gif) | samtavrobo programa jandacva (1).docx | 2025-11-20 22:09 | 446K | |
![[IMG]](/icons/image2.gif) | image003 (85).jpg | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (84).jpg | 2025-11-20 22:09 | 1.5K | |
![[IMG]](/icons/image2.gif) | image002 (64).png | 2025-11-20 22:09 | 6.1K | |
![[IMG]](/icons/image2.gif) | image002 (63).png | 2025-11-20 22:09 | 6.1K | |
![[IMG]](/icons/image2.gif) | image002 (62).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (61).png | 2025-11-20 22:09 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (389).jpg | 2025-11-20 22:09 | 3.0K | |
![[IMG]](/icons/image2.gif) | image001 (388).jpg | 2025-11-20 22:09 | 3.0K | |
![[IMG]](/icons/image2.gif) | image001 (387).jpg | 2025-11-20 22:09 | 3.6K | |
![[IMG]](/icons/image2.gif) | image001 (386).jpg | 2025-11-20 22:09 | 3.6K | |
![[IMG]](/icons/image2.gif) | image001 (242).png | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/unknown.gif) | draft road map GEO_JL_v2.docx | 2025-11-20 22:09 | 37K | |
![[ ]](/icons/unknown.gif) | draft road map GEO_JL_v2 (1).docx | 2025-11-20 22:09 | 37K | |
![[ ]](/icons/unknown.gif) | Untitled (1) | 2025-11-20 22:09 | 0 | |
![[ ]](/icons/unknown.gif) | Twining_Transplantation_MoLHSA.docx | 2025-11-20 22:09 | 328K | |
![[ ]](/icons/unknown.gif) | Twining_MedicalDevices_MoLHSA.docx | 2025-11-20 22:09 | 326K | |
![[ ]](/icons/unknown.gif) | Twining_Blood Safety_NCDC.docx | 2025-11-20 22:09 | 333K | |
![[ ]](/icons/layout.gif) | Programme of Work EB SS.pdf | 2025-11-20 22:09 | 34K | |
![[ ]](/icons/unknown.gif) | Mission briefing 8 November2017.pptm | 2025-11-20 22:09 | 125K | |
![[ ]](/icons/layout.gif) | GPW13_MissionBriefing 8 November2017.pdf | 2025-11-20 22:09 | 1.5M | |
![[ ]](/icons/layout.gif) | AE 6_Armenia (3).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 6_Armenia (2).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia July.pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia (3).pdf | 2025-11-20 22:09 | 83K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia (2).pdf | 2025-11-20 22:09 | 83K | |
![[ ]](/icons/layout.gif) | 2017_11 draft Report CESCR.pdf | 2025-11-20 22:09 | 1.0M | |
![[ ]](/icons/layout.gif) | 2017_11 draft Report CESCR (1).pdf | 2025-11-20 22:09 | 1.0M | |
![[ ]](/icons/unknown.gif) | 0 GEO_BF RD draft programme 2017-11-27 v6.docx | 2025-11-20 22:09 | 34K | |
![[ ]](/icons/unknown.gif) | 0 GEO_BF RD draft programme 2017-11-27 v6 (1).docx | 2025-11-20 22:09 | 34K | |
![[ ]](/icons/layout.gif) | ქალთა_მიმართ_ძალადობის_აღმოფხვრის_საერთაშორისო_დღე.pdf | 2025-11-20 22:09 | 355K | |
![[ ]](/icons/layout.gif) | ქალთა_მიმართ_ძალადობის_აღმოფხვრის_საერთაშორისო_დღე (1).pdf | 2025-11-20 22:09 | 355K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამის განახლება შრომა.docx | 2025-11-20 22:09 | 446K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამის განახლება შრომა (1).docx | 2025-11-20 22:09 | 446K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა_MoLHSA_14_11_2017.docx | 2025-11-20 22:09 | 450K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა_MoLHSA_14_11_2017 (1).docx | 2025-11-20 22:09 | 450K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა_MoLHSA_14 11 2017.docx | 2025-11-20 22:09 | 458K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა_MoLHSA_14 11 2017 (1).docx | 2025-11-20 22:09 | 458K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა ახალი _ნდობა 13_11_2017_nuci.docx | 2025-11-20 22:09 | 450K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა ახალი _ნდობა 13_11_2017_nuci (1).docx | 2025-11-20 22:09 | 450K | |
![[ ]](/icons/unknown.gif) | support letter (2).docx | 2025-11-20 22:09 | 12K | |
![[ ]](/icons/unknown.gif) | support letter (2) (3).docx | 2025-11-20 22:09 | 12K | |
![[ ]](/icons/unknown.gif) | support letter (2) (2).docx | 2025-11-20 22:09 | 12K | |
![[ ]](/icons/unknown.gif) | support letter (2) (1).docx | 2025-11-20 22:09 | 12K | |
![[IMG]](/icons/image2.gif) | red cross workshop.djvu | 2025-11-20 22:09 | 55K | |
![[IMG]](/icons/image2.gif) | red cross workshop (1).djvu | 2025-11-20 22:09 | 55K | |
![[IMG]](/icons/image2.gif) | image002 (143).jpg | 2025-11-20 22:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | image001 (385).jpg | 2025-11-20 22:09 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (384).jpg | 2025-11-20 22:09 | 5.9K | |
![[IMG]](/icons/image2.gif) | image001 (241).png | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (240).png | 2025-11-20 22:09 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (24).gif | 2025-11-20 22:09 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (23).gif | 2025-11-20 22:09 | 4.4K | |
![[IMG]](/icons/image2.gif) | chven.png | 2025-11-20 22:09 | 7.2K | |
![[IMG]](/icons/image2.gif) | chven (1).png | 2025-11-20 22:09 | 7.2K | |
![[ ]](/icons/layout.gif) | UK visa support letter.pdf | 2025-11-20 22:09 | 140K | |
![[ ]](/icons/unknown.gif) | UHC-NCDC.docx | 2025-11-20 22:09 | 212K | |
![[ ]](/icons/unknown.gif) | UHC-NCDC -16_11_17-eng.docx | 2025-11-20 22:09 | 347K | |
![[ ]](/icons/unknown.gif) | UHC-NCDC -16_11_17-eng (1).docx | 2025-11-20 22:09 | 347K | |
![[ ]](/icons/unknown.gif) | UHC-NCDC (1).docx | 2025-11-20 22:09 | 212K | |
![[ ]](/icons/layout.gif) | Letter from WHO (2).pdf | 2025-11-20 22:09 | 109K | |
![[ ]](/icons/layout.gif) | Letter from WHO (1).pdf | 2025-11-20 22:09 | 109K | |
![[ ]](/icons/unknown.gif) | High-level Conference - draftagenda GE.docx | 2025-11-20 22:09 | 683K | |
![[ ]](/icons/unknown.gif) | High-level Conference - draftagenda GE (1).docx | 2025-11-20 22:09 | 683K | |
![[ ]](/icons/layout.gif) | AE 18_Armenia.pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 18_Armenia (1).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 17_Armenia.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 17_Armenia (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 16_Armenia.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 16_Armenia (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 15_Armenia.pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 15_Armenia (1).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 14_Armenia.pdf | 2025-11-20 22:09 | 65K | |
![[ ]](/icons/layout.gif) | AE 14_Armenia (1).pdf | 2025-11-20 22:09 | 65K | |
![[ ]](/icons/layout.gif) | AE 13_Armenia.pdf | 2025-11-20 22:09 | 69K | |
![[ ]](/icons/layout.gif) | AE 13_Armenia (1).pdf | 2025-11-20 22:09 | 69K | |
![[ ]](/icons/layout.gif) | AE 12_Armenia.pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 12_Armenia (1).pdf | 2025-11-20 22:09 | 57K | |
![[ ]](/icons/layout.gif) | AE 11_Armenia.pdf | 2025-11-20 22:09 | 88K | |
![[ ]](/icons/layout.gif) | AE 11_Armenia (1).pdf | 2025-11-20 22:09 | 88K | |
![[ ]](/icons/layout.gif) | AE 10_Armenia.pdf | 2025-11-20 22:09 | 51K | |
![[ ]](/icons/layout.gif) | AE 10_Armenia (1).pdf | 2025-11-20 22:09 | 51K | |
![[ ]](/icons/layout.gif) | AE 9_Armenia.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 9_Armenia (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 8_Armenia.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 8_Armenia (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 7_Armenia.pdf | 2025-11-20 22:09 | 51K | |
![[ ]](/icons/layout.gif) | AE 7_Armenia (1).pdf | 2025-11-20 22:09 | 51K | |
![[ ]](/icons/layout.gif) | AE 6_Armenia.pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 6_Armenia (1).pdf | 2025-11-20 22:09 | 50K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia.pdf | 2025-11-20 22:09 | 83K | |
![[ ]](/icons/layout.gif) | AE 5_Armenia (1).pdf | 2025-11-20 22:09 | 83K | |
![[ ]](/icons/layout.gif) | AE 4_Armenia.pdf | 2025-11-20 22:09 | 113K | |
![[ ]](/icons/layout.gif) | AE 4_Armenia (1).pdf | 2025-11-20 22:09 | 113K | |
![[ ]](/icons/layout.gif) | AE 3_Armenia.pdf | 2025-11-20 22:09 | 104K | |
![[ ]](/icons/layout.gif) | AE 3_Armenia (1).pdf | 2025-11-20 22:09 | 104K | |
![[ ]](/icons/layout.gif) | AE 2_Armenia.pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | AE 2_Armenia (1).pdf | 2025-11-20 22:09 | 98K | |
![[ ]](/icons/layout.gif) | AE 1_Armenia.pdf | 2025-11-20 22:09 | 105K | |
![[ ]](/icons/layout.gif) | AE 1_Armenia (1).pdf | 2025-11-20 22:09 | 105K | |
![[ ]](/icons/unknown.gif) | წერილი გუბერნატორს (2) (2).docx | 2025-11-20 22:09 | 21K | |
![[ ]](/icons/unknown.gif) | პარლამენტში წარსადგენი ანგარიში_ქალთა ძალადობა.doc | 2025-11-20 22:09 | 582K | |
![[ ]](/icons/unknown.gif) | პარლამენტში წარსადგენი ანგარიში_ქალთა ძალადობა (1).doc | 2025-11-20 22:09 | 582K | |
![[ ]](/icons/unknown.gif) | მხარდამჭერი წერილი.docx | 2025-11-20 22:09 | 16K | |
![[ ]](/icons/unknown.gif) | მხარდამჭერი წერილი (1).docx | 2025-11-20 22:09 | 16K | |
![[ ]](/icons/unknown.gif) | მიმართვა - დამატებითი ინფორმაციით.docx | 2025-11-20 22:09 | 20K | |
![[ ]](/icons/unknown.gif) | ინფორმაცია ღონისძიების შესახებ.docx | 2025-11-20 22:09 | 31K | |
![[ ]](/icons/layout.gif) | ვიზის შუამდგომლობა.pdf | 2025-11-20 22:09 | 149K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი_ 24 ნოემბერი.docx | 2025-11-20 22:09 | 44K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი_ 24 ნოემბერი (1).docx | 2025-11-20 22:09 | 44K | |
![[IMG]](/icons/image2.gif) | image002 (142).jpg | 2025-11-20 22:09 | 42K | |
![[IMG]](/icons/image2.gif) | image002 (141).jpg | 2025-11-20 22:09 | 42K | |
![[IMG]](/icons/image2.gif) | image001 (239).png | 2025-11-20 22:09 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (238).png | 2025-11-20 22:09 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (237).png | 2025-11-20 22:09 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (236).png | 2025-11-20 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | XX GEO_BF 2017-11-21 CV Zsuzsanna Jakab.docx | 2025-11-20 22:09 | 41K | |
![[ ]](/icons/unknown.gif) | XX GEO_BF 2017-11-21 CV Zsuzsanna Jakab (4).docx | 2025-11-20 22:09 | 38K | |
![[ ]](/icons/unknown.gif) | XX GEO_BF 2017-11-21 CV Zsuzsanna Jakab (3).docx | 2025-11-20 22:09 | 38K | |
![[ ]](/icons/unknown.gif) | XX GEO_BF 2017-11-21 CV Zsuzsanna Jakab (2).docx | 2025-11-20 22:09 | 38K | |
![[ ]](/icons/unknown.gif) | XX GEO_BF 2017-11-21 CV Zsuzsanna Jakab (1).docx | 2025-11-20 22:09 | 38K | |
![[ ]](/icons/layout.gif) | World Bank - Official Letter.pdf | 2025-11-20 22:09 | 133K | |
![[ ]](/icons/unknown.gif) | WHO -GEO Brief 24_11_2017.docx | 2025-11-20 22:09 | 30K | |
![[ ]](/icons/unknown.gif) | WHO -GEO Brief 24_11_2017 (3).docx | 2025-11-20 22:09 | 30K | |
![[ ]](/icons/unknown.gif) | WHO -GEO Brief 24_11_2017 (2).docx | 2025-11-20 22:09 | 30K | |
![[ ]](/icons/unknown.gif) | WHO -GEO Brief 24_11_2017 (1).docx | 2025-11-20 22:09 | 30K | |
![[ ]](/icons/unknown.gif) | UHC-NCDC -16 11 17-eng.docx | 2025-11-20 22:09 | 361K | |
![[ ]](/icons/unknown.gif) | UHC-NCDC -16 11 17-eng (1).docx | 2025-11-20 22:09 | 361K | |
![[ ]](/icons/unknown.gif) | Training Agenda (2017_11_24-26).docx | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/unknown.gif) | TP's for PM.DOCX | 2025-11-20 22:09 | 18K | |
![[ ]](/icons/layout.gif) | SCRC - 25s2e04_ProgrammeVisitGeorgia partB_170962.pdf | 2025-11-20 22:09 | 247K | |
![[ ]](/icons/layout.gif) | SCRC - 25s2e04_ProgrammeVisitGeorgia partB_170962 (3).pdf | 2025-11-20 22:09 | 247K | |
![[ ]](/icons/layout.gif) | SCRC - 25s2e04_ProgrammeVisitGeorgia partB_170962 (2).pdf | 2025-11-20 22:09 | 247K | |
![[ ]](/icons/layout.gif) | SCRC - 25s2e04_ProgrammeVisitGeorgia partB_170962 (1).pdf | 2025-11-20 22:09 | 247K | |
![[ ]](/icons/layout.gif) | SAKOVELTAO_PRINT_003.pdf | 2025-11-20 22:09 | 679K | |
![[ ]](/icons/layout.gif) | SAKOVELTAO_PRINT_002.pdf | 2025-11-20 22:09 | 900K | |
![[ ]](/icons/layout.gif) | SAKOVELTAO_PRINT_001.pdf | 2025-11-20 22:09 | 925K | |
![[ ]](/icons/unknown.gif) | MoU_Ukraine_GEO_24_11_2017_UkrAlt.doc | 2025-11-20 22:09 | 54K | |
![[ ]](/icons/unknown.gif) | MoU_Ukraine_GEO_24_11_2017_UkrAlt (1).doc | 2025-11-20 22:09 | 54K | |
![[ ]](/icons/unknown.gif) | MoU_Ukraine_GEO_24_11_2017_GeoAlt.doc | 2025-11-20 22:09 | 53K | |
![[ ]](/icons/unknown.gif) | MoU_Ukraine_GEO_24_11_2017_GeoAlt (1).doc | 2025-11-20 22:09 | 53K | |
![[ ]](/icons/unknown.gif) | MoU_Ukraine_ENG _24_07_2017_GeoAlt.doc | 2025-11-20 22:09 | 37K | |
![[ ]](/icons/unknown.gif) | MoU_Ukraine_ENG _24_07_2017_GeoAlt (1).doc | 2025-11-20 22:09 | 37K | |
![[ ]](/icons/unknown.gif) | Minister's speech WHO Georgia Session 28 11 2017.docx | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/unknown.gif) | Minister's speech WHO Georgia Session 28 11 2017 (1).docx | 2025-11-20 22:09 | 25K | |
![[ ]](/icons/layout.gif) | Letter to Nordic Casemix Center.pdf | 2025-11-20 22:09 | 203K | |
![[ ]](/icons/layout.gif) | Letter to Nordic Casemix Center (1).pdf | 2025-11-20 22:09 | 203K | |
![[ ]](/icons/layout.gif) | GEORGIA MNH Brief_PRINT_002.pdf | 2025-11-20 22:09 | 835K | |
![[ ]](/icons/layout.gif) | GEORGIA MNH Brief_PRINT_002 (1).pdf | 2025-11-20 22:09 | 835K | |
![[ ]](/icons/layout.gif) | GEORGIA MNH Brief_PRINT_001.pdf | 2025-11-20 22:09 | 827K | |
![[ ]](/icons/unknown.gif) | Conference draft agenda - 22November (3).docx | 2025-11-20 22:09 | 682K | |
![[ ]](/icons/unknown.gif) | Conference draft agenda - 22November (2).docx | 2025-11-20 22:09 | 682K | |
![[TXT]](/icons/text.gif) | ATT00006 (16).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00006 (15).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005 (21).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005 (20).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (19).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (18).htm | 2025-11-20 22:09 | 168 | |
![[TXT]](/icons/text.gif) | ATT00004 (27).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (26).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (25).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (24).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (38).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (37).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (36).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (35).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (60).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (59).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (58).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (57).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (78).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (77).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (76).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (75).htm | 2025-11-20 22:09 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (6).txt | 2025-11-20 22:09 | 23 | |
![[TXT]](/icons/text.gif) | ATT00001 (5).txt | 2025-11-20 22:09 | 23 | |
![[ ]](/icons/layout.gif) | 12345.pdf | 2025-11-20 22:09 | 192K | |
![[IMG]](/icons/image2.gif) | 1234.djvu | 2025-11-20 22:09 | 83K | |
![[ ]](/icons/unknown.gif) | 25s2eDIV1_ListOfParticipants_new.docx | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/unknown.gif) | 25s2eDIV1_ListOfParticipants_new (3).docx | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/unknown.gif) | 25s2eDIV1_ListOfParticipants_new (2).docx | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/unknown.gif) | 25s2eDIV1_ListOfParticipants_new (1).docx | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/layout.gif) | 25s2e03_ProgrammeVisitGeorgia partA_170938.pdf | 2025-11-20 22:09 | 177K | |
![[ ]](/icons/layout.gif) | 25s2e03_ProgrammeVisitGeorgia partA_170938 (3).pdf | 2025-11-20 22:09 | 177K | |
![[ ]](/icons/layout.gif) | 25s2e03_ProgrammeVisitGeorgia partA_170938 (2).pdf | 2025-11-20 22:09 | 177K | |
![[ ]](/icons/layout.gif) | 25s2e03_ProgrammeVisitGeorgia partA_170938 (1).pdf | 2025-11-20 22:09 | 177K | |
![[ ]](/icons/unknown.gif) | შინაგანაწესის ბრძანების პროექტი (სამუშაო ვერსია -2).docx | 2025-11-20 22:09 | 59K | |
![[ ]](/icons/unknown.gif) | საერთაშორისო ურთ_ დეპარტამენტის ფუნქცია-მოვალ� (1) | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/unknown.gif) | საერთაშორისო ურთ_ დეპარტამენტის ფუნქცია-მოვალ� | 2025-11-20 22:09 | 39K | |
![[ ]](/icons/unknown.gif) | მემორანდუმის პროექტი - ჯანდაცვა - შსს - 2.doc | 2025-11-20 22:09 | 47K | |
![[ ]](/icons/unknown.gif) | მემორანდუმის პროექტი - ჯანდაცვა - შსს -1.doc | 2025-11-20 22:09 | 47K | |
![[ ]](/icons/unknown.gif) | sopo.PDF | 2025-11-20 22:08 | 788K | |
![[ ]](/icons/unknown.gif) | sopo (1).PDF | 2025-11-20 22:08 | 788K | |
![[ ]](/icons/layout.gif) | letter from MoLHSA.pdf | 2025-11-20 22:08 | 191K | |
![[IMG]](/icons/image2.gif) | image005 (14).png | 2025-11-20 22:08 | 1.5K | |
![[IMG]](/icons/image2.gif) | image004 (24).png | 2025-11-20 22:08 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (83).jpg | 2025-11-20 22:08 | 42K | |
![[IMG]](/icons/image2.gif) | image003 (38).png | 2025-11-20 22:08 | 1.6K | |
![[IMG]](/icons/image2.gif) | image002 (60).png | 2025-11-20 22:08 | 5.5K | |
![[IMG]](/icons/image2.gif) | image002 (59).png | 2025-11-20 22:08 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (383).jpg | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (382).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (235).png | 2025-11-20 22:08 | 6.7K | |
![[IMG]](/icons/image2.gif) | image001 (234).png | 2025-11-20 22:08 | 6.7K | |
![[IMG]](/icons/image2.gif) | image001 (233).png | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | TAG Meetingparticipants_MOLHSA_SSA.docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania (4).pdf | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania (3).pdf | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania (2).pdf | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | OGP Action Plan self assessment mid term Report_ENG (2).DOCX | 2025-11-20 22:08 | 154K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze.pdf | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze (2).pdf | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze (1).pdf | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/unknown.gif) | List.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | List (1).docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/layout.gif) | Letter from WHO.pdf | 2025-11-20 22:08 | 109K | |
![[ ]](/icons/unknown.gif) | Conference draft agenda - 22November.docx | 2025-11-20 22:08 | 682K | |
![[ ]](/icons/unknown.gif) | Conference draft agenda - 22November (1).docx | 2025-11-20 22:08 | 682K | |
![[ ]](/icons/layout.gif) | Ana Kasradze.pdf | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/layout.gif) | Ana Kasradze (2).pdf | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/layout.gif) | Ana Kasradze (1).pdf | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/layout.gif) | Amiran Gamkrelidze.pdf | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/layout.gif) | Amiran Gamkrelidze (2).pdf | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/layout.gif) | Amiran Gamkrelidze (1).pdf | 2025-11-20 22:08 | 29K | |
![[TXT]](/icons/text.gif) | ATT00001 (4).txt | 2025-11-20 22:08 | 23 | |
![[TXT]](/icons/text.gif) | ATT00001 (3).txt | 2025-11-20 22:08 | 23 | |
![[ ]](/icons/layout.gif) | 11 December_Conference.pdf | 2025-11-20 22:08 | 219K | |
![[ ]](/icons/layout.gif) | 4-5 December_Conference.pdf | 2025-11-20 22:08 | 1.7M | |
![[ ]](/icons/unknown.gif) | 3rd Hepatitis C Technical Advisory Group Agenda - FINAL.DOCX | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | 3rd Hepatitis C Technical Advisory Group Agenda - FINAL (1).DOCX | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | შეფასების შუალედური ანგარიში_OGP სამოქმედო გეგმა 16-17 (2).docx | 2025-11-20 22:08 | 189K | |
![[ ]](/icons/unknown.gif) | შემოკლებული პაქტი 30_11_17.docx | 2025-11-20 22:08 | 59K | |
![[ ]](/icons/unknown.gif) | შემოკლებული პაქტი 30_11_17 (2).docx | 2025-11-20 22:08 | 59K | |
![[ ]](/icons/unknown.gif) | შემოკლებული პაქტი 30_11_17 (1).docx | 2025-11-20 22:08 | 59K | |
![[ ]](/icons/layout.gif) | ს_ბელქანიას სამახსოვრო.pdf | 2025-11-20 22:08 | 402K | |
![[ ]](/icons/layout.gif) | ს_ბელქანიას სამახსოვრო (1).pdf | 2025-11-20 22:08 | 402K | |
![[ ]](/icons/layout.gif) | სოფო ბელქანია_ID.pdf | 2025-11-20 22:08 | 228K | |
![[ ]](/icons/unknown.gif) | სომხეთი (3).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | სომხეთი (2).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/layout.gif) | სამსახურებრივი პასპორტის თაობაზე.pdf | 2025-11-20 22:08 | 170K | |
![[ ]](/icons/unknown.gif) | დანართი N 5.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | დანართი N 5 (2).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | დანართი N 5 (1).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | დანართი N 4 პაქტი ინგლისური.doc | 2025-11-20 22:08 | 189K | |
![[ ]](/icons/unknown.gif) | დანართი N 4 პაქტი ინგლისური (2).doc | 2025-11-20 22:08 | 189K | |
![[ ]](/icons/unknown.gif) | დანართი N 4 პაქტი ინგლისური (1).doc | 2025-11-20 22:08 | 189K | |
![[ ]](/icons/unknown.gif) | დანართი N 3 საპენსიო.docx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | დანართი N 3 საპენსიო (2).docx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | დანართი N 3 საპენსიო (1).docx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | დანართი N 2 მიუსაფარი.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | დანართი N 2 მიუსაფარი (2).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | დანართი N 2 მიუსაფარი (1).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | დანართი N 1 ფონდი.docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | დანართი N 1 ფონდი (2).docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | დანართი N 1 ფონდი (1).docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | ანგარიშის პროექტი 2017.docx | 2025-11-20 22:08 | 193K | |
![[ ]](/icons/unknown.gif) | ანგარიშის პროექტი 2017 (1).docx | 2025-11-20 22:08 | 193K | |
![[ ]](/icons/unknown.gif) | schedule_UK.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/layout.gif) | nomination letter.pdf | 2025-11-20 22:08 | 154K | |
![[IMG]](/icons/image2.gif) | image003 (82).jpg | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (381).jpg | 2025-11-20 22:08 | 4.9K | |
![[IMG]](/icons/image2.gif) | image001 (380).jpg | 2025-11-20 22:08 | 4.9K | |
![[IMG]](/icons/image2.gif) | image001 (379).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (232).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (231).png | 2025-11-20 22:08 | 38K | |
![[ ]](/icons/layout.gif) | Training Timetable.pdf | 2025-11-20 22:08 | 218K | |
![[ ]](/icons/layout.gif) | Training Timetable (1).pdf | 2025-11-20 22:08 | 218K | |
![[ ]](/icons/unknown.gif) | TOR_GEO_TA_Inspection (3).doc | 2025-11-20 22:08 | 37K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania_passport (2).pdf | 2025-11-20 22:08 | 561K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania_US visa (2).pdf | 2025-11-20 22:08 | 544K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania_US visa (1).pdf | 2025-11-20 22:08 | 544K | |
![[ ]](/icons/unknown.gif) | OGP Action Plan self assessment mid term Report_ENG (1).DOCX | 2025-11-20 22:08 | 154K | |
![[ ]](/icons/layout.gif) | MarinaDarakhvelidze_passport (2).pdf | 2025-11-20 22:08 | 610K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze_US visa (2).pdf | 2025-11-20 22:08 | 550K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze_US visa (1).pdf | 2025-11-20 22:08 | 550K | |
![[ ]](/icons/layout.gif) | Letter - CBS+profile+projects - GEO20171127.pdf | 2025-11-20 22:08 | 68K | |
![[ ]](/icons/layout.gif) | Letter - CBS+profile+projects - GEO 20171127.pdf | 2025-11-20 22:08 | 68K | |
![[ ]](/icons/layout.gif) | Letter - CBS+profile+projects - GEO 20171127.pdf | 2025-11-20 22:08 | 68K | |
![[ ]](/icons/unknown.gif) | GMP.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | GMP (1).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | GF-21045E (6_0)_ReconciliationReport Form_Georgia_November.docx | 2025-11-20 22:08 | 73K | |
![[ ]](/icons/unknown.gif) | GF-21045E (6_0)_ReconciliationReport Form_Georgia_November (1).docx | 2025-11-20 22:08 | 73K | |
![[ ]](/icons/unknown.gif) | GF-21045E (6_0)_ReconciliationReport Form_Armenia_November.docx | 2025-11-20 22:08 | 74K | |
![[ ]](/icons/unknown.gif) | GF-21045E (6_0)_ReconciliationReport Form_Armenia_November (1).docx | 2025-11-20 22:08 | 74K | |
![[ ]](/icons/layout.gif) | GEO -Nomination Letter.pdf | 2025-11-20 22:08 | 87K | |
![[ ]](/icons/layout.gif) | GEO -Nomination Letter (1).pdf | 2025-11-20 22:08 | 87K | |
![[ ]](/icons/layout.gif) | ENG - Scope and Purpose - IHR meeting.pdf | 2025-11-20 22:08 | 271K | |
![[ ]](/icons/layout.gif) | ENG - Scope and Purpose - IHR meeting (1).pdf | 2025-11-20 22:08 | 271K | |
![[ ]](/icons/layout.gif) | CV_Tadaharu UEHARA.pdf | 2025-11-20 22:08 | 37K | |
![[ ]](/icons/layout.gif) | CV_Tadaharu UEHARA (1).pdf | 2025-11-20 22:08 | 37K | |
![[TXT]](/icons/text.gif) | ATT00001 (74).htm | 2025-11-20 22:08 | 1.9K | |
![[TXT]](/icons/text.gif) | ATT00001 (73).htm | 2025-11-20 22:08 | 1.9K | |
![[TXT]](/icons/text.gif) | ATT00001 (72).htm | 2025-11-20 22:08 | 1.9K | |
![[TXT]](/icons/text.gif) | ATT00001 (71).htm | 2025-11-20 22:08 | 1.9K | |
![[TXT]](/icons/text.gif) | ATT00001 (70).htm | 2025-11-20 22:08 | 260 | |
![[TXT]](/icons/text.gif) | ATT00001 (69).htm | 2025-11-20 22:08 | 260 | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda v5.docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda v5 (3).docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda v5 (2).docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda v5 (1).docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_USEdits.docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits.docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits (5).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits (4).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits (3).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits (2).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_USEdits (1).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits (1).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/layout.gif) | 3-1-9_737-526.pdf | 2025-11-20 22:08 | 130K | |
![[ ]](/icons/layout.gif) | 3-1-9_737-526 (1).pdf | 2025-11-20 22:08 | 130K | |
![[ ]](/icons/unknown.gif) | შეფასების შუალედური ანგარიში_OGP სამოქმედო გეგმა 16-17 (1).docx | 2025-11-20 22:08 | 189K | |
![[ ]](/icons/unknown.gif) | საარსებო მინიმუმი წლების მიხედვით.xls | 2025-11-20 22:08 | 57K | |
![[ ]](/icons/unknown.gif) | საარსებო მინიმუმი წლების მიხედვით (1).xls | 2025-11-20 22:08 | 57K | |
![[ ]](/icons/unknown.gif) | პაქტი ჩვენი (2).docx | 2025-11-20 22:08 | 148K | |
![[ ]](/icons/unknown.gif) | პაქტი ჩვენი (1).docx | 2025-11-20 22:08 | 148K | |
![[ ]](/icons/unknown.gif) | დასაქმების მიზნით გატარებული ღონისძიებები (მე-6 მუხლი).docx | 2025-11-20 22:08 | 36K | |
![[ ]](/icons/unknown.gif) | დასაქმების მიზნით გატარებული ღონისძიებები (მე-6 მუხლი) (1).docx | 2025-11-20 22:08 | 36K | |
![[ ]](/icons/unknown.gif) | განცხადება მინისტრის მოადგილეების.doc | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/unknown.gif) | განცხადება მინისტრის მოადგილეების (2).doc | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | განცხადება მინისტრის მოადგილეების (1).doc | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | ანგარიშის პროექტი 2017-5_12_17.docx | 2025-11-20 22:08 | 273K | |
![[ ]](/icons/unknown.gif) | patkti danari.xlsx | 2025-11-20 22:08 | 16K | |
![[TXT]](/icons/text.gif) | moxsenebiti USA.htm | 2025-11-20 22:08 | 29K | |
![[IMG]](/icons/image2.gif) | image006 (12).jpg | 2025-11-20 22:08 | 3.3K | |
![[IMG]](/icons/image2.gif) | image006 (11).jpg | 2025-11-20 22:08 | 3.3K | |
![[IMG]](/icons/image2.gif) | image005 (2).gif | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image005 (1).gif | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image004 (3).gif | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image004 (2).gif | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (8).gif | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (7).gif | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (140).jpg | 2025-11-20 22:08 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (139).jpg | 2025-11-20 22:08 | 19K | |
![[IMG]](/icons/image2.gif) | image002 (138).jpg | 2025-11-20 22:08 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (378).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (377).jpg | 2025-11-20 22:08 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (376).jpg | 2025-11-20 22:08 | 5.5K | |
![[IMG]](/icons/image2.gif) | image001 (230).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (229).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (228).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (227).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (226).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (225).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | WHO document for LBW.djvu | 2025-11-20 22:08 | 246K | |
![[ ]](/icons/unknown.gif) | WHO Mission GEO2017-12_updated.docx | 2025-11-20 22:08 | 97K | |
![[ ]](/icons/unknown.gif) | WHO Mission GEO 2017-12.docx | 2025-11-20 22:08 | 96K | |
![[ ]](/icons/unknown.gif) | WHO Mission GEO 2017-12 (1).docx | 2025-11-20 22:08 | 96K | |
![[ ]](/icons/unknown.gif) | Untitled | 2025-11-20 22:08 | 0 | |
![[ ]](/icons/layout.gif) | Sofiko Belkania_passport (1).pdf | 2025-11-20 22:08 | 561K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania_US visa.pdf | 2025-11-20 22:08 | 544K | |
![[ ]](/icons/unknown.gif) | OGP Action Plan self assessment mid term Report_ENG.DOCX | 2025-11-20 22:08 | 154K | |
![[ ]](/icons/unknown.gif) | Mission on strategic purchasing and patient pathways, 11-13 December 2017_.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | Mission on strategic purchasingand patient pathways, 11-13 December 2017_ (3).docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | Mission on strategic purchasingand patient pathways, 11-13 December 2017_ (2).docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/layout.gif) | MarinaDarakhvelidze_passport (1).pdf | 2025-11-20 22:08 | 610K | |
![[ ]](/icons/layout.gif) | Marina Darakhvelidze_US visa.pdf | 2025-11-20 22:08 | 550K | |
![[ ]](/icons/unknown.gif) | Letter.docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | Letter (1).docx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/unknown.gif) | Disability Policy Dialogue.docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | Decentralization Meeting Draft Agenda plus Attendees Draft for 8 Decmber 2017.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | Decentralization Meeting Draft Agenda plus Attendees Draft for 8 Decmber 2017 (1).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | Decentralization.xlsx | 2025-11-20 22:08 | 11K | |
![[ ]](/icons/unknown.gif) | Decentralization (1).xlsx | 2025-11-20 22:08 | 11K | |
![[ ]](/icons/layout.gif) | Awex Mission to Georgia 2017.pdf | 2025-11-20 22:08 | 950K | |
![[ ]](/icons/layout.gif) | Awex Mission to Georgia 2017 (1).pdf | 2025-11-20 22:08 | 950K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits+Geo comments v7.docx | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_USEdits+Geo comments v7 (4).docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits+Geo comments v7 (3).docx | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits+Geo comments v7 (2).docx | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda as of Dec 4_US Edits+Geo comments v7 (1).docx | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | 2017-12-05 - International UHCDay - FINAL TEXT.doc | 2025-11-20 22:08 | 60K | |
![[ ]](/icons/unknown.gif) | 2017-12-05 - GHFP annualresolution - FINAL TEXT.docx | 2025-11-20 22:08 | 45K | |
![[IMG]](/icons/image2.gif) | 2 (19).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (18).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (17).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (16).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (15).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (14).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (19).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (18).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (17).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (16).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (15).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (14).jpg | 2025-11-20 22:08 | 3.2K | |
![[ ]](/icons/unknown.gif) | შეხვედრა მინისტრთან - 6 დეკემბერი 17 00.msg | 2025-11-20 22:08 | 55K | |
![[ ]](/icons/unknown.gif) | შეფასების შუალედური ანგარიში_OGP სამოქმედო გეგმა 16-17.docx | 2025-11-20 22:08 | 189K | |
![[IMG]](/icons/image2.gif) | მოსაწვევი.jpg | 2025-11-20 22:08 | 165K | |
![[IMG]](/icons/image2.gif) | მოსაწვევი-Ge.jpg | 2025-11-20 22:08 | 161K | |
![[ ]](/icons/layout.gif) | მონაწილეთა სია.pdf | 2025-11-20 22:08 | 249K | |
![[ ]](/icons/unknown.gif) | მინისტრის პრეზენტაცია.pptx | 2025-11-20 22:08 | 98K | |
![[ ]](/icons/unknown.gif) | დამატებითი ინფორმაცია.pptx | 2025-11-20 22:08 | 181K | |
![[ ]](/icons/unknown.gif) | tobacco smoke free councl recommendation.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | tobacco recommendation 2 -template filled in.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | tobacco products directive - template filled in.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | tobacco TAPS directive - template filled in.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | list UNDP.XLSX | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/layout.gif) | inv 3-1637.pdf | 2025-11-20 22:08 | 69K | |
![[IMG]](/icons/image2.gif) | image004 (23).png | 2025-11-20 22:08 | 16K | |
![[IMG]](/icons/image2.gif) | image004 (22).png | 2025-11-20 22:08 | 7.2K | |
![[ ]](/icons/unknown.gif) | image003.emz | 2025-11-20 22:08 | 5.7K | |
![[IMG]](/icons/image2.gif) | image003 (81).jpg | 2025-11-20 22:08 | 3.0K | |
![[IMG]](/icons/image2.gif) | image002 (137).jpg | 2025-11-20 22:08 | 2.7K | |
![[IMG]](/icons/image2.gif) | image002 (58).png | 2025-11-20 22:08 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (375).jpg | 2025-11-20 22:08 | 4.0K | |
![[IMG]](/icons/image2.gif) | image001 (374).jpg | 2025-11-20 22:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (224).png | 2025-11-20 22:08 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (223).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (222).png | 2025-11-20 22:08 | 19K | |
![[IMG]](/icons/image2.gif) | image001 (221).png | 2025-11-20 22:08 | 1.4K | |
![[IMG]](/icons/image2.gif) | image001 (220).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (219).png | 2025-11-20 22:08 | 38K | |
![[ ]](/icons/unknown.gif) | gadamdebi 3 (2).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | gadamdebi 2 (2).docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | gadamdebi 2 (1).docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | gadamdebi 1 (2).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | gadamdebi 1 (1).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | gadamdebi (2).docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | gadamdebi (1).docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | directive 1978 - 79 (3).docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania_passport.pdf | 2025-11-20 22:08 | 561K | |
![[ ]](/icons/layout.gif) | Scope and Purpose Mayors Summit ENG.pdf | 2025-11-20 22:08 | 207K | |
![[ ]](/icons/unknown.gif) | Safe Blood 2 (1).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | Safe Blood 1 (1).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | Safe Blood (1).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | P2P-new 12_12_2017.docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | P2P-new.docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/layout.gif) | Mayors Summit programme FOR CIRCULATION _ENG_.pdf | 2025-11-20 22:08 | 483K | |
![[ ]](/icons/layout.gif) | MarinaDarakhvelidze_passport.pdf | 2025-11-20 22:08 | 610K | |
![[ ]](/icons/layout.gif) | Invitation Mayor of Tbilisi.pdf | 2025-11-20 22:08 | 231K | |
![[ ]](/icons/layout.gif) | DARAKHVELIDZE (1).pdf | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | Copenhagen consensus Mayor Summit ENG.docx | 2025-11-20 22:08 | 48K | |
![[ ]](/icons/layout.gif) | BELKANIA.pdf | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | AA_GE template emty (1).docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | AA_GE LABOUR.docx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | AA_GE LABOUR (1).docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | 20171127_GE34_Partnership agreement MoLHSA CCR_annex 1.xls | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/unknown.gif) | 20171127_Annex 2 to Partnership agreement_visibility manual CzDA.PDF | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | 2017 P2P Agenda final 11_12_2017.docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 2 corrected2017_12_08__GE34_Partnership agreement CCRG-MoLHSA (3).docx | 2025-11-20 22:08 | 824K | |
![[IMG]](/icons/image2.gif) | 2 (13).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (13).jpg | 2025-11-20 22:08 | 3.2K | |
![[ ]](/icons/unknown.gif) | ჯანდაცვა.docx | 2025-11-20 22:08 | 224K | |
![[ ]](/icons/unknown.gif) | შრომისა_2017.docx | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | უწყებებში გასაგზავნი ნუსხა.docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | რელიზი ორბელიანის გახსნა.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | ახალგაზრდული საბოლოო.xlsx | 2025-11-20 22:08 | 88K | |
![[ ]](/icons/unknown.gif) | ანგარიშები_დეპარტამენტი.doc | 2025-11-20 22:08 | 39K | |
![[ ]](/icons/layout.gif) | samoqmedo_gegma_.pdf | 2025-11-20 22:08 | 702K | |
![[ ]](/icons/unknown.gif) | quality control strategypresentation.pptx | 2025-11-20 22:08 | 420K | |
![[ ]](/icons/unknown.gif) | nutsi_2012-2016 Progress Report (Final clean version)_ჩასწორებული_1.docx | 2025-11-20 22:08 | 156K | |
![[ ]](/icons/unknown.gif) | nutsi_2012-2016 Progress Report (Final clean version)_ჩასწორებული_1 (1).docx | 2025-11-20 22:08 | 194K | |
![[ ]](/icons/layout.gif) | letter of nomination_Georgia.pdf | 2025-11-20 22:08 | 136K | |
![[ ]](/icons/unknown.gif) | jandacva.docx | 2025-11-20 22:08 | 36K | |
![[ ]](/icons/unknown.gif) | jandacva (1).docx | 2025-11-20 22:08 | 36K | |
![[IMG]](/icons/image2.gif) | image003 (80).jpg | 2025-11-20 22:08 | 50K | |
![[IMG]](/icons/image2.gif) | image001 (373).jpg | 2025-11-20 22:08 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (372).jpg | 2025-11-20 22:08 | 4.5K | |
![[IMG]](/icons/image2.gif) | image001 (218).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (217).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (216).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (215).png | 2025-11-20 22:08 | 82K | |
![[IMG]](/icons/image2.gif) | image001 (214).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (213).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (212).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (211).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (210).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (209).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (208).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | dear gregg.jpg | 2025-11-20 22:08 | 665K | |
![[IMG]](/icons/image2.gif) | dear graeme.jpg | 2025-11-20 22:08 | 666K | |
![[IMG]](/icons/image2.gif) | dear francisco.jpg | 2025-11-20 22:08 | 667K | |
![[IMG]](/icons/image2.gif) | dear John.jpg | 2025-11-20 22:08 | 664K | |
![[ ]](/icons/unknown.gif) | SCRC meeting health system-27_11_17.pptx | 2025-11-20 22:08 | 4.9M | |
![[ ]](/icons/unknown.gif) | Nomination_Form_WHO_High_Level_meeting_April_16-18-2018_Georgia.docx | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/layout.gif) | MoU (1).pdf | 2025-11-20 22:08 | 106K | |
![[ ]](/icons/layout.gif) | LBW_response from MoLHSA.pdf | 2025-11-20 22:08 | 153K | |
![[ ]](/icons/unknown.gif) | GEO_DRG_implementation_plan_draft_ revised_15122017.docx | 2025-11-20 22:08 | 34K | |
![[TXT]](/icons/text.gif) | ATT00001 (68).htm | 2025-11-20 22:08 | 168 | |
![[ ]](/icons/layout.gif) | AFD - Aide Mémoire DPO 2 - pension reform.pdf | 2025-11-20 22:08 | 316K | |
![[ ]](/icons/layout.gif) | 2018 წლის სამოქმედო გეგმა.pdf | 2025-11-20 22:08 | 83K | |
![[ ]](/icons/layout.gif) | 2017TBIGA79 - CGE 1008 D_Sergeenko - Aide Mémoire.pdf | 2025-11-20 22:08 | 414K | |
![[ ]](/icons/layout.gif) | 2017 ციხელაშვილს გეგმა.pdf | 2025-11-20 22:08 | 66K | |
![[ ]](/icons/unknown.gif) | 2012-2017 Progress Report.docx | 2025-11-20 22:08 | 197K | |
![[ ]](/icons/unknown.gif) | 2012-2016 Progress Report labour changes.docx | 2025-11-20 22:08 | 203K | |
![[ ]](/icons/unknown.gif) | 2012-2016 Progress Report (Final clean version).docx | 2025-11-20 22:08 | 158K | |
![[ ]](/icons/unknown.gif) | 4_ ბრძანებ_ აპარატ_.docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | 3_ ბრძა_დებ_ადა_რეს_და საერთ_.docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | 2_ დადგ_აპარა_.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | 1_ დად_ადა_რესუ_და საერთ_.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/layout.gif) | ფინანსთა სამინისტროს წერილი.pdf | 2025-11-20 22:08 | 719K | |
![[ ]](/icons/layout.gif) | სოფლის შენიშვნებზე.pdf | 2025-11-20 22:08 | 197K | |
![[ ]](/icons/layout.gif) | საკოორდინაციო საბჭო.pdf | 2025-11-20 22:08 | 264K | |
![[ ]](/icons/unknown.gif) | საელჩოების და საერთაშორისოების მისამართები_12_12_2017.doc | 2025-11-20 22:08 | 79K | |
![[ ]](/icons/unknown.gif) | პრესრელიზი (2).docx | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | პაქტი ჩვენი.docx | 2025-11-20 22:08 | 150K | |
![[TXT]](/icons/text.gif) | მოხსენებითი ლომიძეს.html | 2025-11-20 22:08 | 52K | |
![[ ]](/icons/unknown.gif) | მისალოცი ტექსტი შობით და შობის გარეშე_12_12_2017.docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | მინის_ ბრძანე 01-1ნ ცვლილება 18_12_2017.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | მინის_ ბრძანე 01-1ნ ცვლილება.docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | მთავრ_დადგე_ცვლი 249.docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/layout.gif) | მთავრობის განხილვის გრაფიკი 2.pdf | 2025-11-20 22:08 | 56K | |
![[ ]](/icons/unknown.gif) | გაერთ_ ძველი და ახალი_კომენტარებით.docx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | გაერთ_ ძველი და ახალი.docx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | ანგარიში_patient pathway_GMP Mission.docx | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | info chinetis fsikiatriulze.docx | 2025-11-20 22:08 | 14K | |
![[IMG]](/icons/image2.gif) | image009 (2).jpg | 2025-11-20 22:08 | 7.5K | |
![[IMG]](/icons/image2.gif) | image008 (5).png | 2025-11-20 22:08 | 22K | |
![[IMG]](/icons/image2.gif) | image005 (13).png | 2025-11-20 22:08 | 1.2K | |
![[IMG]](/icons/image2.gif) | image004 (21).png | 2025-11-20 22:08 | 1.8K | |
![[IMG]](/icons/image2.gif) | image003 (37).png | 2025-11-20 22:08 | 1.6K | |
![[IMG]](/icons/image2.gif) | image002 (136).jpg | 2025-11-20 22:08 | 7.0K | |
![[IMG]](/icons/image2.gif) | image001 (371).jpg | 2025-11-20 22:08 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (207).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (206).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (205).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (204).png | 2025-11-20 22:08 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (203).png | 2025-11-20 22:08 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (22).gif | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | hospitals data_2013.xlsx | 2025-11-20 22:08 | 41K | |
![[ ]](/icons/unknown.gif) | WHO national counterpart + FP's.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | SCRC meeting health system Nino Berdzuli.pptx | 2025-11-20 22:08 | 4.0M | |
![[ ]](/icons/unknown.gif) | PGG-REG TP 6_2017 Corruption RAHealth Sector _Georgia_EN_CLEAN_20_11_2017.docx | 2025-11-20 22:08 | 191K | |
![[ ]](/icons/layout.gif) | MoU.pdf | 2025-11-20 22:08 | 584K | |
![[ ]](/icons/layout.gif) | MRDI Self-Assessment Report for SPSP II Installment 3_F.pdf | 2025-11-20 22:08 | 1.0M | |
![[ ]](/icons/layout.gif) | MOU აუთენტური.pdf | 2025-11-20 22:08 | 399K | |
![[ ]](/icons/unknown.gif) | GEO National Experts WHO 2017-10.doc | 2025-11-20 22:08 | 68K | |
![[ ]](/icons/unknown.gif) | Compliance Statement.docx | 2025-11-20 22:08 | 46K | |
![[ ]](/icons/layout.gif) | BCA_WHO.pdf | 2025-11-20 22:08 | 9.2M | |
![[ ]](/icons/unknown.gif) | Approximation timetable.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | Annex to draft Council decisionGE_TBT_PP annex update 10102017.doc | 2025-11-20 22:08 | 190K | |
![[ ]](/icons/unknown.gif) | AA Labour changes.xlsx | 2025-11-20 22:08 | 82K | |
![[ ]](/icons/unknown.gif) | AA 2018 გეგმა.xls | 2025-11-20 22:08 | 93K | |
![[ ]](/icons/unknown.gif) | 2018სამოქმედო-თანასწორობა-edited-NCDC.docx | 2025-11-20 22:08 | 37K | |
![[ ]](/icons/layout.gif) | 14-5_5819.pdf | 2025-11-20 22:08 | 699K | |
![[ ]](/icons/layout.gif) | 14-5_5819 (1).pdf | 2025-11-20 22:08 | 699K | |
![[IMG]](/icons/image2.gif) | ხაბალოვა.djvu | 2025-11-20 22:08 | 228K | |
![[IMG]](/icons/image2.gif) | ხაბალოვა (1).djvu | 2025-11-20 22:08 | 228K | |
![[ ]](/icons/unknown.gif) | ცხრილი №2-2017 წელს დაშვებული (დარეგისტრირებული) პრეპარატების ნუსხა.xlsx | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/unknown.gif) | ცხრილი №1-ბაზარზე დაშვების უფლების მქონე პრეპარატების საერთო ნუსხა.xlsx | 2025-11-20 22:08 | 85K | |
![[IMG]](/icons/image2.gif) | ქუთათელაძე.djvu | 2025-11-20 22:08 | 210K | |
![[IMG]](/icons/image2.gif) | ქუთათელაძე (1).djvu | 2025-11-20 22:08 | 210K | |
![[ ]](/icons/unknown.gif) | ტელეფონები 26_12_2017.xlsx | 2025-11-20 22:08 | 50K | |
![[ ]](/icons/unknown.gif) | სამინისტროს ანგარიშის სამუშაო დოკუმენტი (ბოლო ვერსია).docx | 2025-11-20 22:08 | 958K | |
![[ ]](/icons/layout.gif) | სამინისტროებს.pdf | 2025-11-20 22:08 | 152K | |
![[ ]](/icons/layout.gif) | სააგენტოებს.pdf | 2025-11-20 22:08 | 153K | |
![[ ]](/icons/layout.gif) | ნიკუაშვილი.pdf | 2025-11-20 22:08 | 1.6M | |
![[ ]](/icons/layout.gif) | ნიკუაშვილი (1).pdf | 2025-11-20 22:08 | 1.6M | |
![[ ]](/icons/unknown.gif) | მე-3 სხდომის ოქმის შესრულება.docx | 2025-11-20 22:08 | 32K | |
![[IMG]](/icons/image2.gif) | ლიაძე.djvu | 2025-11-20 22:08 | 49K | |
![[IMG]](/icons/image2.gif) | ლიაძე (1).djvu | 2025-11-20 22:08 | 49K | |
![[ ]](/icons/layout.gif) | კალატოზიშვილი.pdf | 2025-11-20 22:08 | 287K | |
![[ ]](/icons/layout.gif) | კალატოზიშვილი (1).pdf | 2025-11-20 22:08 | 287K | |
![[ ]](/icons/unknown.gif) | დეპარტამენტის პასუხი.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/layout.gif) | დეპარტამენტებს.pdf | 2025-11-20 22:08 | 94K | |
![[ ]](/icons/unknown.gif) | Проект протокола 4 МПК для грузинской стороны.doc | 2025-11-20 22:08 | 93K | |
![[ ]](/icons/unknown.gif) | О приглашении в Республику Белорусь (2).docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | questions to be clarified.docx | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image005 (12).png | 2025-11-20 22:08 | 8.4K | |
![[IMG]](/icons/image2.gif) | image004 (17).jpg | 2025-11-20 22:08 | 26K | |
![[IMG]](/icons/image2.gif) | image004 (16).jpg | 2025-11-20 22:08 | 26K | |
![[IMG]](/icons/image2.gif) | image002 (135).jpg | 2025-11-20 22:08 | 7.1K | |
![[IMG]](/icons/image2.gif) | image002 (134).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (370).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (369).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (368).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (202).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (201).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (200).png | 2025-11-20 22:08 | 8.4K | |
![[IMG]](/icons/image2.gif) | image001 (199).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (198).png | 2025-11-20 22:08 | 8.4K | |
![[IMG]](/icons/image2.gif) | image001 (197).png | 2025-11-20 22:08 | 9.2K | |
![[ ]](/icons/unknown.gif) | annex_MOU_GE.DOCX | 2025-11-20 22:08 | 477K | |
![[ ]](/icons/unknown.gif) | annex_MOU_EN.DOCX | 2025-11-20 22:08 | 71K | |
![[ ]](/icons/unknown.gif) | USI-success story.docx | 2025-11-20 22:08 | 168K | |
![[ ]](/icons/layout.gif) | UHC Financing Forum 2018 - Concept Note 11DEC2017.pdf | 2025-11-20 22:08 | 693K | |
![[ ]](/icons/unknown.gif) | UHC Financing Forum 2018 - Call for breakout session proposals.docx | 2025-11-20 22:08 | 87K | |
![[ ]](/icons/unknown.gif) | UHC-WORD.docx | 2025-11-20 22:08 | 265K | |
![[ ]](/icons/layout.gif) | Trip on 21 Jan 18 - PNR ref X15ZQG.pdf | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/layout.gif) | Trip on 21 Jan 18 - PNR ref X15ZQG (2).pdf | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/layout.gif) | Trip on 21 Jan 18 - PNR ref X15ZQG (1).pdf | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/unknown.gif) | Tobacco.docx | 2025-11-20 22:08 | 301K | |
![[ ]](/icons/unknown.gif) | The Global Fund Programs in Georgia_final.docx | 2025-11-20 22:08 | 718K | |
![[ ]](/icons/unknown.gif) | TB.docx | 2025-11-20 22:08 | 4.8M | |
![[ ]](/icons/unknown.gif) | Statistics.docx | 2025-11-20 22:08 | 1.2M | |
![[ ]](/icons/unknown.gif) | STEPS.docx | 2025-11-20 22:08 | 465K | |
![[ ]](/icons/unknown.gif) | SCRC-nutritional surveillance-1 new1.docx | 2025-11-20 22:08 | 119K | |
![[ ]](/icons/unknown.gif) | Reference letter to Tamar Bortsvadze_EBSP.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | Reference letter to Tamar Bortsvadze_CSP.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | Ramada_Encore_Presentation_Format 1.pptx | 2025-11-20 22:08 | 3.6M | |
![[ ]](/icons/unknown.gif) | Public Health.docx | 2025-11-20 22:08 | 2.1M | |
![[ ]](/icons/unknown.gif) | Pharmaceutical sector.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | NCDC State Programs.docx | 2025-11-20 22:08 | 844K | |
![[ ]](/icons/layout.gif) | Mission Georgie 21_01 -Sofiko.pdf | 2025-11-20 22:08 | 277K | |
![[ ]](/icons/layout.gif) | Mission Georgie 21_01 -Sergeenko.pdf | 2025-11-20 22:08 | 276K | |
![[ ]](/icons/layout.gif) | Mission Georgie 21_01 -Gamkrelidze.pdf | 2025-11-20 22:08 | 276K | |
![[ ]](/icons/layout.gif) | Mission Georgie 21_01 -Gamkrelidze (1).pdf | 2025-11-20 22:08 | 276K | |
![[IMG]](/icons/image2.gif) | MOH mariana mkurnali 486 (2).jpg | 2025-11-20 22:08 | 126K | |
![[ ]](/icons/unknown.gif) | Lugar Center new.docx | 2025-11-20 22:08 | 2.0M | |
![[ ]](/icons/unknown.gif) | List (1).xlsx | 2025-11-20 22:08 | 2.1M | |
![[ ]](/icons/unknown.gif) | Influenza surveillance.docx | 2025-11-20 22:08 | 391K | |
![[ ]](/icons/unknown.gif) | Immunization.docx | 2025-11-20 22:08 | 275K | |
![[ ]](/icons/unknown.gif) | IHR & GHSA.docx | 2025-11-20 22:08 | 794K | |
![[ ]](/icons/unknown.gif) | HIV epidemic brief.docx | 2025-11-20 22:08 | 650K | |
![[ ]](/icons/unknown.gif) | HCV_brief.docx | 2025-11-20 22:08 | 683K | |
![[ ]](/icons/unknown.gif) | GEORGIA MCH Brief -WORD.docx | 2025-11-20 22:08 | 280K | |
![[ ]](/icons/unknown.gif) | Environment & health.docx | 2025-11-20 22:08 | 1.2M | |
![[ ]](/icons/unknown.gif) | Diseases Under Elimination.docx | 2025-11-20 22:08 | 625K | |
![[ ]](/icons/unknown.gif) | Deputy Minister of Health of Republic of Belarus.docx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/unknown.gif) | CV büyükelçi.docx | 2025-11-20 22:08 | 24K | |
![[TXT]](/icons/text.gif) | ATT00003 (34).htm | 2025-11-20 22:08 | 522 | |
![[TXT]](/icons/text.gif) | ATT00002 (56).htm | 2025-11-20 22:08 | 666 | |
![[TXT]](/icons/text.gif) | ATT00002 (55).htm | 2025-11-20 22:08 | 179 | |
![[TXT]](/icons/text.gif) | ATT00001 (67).htm | 2025-11-20 22:08 | 4.0K | |
![[TXT]](/icons/text.gif) | ATT00001 (66).htm | 2025-11-20 22:08 | 227 | |
![[ ]](/icons/unknown.gif) | AMR.docx | 2025-11-20 22:08 | 404K | |
![[IMG]](/icons/image2.gif) | 2 (12).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (12).jpg | 2025-11-20 22:08 | 3.2K | |
![[ ]](/icons/layout.gif) | 01-Health MoHLSA - Infectiousdiseases control service.pdf | 2025-11-20 22:08 | 71K | |
![[ ]](/icons/unknown.gif) | ევროდირექტივების ჩამონათვალი.docx | 2025-11-20 22:08 | 48K | |
![[ ]](/icons/unknown.gif) | О приглашении в Республику Белорусь.docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | О приглашении в Республику Белорусь (1).docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | medical-education-final - 12 01 2018 (3).docx | 2025-11-20 22:08 | 68K | |
![[IMG]](/icons/image2.gif) | image003 (36).png | 2025-11-20 22:08 | 21K | |
![[IMG]](/icons/image2.gif) | image003 (35).png | 2025-11-20 22:08 | 21K | |
![[IMG]](/icons/image2.gif) | image002 (133).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image002 (132).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image002 (131).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image002 (130).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image002 (129).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (367).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (196).png | 2025-11-20 22:08 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (195).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (194).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (193).png | 2025-11-20 22:08 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (192).png | 2025-11-20 22:08 | 21K | |
![[ ]](/icons/layout.gif) | document-3.pdf | 2025-11-20 22:08 | 146K | |
![[ ]](/icons/layout.gif) | WHOEURO2018 Nomination CL E.pdf | 2025-11-20 22:08 | 133K | |
![[ ]](/icons/layout.gif) | WHOEURO2018 Nomination CL E (1).pdf | 2025-11-20 22:08 | 133K | |
![[ ]](/icons/layout.gif) | Trip on 23 Jan 18 - PNR refN9LQ83 (1).pdf | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/layout.gif) | Trip on 21 Jan 18 - PNR refX15ZQG-2.pdf | 2025-11-20 22:08 | 32K | |
![[IMG]](/icons/image2.gif) | Sofiko Belkania_photo.jpg | 2025-11-20 22:08 | 139K | |
![[IMG]](/icons/image2.gif) | Sofiko Belkania_photo (1).jpg | 2025-11-20 22:08 | 139K | |
![[ ]](/icons/unknown.gif) | Pharmaceutical sector inGeorgia.docx | 2025-11-20 22:08 | 64K | |
![[ ]](/icons/unknown.gif) | Pharmaceutical sector inGeorgia (1).docx | 2025-11-20 22:08 | 64K | |
![[IMG]](/icons/image2.gif) | MOH mariana mkurnali 486.jpg | 2025-11-20 22:08 | 44K | |
![[IMG]](/icons/image2.gif) | MOH mariana mkurnali 486 (1).jpg | 2025-11-20 22:08 | 44K | |
![[ ]](/icons/unknown.gif) | MCH.docx | 2025-11-20 22:08 | 62K | |
![[ ]](/icons/layout.gif) | Letter to Nordic Casemix Center1.pdf | 2025-11-20 22:08 | 236K | |
![[ ]](/icons/layout.gif) | Letter to Nordic Casemix Center1 (1).pdf | 2025-11-20 22:08 | 236K | |
![[ ]](/icons/layout.gif) | EB142-11-polio-transition-planning-who-dg-report-en-180109.pdf | 2025-11-20 22:08 | 348K | |
![[ ]](/icons/layout.gif) | EB142-11-polio-transition-planning-who-dg-report-en-180109 (1).pdf | 2025-11-20 22:08 | 348K | |
![[ ]](/icons/unknown.gif) | EB 01_2018 დოკუმენტები გაერთიანებული (1).docx | 2025-11-20 22:08 | 538K | |
![[ ]](/icons/unknown.gif) | DRUG.docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_E_form.doc | 2025-11-20 22:08 | 90K | |
![[ ]](/icons/unknown.gif) | CV_SCRC_E_form (1).doc | 2025-11-20 22:08 | 90K | |
![[ ]](/icons/unknown.gif) | CV_REG_E_form (3).doc | 2025-11-20 22:08 | 92K | |
![[ ]](/icons/unknown.gif) | CV_REG_E_form (2).doc | 2025-11-20 22:08 | 92K | |
![[ ]](/icons/unknown.gif) | CV_JCB_E_form.doc | 2025-11-20 22:08 | 92K | |
![[ ]](/icons/unknown.gif) | CV_JCB_E_form (1).doc | 2025-11-20 22:08 | 92K | |
![[ ]](/icons/unknown.gif) | CV_EB_E_form.doc | 2025-11-20 22:08 | 90K | |
![[ ]](/icons/unknown.gif) | CV_EB_E_form (1).doc | 2025-11-20 22:08 | 90K | |
![[ ]](/icons/layout.gif) | BELKANIA_MKURNALI_ticketbooking.pdf | 2025-11-20 22:08 | 17K | |
![[TXT]](/icons/text.gif) | ATT00002 (54).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (65).htm | 2025-11-20 22:08 | 216 | |
![[ ]](/icons/unknown.gif) | 15_01_2018 new MD (1).doc | 2025-11-20 22:08 | 11M | |
![[ ]](/icons/unknown.gif) | შეხვედრის ოქმი_სომხეთის ელჩის ვიზიტი.doc | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | შეხვედრის ოქმი_იაპონიის ელჩის ვიზიტი.doc | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | სომხეთი.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | სომხეთი (1).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | სასაუბრო სომხეთი.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/layout.gif) | ლიტვა.pdf | 2025-11-20 22:08 | 351K | |
![[ ]](/icons/layout.gif) | დანართი.pdf | 2025-11-20 22:08 | 4.6M | |
![[ ]](/icons/layout.gif) | დანართი (2).pdf | 2025-11-20 22:08 | 4.6M | |
![[ ]](/icons/layout.gif) | დანართი (1).pdf | 2025-11-20 22:08 | 4.6M | |
![[IMG]](/icons/image2.gif) | image003 (34).png | 2025-11-20 22:08 | 1.2K | |
![[IMG]](/icons/image2.gif) | image003 (33).png | 2025-11-20 22:08 | 1.2K | |
![[IMG]](/icons/image2.gif) | image001 (366).jpg | 2025-11-20 22:08 | 2.3K | |
![[IMG]](/icons/image2.gif) | image001 (365).jpg | 2025-11-20 22:08 | 2.3K | |
![[IMG]](/icons/image2.gif) | image001 (364).jpg | 2025-11-20 22:08 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (363).jpg | 2025-11-20 22:08 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (362).jpg | 2025-11-20 22:08 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (361).jpg | 2025-11-20 22:08 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (360).jpg | 2025-11-20 22:08 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (191).png | 2025-11-20 22:08 | 6.6K | |
![[IMG]](/icons/image2.gif) | image001 (190).png | 2025-11-20 22:08 | 6.6K | |
![[IMG]](/icons/image2.gif) | image001 (189).png | 2025-11-20 22:08 | 6.6K | |
![[IMG]](/icons/image2.gif) | image001 (188).png | 2025-11-20 22:08 | 6.6K | |
![[ ]](/icons/layout.gif) | WHOEURO Briefing to MS EB14220180116.pdf | 2025-11-20 22:08 | 654K | |
![[ ]](/icons/unknown.gif) | Supplier Creation Template Individual (2).doc | 2025-11-20 22:08 | 127K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania_ticket.pdf | 2025-11-20 22:08 | 7.1K | |
![[ ]](/icons/unknown.gif) | PGG-REG TP 6_2017 Corruption RA Health Sector _Georgia_GE_FINAL_Dec_ 2017.docx | 2025-11-20 22:08 | 222K | |
![[ ]](/icons/unknown.gif) | PGG-REG TP 6_2017 Corruption RA Health Sector _Georgia_GE_FINAL_Dec_ 2017 (1).docx | 2025-11-20 22:08 | 222K | |
![[ ]](/icons/unknown.gif) | PGG-REG TP 6_2017 Corruption RA Health Sector _Georgia_EN_FINAL_Dec_ 2017.docx | 2025-11-20 22:08 | 193K | |
![[ ]](/icons/unknown.gif) | PGG-REG TP 6_2017 Corruption RA Health Sector _Georgia_EN_FINAL_Dec_ 2017 (2).docx | 2025-11-20 22:08 | 193K | |
![[ ]](/icons/unknown.gif) | PGG-REG TP 6_2017 Corruption RA Health Sector _Georgia_EN_FINAL_Dec_ 2017 (2) (1).docx | 2025-11-20 22:08 | 193K | |
![[ ]](/icons/unknown.gif) | PGG-REG TP 6_2017 Corruption RA Health Sector _Georgia_EN_FINAL_Dec_ 2017 (1).docx | 2025-11-20 22:08 | 193K | |
![[ ]](/icons/layout.gif) | Mariana Mkurnali_ticket.pdf | 2025-11-20 22:08 | 7.0K | |
![[ ]](/icons/unknown.gif) | List_complete.xlsx | 2025-11-20 22:08 | 2.1M | |
![[ ]](/icons/unknown.gif) | List_complete (1).xlsx | 2025-11-20 22:08 | 2.1M | |
![[ ]](/icons/unknown.gif) | Geneva GEO meeting 18_01_2018.pptx | 2025-11-20 22:08 | 2.5M | |
![[ ]](/icons/unknown.gif) | Geneva GEO meeting 16_01_2018.pptx | 2025-11-20 22:08 | 2.5M | |
![[ ]](/icons/unknown.gif) | Geneva GEO meeting 16_01_2018 (1).pptx | 2025-11-20 22:08 | 2.5M | |
![[ ]](/icons/unknown.gif) | Equipment clarification.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | Equipment clarification (3).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | Equipment clarification (2).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | Equipment clarification (1).docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | EB session on WHO country work.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/layout.gif) | EB WHO Country Office Georgia 2018-01 handouts.pdf | 2025-11-20 22:08 | 805K | |
![[ ]](/icons/layout.gif) | David Sergeenko_ticket.pdf | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/unknown.gif) | Copy of List_complete-1.xlsx | 2025-11-20 22:08 | 2.1M | |
![[ ]](/icons/unknown.gif) | Copy of List_complete-1 (1).xlsx | 2025-11-20 22:08 | 2.1M | |
![[ ]](/icons/layout.gif) | Amiran Gamkrelidze_ticket.pdf | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | 15_01_2018 new MD.doc | 2025-11-20 22:08 | 11M | |
![[ ]](/icons/unknown.gif) | moxsenebiTi.docx | 2025-11-20 22:08 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (359).jpg | 2025-11-20 22:08 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (187).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (186).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (185).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (184).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (183).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (182).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (181).png | 2025-11-20 22:08 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (180).png | 2025-11-20 22:08 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (179).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (178).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (177).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (176).png | 2025-11-20 22:08 | 6.9K | |
![[ ]](/icons/layout.gif) | danarti_1.pdf | 2025-11-20 22:08 | 897K | |
![[ ]](/icons/layout.gif) | danarti_1 (1).pdf | 2025-11-20 22:08 | 897K | |
![[ ]](/icons/unknown.gif) | WHO EB_142_Session_agenda forMinister_final.docx | 2025-11-20 22:08 | 196K | |
![[ ]](/icons/unknown.gif) | WHO EB_142_Session_agenda forMinister_final (2).docx | 2025-11-20 22:08 | 196K | |
![[ ]](/icons/unknown.gif) | WHO EB_142_Session_agenda forMinister_final (1).docx | 2025-11-20 22:08 | 196K | |
![[ ]](/icons/unknown.gif) | Terms of Reference local-molhsa GEO 2018-01.docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/layout.gif) | TA_1309880.pdf | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/layout.gif) | TA_1309880 (1).pdf | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | Geneva GEO meeting 18 01 2018 Final - Copy.pptx | 2025-11-20 22:08 | 2.5M | |
![[ ]](/icons/unknown.gif) | GEO_UHCP_SSAcapacity_February2018_mission_Scope_and_Purpose_FINAL_v2.docx | 2025-11-20 22:08 | 146K | |
![[ ]](/icons/unknown.gif) | GEO_UHCP_DRG_February2018_mission_Scope_and_Purpose_FINAL.docx | 2025-11-20 22:08 | 39K | |
![[ ]](/icons/unknown.gif) | Concept Note on EaP initiatives - GEO.docx | 2025-11-20 22:08 | 84K | |
![[ ]](/icons/unknown.gif) | Call for evidence_hepatitis Celimination program in Georgia.doc | 2025-11-20 22:08 | 40K | |
![[ ]](/icons/unknown.gif) | Call for ecidence_hepatitisC_final.doc | 2025-11-20 22:08 | 40K | |
![[TXT]](/icons/text.gif) | ძირითადი_დოკუმენტი (2).html | 2025-11-20 22:08 | 33K | |
![[TXT]](/icons/text.gif) | ძირითადი_დოკუმენტი (1).html | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/layout.gif) | უწყებებს generate_pdf.pdf | 2025-11-20 22:08 | 114K | |
![[ ]](/icons/unknown.gif) | საკომუნიკაციო სტრატეგია.docx | 2025-11-20 22:08 | 66K | |
![[ ]](/icons/unknown.gif) | ვაჭრობაზე სამუშაო ჯგუფის ოქმის პროექტი.docx | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/unknown.gif) | ვაჭრობაზე სამუშაო ჯგუფის ოქმის პროექტი (1).docx | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/unknown.gif) | состав белорусской части МПК.DOCX | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | состав белорусской части МПК (1).DOCX | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | Формат заседания Коммисии на 31 января.docx | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | Формат заседания Коммисии на 31 января (1).docx | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | Проект протокола 4 МПК_на 28_01_2018_итоги согласования груз_правок_режи (1) | 2025-11-20 22:08 | 91K | |
![[ ]](/icons/unknown.gif) | Проект протокола 4 МПК_на 28_01_2018_итоги согласования груз_правок_режи | 2025-11-20 22:08 | 91K | |
![[ ]](/icons/unknown.gif) | Проект протокола 4 МПК.DOC | 2025-11-20 22:08 | 169K | |
![[ ]](/icons/unknown.gif) | Проект протокола 4 МПК (1).DOC | 2025-11-20 22:08 | 169K | |
![[ ]](/icons/unknown.gif) | Программа на 31 января.doc | 2025-11-20 22:08 | 77K | |
![[ ]](/icons/unknown.gif) | Программа на 31 января (1).doc | 2025-11-20 22:08 | 77K | |
![[ ]](/icons/unknown.gif) | Программа на 30 января.docx | 2025-11-20 22:08 | 80K | |
![[ ]](/icons/unknown.gif) | Программа на 30 января (1).docx | 2025-11-20 22:08 | 80K | |
![[ ]](/icons/unknown.gif) | План полета состава грузинской части МПК.DOC | 2025-11-20 22:08 | 85K | |
![[ ]](/icons/unknown.gif) | План полета состава грузинской части МПК (1).DOC | 2025-11-20 22:08 | 85K | |
![[ ]](/icons/unknown.gif) | План полета состав Межведомственной Рабочий Группы.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | План полета состав Межведомственной Рабочий Группы (1).docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | merias.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | merias (1).docx | 2025-11-20 22:08 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (358).jpg | 2025-11-20 22:08 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (357).jpg | 2025-11-20 22:08 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (175).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (174).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (173).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (172).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (171).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (170).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (169).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (168).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (167).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (166).png | 2025-11-20 22:08 | 6.9K | |
![[ ]](/icons/unknown.gif) | alex azar apointment.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | alex azar apointment (1).docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | Support Letter Ministry of Health.docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | Support Letter Ministry of Health (1).docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | Strategy_workshop_draft_agenda_Feb2018.docx | 2025-11-20 22:08 | 85K | |
![[ ]](/icons/unknown.gif) | Strategy_workshop_draft_agenda_Feb2018 (1).docx | 2025-11-20 22:08 | 85K | |
![[ ]](/icons/unknown.gif) | Social welfare matrix.xlsx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | Social welfare matrix (1).xlsx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/layout.gif) | Sergeenko letter 20180107.pdf | 2025-11-20 22:08 | 83K | |
![[ ]](/icons/unknown.gif) | SDGs_country nationalization document_GEO-20_10_2017.xlsx | 2025-11-20 22:08 | 930K | |
![[ ]](/icons/unknown.gif) | MoJ chart-სნეპ კანონპროექტი.docx | 2025-11-20 22:08 | 53K | |
![[ ]](/icons/unknown.gif) | MoJ chart-სნეპ კანონპროექტი (1).docx | 2025-11-20 22:08 | 53K | |
![[ ]](/icons/unknown.gif) | MOH Letter of support_v1_20180110 doc reviewed m_ chkhaidze +.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | Andres_ GEO_UHCP_SSAcapacity_February2018_mission_Scope_and_Purpose_FINAL.docx | 2025-11-20 22:08 | 154K | |
![[ ]](/icons/unknown.gif) | Andres_ GEO_UHCP_SSAcapacity_February2018_mission_Scope_and_Purpose_FINAL (1).docx | 2025-11-20 22:08 | 154K | |
![[ ]](/icons/unknown.gif) | Alex Azar letter.docx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/unknown.gif) | Alex Azar letter (1).docx | 2025-11-20 22:08 | 12K | |
![[TXT]](/icons/text.gif) | ATT00002 (53).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (52).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (51).htm | 2025-11-20 22:08 | 345 | |
![[TXT]](/icons/text.gif) | ATT00002 (50).htm | 2025-11-20 22:08 | 345 | |
![[TXT]](/icons/text.gif) | ATT00001 (64).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (63).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (62).htm | 2025-11-20 22:08 | 441 | |
![[TXT]](/icons/text.gif) | ATT00001 (61).htm | 2025-11-20 22:08 | 441 | |
![[ ]](/icons/layout.gif) | 178_249_17 werili mkurnals.pdf | 2025-11-20 22:08 | 204K | |
![[ ]](/icons/unknown.gif) | 26-28 Feb - UHCP_DRG_February2018_mission_Scope_and_Purpose_FINAL (2).docx | 2025-11-20 22:08 | 39K | |
![[ ]](/icons/unknown.gif) | წერილი ინფრასტრუქტურა.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | წერილი ინფრასტრუქტურა (3).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | წერილი ინფრასტრუქტურა (2).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | წერილი ინფრასტრუქტურა (1).docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | სამთავრობო_პროგრამის_ანგარიში_MoLHSA-30_01.doc | 2025-11-20 22:08 | 146K | |
![[ ]](/icons/unknown.gif) | სამთავრობო_პროგრამის_ანგარიში_MoLHSA-30_01 (4).doc | 2025-11-20 22:08 | 65K | |
![[ ]](/icons/unknown.gif) | სამთავრობო_პროგრამის_ანგარიში_MoLHSA-30_01 (3).doc | 2025-11-20 22:08 | 65K | |
![[ ]](/icons/unknown.gif) | სამთავრობო_პროგრამის_ანგარიში_MoLHSA-30_01 (2).doc | 2025-11-20 22:08 | 135K | |
![[ ]](/icons/unknown.gif) | სამთავრობო_პროგრამის_ანგარიში_MoLHSA-30_01 (1).doc | 2025-11-20 22:08 | 135K | |
![[ ]](/icons/unknown.gif) | მთავრობის_ანგარიში_danarti_1.docx | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | მთავრობის_ანგარიში_danarti_1 (1).docx | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | ზოგადი ანგარიში_- დანართი№1.docx | 2025-11-20 22:08 | 212K | |
![[ ]](/icons/unknown.gif) | განათლების სამინისტროს წერილი.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | განათლების სამინისტროს წერილი (3).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | განათლების სამინისტროს წერილი (2).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | განათლების სამინისტროს წერილი (1).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | saagento.xlsx | 2025-11-20 22:08 | 2.8M | |
![[IMG]](/icons/image2.gif) | image002 (57).png | 2025-11-20 22:08 | 7.8K | |
![[IMG]](/icons/image2.gif) | image002 (56).png | 2025-11-20 22:08 | 7.8K | |
![[IMG]](/icons/image2.gif) | image001 (165).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (164).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (163).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (162).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (161).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (160).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (159).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (158).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (157).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (156).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (155).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (154).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (153).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (152).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (151).png | 2025-11-20 22:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (150).png | 2025-11-20 22:08 | 6.9K | |
![[ ]](/icons/layout.gif) | Information for Participants in Meetings.pdf | 2025-11-20 22:08 | 137K | |
![[ ]](/icons/layout.gif) | GIO - Invitation Letter.pdf | 2025-11-20 22:08 | 74K | |
![[ ]](/icons/unknown.gif) | Antons LOI rev.docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | Antons LOI rev (1).docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/layout.gif) | Agenda.pdf | 2025-11-20 22:08 | 115K | |
![[ ]](/icons/unknown.gif) | 26-28 Feb - UHCP_DRG_February2018_mission_Scope_and_Purpose_FINAL.docx | 2025-11-20 22:08 | 39K | |
![[ ]](/icons/unknown.gif) | 26-28 Feb - UHCP_DRG_February2018_mission_Scope_and_Purpose_FINAL (1).docx | 2025-11-20 22:08 | 39K | |
![[ ]](/icons/layout.gif) | 01_02_2018_დელეგაციის_შემადგენლობა (1).pdf | 2025-11-20 22:08 | 547K | |
![[ ]](/icons/layout.gif) | ჯანდაცვა.pdf | 2025-11-20 22:08 | 382K | |
![[ ]](/icons/unknown.gif) | პიროტექნიკა.xlsx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | პიროტექნიკა.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | თანამშრომლობა ჯანდაცვის სფეროში.docx | 2025-11-20 22:08 | 56K | |
![[ ]](/icons/unknown.gif) | თანამშრომლობა ჯანდაცვის სფეროში (2).docx | 2025-11-20 22:08 | 56K | |
![[ ]](/icons/unknown.gif) | თანამშრომლობა ჯანდაცვის სფეროში (1).docx | 2025-11-20 22:08 | 56K | |
![[IMG]](/icons/image2.gif) | image001 (149).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (148).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (147).png | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (146).png | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (145).png | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (144).png | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (143).png | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (142).png | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (141).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | aleqsandra inaZe.jpeg | 2025-11-20 22:08 | 547K | |
![[IMG]](/icons/image2.gif) | aleqsandra inaZe (1).jpeg | 2025-11-20 22:08 | 547K | |
![[ ]](/icons/unknown.gif) | U S Draft EWG Agenda Feb 7 2018 (2).doc | 2025-11-20 22:08 | 69K | |
![[ ]](/icons/unknown.gif) | U S Draft EWG Agenda Feb 7 2018 (2) (1).doc | 2025-11-20 22:08 | 69K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_roadmap_DRG_implementation_FEB_2018 (8).pdf | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_roadmap_DRG_implementation_FEB_2018 (7).pdf | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_roadmap_DRG_implementation_FEB_2018 (6).pdf | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_roadmap_DRG_implementation_FEB_2018 (5).pdf | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_roadmap_DRG_implementation_FEB_2018 (4).pdf | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_Analytical_Report_Nov_2017_Final (8).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/layout.gif) | UHCP_GEO_Analytical_Report_Nov_2017_Final (7).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/layout.gif) | UHCP_GEO_Analytical_Report_Nov_2017_Final (6).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/layout.gif) | UHCP_GEO_Analytical_Report_Nov_2017_Final (5).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/unknown.gif) | ToR DRG.doc | 2025-11-20 22:08 | 46K | |
![[ ]](/icons/unknown.gif) | ToR DRG (1).doc | 2025-11-20 22:08 | 46K | |
![[ ]](/icons/unknown.gif) | HCV Decentralization Concepts_ 2_6_18.docx | 2025-11-20 22:08 | 62K | |
![[ ]](/icons/unknown.gif) | HCV Decentralization Concepts_ 2_6_18 (1).docx | 2025-11-20 22:08 | 62K | |
![[ ]](/icons/unknown.gif) | GEO_Validation Table (3).xlsx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | GEO_Validation Table (2).xlsx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/layout.gif) | GEO_Questionnaire-DataForm (Extranet) (3).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/layout.gif) | GEO_Questionnaire-DataForm (Extranet) (2).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1 (9).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1 (8).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1 (7).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1 (6).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | EWG update.docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/layout.gif) | Annexure_A.pdf | 2025-11-20 22:08 | 96K | |
![[ ]](/icons/layout.gif) | Annexure_A (1).pdf | 2025-11-20 22:08 | 96K | |
![[ ]](/icons/unknown.gif) | Agenda 19-23 February, 2018.doc | 2025-11-20 22:08 | 61K | |
![[TXT]](/icons/text.gif) | ATT00005 (17).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005 (16).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00004 (23).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (22).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (33).htm | 2025-11-20 22:08 | 445 | |
![[TXT]](/icons/text.gif) | ATT00003 (32).htm | 2025-11-20 22:08 | 445 | |
![[TXT]](/icons/text.gif) | ATT00002 (49).htm | 2025-11-20 22:08 | 4.7K | |
![[TXT]](/icons/text.gif) | ATT00002 (48).htm | 2025-11-20 22:08 | 4.7K | |
![[TXT]](/icons/text.gif) | ATT00001 (60).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (59).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (58).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (57).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (56).htm | 2025-11-20 22:08 | 4.1K | |
![[TXT]](/icons/text.gif) | ATT00001 (55).htm | 2025-11-20 22:08 | 4.1K | |
![[ ]](/icons/layout.gif) | 07__ჯანდაცვა.pdf | 2025-11-20 22:08 | 346K | |
![[ ]](/icons/layout.gif) | 01_02_2018_დელეგაციის_შემადგენლობა.pdf | 2025-11-20 22:08 | 547K | |
![[ ]](/icons/unknown.gif) | შშმ პირთა სტატისტიკა.docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | შშმ პირთა სტატისტიკა (1).docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | უზბეკეთის დელეგაციასთან განსახილველი საკითხები_არველაძისთვის _12 თებერვა___.docx | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | სახალხო-შრომის საკითხებზე.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/layout.gif) | კომიტეტის_საზედამხედველო_საქმიანობის_გეგმის_პროექტი.pdf | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/unknown.gif) | კაჭრეთი დღის წესრიგი.docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | ინფორმაცია ორმხრივი ეკ_ ურთიერთობებზე უზბეკეთთან_ 2017 (11).docx | 2025-11-20 22:08 | 211K | |
![[ ]](/icons/layout.gif) | გრაფიკი.pdf | 2025-11-20 22:08 | 29K | |
![[IMG]](/icons/image2.gif) | image005 (11).png | 2025-11-20 22:08 | 1.5K | |
![[IMG]](/icons/image2.gif) | image005 (10).png | 2025-11-20 22:08 | 1.5K | |
![[IMG]](/icons/image2.gif) | image004 (20).png | 2025-11-20 22:08 | 824 | |
![[IMG]](/icons/image2.gif) | image004 (19).png | 2025-11-20 22:08 | 824 | |
![[IMG]](/icons/image2.gif) | image003 (32).png | 2025-11-20 22:08 | 830 | |
![[IMG]](/icons/image2.gif) | image003 (31).png | 2025-11-20 22:08 | 830 | |
![[IMG]](/icons/image2.gif) | image002 (55).png | 2025-11-20 22:08 | 817 | |
![[IMG]](/icons/image2.gif) | image002 (54).png | 2025-11-20 22:08 | 817 | |
![[IMG]](/icons/image2.gif) | image001 (356).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (355).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (354).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (140).png | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (139).png | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (138).png | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (137).png | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (136).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (135).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (134).png | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (133).png | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (132).png | 2025-11-20 22:08 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (131).png | 2025-11-20 22:08 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (21).gif | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | image001 (20).gif | 2025-11-20 22:08 | 3.4K | |
![[ ]](/icons/unknown.gif) | homework - 19-23 feb.docx | 2025-11-20 22:08 | 141K | |
![[ ]](/icons/unknown.gif) | homework - 19-23 feb (2).docx | 2025-11-20 22:08 | 138K | |
![[ ]](/icons/unknown.gif) | homework - 19-23 feb (1).docx | 2025-11-20 22:08 | 138K | |
![[ ]](/icons/unknown.gif) | agenda of the workshop.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | agenda of the workshop (1).docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | Updated Agenda 19-23 February, 2018 As of February 12 CommentsTH.doc | 2025-11-20 22:08 | 76K | |
![[ ]](/icons/unknown.gif) | Updated Agenda 19-23 February, 2018 As of February 12 CommentsTH (1).doc | 2025-11-20 22:08 | 76K | |
![[ ]](/icons/unknown.gif) | Updated Agenda 19-23 February, 2018.doc | 2025-11-20 22:08 | 67K | |
![[ ]](/icons/unknown.gif) | Updated Agenda 19-23 February, 2018 (1).doc | 2025-11-20 22:08 | 67K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_roadmap_DRG_implementation_FEB_2018.pdf | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_roadmap_DRG_implementation_FEB_2018 (3).pdf | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_roadmap_DRG_implementation_FEB_2018 (2).pdf | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_roadmap_DRG_implementation_FEB_2018 (1).pdf | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_Analytical_Report_Nov_2017_Final (4).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/layout.gif) | UHCP_GEO_Analytical_Report_Nov_2017_Final (3).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/layout.gif) | UHCP_GEO_Analytical_Report_Nov_2017_Final (2).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/layout.gif) | UHCP_GEO_Analytical_Report_Nov_2017_Final (1).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/unknown.gif) | ToR DRG-triin.doc | 2025-11-20 22:08 | 53K | |
![[ ]](/icons/layout.gif) | Report_SSA_Organizational_Capacity_Feb2018_Draft.pdf | 2025-11-20 22:08 | 211K | |
![[ ]](/icons/layout.gif) | Report_SSA_Organizational_Capacity_Feb2018_Draft (1).pdf | 2025-11-20 22:08 | 211K | |
![[ ]](/icons/unknown.gif) | PAR AP 2017-2018 მონიტორინგის ჩარჩო.xlsx | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/unknown.gif) | PAR AP 2017-2018 მონიტორინგის ჩარჩო (1).xlsx | 2025-11-20 22:08 | 335K | |
![[ ]](/icons/unknown.gif) | PAR-ის 2017 წლის მონიტორინგის ანგარიში.docx | 2025-11-20 22:08 | 1.2M | |
![[ ]](/icons/unknown.gif) | PAR-ის 2017 წლის მონიტორინგის ანგარიში (1).docx | 2025-11-20 22:08 | 1.2M | |
![[ ]](/icons/unknown.gif) | PAR-ის საბჭოს დღის წესრიგი.docx | 2025-11-20 22:08 | 47K | |
![[ ]](/icons/unknown.gif) | PAR-ის საბჭოს დღის წესრიგი (1).docx | 2025-11-20 22:08 | 47K | |
![[ ]](/icons/unknown.gif) | List of Participants, Workshop.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | List of Participants, Workshop (1).docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | HCV Workshop Agenda_draft Revised 02_09_2018.docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | HCV Workshop Agenda_draft Revised 02_09_2018 (1).docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1 (5).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1 (4).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1 (3).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1 (2).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | Draft Agenda Feb26_28_As of 12 February CommentsTH.docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | Draft Agenda Feb26_28_As of 12 February CommentsTH (1).docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 Spanish.pdf | 2025-11-20 22:08 | 200K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 Spanish (1).pdf | 2025-11-20 22:08 | 200K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 Russian.pdf | 2025-11-20 22:08 | 264K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 Russian (1).pdf | 2025-11-20 22:08 | 264K | |
![[ ]](/icons/layout.gif) | C_L_2_ 2018 French.pdf | 2025-11-20 22:08 | 222K | |
![[ ]](/icons/layout.gif) | C_L_2_ 2018 French (1).pdf | 2025-11-20 22:08 | 222K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 Chinese.pdf | 2025-11-20 22:08 | 478K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 Chinese (1).pdf | 2025-11-20 22:08 | 478K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 Arabic.pdf | 2025-11-20 22:08 | 208K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 Arabic (1).pdf | 2025-11-20 22:08 | 208K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 (40th ECDD).pdf | 2025-11-20 22:08 | 182K | |
![[ ]](/icons/layout.gif) | C_L_2_2018 (40th ECDD) (1).pdf | 2025-11-20 22:08 | 182K | |
![[TXT]](/icons/text.gif) | ATT00006 (14).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00006 (13).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005 (15).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (14).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (21).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (20).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (31).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (30).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (47).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (46).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (54).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (53).htm | 2025-11-20 22:08 | 216 | |
![[ ]](/icons/layout.gif) | APW_201928624, 2018-90328.pdf | 2025-11-20 22:08 | 250K | |
![[ ]](/icons/layout.gif) | APW_201928624, 2018-90328 (1).pdf | 2025-11-20 22:08 | 250K | |
![[ ]](/icons/unknown.gif) | 19-23 Feb - UHCP_SSAcapacity_February2018_mission_Scope_and_Purpose_FINAL_v2.docx | 2025-11-20 22:08 | 146K | |
![[ ]](/icons/unknown.gif) | 19-23 Feb - UHCP_SSAcapacity_February2018_mission_Scope_and_Purpose_FINAL_v2 (1).docx | 2025-11-20 22:08 | 146K | |
![[ ]](/icons/unknown.gif) | შრომა-აშშ.doc | 2025-11-20 22:08 | 53K | |
![[ ]](/icons/unknown.gif) | შრომა-აშშ (1).doc | 2025-11-20 22:08 | 53K | |
![[ ]](/icons/unknown.gif) | სწავლების ანგარიში.docx | 2025-11-20 22:08 | 50K | |
![[ ]](/icons/unknown.gif) | სწავლების ანგარიში (1).docx | 2025-11-20 22:08 | 50K | |
![[ ]](/icons/unknown.gif) | ინსტიტუციური ანალიზის შედეგები.docx | 2025-11-20 22:08 | 402K | |
![[ ]](/icons/unknown.gif) | ინსტიტუციური ანალიზის შედეგები (1).docx | 2025-11-20 22:08 | 402K | |
![[ ]](/icons/unknown.gif) | დეკლარაციების მონიტორინგის ანგარიში.docx | 2025-11-20 22:08 | 351K | |
![[ ]](/icons/unknown.gif) | დეკლარაციების მონიტორინგის ანგარიში (1).docx | 2025-11-20 22:08 | 351K | |
![[ ]](/icons/unknown.gif) | ახალი 2018 წლის გეგმა.docx | 2025-11-20 22:08 | 171K | |
![[ ]](/icons/unknown.gif) | ანგარიში საჯარო სამსახურის შესახებ კანონზე.docx | 2025-11-20 22:08 | 92K | |
![[ ]](/icons/unknown.gif) | ანგარიში საჯარო სამსახურის შესახებ კანონზე (1).docx | 2025-11-20 22:08 | 92K | |
![[IMG]](/icons/image2.gif) | image001 (130).png | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (129).png | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (128).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (127).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (19).gif | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | image001 (18).gif | 2025-11-20 22:08 | 3.4K | |
![[ ]](/icons/unknown.gif) | US collaboration.docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | USA project დანართი 2_.docx | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | USA project დანართი 1.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | UPR-health.docx | 2025-11-20 22:08 | 133K | |
![[ ]](/icons/unknown.gif) | UPR-health (1).docx | 2025-11-20 22:08 | 133K | |
![[ ]](/icons/unknown.gif) | Trip on 11 Apr 18 - PNR ref QPN9CX.PDF | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | Trip on 11 Apr 18 - PNR ref QOWT7W.PDF | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/layout.gif) | Senior Level Talking Points.pdf | 2025-11-20 22:08 | 108K | |
![[ ]](/icons/unknown.gif) | SDG report Parliament Labour.docx | 2025-11-20 22:08 | 84K | |
![[ ]](/icons/unknown.gif) | SDG report Parliament Labour (1).docx | 2025-11-20 22:08 | 84K | |
![[ ]](/icons/unknown.gif) | Report_SSA_Organizational_Capacity_Feb2018_Draft.docx | 2025-11-20 22:08 | 70K | |
![[ ]](/icons/unknown.gif) | Report_SSA_Organizational_Capacity_Feb2018_Draft (1).docx | 2025-11-20 22:08 | 70K | |
![[ ]](/icons/unknown.gif) | MG HOLCOMB BIO.PDF | 2025-11-20 22:08 | 170K | |
![[ ]](/icons/unknown.gif) | GEO_Validation Table.xlsx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | GEO_Validation Table (1).xlsx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/layout.gif) | GEO_Questionnaire-DataForm (Extranet).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/layout.gif) | GEO_Questionnaire-DataForm (Extranet) (1).pdf | 2025-11-20 22:08 | 1.3M | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1.docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | GEO_Communication_Plan_Framework_v1 (1).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | DRG transition plan.docx | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | DRG homework - geo.docx | 2025-11-20 22:08 | 40K | |
![[ ]](/icons/unknown.gif) | DRG homework - geo (1).docx | 2025-11-20 22:08 | 39K | |
![[ ]](/icons/unknown.gif) | DRG Communication_Plan.docx | 2025-11-20 22:08 | 43K | |
![[ ]](/icons/unknown.gif) | DRG Communication_Plan (3).docx | 2025-11-20 22:08 | 40K | |
![[ ]](/icons/unknown.gif) | DRG Communication_Plan (2).docx | 2025-11-20 22:08 | 40K | |
![[ ]](/icons/unknown.gif) | DRG Communication_Plan (1).docx | 2025-11-20 22:08 | 43K | |
![[ ]](/icons/unknown.gif) | DRG-monitoring.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | 2018-02-07 Questions to MoES onmobility _MoLHSA.docx | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | 2018-02-07 Questions to MoES onmobility _MoLHSA (1).docx | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | 2018-02-07 Questions to MoES on mobility - follow-up.docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | 2018-02-07 Questions to MoES on mobility - follow-up (1).docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | 2018 წლის სამოქმედო გეგმა.docx | 2025-11-20 22:08 | 179K | |
![[ ]](/icons/layout.gif) | ჯანდაცვას_კონსოლიდირებულისთვის_მასალები_2018.pdf | 2025-11-20 22:08 | 380K | |
![[ ]](/icons/layout.gif) | ჯანდაცვას_კონსოლიდირებულისთვის_მასალები_2018 (2).pdf | 2025-11-20 22:08 | 380K | |
![[ ]](/icons/layout.gif) | ჯანდაცვას_კონსოლიდირებულისთვის_მასალები_2018 (1).pdf | 2025-11-20 22:08 | 380K | |
![[ ]](/icons/unknown.gif) | სათარგმნი.docx | 2025-11-20 22:08 | 31K | |
![[ ]](/icons/unknown.gif) | სათარგმნი (1).docx | 2025-11-20 22:08 | 31K | |
![[ ]](/icons/unknown.gif) | თარგმანი გაერთიანებული track change.docx | 2025-11-20 22:08 | 97K | |
![[ ]](/icons/unknown.gif) | თარგმანი გაერთიანებული - final.docx | 2025-11-20 22:08 | 70K | |
![[ ]](/icons/unknown.gif) | დანართი 1.docx | 2025-11-20 22:08 | 121K | |
![[ ]](/icons/unknown.gif) | დანართი 1 (1).docx | 2025-11-20 22:08 | 121K | |
![[ ]](/icons/layout.gif) | აშშ-საქართველო.pdf | 2025-11-20 22:08 | 101K | |
![[ ]](/icons/layout.gif) | აშშ-საქართველო (1).pdf | 2025-11-20 22:08 | 101K | |
![[ ]](/icons/layout.gif) | აშშ-საქართველოს_შორის_თანამშრომლობა_Аnnex_საერთო_ფორმატი2.pdf | 2025-11-20 22:08 | 101K | |
![[ ]](/icons/layout.gif) | აშშ-საქართველოს_შორის_თანამშრომლობა_Аnnex_საერთო_ფორმატი 2.pdf | 2025-11-20 22:08 | 101K | |
![[ ]](/icons/layout.gif) | აშშ-საქართველოს_შორის_თანამშრომლობა_Аnnex_საერთო_ფორმატი.pdf | 2025-11-20 22:08 | 86K | |
![[ ]](/icons/layout.gif) | აშშ-საქართველოს_შორის_თანამშრომლობა_Аnnex_საერთო_ფორმატი (1).pdf | 2025-11-20 22:08 | 86K | |
![[ ]](/icons/layout.gif) | marijan ivanusa.pdf | 2025-11-20 22:08 | 42K | |
![[ ]](/icons/layout.gif) | marijan ivanusa (1).pdf | 2025-11-20 22:08 | 42K | |
![[ ]](/icons/layout.gif) | laila omar gad.pdf | 2025-11-20 22:08 | 43K | |
![[ ]](/icons/layout.gif) | laila omar gad (1).pdf | 2025-11-20 22:08 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (353).jpg | 2025-11-20 22:08 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (352).jpg | 2025-11-20 22:08 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (351).jpg | 2025-11-20 22:08 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (350).jpg | 2025-11-20 22:08 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (126).png | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (125).png | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (124).png | 2025-11-20 22:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (123).png | 2025-11-20 22:08 | 2.1K | |
![[ ]](/icons/unknown.gif) | Report summary, Feb 2018.pptx | 2025-11-20 22:08 | 91K | |
![[ ]](/icons/unknown.gif) | EU Commisioners.docx | 2025-11-20 22:08 | 289K | |
![[ ]](/icons/unknown.gif) | EU Commisioners (1).docx | 2025-11-20 22:08 | 289K | |
![[ ]](/icons/layout.gif) | Draft Programme - Ending Corporal Punishment Conference Programme.pdf | 2025-11-20 22:08 | 222K | |
![[ ]](/icons/unknown.gif) | Doc2.xls | 2025-11-20 22:08 | 255K | |
![[ ]](/icons/unknown.gif) | Doc1.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | D09S03 M CORE VALUES UN STAFF.doc | 2025-11-20 22:08 | 41K | |
![[ ]](/icons/unknown.gif) | D09S03 M CORE VALUES UN STAFF (1).doc | 2025-11-20 22:08 | 41K | |
![[ ]](/icons/unknown.gif) | Competences_Indicators_SampleQuestions.docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | Competences_Indicators_SampleQuestions (1).docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | Agency structural chart.xlsx | 2025-11-20 22:08 | 49K | |
![[ ]](/icons/unknown.gif) | 27 თებერვალი.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | უწყებებს.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | პარლამენტის_რეკომენდაციების_შესრულება_MoLHSA_1 (2).docx | 2025-11-20 22:08 | 91K | |
![[ ]](/icons/unknown.gif) | ოქმი N13.docx | 2025-11-20 22:08 | 43K | |
![[ ]](/icons/unknown.gif) | ოქმი N12.docx | 2025-11-20 22:08 | 42K | |
![[ ]](/icons/unknown.gif) | ოქმი N12 (1).docx | 2025-11-20 22:08 | 42K | |
![[ ]](/icons/unknown.gif) | ოქმი N10.docx | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/unknown.gif) | ოქმი N10 (1).docx | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/unknown.gif) | ოქმი N7.docx | 2025-11-20 22:08 | 41K | |
![[ ]](/icons/unknown.gif) | ოქმი N7 (1).docx | 2025-11-20 22:08 | 41K | |
![[ ]](/icons/unknown.gif) | თამბაქო-წერილი უწყებებს_12 02 2018.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | გეგმა-პანკისი.xlsx | 2025-11-20 22:08 | 283K | |
![[TXT]](/icons/text.gif) | ბრძანება 256_ო.html | 2025-11-20 22:08 | 123K | |
![[IMG]](/icons/image2.gif) | image001 (122).png | 2025-11-20 22:08 | 7.8K | |
![[IMG]](/icons/image2.gif) | image001 (121).png | 2025-11-20 22:08 | 7.8K | |
![[IMG]](/icons/image2.gif) | image001 (120).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (119).png | 2025-11-20 22:08 | 38K | |
![[ ]](/icons/unknown.gif) | demo_updated14082017.xlsx | 2025-11-20 22:08 | 52K | |
![[ ]](/icons/unknown.gif) | demo_updated14082017 (1).xlsx | 2025-11-20 22:08 | 52K | |
![[ ]](/icons/unknown.gif) | V_2_FCTC 2030-Signature page-1_იურიდიულის ვერისა.docx | 2025-11-20 22:08 | 54K | |
![[ ]](/icons/unknown.gif) | V_2_FCTC 2030-Signature page-1_იურიდიულის ვერისა (1).docx | 2025-11-20 22:08 | 54K | |
![[ ]](/icons/unknown.gif) | V_1_FCTC 2030-Signature page-2_დკსჯ ცენტრის ვერსია.docx | 2025-11-20 22:08 | 54K | |
![[ ]](/icons/unknown.gif) | V_1_FCTC 2030-Signature page-2_დკსჯ ცენტრის ვერსია (1).docx | 2025-11-20 22:08 | 54K | |
![[ ]](/icons/unknown.gif) | The annual report 2017.docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | The annual report 2017 (1).docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | SSA_groupwork_combined_23Feb2018.xlsx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | SSA_groupwork_combined_23Feb2018 (1).xlsx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | SP_workplan_GEO_Feb-June2018.xlsx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/unknown.gif) | SP_workplan_GEO_Feb-June2018 (1).xlsx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/unknown.gif) | Report_SSA_Organizational_Capacity_Feb2018_Draft-comments.docx | 2025-11-20 22:08 | 112K | |
![[ ]](/icons/unknown.gif) | Homework_Feb2018_PEST_HSdiagnostics.docx | 2025-11-20 22:08 | 89K | |
![[ ]](/icons/unknown.gif) | Homework_Feb2018_PEST_HSdiagnostics (1).docx | 2025-11-20 22:08 | 89K | |
![[ ]](/icons/unknown.gif) | GEO_pathway_next_steps_Feb23_2018 (2).docx | 2025-11-20 22:08 | 292K | |
![[ ]](/icons/unknown.gif) | FCTC2030 სტრატეგია.docx | 2025-11-20 22:08 | 408K | |
![[ ]](/icons/unknown.gif) | FCTC2030 სტრატეგია-NCDC_27_02_18.docx | 2025-11-20 22:08 | 444K | |
![[ ]](/icons/unknown.gif) | FCTC2030 სტრატეგია (1).docx | 2025-11-20 22:08 | 408K | |
![[ ]](/icons/unknown.gif) | EU Commisioners labour.docx | 2025-11-20 22:08 | 45K | |
![[ ]](/icons/unknown.gif) | Brief information on the State Health Programs of the Ministry of Labour Health and Social Affairs of Georgia - keti.docx | 2025-11-20 22:08 | 21K | |
![[ ]](/icons/unknown.gif) | Appendix - keti.docx | 2025-11-20 22:08 | 250K | |
![[ ]](/icons/unknown.gif) | ჯანმრთელობა (2).xlsx | 2025-11-20 22:08 | 298K | |
![[ ]](/icons/unknown.gif) | ჯანმრთელობა (1).xlsx | 2025-11-20 22:08 | 298K | |
![[ ]](/icons/unknown.gif) | პარლამენტის_რეკომენდაციების_შესრულება_final.docx | 2025-11-20 22:08 | 94K | |
![[ ]](/icons/unknown.gif) | პარლამენტის_რეკომენდაციების_შესრულება_MoLHSA_1.docx | 2025-11-20 22:08 | 91K | |
![[ ]](/icons/unknown.gif) | პარლამენტის_რეკომენდაციების_შესრულება_MoLHSA_1 (1).docx | 2025-11-20 22:08 | 91K | |
![[ ]](/icons/unknown.gif) | პარლამენტის_რეკომენდაციების_შესრულება.docx | 2025-11-20 22:08 | 139K | |
![[ ]](/icons/unknown.gif) | პარლამენტის_რეკომენდაციების_შესრულება (1).docx | 2025-11-20 22:08 | 139K | |
![[ ]](/icons/unknown.gif) | პარლამენტის რეკომენდაციების შესრულება_ჯ პუნქტი.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | მთავრობის მიმართ გაცემული რეკომენდაციების შესრულების ანგარიში.docx | 2025-11-20 22:08 | 38K | |
![[ ]](/icons/unknown.gif) | მთავრობის მიმართ გაცემული რეკომენდაციების შესრულების ანგარიში (3).docx | 2025-11-20 22:08 | 38K | |
![[ ]](/icons/unknown.gif) | მთავრობის მიმართ გაცემული რეკომენდაციების შესრულების ანგარიში (2).docx | 2025-11-20 22:08 | 38K | |
![[ ]](/icons/unknown.gif) | მთავრობის მიმართ გაცემული რეკომენდაციების შესრულების ანგარიში (1).docx | 2025-11-20 22:08 | 38K | |
![[ ]](/icons/unknown.gif) | თარგმანი გაერთიანებული - final kg.docx | 2025-11-20 22:08 | 76K | |
![[ ]](/icons/unknown.gif) | თარგმანი გაერთიანებული - final kg (2).docx | 2025-11-20 22:08 | 75K | |
![[ ]](/icons/unknown.gif) | თარგმანი გაერთიანებული - final kg (1).docx | 2025-11-20 22:08 | 64K | |
![[ ]](/icons/unknown.gif) | თარგმანი გაერთიანებული - EA.docx | 2025-11-20 22:08 | 55K | |
![[ ]](/icons/unknown.gif) | თანხმობა_წერილის ფორმით FCTC2030_updated.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | თანხმობა_წერილის ფორმით FCTC2030_updated (1).docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | თავფურცელი_27_02_18.docx | 2025-11-20 22:08 | 56K | |
![[ ]](/icons/unknown.gif) | თავფურცელი_27_02_18 (1).docx | 2025-11-20 22:08 | 56K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი (2).docx | 2025-11-20 22:08 | 124K | |
![[ ]](/icons/unknown.gif) | დასაზუსტებელი-ჯანდაცვა_)1--1-.docx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | დასაზუსტებელი-ჯანდაცვა_)1--1- (1).docx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | დასაზუსტებელი-ჯანდაცვა.docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | დასაზუსტებელი-ჯანდაცვა (1).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | დანართიN2.xls | 2025-11-20 22:08 | 261K | |
![[ ]](/icons/layout.gif) | დანართი1.pdf | 2025-11-20 22:08 | 42K | |
![[ ]](/icons/layout.gif) | nomination for Childhood CancerMeeting_Moscow.pdf | 2025-11-20 22:08 | 87K | |
![[ ]](/icons/layout.gif) | nomination for Childhood CancerMeeting_Moscow (1).pdf | 2025-11-20 22:08 | 87K | |
![[IMG]](/icons/image2.gif) | image002 (128).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image001 (349).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image001 (348).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image001 (347).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image001 (346).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image001 (345).jpg | 2025-11-20 22:08 | 5.3K | |
![[ ]](/icons/unknown.gif) | draft.xlsx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/unknown.gif) | WHA71_sideevent_application (4).docx | 2025-11-20 22:08 | 210K | |
![[ ]](/icons/unknown.gif) | WHA71_sideevent_application (3).docx | 2025-11-20 22:08 | 210K | |
![[ ]](/icons/unknown.gif) | TOR_GEO_TA_Inspection (2).doc | 2025-11-20 22:08 | 48K | |
![[ ]](/icons/layout.gif) | Pro Forma invoice.pdf | 2025-11-20 22:08 | 164K | |
![[ ]](/icons/unknown.gif) | Performance Evaluation Form for MOH (1).xlsx | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | Mission on strategic purchasingand patient pathways, 11-13 December 2017_.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | Mission on strategic purchasingand patient pathways, 11-13 December 2017_ (1).docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | Homework_02_03_2018 PEST_and_health_sector_iagnostics.docx | 2025-11-20 22:08 | 21K | |
![[ ]](/icons/unknown.gif) | Homework_02_03_2018 PEST_and_health_sector_iagnostics (1).docx | 2025-11-20 22:08 | 21K | |
![[ ]](/icons/unknown.gif) | HCV Decentralization Concepts_Draft.docx | 2025-11-20 22:08 | 62K | |
![[ ]](/icons/unknown.gif) | GMP workshopTbilisi 2018-03.doc | 2025-11-20 22:08 | 848K | |
![[ ]](/icons/unknown.gif) | GEO_DRG_mission__summary_28022018_revised (2).pptx | 2025-11-20 22:08 | 50K | |
![[ ]](/icons/unknown.gif) | GEO_DRG_mission__summary_28022018_revised (1).pptx | 2025-11-20 22:08 | 50K | |
![[ ]](/icons/unknown.gif) | BCA 2018_2019_EmergencyPreparedness and IHR_detailed.docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | BCA 2018_2019_EmergencyPreparedness and IHR_detailed (1).docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | BCA 2018_2019_EmergencyPreparedness and IHR.docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | BCA 2018_2019_EmergencyPreparedness and IHR (1).docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | Agenda Decentralizatioin March2018.docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | AA-NAP-2017-წლიური ანგარიშის პროექტი_MoLHSA_28_02_2018.docx | 2025-11-20 22:08 | 174K | |
![[ ]](/icons/unknown.gif) | AA-NAP-2017-წლიური ანგარიშის პროექტი_MoLHSA_28_02_2018 (1).docx | 2025-11-20 22:08 | 174K | |
![[ ]](/icons/unknown.gif) | AA-NAP-2017-წლიური ანგარიშის პროექტი ჯანდაცვა.docx | 2025-11-20 22:08 | 215K | |
![[ ]](/icons/unknown.gif) | AA-NAP-2017-წლიური ანგარიშის პროექტი ჯანდაცვა (1).docx | 2025-11-20 22:08 | 215K | |
![[ ]](/icons/unknown.gif) | AA-NAP-2017-წლიური ანგარიშის პროექტი ნ_ო_.docx | 2025-11-20 22:08 | 221K | |
![[ ]](/icons/unknown.gif) | AA-NAP-2017-წლიური ანგარიშის პროექტი ნ_ო_ (1).docx | 2025-11-20 22:08 | 221K | |
![[ ]](/icons/unknown.gif) | 5_Draft_DRG_communication_plan_feedbackWHO_28022018.docx | 2025-11-20 22:08 | 38K | |
![[ ]](/icons/unknown.gif) | 5_Draft_DRG_communication_plan_feedbackWHO_28022018 (1).docx | 2025-11-20 22:08 | 38K | |
![[ ]](/icons/unknown.gif) | 4_DRG_monitoring_feedbackWHO_28022018.docx | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | 4_DRG_monitoring_feedbackWHO_28022018 (1).docx | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | 3_ToR_DRGWG_Feb12_FeedbackWHO_28022018 (3).doc | 2025-11-20 22:08 | 60K | |
![[ ]](/icons/unknown.gif) | 3_ToR_DRGWG_Feb12_FeedbackWHO_28022018 (2).doc | 2025-11-20 22:08 | 60K | |
![[ ]](/icons/unknown.gif) | 2_Areas_for_capacity_building_28022018 (2).docx | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | 2_Areas_for_capacity_building_28022018 (1).docx | 2025-11-20 22:08 | 22K | |
![[IMG]](/icons/image2.gif) | 2 (11).jpg | 2025-11-20 22:08 | 135K | |
![[ ]](/icons/unknown.gif) | 1_DRG_Implementation_plan_2018_FeedbackWHO_28022018.xlsx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | 1_DRG_Implementation_plan_2018_FeedbackWHO_28022018 (1).xlsx | 2025-11-20 22:08 | 16K | |
![[IMG]](/icons/image2.gif) | 1 (11).jpg | 2025-11-20 22:08 | 140K | |
![[ ]](/icons/unknown.gif) | ჯანმრთელობა.xlsx | 2025-11-20 22:08 | 246K | |
![[ ]](/icons/unknown.gif) | სახალხო დამცველი ანგარიშის შესრულება_27_02_2018.docx | 2025-11-20 22:08 | 94K | |
![[ ]](/icons/unknown.gif) | სახალხო დამცველი ანგარიშის შესრულება_27_02_2018 (1).docx | 2025-11-20 22:08 | 94K | |
![[ ]](/icons/layout.gif) | სასტუმრო ხელმძღვანელების.pdf | 2025-11-20 22:08 | 164K | |
![[ ]](/icons/layout.gif) | სასტუმრო ხელმძღვანელების (1).pdf | 2025-11-20 22:08 | 164K | |
![[ ]](/icons/unknown.gif) | კულტურა-სპორტი კანონპროექტი.docx | 2025-11-20 22:08 | 104K | |
![[ ]](/icons/unknown.gif) | კულტურა-სპორტი კანონპროექტი (1).docx | 2025-11-20 22:08 | 104K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი.docx | 2025-11-20 22:08 | 127K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი (1).docx | 2025-11-20 22:08 | 127K | |
![[IMG]](/icons/image2.gif) | image011.png | 2025-11-20 22:08 | 824 | |
![[IMG]](/icons/image2.gif) | image010 (4).png | 2025-11-20 22:08 | 830 | |
![[IMG]](/icons/image2.gif) | image009 (5).png | 2025-11-20 22:08 | 25K | |
![[IMG]](/icons/image2.gif) | image009 (4).png | 2025-11-20 22:08 | 817 | |
![[IMG]](/icons/image2.gif) | image008 (4).png | 2025-11-20 22:08 | 1.9K | |
![[IMG]](/icons/image2.gif) | image008 (3).png | 2025-11-20 22:08 | 1.5K | |
![[IMG]](/icons/image2.gif) | image007 (3).png | 2025-11-20 22:08 | 2.0K | |
![[IMG]](/icons/image2.gif) | image006 (6).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image006 (5).png | 2025-11-20 22:08 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (9).png | 2025-11-20 22:08 | 1.9K | |
![[IMG]](/icons/image2.gif) | image005 (8).png | 2025-11-20 22:08 | 1.9K | |
![[IMG]](/icons/image2.gif) | image004 (18).png | 2025-11-20 22:08 | 2.0K | |
![[IMG]](/icons/image2.gif) | image003 (30).png | 2025-11-20 22:08 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (127).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image002 (126).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image002 (53).png | 2025-11-20 22:08 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001 (344).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image001 (343).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image001 (342).jpg | 2025-11-20 22:08 | 5.4K | |
![[IMG]](/icons/image2.gif) | image001 (341).jpg | 2025-11-20 22:08 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (340).jpg | 2025-11-20 22:08 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (339).jpg | 2025-11-20 22:08 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (338).jpg | 2025-11-20 22:08 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (337).jpg | 2025-11-20 22:08 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (118).png | 2025-11-20 22:08 | 627K | |
![[IMG]](/icons/image2.gif) | image001 (117).png | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | WHA71_sideevent_application (2).docx | 2025-11-20 22:08 | 210K | |
![[TXT]](/icons/text.gif) | Untitled attachment 00854.htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | Untitled attachment 00851.htm | 2025-11-20 22:08 | 336 | |
![[ ]](/icons/layout.gif) | Tanxmobis porma.pdf | 2025-11-20 22:08 | 1.7M | |
![[ ]](/icons/layout.gif) | TPN - 287-2018 Ref WHO-1-b.pdf | 2025-11-20 22:08 | 382K | |
![[ ]](/icons/unknown.gif) | Re Mr_ David Sergeenko_International Liver Congress 2018.msg | 2025-11-20 22:08 | 120K | |
![[ ]](/icons/unknown.gif) | Joint statement - Annual full-day meeting on the rights of the child.docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/layout.gif) | Invitation letter to Georgia.pdf | 2025-11-20 22:08 | 523K | |
![[ ]](/icons/unknown.gif) | Homework_02_03_2018 PEST_and_health_sector_iagnostics-AR-TH.docx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | GEO_pathway_next_steps_Feb23_2018 (1).docx | 2025-11-20 22:08 | 292K | |
![[ ]](/icons/unknown.gif) | GEO_UHCP_SSAcapacity_March2018_mission_Scope_and_Purpose.docx | 2025-11-20 22:08 | 324K | |
![[ ]](/icons/unknown.gif) | Copy of Performance Evaluation Form for MOH.XLSX | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | Agencies_Ge.docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | Agencies_Ge (1).docx | 2025-11-20 22:08 | 24K | |
![[TXT]](/icons/text.gif) | ATT00006 (12).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005 (13).htm | 2025-11-20 22:08 | 9.3K | |
![[TXT]](/icons/text.gif) | ATT00004 (19).htm | 2025-11-20 22:08 | 788 | |
![[TXT]](/icons/text.gif) | ATT00003 (29).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (28).htm | 2025-11-20 22:08 | 847 | |
![[TXT]](/icons/text.gif) | ATT00002 (45).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (44).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (43).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (42).htm | 2025-11-20 22:08 | 837 | |
![[TXT]](/icons/text.gif) | ATT00001 (52).htm | 2025-11-20 22:08 | 336 | |
![[TXT]](/icons/text.gif) | ATT00001 (51).htm | 2025-11-20 22:08 | 471 | |
![[TXT]](/icons/text.gif) | ATT00001 (50).htm | 2025-11-20 22:08 | 1.9K | |
![[TXT]](/icons/text.gif) | ATT00001 (49).htm | 2025-11-20 22:08 | 797 | |
![[ ]](/icons/unknown.gif) | შეთანხმების_ფურცელი_2_03_2018.doc | 2025-11-20 22:08 | 70K | |
![[ ]](/icons/layout.gif) | შეთანხმების ფურცელი ვიზირებული.pdf | 2025-11-20 22:08 | 4.9M | |
![[ ]](/icons/layout.gif) | შეთანხმების ფურცელი ვიზირებული (1).pdf | 2025-11-20 22:08 | 4.9M | |
![[ ]](/icons/layout.gif) | სოლიდარობა.pdf | 2025-11-20 22:08 | 381K | |
![[ ]](/icons/unknown.gif) | სახიფათო ნარჩენები მაიას.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | საპასუხო_ნოტა_Geo_2_03_2018.doc | 2025-11-20 22:08 | 37K | |
![[ ]](/icons/unknown.gif) | საპასუხო ნოტა_Eng_2_03_2018.doc | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/layout.gif) | საპასიხო ნოტები_Eng_Geo_ვიზირებული.pdf | 2025-11-20 22:08 | 2.5M | |
![[ ]](/icons/layout.gif) | საპასიხო ნოტები_Eng_Geo_ვიზირებული (1).pdf | 2025-11-20 22:08 | 2.5M | |
![[ ]](/icons/unknown.gif) | ონკოლოგიური სერვისი.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | ინდოეთი.docx | 2025-11-20 22:08 | 31K | |
![[ ]](/icons/unknown.gif) | განმარტებითი_ბარათი_ჩინეთი_6_03_2018.doc | 2025-11-20 22:08 | 43K | |
![[ ]](/icons/unknown.gif) | განმარტებითი_ბარათი_ჩინეთი_2_03_2018.doc | 2025-11-20 22:08 | 43K | |
![[ ]](/icons/layout.gif) | განმარტებითი ბარათი.pdf | 2025-11-20 22:08 | 2.0M | |
![[ ]](/icons/unknown.gif) | Меморандум_Грузия.docx | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (2).jpg | 2025-11-20 22:08 | 823 | |
![[ ]](/icons/unknown.gif) | personal use.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/layout.gif) | nomlet geo.pdf | 2025-11-20 22:08 | 79K | |
![[ ]](/icons/unknown.gif) | letter of nomination_Dr_ Paata Imnadze_Word.docx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/layout.gif) | letter of nomination_Dr_ Imnadze.pdf | 2025-11-20 22:08 | 88K | |
![[ ]](/icons/layout.gif) | jandatsva1.pdf | 2025-11-20 22:08 | 46K | |
![[ ]](/icons/layout.gif) | jandatsva.pdf | 2025-11-20 22:08 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (336).jpg | 2025-11-20 22:08 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (335).jpg | 2025-11-20 22:08 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (334).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (333).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (332).jpg | 2025-11-20 22:08 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (331).jpg | 2025-11-20 22:08 | 18K | |
![[IMG]](/icons/image2.gif) | image001 (330).jpg | 2025-11-20 22:08 | 2.5K | |
![[IMG]](/icons/image2.gif) | image001 (116).png | 2025-11-20 22:08 | 7.8K | |
![[IMG]](/icons/image2.gif) | image001 (115).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (114).png | 2025-11-20 22:08 | 7.8K | |
![[IMG]](/icons/image2.gif) | image001 (113).png | 2025-11-20 22:08 | 1.0K | |
![[ ]](/icons/unknown.gif) | WHA71_sideevent_application (1).docx | 2025-11-20 22:08 | 210K | |
![[ ]](/icons/unknown.gif) | TOR_GEO_TA_Inspection (1).doc | 2025-11-20 22:08 | 48K | |
![[ ]](/icons/unknown.gif) | Scope and Purpose_ENG.docx | 2025-11-20 22:08 | 224K | |
![[ ]](/icons/layout.gif) | Scope and Purpose E.pdf | 2025-11-20 22:08 | 302K | |
![[ ]](/icons/layout.gif) | Scanned from a Xerox multifunction device.pdf | 2025-11-20 22:08 | 80K | |
![[ ]](/icons/layout.gif) | Provisional agenda.pdf | 2025-11-20 22:08 | 180K | |
![[ ]](/icons/unknown.gif) | Press_Note_GEO_2018-03-07 revised version.docx | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | Press_Note_GEO_2018-03-07.docx | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | Homework_13032018_PEST_revised.docx | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/unknown.gif) | Homework_12 03 2018 PEST(MM).docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | Homework_02 03 2018 PEST_and_health_sector_diagnostics-kg.docx | 2025-11-20 22:08 | 47K | |
![[ ]](/icons/unknown.gif) | GMP workshopTbilisi 2018-03-20 (1).doc | 2025-11-20 22:08 | 849K | |
![[ ]](/icons/unknown.gif) | GMP mission Tbilisi 2018-03 (1).docx | 2025-11-20 22:08 | 45K | |
![[ ]](/icons/unknown.gif) | GMP Implement_strat_v2018-01-16 (1).doc | 2025-11-20 22:08 | 127K | |
![[ ]](/icons/layout.gif) | GEO_en.pdf | 2025-11-20 22:08 | 92K | |
![[ ]](/icons/unknown.gif) | GCM-NCD for MoH.docx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/unknown.gif) | CV_JCB_E_form_(Georgia)-2.doc | 2025-11-20 22:08 | 93K | |
![[ ]](/icons/unknown.gif) | შეხვედრა 09_03_2018.xlsx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/layout.gif) | სსიპ – ლ_ საყვარელიძის სახ.pdf | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | სოფიკო ბაბილოძე.docx | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | მე-4 სხდომის ოქმის შესრულება.docx | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/unknown.gif) | თარგმანი.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | თამბაქოს სია.docx | 2025-11-20 22:08 | 21K | |
![[ ]](/icons/layout.gif) | ეკონომიკის სამინისტროს წერილი.pdf | 2025-11-20 22:08 | 123K | |
![[ ]](/icons/unknown.gif) | Меморандум_Грузия_GEO_14_03_2018.doc | 2025-11-20 22:08 | 44K | |
![[ ]](/icons/unknown.gif) | Меморандум_Грузия_14_03_2018.doc | 2025-11-20 22:08 | 40K | |
![[ ]](/icons/unknown.gif) | ДОРОЖНАЯ_КАРТА_ОБЩАЯ_(2).docx | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | ДОРОЖНАЯ_КАРТА_ОБЩАЯ_(2) (1).docx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | ДОРОЖНАЯ КАРТА ОБЩАЯ.docx | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | tamuna beridze (1).xlsx | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/layout.gif) | nomination for Ministerial Meeting_Tallinn.pdf | 2025-11-20 22:08 | 89K | |
![[ ]](/icons/layout.gif) | letter to Vera Luiza da Costa e Silva.pdf | 2025-11-20 22:08 | 89K | |
![[IMG]](/icons/image2.gif) | image001 (329).jpg | 2025-11-20 22:08 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (328).jpg | 2025-11-20 22:08 | 3.8K | |
![[IMG]](/icons/image2.gif) | image001 (112).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (111).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (110).png | 2025-11-20 22:08 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (109).png | 2025-11-20 22:08 | 7.9K | |
![[ ]](/icons/unknown.gif) | TOR_GEO_TA_Inspection.doc | 2025-11-20 22:08 | 41K | |
![[ ]](/icons/unknown.gif) | SSA_startegy_key_domains_19032018.pptx | 2025-11-20 22:08 | 118K | |
![[ ]](/icons/layout.gif) | Report_SSA_Organizational_Capacity_March2018_Final_MOLHSA.pdf | 2025-11-20 22:08 | 234K | |
![[ ]](/icons/unknown.gif) | RUS_Agreement_Armenia_Georgia_20 02 2017 (4)_final geoargian.doc | 2025-11-20 22:08 | 54K | |
![[ ]](/icons/unknown.gif) | Prog Geo 2.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | Performance Evaluation Form for MOH_Maia Nikoleishvili_1.xlsx | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | Performance Evaluation Form for MOH_Maia Nikoleishvili.xlsx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | Performance Evaluation Form for MOH.XLSX | 2025-11-20 22:08 | 58K | |
![[ ]](/icons/unknown.gif) | Nomination_Form_Georgia.docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | Homework_13032018_PEST_revised_19032018_v1.docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | Geo_Jordan_1_JIC_Protocol_13_10_2017.docx | 2025-11-20 22:08 | 30K | |
![[ ]](/icons/unknown.gif) | GMP workshopTbilisi 2018-03-20.doc | 2025-11-20 22:08 | 843K | |
![[ ]](/icons/unknown.gif) | GMP mission Tbilisi 2018-03.docx | 2025-11-20 22:08 | 45K | |
![[ ]](/icons/unknown.gif) | GMP Implement_strat_v2018-01-16.doc | 2025-11-20 22:08 | 123K | |
![[ ]](/icons/unknown.gif) | FinalМеморандум_Грузия (2) თარგმანი რეგულირება (2).docx | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/unknown.gif) | Final ДОРОЖНАЯ_КАРТА_ОБЩАЯ_comments 2018 March 13_მაიკო.docx | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/unknown.gif) | Final ДОРОЖНАЯ_КАРТА_ОБЩАЯ_comments 2018 March 13 (3).docx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | Final ДОРОЖНАЯ_КАРТА_ОБЩАЯ_16_03_2018_Rus.docx | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | Final ДОРОЖНАЯ_КАРТА_ОБЩАЯ_16_03_2018_GEO.docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | FINAL_GEO_Agreement_Armenia_Georgia_22_02_2017_Georgia alt.doc | 2025-11-20 22:08 | 60K | |
![[ ]](/icons/unknown.gif) | Draft_DRG_background_note_list_of_FAQ_18032018.docx | 2025-11-20 22:08 | 40K | |
![[ ]](/icons/unknown.gif) | Cooperation areas with EU Commisioners.docx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | AGENDA 19-23 - მონაწილეთა სია.docx | 2025-11-20 22:08 | 21K | |
![[ ]](/icons/unknown.gif) | 2018 წლის გეგმა_არასამთავრობოების შენიშვნებზე კომენტარები_MoLHSA.docx | 2025-11-20 22:08 | 42K | |
![[ ]](/icons/unknown.gif) | 2018 წლის გეგმა_არასამთავრობოების კომენტარები.docx | 2025-11-20 22:08 | 47K | |
![[ ]](/icons/unknown.gif) | 2018 წლის გეგმა_არასამთავრობოების კომენტარები (1).docx | 2025-11-20 22:08 | 47K | |
![[ ]](/icons/unknown.gif) | 349 decree.docx | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | 20 -21 ტრენინგის მონაწილეები.xlsx | 2025-11-20 22:08 | 10K | |
![[ ]](/icons/unknown.gif) | 18MA088-GE-005 GE Anfrage an MoH.PDF | 2025-11-20 22:08 | 1.1M | |
![[ ]](/icons/unknown.gif) | 7th SSS Objectives 23022018 ing.docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 7th SSS Objectives 23022018 ing (2).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 7th SSS Objectives 23022018 ing (1).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | 4ДОРОЖНАЯ_КАРТА_ОБЩАЯ_comments 2018 March 13 (3).docx | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/unknown.gif) | 3_ToR_DRGWG_Feb12_FeedbackWHO_28022018.doc | 2025-11-20 22:08 | 67K | |
![[ ]](/icons/unknown.gif) | 3_ToR_DRGWG_Feb12_FeedbackWHO_28022018 (1).doc | 2025-11-20 22:08 | 53K | |
![[ ]](/icons/unknown.gif) | 3ДОРОЖНАЯ_КАРТА_ОБЩАЯ_comments 2018 March 13 (3).docx | 2025-11-20 22:08 | 34K | |
![[ ]](/icons/unknown.gif) | 2_Areas_for_capacity_building_28022018.docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | 1_DRG_Implementation_plan_2018_FeedbackWHO_28022018 (copy).xlsx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/layout.gif) | 01 958.pdf | 2025-11-20 22:08 | 73K | |
![[ ]](/icons/layout.gif) | 01-26591 მოხსენებითი ბარათი.pdf | 2025-11-20 22:08 | 97K | |
![[ ]](/icons/layout.gif) | 01-25372 მოხსენებითი ბარათი.pdf | 2025-11-20 22:08 | 56K | |
![[ ]](/icons/layout.gif) | 01-20639 მოხსენებითი ბარათი.pdf | 2025-11-20 22:08 | 52K | |
![[ ]](/icons/layout.gif) | 01-19995 მოხსენებითი ბარათი.pdf | 2025-11-20 22:08 | 51K | |
![[ ]](/icons/layout.gif) | 01-19720 მოხსენებითი ბარათი.pdf | 2025-11-20 22:08 | 110K | |
![[ ]](/icons/layout.gif) | 01-19689 მოხსენებითი ბარათი.pdf | 2025-11-20 22:08 | 111K | |
![[ ]](/icons/layout.gif) | 01-19362 მოხსენებითი ბარათი.pdf | 2025-11-20 22:08 | 72K | |
![[ ]](/icons/layout.gif) | 01-6894 მოხსენებითი ბარათი.pdf | 2025-11-20 22:08 | 60K | |
![[ ]](/icons/unknown.gif) | შეფასების ფორმა (3).xlsx | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/unknown.gif) | შეფასება.xlsx | 2025-11-20 22:08 | 23K | |
![[ ]](/icons/unknown.gif) | იორდანიის პროექტი (1).docx | 2025-11-20 22:08 | 35K | |
![[ ]](/icons/unknown.gif) | თამუნა.xls | 2025-11-20 22:08 | 134K | |
![[ ]](/icons/unknown.gif) | Порядок форума 2018.doc | 2025-11-20 22:08 | 49K | |
![[ ]](/icons/unknown.gif) | Меморандум_Грузия-Беларусь.docx | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | Меморандум_Беларусь-Грузия.docx | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | untitled_job1-1.djvu | 2025-11-20 22:08 | 229K | |
![[ ]](/icons/layout.gif) | mkurnali pasport.pdf | 2025-11-20 22:08 | 37K | |
![[ ]](/icons/layout.gif) | mkurnali ID.pdf | 2025-11-20 22:08 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (79).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (78).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (327).jpg | 2025-11-20 22:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (326).jpg | 2025-11-20 22:08 | 1.5M | |
![[IMG]](/icons/image2.gif) | image001 (325).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (324).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (323).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (322).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (321).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (108).png | 2025-11-20 22:08 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (107).png | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | Strategic purchasing strategy SSA (1).docx | 2025-11-20 22:08 | 44K | |
![[ ]](/icons/unknown.gif) | SSA worksheet 23_3_18.xlsx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | Questionnaire on the right of persons with disabilities to the highest attainable standard of health.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/layout.gif) | Passport Lado Tsikarishvili.pdf | 2025-11-20 22:08 | 120K | |
![[IMG]](/icons/image2.gif) | Pasport-Irakli Vardzukashvili_20180321_0001.jpg | 2025-11-20 22:08 | 1.2M | |
![[ ]](/icons/layout.gif) | Mr Sergeenko MoL GEO.pdf | 2025-11-20 22:08 | 385K | |
![[ ]](/icons/unknown.gif) | Homework_13032018_PEST_revised_19032018_v1-20_03_2018 -Copy.docx | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/unknown.gif) | GEO_Health_Sector_Diagnostics_20032018__comments (1).docx | 2025-11-20 22:08 | 47K | |
![[ ]](/icons/layout.gif) | GEO BerlinNomLetterFunded_ENG_final.pdf | 2025-11-20 22:08 | 84K | |
![[ ]](/icons/layout.gif) | GEO BerlinNomLetterFunded_ENG_final (1).pdf | 2025-11-20 22:08 | 84K | |
![[ ]](/icons/unknown.gif) | Copy of Pankisi - Action Plan 02_03_18.xlsx | 2025-11-20 22:08 | 127K | |
![[ ]](/icons/unknown.gif) | CV-mariana (1).docx | 2025-11-20 22:08 | 25K | |
![[TXT]](/icons/text.gif) | ATT00001 (48).htm | 2025-11-20 22:08 | 295 | |
![[ ]](/icons/unknown.gif) | AA 2018 action plan.xls | 2025-11-20 22:08 | 115K | |
![[ ]](/icons/layout.gif) | 20180321_RFI_DRG-grouper_Software_For_Georgia_Ministry_of_health_by_FCG_Prodacapo_Finland_Oy (1).pdf | 2025-11-20 22:08 | 675K | |
![[ ]](/icons/unknown.gif) | 2018-03_UHC.xlsx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | 2018 წლის გეგმა_არასამტავრობოების კომენტარები-პლატფორმა(1)_MoLHSA.doc | 2025-11-20 22:08 | 111K | |
![[ ]](/icons/unknown.gif) | 2018 წლის გეგმა_არასამთავრობოების კომენტარები_პლატფორმა (1).doc | 2025-11-20 22:08 | 102K | |
![[ ]](/icons/unknown.gif) | 2018 წლის გეგმა_არასამთავრობოების კომენტარები_პლატფორმა (1) (1).doc | 2025-11-20 22:08 | 102K | |
![[ ]](/icons/unknown.gif) | 2 Areas_for_capacity_building_21032018 (2).xlsx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/layout.gif) | ცნობა.pdf | 2025-11-20 22:08 | 96K | |
![[ ]](/icons/unknown.gif) | შეფასების ფორმა (2).xlsx | 2025-11-20 22:08 | 42K | |
![[ ]](/icons/layout.gif) | სერთიფიკატი.pdf | 2025-11-20 22:08 | 570K | |
![[ ]](/icons/layout.gif) | რეკომენდაცია.pdf | 2025-11-20 22:08 | 52K | |
![[ ]](/icons/unknown.gif) | პანკისის სამოქმედო გეგმა rac-formatshi.xlsx | 2025-11-20 22:08 | 137K | |
![[ ]](/icons/unknown.gif) | პანკისის სამოქმედო გეგმა rac-formatshi (3).xlsx | 2025-11-20 22:08 | 136K | |
![[ ]](/icons/unknown.gif) | პანკისის სამოქმედო გეგმა rac-formatshi (2).xlsx | 2025-11-20 22:08 | 136K | |
![[ ]](/icons/unknown.gif) | პანკისის სამოქმედო გეგმა rac-formatshi (1).xlsx | 2025-11-20 22:08 | 136K | |
![[ ]](/icons/unknown.gif) | მოსაწვევი _პროექტი_29 03 2018.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | იორდანიის პროექტი.docx | 2025-11-20 22:08 | 36K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი_29 03 2018 (1).docx | 2025-11-20 22:08 | 270K | |
![[ ]](/icons/layout.gif) | დიპლომი.pdf | 2025-11-20 22:08 | 711K | |
![[ ]](/icons/layout.gif) | nomination from Georgia_23-25 April, Berlin.pdf | 2025-11-20 22:08 | 88K | |
![[IMG]](/icons/image2.gif) | image006 (10).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image005 (15).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (77).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (76).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image003 (75).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image002 (125).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (124).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (123).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (122).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (121).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (120).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (119).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (52).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (320).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (319).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (318).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (317).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (316).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (315).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (314).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (313).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (312).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (311).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (310).jpg | 2025-11-20 22:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | image001 (309).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (308).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (307).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (306).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (305).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (304).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (303).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (302).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (301).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (300).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (106).png | 2025-11-20 22:08 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (105).png | 2025-11-20 22:08 | 1.0K | |
![[ ]](/icons/layout.gif) | hotel booking form.pdf | 2025-11-20 22:08 | 130K | |
![[ ]](/icons/unknown.gif) | first draft agenda 19 April 2018_MoLHSA.docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | first draft agenda (2) (2).docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | first draft agenda (2) (2) (2).docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | first draft agenda (2) (2) (1).docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | disabilities.docx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | UHCP Georgia Action Plan 2018.docx | 2025-11-20 22:08 | 58K | |
![[ ]](/icons/layout.gif) | Transportation info Cph.pdf | 2025-11-20 22:08 | 70K | |
![[ ]](/icons/layout.gif) | Summer School 2018_ application form.pdf | 2025-11-20 22:08 | 233K | |
![[ ]](/icons/unknown.gif) | SC VI_2_ final operational conclusions 2017 (6).doc | 2025-11-20 22:08 | 68K | |
![[ ]](/icons/unknown.gif) | SC VI_2_ final operational conclusions 2017 (5).doc | 2025-11-20 22:08 | 68K | |
![[ ]](/icons/unknown.gif) | SC VI_2_ final operational conclusions 2017 (4).doc | 2025-11-20 22:08 | 68K | |
![[ ]](/icons/unknown.gif) | S&P Eng.doc | 2025-11-20 22:08 | 114K | |
![[ ]](/icons/unknown.gif) | Report Form.xlsx | 2025-11-20 22:08 | 8.9K | |
![[ ]](/icons/unknown.gif) | Joint ECDC WHO meeting agenda 11-15 June.xlsx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | Info circular.docx | 2025-11-20 22:08 | 69K | |
![[ ]](/icons/unknown.gif) | GEO_pathway_next_steps_Feb23_2018.docx | 2025-11-20 22:08 | 293K | |
![[ ]](/icons/layout.gif) | GEO-reform-gesundheitswesen-d (2).pdf | 2025-11-20 22:08 | 876K | |
![[ ]](/icons/unknown.gif) | DRAFT GHSA 2024 Framework v1_0 (March 2018-for consultation).docx | 2025-11-20 22:08 | 75K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 Spanish.pdf | 2025-11-20 22:08 | 191K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 Spanish (1).pdf | 2025-11-20 22:08 | 191K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 Russian.pdf | 2025-11-20 22:08 | 252K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 Russian (1).pdf | 2025-11-20 22:08 | 252K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 French.pdf | 2025-11-20 22:08 | 260K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 French (1).pdf | 2025-11-20 22:08 | 260K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 Chinese.pdf | 2025-11-20 22:08 | 547K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 Chinese (1).pdf | 2025-11-20 22:08 | 547K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 Arabic.pdf | 2025-11-20 22:08 | 255K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 Arabic (1).pdf | 2025-11-20 22:08 | 255K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 (WHA71).pdf | 2025-11-20 22:08 | 180K | |
![[ ]](/icons/layout.gif) | C_L_8_2018 (WHA71) (1).pdf | 2025-11-20 22:08 | 180K | |
![[TXT]](/icons/text.gif) | ATT00006 (11).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00006 (10).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005 (12).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (11).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (18).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (17).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (27).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (26).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (41).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (40).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (47).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (46).htm | 2025-11-20 22:08 | 216 | |
![[ ]](/icons/unknown.gif) | AA 2017 წლის შესრულება_ჯანდაცვის სამინისტრო (1).doc | 2025-11-20 22:08 | 476K | |
![[ ]](/icons/layout.gif) | 20180321_RFI_DRG-grouper_Software_For_Georgia_Ministry_of_health_by_FCG_Prodacapo_Finland_Oy.pdf | 2025-11-20 22:08 | 675K | |
![[ ]](/icons/unknown.gif) | 3 ToR_DRGWG_Feb12_FeedbackWHO_25032018 (1).doc | 2025-11-20 22:08 | 57K | |
![[ ]](/icons/unknown.gif) | 2 Areas_for_capacity_building_21032018.xlsx | 2025-11-20 22:08 | 11K | |
![[ ]](/icons/unknown.gif) | 2 Areas_for_capacity_building_21032018 (1).xlsx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/layout.gif) | შრომის, ჯანმრთელობისა და სოციალური დაცვის სამინისტროს_28_03_2018.pdf | 2025-11-20 22:08 | 208K | |
![[ ]](/icons/unknown.gif) | შესრულება _უზბეკეთის კომისიის მე-7 სხდომა.doc | 2025-11-20 22:08 | 107K | |
![[ ]](/icons/layout.gif) | ფინანსთა სამინისტროს_28_03_2018.pdf | 2025-11-20 22:08 | 207K | |
![[ ]](/icons/layout.gif) | საგარეო საქმეთა სამინისტროს_28_03_2018.pdf | 2025-11-20 22:08 | 209K | |
![[ ]](/icons/layout.gif) | რეგიონული განვითარებისა და ინფრასტრუქტურის სამინისტროს_28_03_2018.pdf | 2025-11-20 22:08 | 207K | |
![[ ]](/icons/unknown.gif) | ოქმის პროექტი_უზბეკეთის კომისიის მე-8 სხდომა.doc | 2025-11-20 22:08 | 110K | |
![[ ]](/icons/layout.gif) | კულტურისა და სპორტის სამინისტროს_28_03_2018.pdf | 2025-11-20 22:08 | 206K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი_29 03 2018.docx | 2025-11-20 22:08 | 270K | |
![[ ]](/icons/layout.gif) | გარემოს დაცვისა და სოფლის მეურნეობის სამინისტროს_28_03_2018.pdf | 2025-11-20 22:08 | 207K | |
![[ ]](/icons/layout.gif) | განათლებისა და მეცნიერების სამინისტროს_28_03_2018.pdf | 2025-11-20 22:08 | 207K | |
![[ ]](/icons/unknown.gif) | გაერთიანებული_SDG_21_02_2018 (1).docx | 2025-11-20 22:08 | 97K | |
![[ ]](/icons/layout.gif) | sergeenko_david_DBL.pdf | 2025-11-20 22:08 | 150K | |
![[ ]](/icons/layout.gif) | sergeenko_david_DBL (1).pdf | 2025-11-20 22:08 | 150K | |
![[ ]](/icons/layout.gif) | nomination letter-Irine Kalandadze.pdf | 2025-11-20 22:08 | 132K | |
![[ ]](/icons/layout.gif) | khonelidze_stvilia_TW.pdf | 2025-11-20 22:08 | 152K | |
![[ ]](/icons/layout.gif) | khonelidze_stvilia_TW (1).pdf | 2025-11-20 22:08 | 152K | |
![[IMG]](/icons/image2.gif) | image003 (74).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (29).png | 2025-11-20 22:08 | 7.4K | |
![[IMG]](/icons/image2.gif) | image002 (118).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (117).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (116).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (115).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (114).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (299).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (298).jpg | 2025-11-20 22:08 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (297).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (296).jpg | 2025-11-20 22:08 | 9.7K | |
![[IMG]](/icons/image2.gif) | image001 (295).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (294).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (293).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (292).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (291).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (290).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (289).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (288).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (287).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image001 (286).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (285).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (284).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (283).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (282).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (104).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (103).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (102).png | 2025-11-20 22:08 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (101).png | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/layout.gif) | gamkrelidze_amiran_DBL.pdf | 2025-11-20 22:08 | 151K | |
![[ ]](/icons/layout.gif) | gamkrelidze_amiran_DBL (1).pdf | 2025-11-20 22:08 | 151K | |
![[ ]](/icons/unknown.gif) | code Copy of 29_03_18 - რგპ ფინანსური ცხრილი - საბიუჯეტო კოდებით (2).xlsx | 2025-11-20 22:08 | 236K | |
![[ ]](/icons/layout.gif) | belkania_sofiko_DBL (00000002).pdf | 2025-11-20 22:08 | 151K | |
![[ ]](/icons/layout.gif) | belkania_sofiko_DBL (00000002) (1).pdf | 2025-11-20 22:08 | 151K | |
![[ ]](/icons/unknown.gif) | TAG Letter Minister to JW draft 28 March 2018.docx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/unknown.gif) | TAG Letter Minister to JM draft 28 March 2018.docx | 2025-11-20 22:08 | 12K | |
![[ ]](/icons/layout.gif) | Scope and Purpose GEO AEFI Guideline and Training Workshop_Eng-Final.pdf | 2025-11-20 22:08 | 186K | |
![[ ]](/icons/unknown.gif) | SMR comments 2018.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | SDGs SOCIAL_ზაზასთვის.pptx | 2025-11-20 22:08 | 3.7M | |
![[ ]](/icons/unknown.gif) | SC VI_2_ final operational conclusions 2017 (3).doc | 2025-11-20 22:08 | 87K | |
![[ ]](/icons/layout.gif) | Letter to MoH GEO AEFI guideline mission April-2018_Eng.pdf | 2025-11-20 22:08 | 56K | |
![[ ]](/icons/layout.gif) | Letter to Dr_ Dara.pdf | 2025-11-20 22:08 | 189K | |
![[ ]](/icons/unknown.gif) | GEO AEFI assessment Questionnaires_ENG (1).xlsx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/layout.gif) | GEO-reform-gesundheitswesen-d (1).pdf | 2025-11-20 22:08 | 876K | |
![[ ]](/icons/unknown.gif) | Comments of the Georgian authorities - 16 Consolidated report.docx | 2025-11-20 22:08 | 28K | |
![[TXT]](/icons/text.gif) | ATT00002 (39).htm | 2025-11-20 22:08 | 345 | |
![[TXT]](/icons/text.gif) | ATT00001 (45).htm | 2025-11-20 22:08 | 441 | |
![[ ]](/icons/unknown.gif) | AA2017Geoparliament.pptx | 2025-11-20 22:08 | 396K | |
![[ ]](/icons/unknown.gif) | 22_03_2018_Post_RDP_30_02_MRDI_The_FINAL-CLEAN-to_be_disseminated (2).docx | 2025-11-20 22:08 | 3.4M | |
![[ ]](/icons/unknown.gif) | 17th draft consolidated report version 29032018.docx | 2025-11-20 22:08 | 94K | |
![[ ]](/icons/unknown.gif) | 4_DRG_monitoring_feedbackWHO_29032018.docx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | 3 ToR_DRGWG_Feb12_FeedbackWHO_25032018.doc | 2025-11-20 22:08 | 57K | |
![[ ]](/icons/unknown.gif) | 3 ToR_DRGWG_Feb12_FeedbackWHO_290317 (1).doc | 2025-11-20 22:08 | 52K | |
![[ ]](/icons/layout.gif) | შეთანხმება.pdf | 2025-11-20 22:08 | 6.8M | |
![[ ]](/icons/unknown.gif) | ფსიქოზები სტატისტიკა.xlsx | 2025-11-20 22:08 | 20K | |
![[ ]](/icons/unknown.gif) | მოწვეულ პირთა სია.docx | 2025-11-20 22:08 | 16K | |
![[TXT]](/icons/text.gif) | მინდობილობა - პერსონალურზე.htm | 2025-11-20 22:08 | 51K | |
![[ ]](/icons/unknown.gif) | კვირის ფორმა.xlsx | 2025-11-20 22:08 | 11K | |
![[ ]](/icons/unknown.gif) | თანამშრომლები_.docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | გაერთიანებული_SDG_21_02_2018.docx | 2025-11-20 22:08 | 97K | |
![[ ]](/icons/unknown.gif) | ასოცირებადეტალური.docx | 2025-11-20 22:08 | 59K | |
![[ ]](/icons/unknown.gif) | visa support letter.doc | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/layout.gif) | letter to Bloomberg.pdf | 2025-11-20 22:08 | 129K | |
![[IMG]](/icons/image2.gif) | image015 (1).jpg | 2025-11-20 22:08 | 6.5K | |
![[IMG]](/icons/image2.gif) | image014.png | 2025-11-20 22:08 | 20K | |
![[IMG]](/icons/image2.gif) | image013.png | 2025-11-20 22:08 | 1.6K | |
![[IMG]](/icons/image2.gif) | image011 (3).jpg | 2025-11-20 22:08 | 6.5K | |
![[IMG]](/icons/image2.gif) | image011 (2).jpg | 2025-11-20 22:08 | 6.5K | |
![[IMG]](/icons/image2.gif) | image010 (3).png | 2025-11-20 22:08 | 1.2K | |
![[IMG]](/icons/image2.gif) | image010 (2).png | 2025-11-20 22:08 | 20K | |
![[IMG]](/icons/image2.gif) | image010 (1).png | 2025-11-20 22:08 | 20K | |
![[IMG]](/icons/image2.gif) | image009 (3).png | 2025-11-20 22:08 | 1.8K | |
![[IMG]](/icons/image2.gif) | image009 (2).png | 2025-11-20 22:08 | 1.2K | |
![[IMG]](/icons/image2.gif) | image009 (1).png | 2025-11-20 22:08 | 1.2K | |
![[IMG]](/icons/image2.gif) | image008 (2).png | 2025-11-20 22:08 | 1.8K | |
![[IMG]](/icons/image2.gif) | image008 (1).png | 2025-11-20 22:08 | 1.8K | |
![[IMG]](/icons/image2.gif) | image007 (2).png | 2025-11-20 22:08 | 1.6K | |
![[IMG]](/icons/image2.gif) | image007 (1).png | 2025-11-20 22:08 | 1.6K | |
![[IMG]](/icons/image2.gif) | image006 (4).png | 2025-11-20 22:08 | 22K | |
![[IMG]](/icons/image2.gif) | image004 (17).png | 2025-11-20 22:08 | 25K | |
![[IMG]](/icons/image2.gif) | image004 (16).png | 2025-11-20 22:08 | 25K | |
![[IMG]](/icons/image2.gif) | image004 (15).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (73).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (72).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (71).jpg | 2025-11-20 22:08 | 2.5K | |
![[IMG]](/icons/image2.gif) | image003 (70).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (69).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (113).jpg | 2025-11-20 22:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | image002 (112).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (111).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (110).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (109).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (51).png | 2025-11-20 22:08 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (50).png | 2025-11-20 22:08 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (49).png | 2025-11-20 22:08 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (281).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (280).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (279).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (278).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (277).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (276).jpg | 2025-11-20 22:08 | 2.5K | |
![[IMG]](/icons/image2.gif) | image001 (275).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (274).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (273).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (272).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (271).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (270).jpg | 2025-11-20 22:08 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (269).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (268).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (100).png | 2025-11-20 22:08 | 25K | |
![[IMG]](/icons/image2.gif) | image001 (99).png | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | iaponia დანართი 1.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | draft agenda 19 April 2018_Ge (4).docx | 2025-11-20 22:08 | 28K | |
![[ ]](/icons/unknown.gif) | draft agenda 19 April 2018 (3).docx | 2025-11-20 22:08 | 24K | |
![[ ]](/icons/unknown.gif) | draft agenda 19 April 2018 (2).docx | 2025-11-20 22:08 | 33K | |
![[ ]](/icons/unknown.gif) | annotated agenda HR 2017 (1).docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | WHA71_sideevent_application Global Citizens Dialogue 2018_Rev1.docx | 2025-11-20 22:08 | 209K | |
![[ ]](/icons/unknown.gif) | WHA71_sideevent_application.docx | 2025-11-20 22:08 | 210K | |
![[ ]](/icons/unknown.gif) | ToR GEO pathway_analysis_scope_10March2018.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | SC VI_2_ final operational conclusions 2017_MoLHSA_3_04_2018.doc | 2025-11-20 22:08 | 107K | |
![[ ]](/icons/unknown.gif) | SC VI_2_ final operational conclusions 2017_MoLHSA.doc | 2025-11-20 22:08 | 106K | |
![[ ]](/icons/unknown.gif) | MOH Rd 23.doc | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | GEO AEFI assessmentQuestionnaires_ENG.XLSX | 2025-11-20 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | GEO AEFI assessment Questionnaires_ENG.XLSX | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | DRG_მოკლე ანგარიში.docx | 2025-11-20 22:08 | 29K | |
![[TXT]](/icons/text.gif) | ATT00001 (44).htm | 2025-11-20 22:08 | 179 | |
![[ ]](/icons/unknown.gif) | AEFI mission agenda April Tbilisi 2018-03 EL-4_4_18.doc | 2025-11-20 22:08 | 849K | |
![[ ]](/icons/unknown.gif) | 29_03_18 - რგპ ფინანსური ცხრილი - საბიუჯეტო კოდებით.xlsx | 2025-11-20 22:08 | 237K | |
![[ ]](/icons/unknown.gif) | 29_03_18 - რგპ ფინანსური ცხრილი - საბიუჯეტო კოდებით (2).xlsx | 2025-11-20 22:08 | 211K | |
![[ ]](/icons/unknown.gif) | 29_03_18 - რგპ ფინანსური ცხრილი - საბიუჯეტო კოდებით (1).xlsx | 2025-11-20 22:08 | 237K | |
![[ ]](/icons/unknown.gif) | 17th draft consolidated report version 29_03_18.docx | 2025-11-20 22:08 | 92K | |
![[ ]](/icons/unknown.gif) | 17th draft consolidated report version 29_03_18 (1).docx | 2025-11-20 22:08 | 92K | |
![[ ]](/icons/layout.gif) | ჯანდაცვის_სამინისტროს (1).pdf | 2025-11-20 22:08 | 452K | |
![[ ]](/icons/layout.gif) | შენიშვნები-სოფელზე.pdf | 2025-11-20 22:08 | 47K | |
![[ ]](/icons/layout.gif) | სოფლის წერილი.pdf | 2025-11-20 22:08 | 278K | |
![[ ]](/icons/layout.gif) | სერგეენკოს_-_13_04_კომიტეტის_სხდომაზე_მოწვევა.pdf | 2025-11-20 22:08 | 203K | |
![[ ]](/icons/unknown.gif) | გეგმა-სოფელი.xlsx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | ანგარიში-სოფელი.docx | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/layout.gif) | Письмо №107 от 30_03_18.pdf | 2025-11-20 22:08 | 1.8M | |
![[ ]](/icons/layout.gif) | statement.pdf | 2025-11-20 22:08 | 373K | |
![[ ]](/icons/layout.gif) | instructions-for-candidates (1).pdf | 2025-11-20 22:08 | 504K | |
![[ ]](/icons/unknown.gif) | information on agenda items_19 April.docx | 2025-11-20 22:08 | 39K | |
![[IMG]](/icons/image2.gif) | image003 (68).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (108).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (107).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (106).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (105).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (267).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (266).jpg | 2025-11-20 22:08 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (265).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (264).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (263).jpg | 2025-11-20 22:08 | 3.0K | |
![[IMG]](/icons/image2.gif) | image001 (262).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (261).jpg | 2025-11-20 22:08 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (260).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (259).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (258).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (257).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (256).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (255).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (254).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (98).png | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | draft agenda 19 April 2018.docx | 2025-11-20 22:08 | 48K | |
![[ ]](/icons/unknown.gif) | draft agenda 19 April 2018 (1).docx | 2025-11-20 22:08 | 44K | |
![[ ]](/icons/unknown.gif) | annotated agenda HR 2017.docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/layout.gif) | Ticket Amiran Gamkrelidze.pdf | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/layout.gif) | Ticket Amiran Gamkrelidze (2).pdf | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/layout.gif) | Ticket Amiran Gamkrelidze (1).pdf | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania tiket.pdf | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania tiket (2).pdf | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania tiket (1).pdf | 2025-11-20 22:08 | 32K | |
![[IMG]](/icons/image2.gif) | Minister's presentation agenda.png | 2025-11-20 22:08 | 126K | |
![[ ]](/icons/unknown.gif) | MOH_EASL2018 6_04_2018.pptx | 2025-11-20 22:08 | 2.5M | |
![[ ]](/icons/unknown.gif) | MOH_EASL2018 6_04_2018 (2).pptx | 2025-11-20 22:08 | 2.5M | |
![[ ]](/icons/unknown.gif) | MOH_EASL2018 6_04_2018 (1).pptx | 2025-11-20 22:08 | 2.5M | |
![[ ]](/icons/layout.gif) | Invitation_Georgia_Ms-Sofiko-Belkania.pdf | 2025-11-20 22:08 | 228K | |
![[ ]](/icons/layout.gif) | HRD_Draft.pdf | 2025-11-20 22:08 | 59K | |
![[ ]](/icons/layout.gif) | HRD_Draft (1).pdf | 2025-11-20 22:08 | 59K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_10042018 (1).xlsx | 2025-11-20 22:08 | 40K | |
![[ ]](/icons/layout.gif) | From the Ministry of Labour Health and Social Affairs of Georgia_pdf April.pdf | 2025-11-20 22:08 | 88K | |
![[ ]](/icons/layout.gif) | Encl_3_Information-circular_05-04-2018.pdf | 2025-11-20 22:08 | 768K | |
![[ ]](/icons/layout.gif) | Encl_2_Tallinn 2018_Provisional Programme_05-04-2018.pdf | 2025-11-20 22:08 | 468K | |
![[ ]](/icons/layout.gif) | Encl_1_Scope and Purpose_Tallinn2018.pdf | 2025-11-20 22:08 | 263K | |
![[IMG]](/icons/image2.gif) | Drug Center Pharmacy Letter.jpg | 2025-11-20 22:08 | 440K | |
![[ ]](/icons/unknown.gif) | Drug Center Pharmacy.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | Draft_DRG_background_note_list_of_FAQ_10_04_2018.docx | 2025-11-20 22:08 | 54K | |
![[ ]](/icons/layout.gif) | David Sergeenko ticket.pdf | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/layout.gif) | David Sergeenko ticket (2).pdf | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/layout.gif) | David Sergeenko ticket (1).pdf | 2025-11-20 22:08 | 32K | |
![[ ]](/icons/unknown.gif) | David Sergeenko - Bio (2).docx | 2025-11-20 22:08 | 64K | |
![[ ]](/icons/unknown.gif) | David Sergeenko - Bio (1).docx | 2025-11-20 22:08 | 63K | |
![[ ]](/icons/unknown.gif) | DRG_implementation_and_transition_strategy_March2018 (1).xlsx | 2025-11-20 22:08 | 21K | |
![[ ]](/icons/layout.gif) | DRG_implementation_and_transition_strategy_March2018 (1).pdf | 2025-11-20 22:08 | 256K | |
![[ ]](/icons/unknown.gif) | Company Profile.docx | 2025-11-20 22:08 | 131K | |
![[ ]](/icons/unknown.gif) | CDC_EASL_SIDE-MEETING-GEORGIA-2018_Draft.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | CDC_EASL_SIDE-MEETING-GEORGIA-2018_Draft (1).docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | CDC_EASL_Decentralization2018_FINAL.DOCX | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | CDC_EASL_Decentralization2018_FINAL (1).docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | 19 April 2018_final draft agenda.docx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | 5_Draft_DRG_communication_plan_feedbackWHO_4_04_2018.docx | 2025-11-20 22:08 | 49K | |
![[ ]](/icons/layout.gif) | შეხვედრის_ანგარიში.pdf | 2025-11-20 22:08 | 80K | |
![[ ]](/icons/layout.gif) | შეხვედრის_ანგარიში (1).pdf | 2025-11-20 22:08 | 80K | |
![[ ]](/icons/unknown.gif) | პანკისის სამოქმედო გეგმა.xlsx | 2025-11-20 22:08 | 137K | |
![[ ]](/icons/unknown.gif) | პანკისის სამოქმედო გეგმა (1).xlsx | 2025-11-20 22:08 | 137K | |
![[ ]](/icons/unknown.gif) | sympa.docx | 2025-11-20 22:08 | 44K | |
![[ ]](/icons/layout.gif) | letter to Dr_ Robert Redfield_.pdf | 2025-11-20 22:08 | 91K | |
![[IMG]](/icons/image2.gif) | image003 (67).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (66).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (65).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (28).png | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (104).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (103).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (102).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (48).png | 2025-11-20 22:08 | 7.4K | |
![[IMG]](/icons/image2.gif) | image002 (47).png | 2025-11-20 22:08 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (253).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (252).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (251).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (250).jpg | 2025-11-20 22:08 | 7.1K | |
![[IMG]](/icons/image2.gif) | image001 (249).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (248).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (247).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (246).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (245).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (244).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (243).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (97).png | 2025-11-20 22:08 | 1.0K | |
![[IMG]](/icons/image2.gif) | image001 (96).png | 2025-11-20 22:08 | 1.0K | |
![[ ]](/icons/unknown.gif) | WHOEURO ExtensionNominationLetter E 201804 (1).PDF | 2025-11-20 22:08 | 67K | |
![[ ]](/icons/unknown.gif) | TSA_Nino Odisharia (1).pptx | 2025-11-20 22:08 | 410K | |
![[IMG]](/icons/image2.gif) | Sergeenko_951 USD_.JPG | 2025-11-20 22:08 | 197K | |
![[IMG]](/icons/image2.gif) | Sergeenko_951 USD.JPG | 2025-11-20 22:08 | 258K | |
![[IMG]](/icons/image2.gif) | Sergeenko_.JPG | 2025-11-20 22:08 | 195K | |
![[IMG]](/icons/image2.gif) | Sergeenko.JPG | 2025-11-20 22:08 | 269K | |
![[ ]](/icons/layout.gif) | Scope_and_Purpose_HCs_NN Meeting_Antalya_TUR_25-27_April_2018 v2 (1).pdf | 2025-11-20 22:08 | 242K | |
![[ ]](/icons/layout.gif) | Scientific_Programm_Eng.pdf | 2025-11-20 22:08 | 126K | |
![[ ]](/icons/unknown.gif) | SYMPA9_Georgiaaaaaaaaaaaaaaaa.xlsx | 2025-11-20 22:08 | 11K | |
![[ ]](/icons/unknown.gif) | SC VI_2_ final operational conclusions 2017 (2).doc | 2025-11-20 22:08 | 108K | |
![[ ]](/icons/unknown.gif) | SC VI_2_ final operational conclusions 2017 (1).doc | 2025-11-20 22:08 | 108K | |
![[ ]](/icons/layout.gif) | Provisional_Programme_HCs_NN Meeting_Antalya_TUR_25-27_April_2018 v4 (1).pdf | 2025-11-20 22:08 | 417K | |
![[ ]](/icons/layout.gif) | Prodacapo_NordDRG_Batch_Grouper_Users_Guide.pdf | 2025-11-20 22:08 | 548K | |
![[ ]](/icons/layout.gif) | Prodacapo_Grouper_REST_API_general_description.pdf | 2025-11-20 22:08 | 98K | |
![[ ]](/icons/layout.gif) | Prodacapo DRG Server UM.pdf | 2025-11-20 22:08 | 707K | |
![[ ]](/icons/unknown.gif) | Presentation study visit.pptx | 2025-11-20 22:08 | 6.9M | |
![[ ]](/icons/layout.gif) | List of Speakers_Last.pdf | 2025-11-20 22:08 | 123K | |
![[ ]](/icons/unknown.gif) | Labour_Elza Jgerenaia (1).pptx | 2025-11-20 22:08 | 225K | |
![[ ]](/icons/layout.gif) | Invitation letter Ms Adamia _ENG.pdf | 2025-11-20 22:08 | 104K | |
![[ ]](/icons/unknown.gif) | Internal HRD Agenda (2).doc | 2025-11-20 22:08 | 44K | |
![[ ]](/icons/layout.gif) | Information Circular - NN Meeting Antalya (1).pdf | 2025-11-20 22:08 | 515K | |
![[ ]](/icons/layout.gif) | Indicator list.pdf | 2025-11-20 22:08 | 266K | |
![[ ]](/icons/layout.gif) | Georgia (2).pdf | 2025-11-20 22:08 | 61K | |
![[ ]](/icons/unknown.gif) | GEO_Health_Sector_Diagnostics_11_04_18.docx | 2025-11-20 22:08 | 52K | |
![[ ]](/icons/layout.gif) | Explanatory notes.pdf | 2025-11-20 22:08 | 109K | |
![[ ]](/icons/layout.gif) | Ecomed_VisualDRG_Overview_ENG.pdf | 2025-11-20 22:08 | 791K | |
![[ ]](/icons/layout.gif) | Darakhvelidze.pdf | 2025-11-20 22:08 | 212K | |
![[ ]](/icons/layout.gif) | Country profile Georgia.pdf | 2025-11-20 22:08 | 431K | |
![[ ]](/icons/layout.gif) | C_L_12_2018 Spanish.pdf | 2025-11-20 22:08 | 59K | |
![[ ]](/icons/layout.gif) | C_L_12_2018 Russian.pdf | 2025-11-20 22:08 | 93K | |
![[ ]](/icons/layout.gif) | C_L_12_2018 French.pdf | 2025-11-20 22:08 | 56K | |
![[ ]](/icons/layout.gif) | C_L_12_2018 Chinese.pdf | 2025-11-20 22:08 | 169K | |
![[ ]](/icons/layout.gif) | C_L_12_2018 Arabic.pdf | 2025-11-20 22:08 | 108K | |
![[ ]](/icons/layout.gif) | C_L_12_2018 (GCNMO and Triad mtg).pdf | 2025-11-20 22:08 | 88K | |
![[ ]](/icons/unknown.gif) | CV_REG_E_form (1).doc | 2025-11-20 22:08 | 95K | |
![[ ]](/icons/layout.gif) | Briefing Note to Member States on WHO European National Healthy Cities Networks (1).pdf | 2025-11-20 22:08 | 275K | |
![[TXT]](/icons/text.gif) | ATT00006 (9).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005 (10).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (9).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00004 (16).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (15).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (25).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (24).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (23).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (22).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (38).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (37).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (36).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (35).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (34).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (33).htm | 2025-11-20 22:08 | 179 | |
![[TXT]](/icons/text.gif) | ATT00001 (43).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (42).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (41).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (40).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (39).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (38).htm | 2025-11-20 22:08 | 227 | |
![[ ]](/icons/layout.gif) | 2018 AGENDA_CISPPRI2_FINAL (2).pdf | 2025-11-20 22:08 | 272K | |
![[ ]](/icons/unknown.gif) | 19_04_2018_SC-VI_3-final draft agenda.docx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | 19_04_2018_SC-VI_3-final draft agenda (1).docx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | 19 April 2018_final draft agenda with social dialogue.docx | 2025-11-20 22:08 | 25K | |
![[ ]](/icons/unknown.gif) | 9-tipireba.doc | 2025-11-20 22:08 | 375K | |
![[ ]](/icons/unknown.gif) | საპასუხო_ნოტა_Geo translation.doc | 2025-11-20 22:08 | 37K | |
![[ ]](/icons/layout.gif) | საპასუხო_ნოტა_ხელმოწერილი.pdf | 2025-11-20 22:08 | 285K | |
![[ ]](/icons/unknown.gif) | განმარტებითი_ბარათი ჩინეთზე.doc | 2025-11-20 22:08 | 43K | |
![[ ]](/icons/unknown.gif) | transplantation_Marina Darakhvelidze.pptx | 2025-11-20 22:08 | 44K | |
![[IMG]](/icons/image2.gif) | invitation.djvu | 2025-11-20 22:08 | 68K | |
![[IMG]](/icons/image2.gif) | image008 (5).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image007 (4).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image006 (9).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image005 (14).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image004 (14).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (64).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (63).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (62).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image003 (61).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (60).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (59).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (58).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (101).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (100).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (99).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (242).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (241).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (240).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (239).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (238).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (237).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (236).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (95).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (94).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (93).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (92).png | 2025-11-20 22:08 | 27K | |
![[ ]](/icons/unknown.gif) | WHO FCTC Implementation_EU.pptx | 2025-11-20 22:08 | 5.0M | |
![[ ]](/icons/layout.gif) | Tiflis0924.pdf | 2025-11-20 22:08 | 309K | |
![[ ]](/icons/unknown.gif) | TSA_Nino Odisharia.pptx | 2025-11-20 22:08 | 410K | |
![[ ]](/icons/unknown.gif) | Strengthening Blood Safety System in Georgia 19 March 2018.pptx | 2025-11-20 22:08 | 697K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania (1).pdf | 2025-11-20 22:08 | 260K | |
![[ ]](/icons/layout.gif) | Scope and purpose (1).pdf | 2025-11-20 22:08 | 68K | |
![[ ]](/icons/unknown.gif) | SC VI_2_ final operational conclusions 2017.doc | 2025-11-20 22:08 | 107K | |
![[ ]](/icons/unknown.gif) | SC-VI_3-final draft agenda (1).docx | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/layout.gif) | Provisional programme (1).pdf | 2025-11-20 22:08 | 89K | |
![[ ]](/icons/layout.gif) | Mrs_ Sofiko Belkania.pdf | 2025-11-20 22:08 | 299K | |
![[ ]](/icons/layout.gif) | Mrs_ Khatuna Chachava.pdf | 2025-11-20 22:08 | 299K | |
![[ ]](/icons/unknown.gif) | MediPIET_Georgia_2018.ppt | 2025-11-20 22:08 | 2.3M | |
![[ ]](/icons/layout.gif) | Letter Ministry Georgia.pdf | 2025-11-20 22:08 | 350K | |
![[ ]](/icons/unknown.gif) | Last meeting agenda.docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | Labour_Elza Jgerenaia.pptx | 2025-11-20 22:08 | 225K | |
![[ ]](/icons/layout.gif) | Khatuna Chachava (1).pdf | 2025-11-20 22:08 | 260K | |
![[ ]](/icons/layout.gif) | KLatzer GRB in Georgia Intro short v2.pdf | 2025-11-20 22:08 | 734K | |
![[ ]](/icons/layout.gif) | KLatzer GRB GEO.pdf | 2025-11-20 22:08 | 1.1M | |
![[ ]](/icons/unknown.gif) | Internal HRD Agenda.doc | 2025-11-20 22:08 | 44K | |
![[ ]](/icons/unknown.gif) | Internal HRD Agenda (1).doc | 2025-11-20 22:08 | 44K | |
![[ ]](/icons/layout.gif) | Information circular (1).pdf | 2025-11-20 22:08 | 90K | |
![[ ]](/icons/unknown.gif) | IHR_EU.ppt | 2025-11-20 22:08 | 1.2M | |
![[ ]](/icons/unknown.gif) | Health systems_Marina Darakhvelidze.pptx | 2025-11-20 22:08 | 1.2M | |
![[ ]](/icons/layout.gif) | HSS_NCD_Provisional_Programme_eng.pdf | 2025-11-20 22:08 | 274K | |
![[ ]](/icons/layout.gif) | Darakhvelidze Invitation Study Visit.pdf | 2025-11-20 22:08 | 1.4M | |
![[ ]](/icons/layout.gif) | Course Flyer A9711191.pdf | 2025-11-20 22:08 | 1.2M | |
![[ ]](/icons/unknown.gif) | Candidate's profile.docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/layout.gif) | Belkania_service passport.pdf | 2025-11-20 22:08 | 561K | |
![[ ]](/icons/unknown.gif) | Application Form (TC) (2).docx | 2025-11-20 22:08 | 71K | |
![[ ]](/icons/unknown.gif) | Application Form (Grant) (2).doc | 2025-11-20 22:08 | 69K | |
![[ ]](/icons/layout.gif) | Adv course 2018 inv ltr _Kazanjan.pdf | 2025-11-20 22:08 | 70K | |
![[TXT]](/icons/text.gif) | ATT00004 (14).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (21).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (20).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (32).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (31).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (37).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (36).htm | 2025-11-20 22:08 | 216 | |
![[ ]](/icons/unknown.gif) | AMR in Georgia_EU meeting.ppt | 2025-11-20 22:08 | 373K | |
![[IMG]](/icons/image2.gif) | 2 (10).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (9).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (8).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (7).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1 (10).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (9).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (8).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (7).jpg | 2025-11-20 22:08 | 3.2K | |
![[ ]](/icons/unknown.gif) | სახალხო დამცველის რეკომენდაციების თაობაზე_მთავრობა_16_04_2018.docx | 2025-11-20 22:08 | 44K | |
![[ ]](/icons/unknown.gif) | სახალხო დამცველის რეკომენდაციების თაობაზე_მთავრობა.docx | 2025-11-20 22:08 | 46K | |
![[ ]](/icons/unknown.gif) | მარიანა.docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/unknown.gif) | specification of the furniture (4).xlsx | 2025-11-20 22:08 | 1.9M | |
![[ ]](/icons/unknown.gif) | specification of the furniture (3).xlsx | 2025-11-20 22:08 | 1.9M | |
![[ ]](/icons/unknown.gif) | reforms_MoLHSA.docx | 2025-11-20 22:08 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (57).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (56).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image003 (55).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (54).jpg | 2025-11-20 22:08 | 2.7K | |
![[IMG]](/icons/image2.gif) | image003 (53).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (27).png | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (26).png | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (98).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (97).jpg | 2025-11-20 22:08 | 658 | |
![[IMG]](/icons/image2.gif) | image002 (46).png | 2025-11-20 22:08 | 922 | |
![[IMG]](/icons/image2.gif) | image001 (235).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (234).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (233).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (91).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (90).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (89).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (88).png | 2025-11-20 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (87).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (86).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (85).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (84).png | 2025-11-20 22:08 | 27K | |
![[IMG]](/icons/image2.gif) | image001 (83).png | 2025-11-20 22:08 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (82).png | 2025-11-20 22:08 | 3.7K | |
![[ ]](/icons/unknown.gif) | for Maia 25thApril.docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania.pdf | 2025-11-20 22:08 | 260K | |
![[ ]](/icons/unknown.gif) | SC-VI_3_final draft agenda_19_04_2018 (1).docx | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | SC-VI_3-final draft agenda.docx | 2025-11-20 22:08 | 26K | |
![[ ]](/icons/unknown.gif) | Proposed items (4).xls | 2025-11-20 22:08 | 131K | |
![[ ]](/icons/unknown.gif) | Proposed items (3).xls | 2025-11-20 22:08 | 131K | |
![[ ]](/icons/layout.gif) | Policy Dialogue Concept Note.pdf | 2025-11-20 22:08 | 469K | |
![[IMG]](/icons/image2.gif) | OutlookEmoji-����.png | 2025-11-20 22:08 | 488 | |
![[ ]](/icons/unknown.gif) | List of Consultants MoLHSA.docx | 2025-11-20 22:08 | 16K | |
![[ ]](/icons/unknown.gif) | List of Consultants (5) (2).docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | List of Consultants (5) (1).docx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/layout.gif) | Khatuna Chachava.pdf | 2025-11-20 22:08 | 260K | |
![[ ]](/icons/unknown.gif) | Implementation_of_Resolution_(3).docx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/layout.gif) | Dr_ Sargeenko_Formal Invite_Policy Dialogue.pdf | 2025-11-20 22:08 | 185K | |
![[ ]](/icons/unknown.gif) | April 25 LABOUR.docx | 2025-11-20 22:08 | 14K | |
![[ ]](/icons/unknown.gif) | Application Form (TC) (1).docx | 2025-11-20 22:08 | 71K | |
![[ ]](/icons/unknown.gif) | Application Form (Grant) (1).doc | 2025-11-20 22:08 | 69K | |
![[TXT]](/icons/text.gif) | ATT00003 (19).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (18).htm | 2025-11-20 22:08 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (30).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (29).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (28).htm | 2025-11-20 22:08 | 334 | |
![[TXT]](/icons/text.gif) | ATT00001 (35).htm | 2025-11-20 22:08 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (34).htm | 2025-11-20 22:08 | 423 | |
![[TXT]](/icons/text.gif) | ATT00001 (33).htm | 2025-11-20 22:08 | 430 | |
![[ ]](/icons/unknown.gif) | AA_ge_List (1).docx | 2025-11-20 22:08 | 161K | |
![[ ]](/icons/unknown.gif) | AA_GE template emty.docx | 2025-11-20 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | 3_Travel_Details.docx | 2025-11-20 22:08 | 18K | |
![[ ]](/icons/unknown.gif) | 2_Declaration_Form.docx | 2025-11-20 22:08 | 18K | |
![[IMG]](/icons/image2.gif) | 2.jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (6).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (5).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (4).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (3).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (2).jpg | 2025-11-20 22:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2 (1).jpg | 2025-11-20 22:08 | 3.4K | |
![[ ]](/icons/unknown.gif) | 1_Company_Detail_Form.docx | 2025-11-20 22:08 | 19K | |
![[IMG]](/icons/image2.gif) | 1.jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (6).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (5).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (4).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (3).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (2).jpg | 2025-11-20 22:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1 (1).jpg | 2025-11-20 22:08 | 3.2K | |
![[ ]](/icons/unknown.gif) | 1 მაისი 2018.docx | 2025-11-20 22:08 | 679K | |
![[ ]](/icons/layout.gif) | ქონების ეროვნული სააგენტო.pdf | 2025-11-20 22:08 | 46K | |
![[ ]](/icons/unknown.gif) | სამინისტროს მიმართ გაცემული რეკომენდაციების თაობაზე _16_04_2018.docx | 2025-11-20 22:08 | 88K | |
![[ ]](/icons/unknown.gif) | მაია ნიკოლეიშვილი_2-13 აპრილი.xlsx | 2025-11-20 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | მაია ლაგვილავა.PDF | 2025-11-20 22:08 | 482K | |
![[ ]](/icons/unknown.gif) | დღის_წესრიგი_კომისიისთვის.docx | 2025-11-20 22:08 | 33K | |
![[IMG]](/icons/image2.gif) | ~WRD271.jpg | 2025-11-20 22:08 | 823 | |
![[ ]](/icons/unknown.gif) | specification of the furniture (2).xlsx | 2025-11-20 22:08 | 1.9M | |
![[IMG]](/icons/image2.gif) | image012 (1).jpg | 2025-11-20 22:08 | 105K | |
![[IMG]](/icons/image2.gif) | image011 (1).jpg | 2025-11-20 22:08 | 2.2K | |
![[IMG]](/icons/image2.gif) | image010.jpg | 2025-11-20 22:08 | 1.3K | |
![[IMG]](/icons/image2.gif) | image010 (1).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image009.jpg | 2025-11-20 22:08 | 6.3K | |
![[IMG]](/icons/image2.gif) | image009 (1).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image008 (4).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image008 (3).jpg | 2025-11-20 22:08 | 6.0K | |
![[IMG]](/icons/image2.gif) | image005 (13).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image004 (13).jpg | 2025-11-20 22:08 | 5.3K | |
![[IMG]](/icons/image2.gif) | image004 (12).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image004 (11).jpg | 2025-11-20 22:08 | 4.1K | |
![[IMG]](/icons/image2.gif) | image003 (52).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (51).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (50).jpg | 2025-11-20 22:08 | 1.0K | |
![[IMG]](/icons/image2.gif) | image002 (96).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (95).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (94).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (93).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (45).png | 2025-11-20 22:08 | 1.7K | |
![[IMG]](/icons/image2.gif) | image001 (232).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (231).jpg | 2025-11-20 22:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (230).jpg | 2025-11-20 22:08 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (229).jpg | 2025-11-20 22:08 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (228).jpg | 2025-11-20 22:08 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (227).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (226).jpg | 2025-11-20 22:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (225).jpg | 2025-11-20 22:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (224).jpg | 2025-11-20 22:08 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (223).jpg | 2025-11-20 22:08 | 823 | |
![[ ]](/icons/unknown.gif) | WHA71Sideevent_application Global Citizens Dialogue 2018 (Proposal to merge with QED event).docx | 2025-11-20 22:08 | 218K | |
![[IMG]](/icons/image2.gif) | Teimuraz Pirvelashvili_service pasport (1).jpg | 2025-11-20 22:08 | 298K | |
![[ ]](/icons/layout.gif) | Sopiko Belkania.pdf | 2025-11-20 22:08 | 132K | |
![[ ]](/icons/layout.gif) | Sofiko Belkania_service passport.pdf | 2025-11-20 22:08 | 561K | |
![[ ]](/icons/unknown.gif) | Proposed items (2).xls | 2025-11-20 22:08 | 131K | |
![[ ]](/icons/layout.gif) | Maia Nikoleishvili- Hotel Voucher.pdf | 2025-11-20 22:08 | 609K | |
![[ ]](/icons/unknown.gif) | List of EU-Participants.docx | 2025-11-20 22:08 | 13K | |
![[ ]](/icons/unknown.gif) | Khatuna Chachava_service passport.PDF | 2025-11-20 22:08 | 72K | |
![[ ]](/icons/layout.gif) | KHATUNAMRS CHACHAVA için Seyahat Rezervasyonu 03 Mayıs.pdf | 2025-11-20 22:08 | 29K | |
![[ ]](/icons/layout.gif) | Itinerary.pdf | 2025-11-20 22:08 | 75K | |
![[ ]](/icons/layout.gif) | Itinerary (1).pdf | 2025-11-20 22:08 | 76K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_10042018.xlsx | 2025-11-20 22:08 | 19K | |
![[ ]](/icons/layout.gif) | ElectronicTicket.pdf | 2025-11-20 22:08 | 98K | |
![[ ]](/icons/layout.gif) | ElectronicTicket (1).pdf | 2025-11-20 22:08 | 92K | |
![[ ]](/icons/unknown.gif) | EU_PPT health SC GEORGIA 2018.ppt | 2025-11-20 22:08 | 8.2M | |
![[ ]](/icons/layout.gif) | CHACHAVA KHATUNA MRS.pdf | 2025-11-20 22:08 | 211K | |
![[ ]](/icons/layout.gif) | BELKANIA SOFIKO MRS.pdf | 2025-11-20 22:08 | 210K | |
![[ ]](/icons/unknown.gif) | 2352056411760_TFDNQD_BELKANIA SOFIKOMRS.PDF | 2025-11-20 22:08 | 47K | |
![[ ]](/icons/unknown.gif) | 2352056411759_TFDNQD_CHACHAVA KHATUNAMRS.PDF | 2025-11-20 22:08 | 47K | |
![[ ]](/icons/unknown.gif) | საქართველო-ქუვეითი_MOU_GEO_20_04_2018.doc | 2025-11-20 22:08 | 40K | |
![[ ]](/icons/unknown.gif) | საქართველო ქუვეითი_MoU_ENG_20_04_2018.doc | 2025-11-20 22:08 | 41K | |
![[ ]](/icons/unknown.gif) | საბინის აქტივობები.docx | 2025-11-20 22:08 | 17K | |
![[IMG]](/icons/image2.gif) | ~WRD109.jpg | 2025-11-20 22:07 | 823 | |
![[ ]](/icons/unknown.gif) | tobacco smoke free councl recommendation.docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | tobacco recommendation 2 - template filled in.docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | tobacco products directive - template filled in.docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | tobacco TAPS directive - template filled in.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | specification of the furniture (1).xlsx | 2025-11-20 22:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | image006 (8).jpg | 2025-11-20 22:07 | 5.3K | |
![[IMG]](/icons/image2.gif) | image005 (12).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image005 (7).png | 2025-11-20 22:07 | 883 | |
![[IMG]](/icons/image2.gif) | image004 (15).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image004 (14).png | 2025-11-20 22:07 | 663 | |
![[IMG]](/icons/image2.gif) | image004 (10).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (49).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (25).png | 2025-11-20 22:07 | 760 | |
![[IMG]](/icons/image2.gif) | image003 (6).gif | 2025-11-20 22:07 | 43 | |
![[IMG]](/icons/image2.gif) | image002 (92).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (91).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (44).png | 2025-11-20 22:07 | 37K | |
![[IMG]](/icons/image2.gif) | image002 (4).gif | 2025-11-20 22:07 | 3.4K | |
![[IMG]](/icons/image2.gif) | image001 (222).jpg | 2025-11-20 22:07 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (221).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (220).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (219).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (218).jpg | 2025-11-20 22:07 | 823 | |
![[IMG]](/icons/image2.gif) | image001 (217).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (216).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (215).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (214).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (213).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (212).jpg | 2025-11-20 22:07 | 5.8K | |
![[IMG]](/icons/image2.gif) | image001 (211).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (210).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (81).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (80).png | 2025-11-20 22:07 | 28K | |
![[IMG]](/icons/image2.gif) | image001 (79).png | 2025-11-20 22:07 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (78).png | 2025-11-20 22:07 | 5.6K | |
![[ ]](/icons/unknown.gif) | gadamdebi 3 (1).docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | gadamdebi 2.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | gadamdebi 1.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | gadamdebi.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/layout.gif) | document(1).pdf | 2025-11-20 22:07 | 90K | |
![[ ]](/icons/unknown.gif) | directive 2004-113 (1).docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | directive 2000-78 (1).docx | 2025-11-20 22:07 | 21K | |
![[ ]](/icons/unknown.gif) | directive 2000-43 (1).docx | 2025-11-20 22:07 | 21K | |
![[ ]](/icons/unknown.gif) | directive 1978 - 79 (2).docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | WHOEURO ExtensionNominationLetter E 201804.PDF | 2025-11-20 22:07 | 67K | |
![[ ]](/icons/layout.gif) | Topics 2018.pdf | 2025-11-20 22:07 | 199K | |
![[ ]](/icons/unknown.gif) | Template filled in transplantation.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/layout.gif) | Scope_and_Purpose_HCs_NN Meeting_Antalya_TUR_25-27_April_2018 v2.pdf | 2025-11-20 22:07 | 242K | |
![[ ]](/icons/unknown.gif) | Safe Blood 2.docx | 2025-11-20 22:07 | 23K | |
![[ ]](/icons/unknown.gif) | Safe Blood 1.docx | 2025-11-20 22:07 | 23K | |
![[ ]](/icons/unknown.gif) | Safe Blood.docx | 2025-11-20 22:07 | 22K | |
![[ ]](/icons/layout.gif) | Provisional_Programme_HCs_NN Meeting_Antalya_TUR_25-27_April_2018 v4.pdf | 2025-11-20 22:07 | 417K | |
![[ ]](/icons/unknown.gif) | Proposed items (1).xls | 2025-11-20 22:07 | 131K | |
![[ ]](/icons/layout.gif) | Ms_ Sofiko Belkania_ 4 Night ITC Hotel Voucher.pdf | 2025-11-20 22:07 | 609K | |
![[ ]](/icons/layout.gif) | Ms_ Sofiko Belkania- ITC Hotel Voucher.pdf | 2025-11-20 22:07 | 608K | |
![[ ]](/icons/layout.gif) | Ms_ Khatuna Chachava_ 4 Nigths -ITC Hotel Voucher.pdf | 2025-11-20 22:07 | 609K | |
![[ ]](/icons/layout.gif) | Ms_ Khatuna Chachava- ITC Hotel Voucher.pdf | 2025-11-20 22:07 | 608K | |
![[ ]](/icons/layout.gif) | Ms Belkania.pdf | 2025-11-20 22:07 | 36K | |
![[ ]](/icons/layout.gif) | Mr_ Teimuraz Pirvelashvili- 4 Nights- ITC Maurya Hotel Voucher.pdf | 2025-11-20 22:07 | 610K | |
![[ ]](/icons/layout.gif) | Mr_ Teimuraz Pirelashvili- ITC Hotel Voucher_.pdf | 2025-11-20 22:07 | 608K | |
![[ ]](/icons/unknown.gif) | MOH_GEORGIA_jpg.docx | 2025-11-20 22:07 | 651K | |
![[ ]](/icons/layout.gif) | Information Circular - NN Meeting Antalya.pdf | 2025-11-20 22:07 | 515K | |
![[ ]](/icons/unknown.gif) | HRD Agenda.doc | 2025-11-20 22:07 | 45K | |
![[ ]](/icons/layout.gif) | Georgia-2018.pdf | 2025-11-20 22:07 | 80K | |
![[ ]](/icons/layout.gif) | Georgia (1).pdf | 2025-11-20 22:07 | 61K | |
![[ ]](/icons/unknown.gif) | GEO_UHCP_DRG_May2018_mission_Scope_and_Purpose_FINAL.docx | 2025-11-20 22:07 | 43K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_23042018.xlsx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | GEO_Health_Sector_Diagnostics_24_04_18.docx | 2025-11-20 22:07 | 67K | |
![[ ]](/icons/unknown.gif) | CV_REG_E_form.doc | 2025-11-20 22:07 | 95K | |
![[ ]](/icons/layout.gif) | Briefing Note to Member States on WHO European National Healthy Cities Networks.pdf | 2025-11-20 22:07 | 275K | |
![[ ]](/icons/unknown.gif) | AA_ge_List.docx | 2025-11-20 22:07 | 162K | |
![[ ]](/icons/layout.gif) | 1516702465678740.pdf | 2025-11-20 22:07 | 310K | |
![[ ]](/icons/unknown.gif) | 2018-04-20 draft press release_ docx.docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | ტექსტი.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/layout.gif) | საპროექტო განაცხადი ჩინეთის გრანტზე.pdf | 2025-11-20 22:07 | 71K | |
![[ ]](/icons/unknown.gif) | პრეს რელიზი 1 მაისი 2018.docx | 2025-11-20 22:07 | 679K | |
![[ ]](/icons/unknown.gif) | პრესრელიზი (1).docx | 2025-11-20 22:07 | 684K | |
![[ ]](/icons/unknown.gif) | მოსაწვევი 1 მაისი.docx | 2025-11-20 22:07 | 82K | |
![[ ]](/icons/unknown.gif) | მოსაწვევი 1 მაისი (1).docx | 2025-11-20 22:07 | 79K | |
![[ ]](/icons/unknown.gif) | მოსაწვევი.docx | 2025-11-20 22:07 | 80K | |
![[ ]](/icons/unknown.gif) | ინდურ კომპანიებთან შეხვედრის თაობაზე.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | ინდურ კომპანიებთან შეხვედრის თაობაზე (1).docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი_1 05 2018.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი_1 05 2018 (2).docx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი_1 05 2018 (1).docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | transplantation - 26_04_2018.docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | tobacco smoke free councl recommendation 26_04_2018.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | tobacco recommendation 2 - template filled in 26_04_2018.docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | tobacco products directive - template filled in_26_04_2018.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | tobacco TAPS directive - template filled in 26_04_2018.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/layout.gif) | tika.pdf | 2025-11-20 22:07 | 49K | |
![[IMG]](/icons/image2.gif) | image003 (48).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (47).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (46).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (45).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (5).gif | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (4).gif | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (3).gif | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (2).gif | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image002 (90).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (89).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (88).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (87).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (86).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (85).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (84).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (3).gif | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image002 (2).gif | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (209).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (208).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (207).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (206).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (205).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (204).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (203).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (202).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (201).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (200).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (199).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (77).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (76).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (75).png | 2025-11-20 22:07 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (17).gif | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (16).gif | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | gadamdebi 3.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | gadamdebi დირექტივა 2119-98-EC ჩამატებული აკ.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | directive 2006-54.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | directive 2004-113.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | directive 2002-14.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | directive 2000-78.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | directive 2000-43.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | directive 1999-70.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | directive 1978 - 79.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | directive 1978 - 79 (1).docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | directive 97-81.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | directive 92-85.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | directive 91-533.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/layout.gif) | WHO DH to MoH on Tobacco-control 2018-04.pdf | 2025-11-20 22:07 | 628K | |
![[ ]](/icons/layout.gif) | VILNIUS DECLARATION ARTICLE_200418.pdf | 2025-11-20 22:07 | 554K | |
![[ ]](/icons/unknown.gif) | Template filled in transplantation - 26_04_2018.docx | 2025-11-20 22:07 | 22K | |
![[ ]](/icons/layout.gif) | Scope and purpose.pdf | 2025-11-20 22:07 | 68K | |
![[ ]](/icons/layout.gif) | Provisional programme.pdf | 2025-11-20 22:07 | 89K | |
![[ ]](/icons/layout.gif) | OFFICIAL AGREEMENT OF COAUTHORSHIP OF MINISTER OF UKRAINE_160418.pdf | 2025-11-20 22:07 | 198K | |
![[ ]](/icons/unknown.gif) | Letter of Recommendation_Sachkhere.docx | 2025-11-20 22:07 | 12K | |
![[ ]](/icons/unknown.gif) | Letter of Recommendation.docx | 2025-11-20 22:07 | 22K | |
![[ ]](/icons/layout.gif) | Information circular.pdf | 2025-11-20 22:07 | 90K | |
![[ ]](/icons/unknown.gif) | ITALY Legal Framework GEO.DOC | 2025-11-20 22:07 | 73K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_25_04_2018.xlsx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_25_04_2018 (1).xlsx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/layout.gif) | From the Ministry of Labour, Health and Social Affairs of Georgia April 26,2018.pdf | 2025-11-20 22:07 | 140K | |
![[ ]](/icons/unknown.gif) | Framework of Bilateral Cooperation Plan-fyi.doc | 2025-11-20 22:07 | 57K | |
![[ ]](/icons/unknown.gif) | Framework of Bilateral Cooperation Plan-fyi (1).doc | 2025-11-20 22:07 | 57K | |
![[ ]](/icons/layout.gif) | EB143 Travel Spanish.pdf | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/layout.gif) | EB143 Travel French.pdf | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/layout.gif) | EB143 Travel English.pdf | 2025-11-20 22:07 | 25K | |
![[ ]](/icons/layout.gif) | EB143 Travel Arabic.pdf | 2025-11-20 22:07 | 133K | |
![[ ]](/icons/unknown.gif) | C Hep -last.docx | 2025-11-20 22:07 | 22K | |
![[ ]](/icons/layout.gif) | Adv course 2018 inv ltr _Gasviani.pdf | 2025-11-20 22:07 | 70K | |
![[ ]](/icons/unknown.gif) | About Dr_ HIMABINDUTIRUMALASETTY.docx | 2025-11-20 22:07 | 13K | |
![[TXT]](/icons/text.gif) | ATT00002 (27).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (32).htm | 2025-11-20 22:07 | 838 | |
![[TXT]](/icons/text.gif) | 123 ბრძანებ 2018 26 მარტის ბრძ_.html | 2025-11-20 22:07 | 100K | |
![[ ]](/icons/layout.gif) | 30_04-01_05-გრაფიკი.pdf | 2025-11-20 22:07 | 28K | |
![[ ]](/icons/unknown.gif) | 30 აპრილის-პრესრელიზი.docx | 2025-11-20 22:07 | 52K | |
![[ ]](/icons/unknown.gif) | 30 აპრილის-დღის წესრიგი.docx | 2025-11-20 22:07 | 60K | |
![[ ]](/icons/layout.gif) | 18MA109-GE-005 GE Anfrage an MoH.pdf | 2025-11-20 22:07 | 585K | |
![[ ]](/icons/layout.gif) | 18MA102-GE-005 GE Anfrage an MoH.pdf | 2025-11-20 22:07 | 969K | |
![[ ]](/icons/unknown.gif) | 4_Safe Blood-62EC.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | 3_Safe Blood-61EC.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 2_Safe Blood-33EC.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 1_Safe Blood-98EC.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | 1 მაისი დასწრება.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/layout.gif) | ჯანდაცვის_სამ_-სახ__დამცვ_.pdf | 2025-11-20 22:07 | 346K | |
![[ ]](/icons/layout.gif) | წერილი_სამინისტროს.pdf | 2025-11-20 22:07 | 244K | |
![[ ]](/icons/unknown.gif) | შუამდგომლობა საელჩოსთან, 26 აპრილი 2018.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | შუამდგომლობა საელჩოსთან, 26 აპრილი 2018 (1).docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | შვეიცარიის საელჩოს-30_04_2018 (1).docx | 2025-11-20 22:07 | 173K | |
![[ ]](/icons/unknown.gif) | შესრულებული სამუშაო.docx | 2025-11-20 22:07 | 28K | |
![[ ]](/icons/unknown.gif) | საშვები.xlsx | 2025-11-20 22:07 | 10K | |
![[ ]](/icons/unknown.gif) | სამინისტროს_მიმართ_გაცემული_რეკომენდაციების_თაობაზე__17_04_2018.docx | 2025-11-20 22:07 | 88K | |
![[IMG]](/icons/image2.gif) | მოწვევა_ბოსნია და ჰერცეგოვინა.djvu | 2025-11-20 22:07 | 154K | |
![[ ]](/icons/unknown.gif) | მკურნალი.xlsx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | ინფორმაცია ინდური კომპანიების შესახებ_26_04_2018.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | თამილა.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/layout.gif) | დოკუმენტი (1).pdf | 2025-11-20 22:07 | 2.2M | |
![[IMG]](/icons/image2.gif) | vadachkoria.djvu | 2025-11-20 22:07 | 445K | |
![[ ]](/icons/layout.gif) | instructions-for-candidates.pdf | 2025-11-20 22:07 | 504K | |
![[IMG]](/icons/image2.gif) | image009.gif | 2025-11-20 22:07 | 433 | |
![[IMG]](/icons/image2.gif) | image008 (2).jpg | 2025-11-20 22:07 | 1.4K | |
![[IMG]](/icons/image2.gif) | image007 (3).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image006 (7).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image005.gif | 2025-11-20 22:07 | 433 | |
![[IMG]](/icons/image2.gif) | image005 (11).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image005 (10).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image004 (9).jpg | 2025-11-20 22:07 | 1.4K | |
![[IMG]](/icons/image2.gif) | image003 (44).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (43).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (42).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (83).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (82).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (81).jpg | 2025-11-20 22:07 | 3.4K | |
![[IMG]](/icons/image2.gif) | image002 (80).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (79).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (78).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (198).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (197).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (196).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (195).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (194).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (193).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (192).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (191).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (190).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (189).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (188).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (187).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (186).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (185).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (184).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (183).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (182).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (181).jpg | 2025-11-20 22:07 | 3.2K | |
![[IMG]](/icons/image2.gif) | image001 (180).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (74).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (15).gif | 2025-11-20 22:07 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (14).gif | 2025-11-20 22:07 | 6.9K | |
![[ ]](/icons/layout.gif) | accounts_bog_online_nutsi.pdf | 2025-11-20 22:07 | 54K | |
![[ ]](/icons/unknown.gif) | Supplier Creation Template Individual (1).doc | 2025-11-20 22:07 | 127K | |
![[ ]](/icons/unknown.gif) | RE NordDRG grouper software.msg | 2025-11-20 22:07 | 51K | |
![[ ]](/icons/unknown.gif) | Payment_Advice_69040919.PDF | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/layout.gif) | Nino Odisharia.pdf | 2025-11-20 22:07 | 99K | |
![[ ]](/icons/layout.gif) | Nino Odisharia (1).pdf | 2025-11-20 22:07 | 99K | |
![[ ]](/icons/unknown.gif) | MCH_ჯანდაცვის დეპარტამენტი.docx | 2025-11-20 22:07 | 62K | |
![[ ]](/icons/unknown.gif) | List of Consultants (5).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/layout.gif) | Khatuna Chachava ticket_izmir istanbul.pdf | 2025-11-20 22:07 | 207K | |
![[ ]](/icons/layout.gif) | Khatuna Chachava ticket_Kusadasi.pdf | 2025-11-20 22:07 | 53K | |
![[ ]](/icons/layout.gif) | Khatuna Chachava_ITC Hotel Voucher.pdf | 2025-11-20 22:07 | 609K | |
![[ ]](/icons/layout.gif) | Khatuna Chachava Hotel_Kusadasi.pdf | 2025-11-20 22:07 | 260K | |
![[ ]](/icons/layout.gif) | GOARN_GuidingPrinciples_v2016_20161121_WEB.pdf | 2025-11-20 22:07 | 624K | |
![[ ]](/icons/unknown.gif) | GEO_UHCP_DRG_May2018_mission_Scope_and_Purpose_FINAL (2).docx | 2025-11-20 22:07 | 52K | |
![[ ]](/icons/layout.gif) | GEO_Nomination_GOARN_Meeting_Belgrade.pdf | 2025-11-20 22:07 | 111K | |
![[ ]](/icons/unknown.gif) | EB 01_2018 დოკუმენტები გაერთიანებული.docx | 2025-11-20 22:07 | 539K | |
![[ ]](/icons/layout.gif) | E-ticket_India_Belkania_Chachava.pdf | 2025-11-20 22:07 | 98K | |
![[ ]](/icons/unknown.gif) | DRUG_ჯანდაცვის დეპარტამენტი.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | Copy of Registration Tool - List of Participants (5).xls | 2025-11-20 22:07 | 72K | |
![[ ]](/icons/unknown.gif) | Agenda2.doc | 2025-11-20 22:07 | 201K | |
![[TXT]](/icons/text.gif) | ATT00002 (26).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (31).htm | 2025-11-20 22:07 | 431 | |
![[ ]](/icons/layout.gif) | 2018_06_14-15_ScopePurpose_GOARN_Meeting_Belgrade.pdf | 2025-11-20 22:07 | 101K | |
![[ ]](/icons/unknown.gif) | 2017 წ არარეგისტრირებული პროგრამული.docx | 2025-11-20 22:07 | 37K | |
![[ ]](/icons/unknown.gif) | 2016 წ არარეგისტრირებული პროგრამული.docx | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/unknown.gif) | 218.docx | 2025-11-20 22:07 | 23K | |
![[ ]](/icons/layout.gif) | 4 მაისის დასწრება.pdf | 2025-11-20 22:07 | 43K | |
![[ ]](/icons/unknown.gif) | შეფასების ფორმა (1).xlsx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | სოფრომაძე კომისიებში.docx | 2025-11-20 22:07 | 18K | |
![[IMG]](/icons/image2.gif) | სარძევე ჯირკვალი.djvu | 2025-11-20 22:07 | 61K | |
![[ ]](/icons/unknown.gif) | საკურაციო - მინისტრისთვის.docx | 2025-11-20 22:07 | 22K | |
![[ ]](/icons/unknown.gif) | საგარეოს.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | სააგენტო.xlsx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | პრეკვალიფიკაციის შესახებ.docx | 2025-11-20 22:07 | 24K | |
![[ ]](/icons/unknown.gif) | მოქმედი რეგულაციები.docx | 2025-11-20 22:07 | 19K | |
![[IMG]](/icons/image2.gif) | კარიტასი.djvu | 2025-11-20 22:07 | 147K | |
![[ ]](/icons/unknown.gif) | ინფორმაცია ინდური კომპანიების შესახებ_1_05_2018.docx | 2025-11-20 22:07 | 44K | |
![[ ]](/icons/unknown.gif) | ინფორმაცია ინდური კომპანიების შესახებ_1_05_2018 (2).docx | 2025-11-20 22:07 | 32K | |
![[ ]](/icons/unknown.gif) | ინფორმაცია ინდური კომპანიების შესახებ_1_05_2018 (1).docx | 2025-11-20 22:07 | 32K | |
![[ ]](/icons/unknown.gif) | ბათუმის პორტის წერილი.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | ატაშე2.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | программа CEF.docx | 2025-11-20 22:07 | 24K | |
![[IMG]](/icons/image2.gif) | ~WRD000 (1).jpg | 2025-11-20 22:07 | 823 | |
![[IMG]](/icons/image2.gif) | misaloci + mosacvevi el.jpg | 2025-11-20 22:07 | 769K | |
![[IMG]](/icons/image2.gif) | image714001.png | 2025-11-20 22:07 | 2.1K | |
![[IMG]](/icons/image2.gif) | image650000.png | 2025-11-20 22:07 | 2.9K | |
![[IMG]](/icons/image2.gif) | image616002.png | 2025-11-20 22:07 | 2.0K | |
![[IMG]](/icons/image2.gif) | image004 (8).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (41).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (40).jpg | 2025-11-20 22:07 | 4.1K | |
![[IMG]](/icons/image2.gif) | image003 (39).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (38).jpg | 2025-11-20 22:07 | 4.1K | |
![[IMG]](/icons/image2.gif) | image002 (77).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (76).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (75).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (74).jpg | 2025-11-20 22:07 | 579 | |
![[IMG]](/icons/image2.gif) | image002 (73).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (72).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (43).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (179).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (178).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (177).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (176).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (175).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (174).jpg | 2025-11-20 22:07 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (173).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (172).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (171).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (170).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (169).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (73).png | 2025-11-20 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (72).png | 2025-11-20 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (71).png | 2025-11-20 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (70).png | 2025-11-20 22:07 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (69).png | 2025-11-20 22:07 | 6.6K | |
![[ ]](/icons/layout.gif) | Updated Hotels List - Preferential Rates for period 1 April 2018 to 31 M___.pdf | 2025-11-20 22:07 | 196K | |
![[ ]](/icons/unknown.gif) | UPR Mid-term report 2018 (first draft).docx | 2025-11-20 22:07 | 349K | |
![[ ]](/icons/layout.gif) | Trip on 27 May 18 - PNR ref NJ06ME (3).pdf | 2025-11-20 22:07 | 35K | |
![[ ]](/icons/layout.gif) | Trip on 27 May 18 - PNR ref NJ06ME (2).pdf | 2025-11-20 22:07 | 35K | |
![[ ]](/icons/layout.gif) | Trip on 27 May 18 - PNR ref NJ06ME (1).pdf | 2025-11-20 22:07 | 35K | |
![[ ]](/icons/unknown.gif) | Supplier Creation Template Individual.doc | 2025-11-20 22:07 | 128K | |
![[ ]](/icons/unknown.gif) | Strategic purchasing strategy SSA.docx | 2025-11-20 22:07 | 15K | |
![[IMG]](/icons/image2.gif) | STAR_ITIH0_ITI_4064748_1.png | 2025-11-20 22:07 | 1.1K | |
![[ ]](/icons/unknown.gif) | SSA_strategy_key_domains_19032018.pptx | 2025-11-20 22:07 | 130K | |
![[ ]](/icons/layout.gif) | Report_SSA_Organizational_Capacity_March2018_Final_MOLHSA (2).pdf | 2025-11-20 22:07 | 233K | |
![[ ]](/icons/unknown.gif) | List of Consultants (Mzia Jokhidze).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | List of Consultants (Mzia Jokhidze) (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/layout.gif) | Invitation to UPR discussion (final).pdf | 2025-11-20 22:07 | 64K | |
![[ ]](/icons/layout.gif) | Invitation letter Mr Japarizde_ENG.pdf | 2025-11-20 22:07 | 104K | |
![[ ]](/icons/layout.gif) | Invitation letter Mr Japarizde_ENG (1).pdf | 2025-11-20 22:07 | 104K | |
![[ ]](/icons/unknown.gif) | Hotel Reservation_28-30 May.docx | 2025-11-20 22:07 | 812K | |
![[ ]](/icons/unknown.gif) | Hotel Reservation_20-23 May.docx | 2025-11-20 22:07 | 813K | |
![[ ]](/icons/unknown.gif) | GF_German PMs visit to Georgia_Agenda_Geo Input_V2.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | GEO_UHCP_SSAcapacity_June2018_mission_Scope_and_Purpose-v3.docx | 2025-11-20 22:07 | 41K | |
![[ ]](/icons/unknown.gif) | GEO_Health_Sector_Diagnostics_20032018__comments.docx | 2025-11-20 22:07 | 57K | |
![[ ]](/icons/unknown.gif) | GEO_DRG_mission__summary_28022018_revised.pptx | 2025-11-20 22:07 | 61K | |
![[ ]](/icons/layout.gif) | FR_Newsletter_March2018 issue.pdf | 2025-11-20 22:07 | 550K | |
![[ ]](/icons/layout.gif) | EN_Newsletter_March2018 issue.pdf | 2025-11-20 22:07 | 546K | |
![[ ]](/icons/unknown.gif) | Draft_DRG_background_note_list_of_FAQ_10 04 2018.docx | 2025-11-20 22:07 | 54K | |
![[ ]](/icons/unknown.gif) | DRG_implementation_and_transition_strategy_March2018.xlsx | 2025-11-20 22:07 | 21K | |
![[ ]](/icons/layout.gif) | DRG_implementation_and_transition_strategy_March2018.pdf | 2025-11-20 22:07 | 226K | |
![[ ]](/icons/unknown.gif) | DRG_მოკლე ანგარიში Final.docx | 2025-11-20 22:07 | 34K | |
![[ ]](/icons/unknown.gif) | Copy of SSA worksheet 23 3 18.xlsx | 2025-11-20 22:07 | 33K | |
![[ ]](/icons/unknown.gif) | Copy of GEO_Indicators_10042018.xlsx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | Copy of Copy of 2 Areas_for_capacity_building_21032018.xlsx | 2025-11-20 22:07 | 12K | |
![[TXT]](/icons/text.gif) | ATT00017 (2).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00016 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00015 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00014 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00013 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00012 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00011 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00010 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00009 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00008 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00007 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00006 (8).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (8).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (13).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (17).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (25).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (30).htm | 2025-11-20 22:07 | 216 | |
![[ ]](/icons/layout.gif) | 2018 AGENDA_CISPPRI2_FINAL.pdf | 2025-11-20 22:07 | 272K | |
![[ ]](/icons/layout.gif) | 2018 AGENDA_CISPPRI2_FINAL (1).pdf | 2025-11-20 22:07 | 272K | |
![[ ]](/icons/layout.gif) | 22nd International AIDS Conference (AIDS 2018)_Invitation_David Sergeenko.pdf | 2025-11-20 22:07 | 284K | |
![[ ]](/icons/unknown.gif) | 5 Draft_DRG_communication_plan_feedbackWHO_4 04 2018.docx | 2025-11-20 22:07 | 49K | |
![[ ]](/icons/unknown.gif) | 4 DRG_monitoring_feedbackWHO_29032018.docx | 2025-11-20 22:07 | 25K | |
![[ ]](/icons/unknown.gif) | 3 ToR_DRGWG_Feb12_FeedbackWHO_290317.doc | 2025-11-20 22:07 | 52K | |
![[ ]](/icons/unknown.gif) | წერილი გერმანიის საელჩოს.docx | 2025-11-20 22:07 | 23K | |
![[ ]](/icons/unknown.gif) | შვეიცარიის საელჩოს-30_04_2018.docx | 2025-11-20 22:07 | 173K | |
![[ ]](/icons/unknown.gif) | სოციალური მომსახურების სააგენტოს სტრუქტურისა და საქმიანობის შეფასება.docx | 2025-11-20 22:07 | 71K | |
![[ ]](/icons/unknown.gif) | მდინარე არაგვის დაბინძურების თაობაზე 1- 4 _05_2018.docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | ინფორმაცია სტრატეგიული შესყიდვების თაობაზე.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/layout.gif) | ბათუმი_.pdf | 2025-11-20 22:07 | 53K | |
![[ ]](/icons/unknown.gif) | tamuna beridze.xlsx | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/unknown.gif) | specification of the furniture.xlsx | 2025-11-20 22:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | image020.png | 2025-11-20 22:07 | 1.1K | |
![[IMG]](/icons/image2.gif) | image019.png | 2025-11-20 22:07 | 1.0K | |
![[IMG]](/icons/image2.gif) | image018.png | 2025-11-20 22:07 | 708 | |
![[IMG]](/icons/image2.gif) | image017.png | 2025-11-20 22:07 | 725 | |
![[IMG]](/icons/image2.gif) | image016 (1).png | 2025-11-20 22:07 | 714 | |
![[IMG]](/icons/image2.gif) | image006 (6).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image005 (6).png | 2025-11-20 22:07 | 1.2K | |
![[IMG]](/icons/image2.gif) | image004 (13).png | 2025-11-20 22:07 | 824 | |
![[IMG]](/icons/image2.gif) | image004 (12).png | 2025-11-20 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | image003 (37).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (36).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (24).png | 2025-11-20 22:07 | 834 | |
![[IMG]](/icons/image2.gif) | image002 (71).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (70).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (69).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (68).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (67).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (66).jpg | 2025-11-20 22:07 | 1.9K | |
![[IMG]](/icons/image2.gif) | image002 (65).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (42).png | 2025-11-20 22:07 | 815 | |
![[IMG]](/icons/image2.gif) | image001 (168).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (167).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (166).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (165).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (164).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (163).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (162).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (161).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (160).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (159).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (158).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (157).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (156).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (155).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (154).jpg | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image001 (153).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (152).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (68).png | 2025-11-20 22:07 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (67).png | 2025-11-20 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (13).gif | 2025-11-20 22:07 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (12).gif | 2025-11-20 22:07 | 6.9K | |
![[ ]](/icons/unknown.gif) | draft operational conclusions 2018 (3) (2).doc | 2025-11-20 22:07 | 88K | |
![[ ]](/icons/layout.gif) | Trip on 27 May 18 - PNR ref NJ06ME.pdf | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/unknown.gif) | Treat All Policy_nc.docx | 2025-11-20 22:07 | 311K | |
![[IMG]](/icons/image2.gif) | Teimuraz Pirvelashvili_service pasport.jpg | 2025-11-20 22:07 | 298K | |
![[ ]](/icons/unknown.gif) | Proposed items.xls | 2025-11-20 22:07 | 123K | |
![[ ]](/icons/layout.gif) | Preliminary Agenda for Workshop on Analysis of Causes of_RUSSIAN.pdf | 2025-11-20 22:07 | 142K | |
![[ ]](/icons/layout.gif) | Preliminary Agenda - Analysis of Causes of Death.pdf | 2025-11-20 22:07 | 134K | |
![[ ]](/icons/layout.gif) | Letter to Ministry of Labour, Health and Social Affairs of Georgia.pdf | 2025-11-20 22:07 | 1.0M | |
![[ ]](/icons/layout.gif) | Invitation_Georgia_R.pdf | 2025-11-20 22:07 | 381K | |
![[ ]](/icons/layout.gif) | Invitation_Georgia.pdf | 2025-11-20 22:07 | 375K | |
![[ ]](/icons/layout.gif) | Georgia FCTC Mission Report April 2018.pdf | 2025-11-20 22:07 | 269K | |
![[ ]](/icons/layout.gif) | ElectronicTicket_Pirvelashvili.pdf | 2025-11-20 22:07 | 92K | |
![[ ]](/icons/unknown.gif) | David Sergeenko - Bio.docx | 2025-11-20 22:07 | 62K | |
![[ ]](/icons/unknown.gif) | Copy of Performance Evaluation Form for MOH_Maia Nikoleishvili_1 (2).xlsx | 2025-11-20 22:07 | 28K | |
![[ ]](/icons/unknown.gif) | Copy of Performance Evaluation Form მკურნალი.xlsx | 2025-11-20 22:07 | 24K | |
![[ ]](/icons/unknown.gif) | Association Action Plan_MoLHSA_13_04_2018.xls | 2025-11-20 22:07 | 125K | |
![[ ]](/icons/layout.gif) | Appendix.pdf | 2025-11-20 22:07 | 62K | |
![[TXT]](/icons/text.gif) | ATT00006 (7).htm | 2025-11-20 22:07 | 190 | |
![[TXT]](/icons/text.gif) | ATT00005 (7).htm | 2025-11-20 22:07 | 238 | |
![[TXT]](/icons/text.gif) | ATT00004 (12).htm | 2025-11-20 22:07 | 238 | |
![[TXT]](/icons/text.gif) | ATT00003 (16).htm | 2025-11-20 22:07 | 238 | |
![[TXT]](/icons/text.gif) | ATT00002 (24).htm | 2025-11-20 22:07 | 1.3K | |
![[TXT]](/icons/text.gif) | ATT00001 (29).htm | 2025-11-20 22:07 | 332 | |
![[ ]](/icons/unknown.gif) | AA 2017 წლის შესრულება_ჯანდაცვის სამინისტრო.doc | 2025-11-20 22:07 | 465K | |
![[ ]](/icons/unknown.gif) | 22.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/layout.gif) | 10 მაისი-დღის წესრიგი.pdf | 2025-11-20 22:07 | 523K | |
![[ ]](/icons/layout.gif) | 10 მაისი-დღის წესრიგი (1).pdf | 2025-11-20 22:07 | 507K | |
![[TXT]](/icons/text.gif) | 4_Flight_IST-TBS_20180531.ics | 2025-11-20 22:07 | 1.3K | |
![[TXT]](/icons/text.gif) | 3_Flight_GVA-IST_20180530.ics | 2025-11-20 22:07 | 1.3K | |
![[TXT]](/icons/text.gif) | 2_Flight_IST-GVA_20180527.ics | 2025-11-20 22:07 | 1.3K | |
![[TXT]](/icons/text.gif) | 1_Flight_TBS-IST_20180527.ics | 2025-11-20 22:07 | 1.3K | |
![[ ]](/icons/layout.gif) | წერილი-8-05-18.pdf | 2025-11-20 22:07 | 617K | |
![[IMG]](/icons/image2.gif) | მოსაწვევი-10 მაისი.jpg | 2025-11-20 22:07 | 88K | |
![[IMG]](/icons/image2.gif) | მოსაწვევი-10 მაისი (1).jpg | 2025-11-20 22:07 | 88K | |
![[ ]](/icons/unknown.gif) | მემორანდუმის პროექტი.docx | 2025-11-20 22:07 | 29K | |
![[ ]](/icons/layout.gif) | ინფო მინისტრის მოხსენებისთვის.pdf | 2025-11-20 22:07 | 534K | |
![[ ]](/icons/unknown.gif) | ელზა თელია.xlsx | 2025-11-20 22:07 | 24K | |
![[TXT]](/icons/text.gif) | ანტიკო.htm | 2025-11-20 22:07 | 15K | |
![[IMG]](/icons/image2.gif) | ანტიკონვულსიური.djvu | 2025-11-20 22:07 | 18K | |
![[IMG]](/icons/image2.gif) | image006 (5).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image005 (9).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (35).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (34).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (64).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (63).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (62).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (61).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (60).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (59).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (151).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (150).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (149).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (148).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (147).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (146).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (145).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (144).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (143).jpg | 2025-11-20 22:07 | 8.0K | |
![[IMG]](/icons/image2.gif) | image001 (142).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (141).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (140).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (139).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (138).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (137).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (136).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (135).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (66).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (11).gif | 2025-11-20 22:07 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (10).gif | 2025-11-20 22:07 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (9).gif | 2025-11-20 22:07 | 6.9K | |
![[ ]](/icons/unknown.gif) | draft operational conclusions 2018.doc | 2025-11-20 22:07 | 89K | |
![[ ]](/icons/unknown.gif) | draft operational conclusions 2018 (3).doc | 2025-11-20 22:07 | 89K | |
![[ ]](/icons/unknown.gif) | draft operational conclusions 2018 (3) (1).doc | 2025-11-20 22:07 | 92K | |
![[IMG]](/icons/image2.gif) | _MG_9368.JPG | 2025-11-20 22:07 | 1.5M | |
![[ ]](/icons/layout.gif) | WHOEURO Briefing to MS WHA71 20180504 final e (1).pdf | 2025-11-20 22:07 | 832K | |
![[ ]](/icons/layout.gif) | TAIEX 05_11_2018.pdf | 2025-11-20 22:07 | 356K | |
![[ ]](/icons/unknown.gif) | NGO Initiatives_May 7_2018 (2).docx | 2025-11-20 22:07 | 59K | |
![[ ]](/icons/unknown.gif) | NGO Initiatives_May 7_2018 (1).docx | 2025-11-20 22:07 | 59K | |
![[ ]](/icons/unknown.gif) | Maia Nikoleishvili_Performance Evaluation Form (1).xlsx | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/unknown.gif) | International Reccomendations-Good Practice_May 7_2018 (2).docx | 2025-11-20 22:07 | 26K | |
![[ ]](/icons/unknown.gif) | International Reccomendations-Good Practice_May 7_2018 (1).docx | 2025-11-20 22:07 | 26K | |
![[ ]](/icons/unknown.gif) | General Information EXPERTS MEETING 27-28 JUNE.docx | 2025-11-20 22:07 | 53K | |
![[ ]](/icons/unknown.gif) | GOV initiatives_May 7_2018 (2).docx | 2025-11-20 22:07 | 48K | |
![[ ]](/icons/unknown.gif) | GOV initiatives_May 7_2018 (1).docx | 2025-11-20 22:07 | 48K | |
![[ ]](/icons/layout.gif) | GEO_UHCP_DRG_Training_May14_15_Agenda.pdf | 2025-11-20 22:07 | 54K | |
![[IMG]](/icons/image2.gif) | David Sergeenko_Photo.jpg | 2025-11-20 22:07 | 516K | |
![[ ]](/icons/unknown.gif) | CV_EB_David Sergeenko.doc | 2025-11-20 22:07 | 83K | |
![[TXT]](/icons/text.gif) | ATT00004 (11).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00004 (10).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (15).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (14).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (23).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (22).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (28).htm | 2025-11-20 22:07 | 4.6K | |
![[TXT]](/icons/text.gif) | ATT00001 (27).htm | 2025-11-20 22:07 | 4.6K | |
![[IMG]](/icons/image2.gif) | 31732519_2132502573456416_6205689454468792320_o.jpg | 2025-11-20 22:07 | 125K | |
![[IMG]](/icons/image2.gif) | 121_121_982113__MG_5986.JPG | 2025-11-20 22:07 | 53K | |
![[IMG]](/icons/image2.gif) | 6.jpg | 2025-11-20 22:07 | 3.8M | |
![[ ]](/icons/unknown.gif) | შვეიცარიის საელჩოს-30_04_2018 (00000002) (2).docx | 2025-11-20 22:07 | 172K | |
![[ ]](/icons/unknown.gif) | შვეიცარიის საელჩოს-30_04_2018 (00000002) (1).docx | 2025-11-20 22:07 | 112K | |
![[IMG]](/icons/image2.gif) | სარეკომენდაციო წერილი დანართი N2.djvu | 2025-11-20 22:07 | 352K | |
![[ ]](/icons/unknown.gif) | მემორანდუმის პროექტი_აიია (4).docx | 2025-11-20 22:07 | 31K | |
![[ ]](/icons/unknown.gif) | მემორანდუმის პროექტი_აიია (3).docx | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/unknown.gif) | მემორანდუმის პროექტი_აიია (2).docx | 2025-11-20 22:07 | 37K | |
![[ ]](/icons/unknown.gif) | მემორანდუმის პროექტი_აიია (1).docx | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/unknown.gif) | თამარ ბერიძის შეფასება (2).xlsx | 2025-11-20 22:07 | 27K | |
![[IMG]](/icons/image2.gif) | თავფურცელი და დანართიN3.djvu | 2025-11-20 22:07 | 80K | |
![[ ]](/icons/unknown.gif) | ბრძანების დანართი.doc | 2025-11-20 22:07 | 29K | |
![[TXT]](/icons/text.gif) | ბრძანება 01-176.html | 2025-11-20 22:07 | 60K | |
![[ ]](/icons/layout.gif) | metreveli achiko0003.pdf | 2025-11-20 22:07 | 439K | |
![[ ]](/icons/unknown.gif) | list.xlsx | 2025-11-20 22:07 | 690K | |
![[IMG]](/icons/image2.gif) | image006 (4).jpg | 2025-11-20 22:07 | 1.7K | |
![[IMG]](/icons/image2.gif) | image005 (8).jpg | 2025-11-20 22:07 | 2.2K | |
![[IMG]](/icons/image2.gif) | image004 (7).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (33).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (32).jpg | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image003 (31).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (30).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (29).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (23).png | 2025-11-20 22:07 | 16K | |
![[IMG]](/icons/image2.gif) | image002 (58).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (57).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (56).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (55).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (54).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (53).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (52).jpg | 2025-11-20 22:07 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (134).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (133).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (132).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (131).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (130).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (129).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (128).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (127).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (126).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (125).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (124).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (123).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (65).png | 2025-11-20 22:07 | 51K | |
![[IMG]](/icons/image2.gif) | image001 (64).png | 2025-11-20 22:07 | 16K | |
![[IMG]](/icons/image2.gif) | image001 (8).gif | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (7).gif | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (6).gif | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/layout.gif) | TAIEX 05_14_2018.pdf | 2025-11-20 22:07 | 358K | |
![[ ]](/icons/unknown.gif) | Operationalizing the Jobs Agenda_draft agenda May 28-31, 2018.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | Maia Nikoleishvili_Performance Evaluation Form.xlsx | 2025-11-20 22:07 | 31K | |
![[ ]](/icons/layout.gif) | MAL Operationalizing the Jobs Agenda_ May 23-June 1, 2018.pdf | 2025-11-20 22:07 | 194K | |
![[ ]](/icons/unknown.gif) | I Project (Mental Health Clinic) (00000002).docx | 2025-11-20 22:07 | 24K | |
![[ ]](/icons/unknown.gif) | GF_German PMs visit to Georgia_Agenda_Geo Input_V3.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | Copy of Maia Nikoleishvili_Performance Evaluation Form.xlsx | 2025-11-20 22:07 | 28K | |
![[ ]](/icons/unknown.gif) | 15_05_.docx | 2025-11-20 22:07 | 35K | |
![[ ]](/icons/unknown.gif) | 15_05_-ჩასწორებული.docx | 2025-11-20 22:07 | 36K | |
![[ ]](/icons/unknown.gif) | 15_05_-ჩასწორებული (საბოლოო)18-40 (1).docx | 2025-11-20 22:07 | 36K | |
![[ ]](/icons/unknown.gif) | წერილის პროექტი-მემორანდუმი.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | შეთანხმების_ფურცელი_30_04_2018.doc | 2025-11-20 22:07 | 70K | |
![[ ]](/icons/unknown.gif) | სმენის-პრობლემების-თაობაზე-მემორანდუმის-პროექტი-15_05_18.docx | 2025-11-20 22:07 | 33K | |
![[ ]](/icons/unknown.gif) | სმენის-პრობლემების-თაობაზე-მემორანდუმის-პროექტი-15_05_18-1-new-1.docx | 2025-11-20 22:07 | 31K | |
![[ ]](/icons/unknown.gif) | სმენის-პრობლემების-თაობაზე-მემორანდუმის-პროექტი-15_05_18-საბოლოო.docx | 2025-11-20 22:07 | 34K | |
![[ ]](/icons/unknown.gif) | სმენის-პრობლემების-თაობაზე-მემორანდუმის-პროექტი-14_05_18-1-new-1.docx | 2025-11-20 22:07 | 31K | |
![[ ]](/icons/unknown.gif) | სახალხო დამცველი-ჯანდაცვა.docx | 2025-11-20 22:07 | 35K | |
![[ ]](/icons/unknown.gif) | საპასუხო_ნოტა_Geo.doc | 2025-11-20 22:07 | 37K | |
![[ ]](/icons/layout.gif) | საპასუხო ნოტა_ხელმოწერილი.pdf | 2025-11-20 22:07 | 92K | |
![[ ]](/icons/layout.gif) | საერთაშორისო_კონფერენცია_რელიზი_პირველადი.pdf | 2025-11-20 22:07 | 393K | |
![[ ]](/icons/unknown.gif) | საგრანტო პროექტების შესახებ შესავსები ფორმა.docx | 2025-11-20 22:07 | 12K | |
![[ ]](/icons/layout.gif) | პროგრამა-17-18 მაისი.pdf | 2025-11-20 22:07 | 11M | |
![[ ]](/icons/unknown.gif) | მივ_დასტურის შესრულ.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/layout.gif) | მივლ_დასტურის ბრძანება.pdf | 2025-11-20 22:07 | 87K | |
![[ ]](/icons/unknown.gif) | მემორანდუმის პროექტი_აიია.docx | 2025-11-20 22:07 | 29K | |
![[ ]](/icons/unknown.gif) | ინფორმაცია ჩინეთის საგრანტო პროექტის თაობაზე.doc | 2025-11-20 22:07 | 43K | |
![[ ]](/icons/unknown.gif) | თამარ ბერიძის შეფასება.xlsx | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/unknown.gif) | თამარ ბერიძის შეფასება (1).xlsx | 2025-11-20 22:07 | 29K | |
![[ ]](/icons/layout.gif) | დღის წესრიგი-17-15-18.pdf | 2025-11-20 22:07 | 555K | |
![[ ]](/icons/unknown.gif) | დანართი 01-176.doc | 2025-11-20 22:07 | 38K | |
![[ ]](/icons/unknown.gif) | განმარტებითი_ბარათი_30_04_2018.doc | 2025-11-20 22:07 | 44K | |
![[IMG]](/icons/image2.gif) | image005 (7).jpg | 2025-11-20 22:07 | 4.1K | |
![[IMG]](/icons/image2.gif) | image005 (6).jpg | 2025-11-20 22:07 | 4.1K | |
![[IMG]](/icons/image2.gif) | image004 (6).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image004 (5).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (28).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (27).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (26).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (51).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (50).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (41).png | 2025-11-20 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (122).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (121).jpg | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (120).jpg | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image001 (119).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (118).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (63).png | 2025-11-20 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | image001 (62).png | 2025-11-20 22:07 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (61).png | 2025-11-20 22:07 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (60).png | 2025-11-20 22:07 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (5).gif | 2025-11-20 22:07 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (4).gif | 2025-11-20 22:07 | 6.9K | |
![[ ]](/icons/layout.gif) | WHOEURO Briefing to MS WHA71 batch2 20180512 final e.pdf | 2025-11-20 22:07 | 430K | |
![[ ]](/icons/layout.gif) | WHOEURO Briefing to MS WHA71 20180504 final e.pdf | 2025-11-20 22:07 | 832K | |
![[ ]](/icons/unknown.gif) | WHO 05_2018 დოკუმენტები გაერთიანებული -14_05_2018.docx | 2025-11-20 22:07 | 545K | |
![[ ]](/icons/layout.gif) | UHCP_GEO_Analytical_Report_Nov_2017_Final.pdf | 2025-11-20 22:07 | 1.3M | |
![[ ]](/icons/unknown.gif) | ToR_DRGWG_May2018_for_DRG_WG_feedback.doc | 2025-11-20 22:07 | 52K | |
![[ ]](/icons/unknown.gif) | Thyroid.docx | 2025-11-20 22:07 | 12K | |
![[ ]](/icons/layout.gif) | TAIEX 05_16_2018.pdf | 2025-11-20 22:07 | 358K | |
![[ ]](/icons/unknown.gif) | Side events_WHA_EB.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | Performance__monit_indic_templates_for_DRG_WG_feedback (2).docx | 2025-11-20 22:07 | 44K | |
![[ ]](/icons/unknown.gif) | Information for WHA_71.docx | 2025-11-20 22:07 | 594K | |
![[ ]](/icons/unknown.gif) | Health for all.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | Health for all (1).docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | GEO_SSA_Indicators_15052018.xlsx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | Draft_DRG_comm_plan_May2018_for_DRG_WG_Feedback (2).docx | 2025-11-20 22:07 | 38K | |
![[ ]](/icons/unknown.gif) | Draft_DRG_background_note_FAQ_May2018_for_DRG_WG_feedback (2).docx | 2025-11-20 22:07 | 43K | |
![[ ]](/icons/unknown.gif) | DRG_impl_and_trans_strategy_May2018_for_DRG_WG_feedback.xlsx | 2025-11-20 22:07 | 21K | |
![[ ]](/icons/unknown.gif) | D1S3_DRG_weights_prices_May2018.pptx | 2025-11-20 22:07 | 292K | |
![[ ]](/icons/unknown.gif) | D1S2_DRG_for_perf_mon_May2018.pptx | 2025-11-20 22:07 | 1.2M | |
![[ ]](/icons/unknown.gif) | D1S1_DRG_training_May2018.pptx | 2025-11-20 22:07 | 2.0M | |
![[TXT]](/icons/text.gif) | ATT00003 (13).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (12).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (21).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (20).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (26).htm | 2025-11-20 22:07 | 260 | |
![[TXT]](/icons/text.gif) | ATT00001 (25).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (24).htm | 2025-11-20 22:07 | 216 | |
![[ ]](/icons/layout.gif) | A71_JourP-en.pdf | 2025-11-20 22:07 | 179K | |
![[ ]](/icons/unknown.gif) | 2018-0519_WHA71 EU statement item 12_3 GSWCAH (alignmnet).docx | 2025-11-20 22:07 | 25K | |
![[ ]](/icons/unknown.gif) | 2018-0518_WHA71 EU statement item 11_7 NCDs HLM (alignment).docx | 2025-11-20 22:07 | 23K | |
![[ ]](/icons/unknown.gif) | 2018-0518_WHA71 EU statement item 11_4 health environment climate change___.doc | 2025-11-20 22:07 | 49K | |
![[ ]](/icons/unknown.gif) | 2018-0518_WHA71 EU_statement item 11_2 -IHR (alignment).docx | 2025-11-20 22:07 | 24K | |
![[ ]](/icons/unknown.gif) | 2018-0518_WHA71 EU Statement GPW (alignment).docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | 2018-0517_WHA71_EU statement item 12_4 mHealth (Alignment).doc | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/unknown.gif) | 2018-0517_WHA71_EU statement item 12_4 mHealth (Alignment) (1).doc | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/unknown.gif) | 2018-0517_WHA71 EU Statement item 11_6 on GSPOA (alignment).docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | 2018-0517_WHA71 EU Statement item 11_6 on GSPOA (alignment) (1).docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | 2018-0517_WHA 71 EU Statement item 3_Address by DG Tedros (alignment).doc | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/unknown.gif) | 2018-0517_WHA 71 EU Statement item 3_Address by DG Tedros (alignment) (1).doc | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/unknown.gif) | 15_05_-ჩასწორებული (საბოლოო)18-40.docx | 2025-11-20 22:07 | 37K | |
![[ ]](/icons/layout.gif) | წერილი_(ქვემო_ქართლი).pdf | 2025-11-20 22:07 | 416K | |
![[ ]](/icons/layout.gif) | წერილი_საინფორმაციო_კამპანია_-_ჯანდაცვა.pdf | 2025-11-20 22:07 | 355K | |
![[TXT]](/icons/text.gif) | წერილი GWP-ს_ html.html | 2025-11-20 22:07 | 131K | |
![[ ]](/icons/layout.gif) | საინფორმაციო_კამპანიის_თემატიკა.pdf | 2025-11-20 22:07 | 61K | |
![[ ]](/icons/unknown.gif) | მონაწილეთა რაოდენობა.docx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | ინტეგრაციის საკითხთა სამუშაო ჯგუფის შეხვედრის თემატიკა.docx | 2025-11-20 22:07 | 19K | |
![[TXT]](/icons/text.gif) | დკსჯეც-ის წერილი იანვარი.html | 2025-11-20 22:07 | 195K | |
![[TXT]](/icons/text.gif) | არაგვის ხეობა-.html | 2025-11-20 22:07 | 110K | |
![[IMG]](/icons/image2.gif) | untitled_job1-10.djvu | 2025-11-20 22:07 | 23K | |
![[IMG]](/icons/image2.gif) | image010.png | 2025-11-20 22:07 | 266K | |
![[IMG]](/icons/image2.gif) | image009.png | 2025-11-20 22:07 | 394 | |
![[IMG]](/icons/image2.gif) | image008 (1).jpg | 2025-11-20 22:07 | 2.2K | |
![[IMG]](/icons/image2.gif) | image007 (2).jpg | 2025-11-20 22:07 | 1.9K | |
![[IMG]](/icons/image2.gif) | image006 (3).png | 2025-11-20 22:07 | 403 | |
![[IMG]](/icons/image2.gif) | image005 (5).png | 2025-11-20 22:07 | 1.0K | |
![[IMG]](/icons/image2.gif) | image004 (11).png | 2025-11-20 22:07 | 1.8K | |
![[IMG]](/icons/image2.gif) | image004 (10).png | 2025-11-20 22:07 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (25).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (24).jpg | 2025-11-20 22:07 | 731 | |
![[IMG]](/icons/image2.gif) | image003 (23).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (22).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image003 (22).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (21).png | 2025-11-20 22:07 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (20).png | 2025-11-20 22:07 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (19).png | 2025-11-20 22:07 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (18).png | 2025-11-20 22:07 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (17).png | 2025-11-20 22:07 | 1.0K | |
![[IMG]](/icons/image2.gif) | image003 (16).png | 2025-11-20 22:07 | 1.0K | |
![[IMG]](/icons/image2.gif) | image002 (49).jpg | 2025-11-20 22:07 | 7.8K | |
![[IMG]](/icons/image2.gif) | image002 (48).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (47).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (40).png | 2025-11-20 22:07 | 22K | |
![[IMG]](/icons/image2.gif) | image002 (39).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image002 (38).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (37).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (36).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (35).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (34).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (33).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (32).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image001 (117).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (116).jpg | 2025-11-20 22:07 | 2.0K | |
![[IMG]](/icons/image2.gif) | image001 (115).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (114).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (113).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (59).png | 2025-11-20 22:07 | 13K | |
![[IMG]](/icons/image2.gif) | image001 (58).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image001 (57).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (56).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (55).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (54).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (53).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (52).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (51).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (50).png | 2025-11-20 22:07 | 266K | |
![[IMG]](/icons/image2.gif) | image001 (3).gif | 2025-11-20 22:07 | 6.9K | |
![[ ]](/icons/layout.gif) | WR WNTD invitation 2018-05-23 MoLHSA.pdf | 2025-11-20 22:07 | 61K | |
![[ ]](/icons/unknown.gif) | WB Agenda_May 28-31_with comments.docx | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/unknown.gif) | WB Agenda_May 28-31_clean.docx | 2025-11-20 22:07 | 26K | |
![[ ]](/icons/layout.gif) | Regional Consultation Final Program ENG.pdf | 2025-11-20 22:07 | 243K | |
![[ ]](/icons/layout.gif) | Regional Consultation Draft Program ENG 27042018.pdf | 2025-11-20 22:07 | 204K | |
![[ ]](/icons/layout.gif) | Nino ticket2t.pdf | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/layout.gif) | Nino ticket1.pdf | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | NGO Initiatives_May 7_2018.docx | 2025-11-20 22:07 | 59K | |
![[ ]](/icons/layout.gif) | Minister Sergeenko and CCM Invitation Regional Consultation ENG.pdf | 2025-11-20 22:07 | 439K | |
![[ ]](/icons/layout.gif) | Labor act - extract (1).pdf | 2025-11-20 22:07 | 94K | |
![[ ]](/icons/layout.gif) | LAW of Economic and Social Council (1).pdf | 2025-11-20 22:07 | 31K | |
![[ ]](/icons/layout.gif) | Kiev MSM Consultation Report - English FINAL.pdf | 2025-11-20 22:07 | 285K | |
![[ ]](/icons/layout.gif) | Invitation Letter - Trade & Public Health 2018.pdf | 2025-11-20 22:07 | 1.0M | |
![[ ]](/icons/unknown.gif) | International Reccomendations-Good Practice_May 7_2018.docx | 2025-11-20 22:07 | 26K | |
![[ ]](/icons/unknown.gif) | German delegation visit to Georgia_passport details.xlsx | 2025-11-20 22:07 | 9.9K | |
![[ ]](/icons/unknown.gif) | GOV initiatives_May 7_2018.docx | 2025-11-20 22:07 | 48K | |
![[ ]](/icons/unknown.gif) | FCG_Prodacapo_Finland_Oy_NordDRG_grouper_products_overview_r4.pptx | 2025-11-20 22:07 | 2.5M | |
![[ ]](/icons/layout.gif) | Draft Programme Trade and Public Health Workshop.pdf | 2025-11-20 22:07 | 140K | |
![[ ]](/icons/unknown.gif) | Application Form (TC).docx | 2025-11-20 22:07 | 71K | |
![[ ]](/icons/unknown.gif) | Application Form (Grant).doc | 2025-11-20 22:07 | 69K | |
![[TXT]](/icons/text.gif) | ATT00004 (9).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (11).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (19).htm | 2025-11-20 22:07 | 179 | |
![[TXT]](/icons/text.gif) | ATT00002 (18).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (23).htm | 2025-11-20 22:07 | 227 | |
![[TXT]](/icons/text.gif) | ATT00001 (22).htm | 2025-11-20 22:07 | 4.6K | |
![[TXT]](/icons/text.gif) | ATT00001 (2).txt | 2025-11-20 22:07 | 23 | |
![[ ]](/icons/unknown.gif) | ANNEX 1 - Trade & Public Health 2018.docx | 2025-11-20 22:07 | 44K | |
![[IMG]](/icons/image2.gif) | 31 მაისის ღონისძიება.djvu | 2025-11-20 22:07 | 606K | |
![[ ]](/icons/layout.gif) | letter to the Embassy of Italy.pdf | 2025-11-20 22:07 | 128K | |
![[ ]](/icons/layout.gif) | letter to the Embassy of Italy (1).pdf | 2025-11-20 22:07 | 128K | |
![[ ]](/icons/layout.gif) | letter of nomination on workshop in Minsk_.pdf | 2025-11-20 22:07 | 112K | |
![[IMG]](/icons/image2.gif) | image006 (3).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image005 (5).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image004 (4).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (21).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (20).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image003 (19).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (15).png | 2025-11-20 22:07 | 7.9K | |
![[IMG]](/icons/image2.gif) | image002 (46).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (45).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (44).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (43).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (42).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (41).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (40).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (39).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (31).png | 2025-11-20 22:07 | 7.9K | |
![[IMG]](/icons/image2.gif) | image002 (30).png | 2025-11-20 22:07 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (29).png | 2025-11-20 22:07 | 43K | |
![[IMG]](/icons/image2.gif) | image001 (112).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (111).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (110).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (109).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (108).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (107).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (106).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (105).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (104).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (103).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (102).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (49).png | 2025-11-20 22:07 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (48).png | 2025-11-20 22:07 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (47).png | 2025-11-20 22:07 | 7.9K | |
![[IMG]](/icons/image2.gif) | image001 (46).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (45).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (44).png | 2025-11-20 22:07 | 12K | |
![[IMG]](/icons/image2.gif) | image001 (43).png | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (42).png | 2025-11-20 22:07 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (2).gif | 2025-11-20 22:07 | 43 | |
![[ ]](/icons/unknown.gif) | USDOL letter.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | Summer-School-2018_-application-form - M_Lagvilava.docx | 2025-11-20 22:07 | 146K | |
![[ ]](/icons/unknown.gif) | Summer-School-2018_-application-form - M_Darakhvelidze.docx | 2025-11-20 22:07 | 146K | |
![[ ]](/icons/unknown.gif) | Summer-School-2018_-application-form - M_Darakhvelidze (1).docx | 2025-11-20 22:07 | 146K | |
![[ ]](/icons/unknown.gif) | Summer-School-2018_-application-form - K_Goginashvili.docx | 2025-11-20 22:07 | 146K | |
![[ ]](/icons/unknown.gif) | Summer-School-2018_-application-form - K_Goginashvili (1).docx | 2025-11-20 22:07 | 146K | |
![[ ]](/icons/unknown.gif) | Marina Darakhvelidze- CV.docx | 2025-11-20 22:07 | 26K | |
![[ ]](/icons/layout.gif) | M_darakhvelidze.pdf | 2025-11-20 22:07 | 181K | |
![[IMG]](/icons/image2.gif) | M_Darakhvelidze.jpg | 2025-11-20 22:07 | 10K | |
![[ ]](/icons/layout.gif) | Labor act - extract.pdf | 2025-11-20 22:07 | 94K | |
![[ ]](/icons/layout.gif) | LAW of Economic and Social Council.pdf | 2025-11-20 22:07 | 31K | |
![[ ]](/icons/unknown.gif) | Ketevan Goginashvili-CV.docx | 2025-11-20 22:07 | 44K | |
![[ ]](/icons/layout.gif) | K_goginashvili.pdf | 2025-11-20 22:07 | 81K | |
![[IMG]](/icons/image2.gif) | K_Goginashvili.jpg | 2025-11-20 22:07 | 9.1K | |
![[ ]](/icons/unknown.gif) | KHABAZI_Tbilisi-rome-trieste-Tbilisi.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | KHABAZI_Rome-Trieste.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | June 18-24_ Rome Trieste agenda.docx | 2025-11-20 22:07 | 19K | |
![[IMG]](/icons/image2.gif) | IMG_6664.JPG | 2025-11-20 22:07 | 124K | |
![[ ]](/icons/unknown.gif) | H_ E Ambassador Antonio Enrico Bartoli_1.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | Glutaric-aciduraia- eng.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | Glutaric-aciduraia-30_05_18 (1).docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | Glutaric-aciduraia (1).docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | German MP visit List for Mariana.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/layout.gif) | Georgia_Nomination letter_ENG.pdf | 2025-11-20 22:07 | 69K | |
![[ ]](/icons/unknown.gif) | Dr_ Maia Lagvilava - CV.doc | 2025-11-20 22:07 | 66K | |
![[ ]](/icons/unknown.gif) | Copy of დანართი_№4 eng.xlsx | 2025-11-20 22:07 | 9.1K | |
![[ ]](/icons/unknown.gif) | Copy of დანართი_№3 eng.xlsx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | Copy of დანართი_№2 eng.xlsx | 2025-11-20 22:07 | 12K | |
![[ ]](/icons/unknown.gif) | Copy of დანართი_№1 (eng).xlsx | 2025-11-20 22:07 | 9.9K | |
![[ ]](/icons/unknown.gif) | Bios German delegation to Georgia.docx | 2025-11-20 22:07 | 275K | |
![[ ]](/icons/layout.gif) | Annex.pdf | 2025-11-20 22:07 | 178K | |
![[TXT]](/icons/text.gif) | ATT00001 (1).txt | 2025-11-20 22:07 | 34 | |
![[ ]](/icons/layout.gif) | 20180504_MoH_Fibrosarkom.pdf | 2025-11-20 22:07 | 332K | |
![[ ]](/icons/unknown.gif) | 2018 letter-3 გასწორებული.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/layout.gif) | 18 05 18 Draft Agenda Workshop IVD_v2 ENG.pdf | 2025-11-20 22:07 | 109K | |
![[ ]](/icons/layout.gif) | 18 05 18 Concept Note IVD_v2 ENG.pdf | 2025-11-20 22:07 | 93K | |
![[ ]](/icons/layout.gif) | წერილი.pdf | 2025-11-20 22:07 | 58K | |
![[TXT]](/icons/text.gif) | ძირითადი_დოკუმენტი.html | 2025-11-20 22:07 | 109K | |
![[ ]](/icons/unknown.gif) | ჩეხეთის ელჩთან შეხვედრის ანგარიში.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | შეხვედრის ანგარიში_WHO IHR.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | უროლოგებს_ENG.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | უროლოგებს.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | სლოვაკეთის დელეგაციის ვიზიტი.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | საყდრისი ყარაჩიანი 2_2.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | სამოქმედო გეგმა (1).xlsx | 2025-11-20 22:07 | 8.8K | |
![[ ]](/icons/layout.gif) | სამინისტროს წერილი.pdf | 2025-11-20 22:07 | 115K | |
![[ ]](/icons/layout.gif) | სააგენტოს და შსს მემორანდუმი.pdf | 2025-11-20 22:07 | 90K | |
![[ ]](/icons/unknown.gif) | მსოფლიო ბანკის შეხვედრის ანგარიში.docx | 2025-11-20 22:07 | 15K | |
![[IMG]](/icons/image2.gif) | მაია ლაგვილავა.jpg | 2025-11-20 22:07 | 148K | |
![[ ]](/icons/unknown.gif) | თამბაქო - სიტუაციური მიმოხილვა - 31_05_2018.docx | 2025-11-20 22:07 | 22K | |
![[ ]](/icons/unknown.gif) | ვახტანგ მახარობლიშვილს.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | ესტონეთთან თანამშრომლობა.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | ესტონეთთან თანამშრომლობა (1).docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი - 31_05_2018.docx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | დანართი_№4.xlsx | 2025-11-20 22:07 | 9.9K | |
![[ ]](/icons/unknown.gif) | დანართი_№4 (1).xlsx | 2025-11-20 22:07 | 9.9K | |
![[ ]](/icons/unknown.gif) | დანართი_№3.xlsx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | დანართი_№3 (1).xlsx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | დანართი_№2.xlsx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | დანართი_№2 (1).xlsx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | დანართი_№1.xlsx | 2025-11-20 22:07 | 10K | |
![[ ]](/icons/unknown.gif) | დანართი_№1 (1).xlsx | 2025-11-20 22:07 | 10K | |
![[ ]](/icons/unknown.gif) | გრუტკეს დამატებით კითხვებზე პასუხები.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/layout.gif) | werili.pdf | 2025-11-20 22:07 | 342K | |
![[IMG]](/icons/image2.gif) | image006 (2).jpg | 2025-11-20 22:07 | 332 | |
![[IMG]](/icons/image2.gif) | image005 (4).png | 2025-11-20 22:07 | 4.3K | |
![[IMG]](/icons/image2.gif) | image005 (4).jpg | 2025-11-20 22:07 | 4.9K | |
![[IMG]](/icons/image2.gif) | image005 (3).jpg | 2025-11-20 22:07 | 4.9K | |
![[IMG]](/icons/image2.gif) | image004.gif | 2025-11-20 22:07 | 1.6K | |
![[IMG]](/icons/image2.gif) | image004 (9).png | 2025-11-20 22:07 | 197 | |
![[IMG]](/icons/image2.gif) | image004 (1).gif | 2025-11-20 22:07 | 1.6K | |
![[IMG]](/icons/image2.gif) | image003.gif | 2025-11-20 22:07 | 1.5K | |
![[IMG]](/icons/image2.gif) | image003 (18).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (17).jpg | 2025-11-20 22:07 | 353 | |
![[IMG]](/icons/image2.gif) | image003 (16).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (14).png | 2025-11-20 22:07 | 1.2K | |
![[IMG]](/icons/image2.gif) | image003 (1).gif | 2025-11-20 22:07 | 1.5K | |
![[IMG]](/icons/image2.gif) | image002.gif | 2025-11-20 22:07 | 1.5K | |
![[IMG]](/icons/image2.gif) | image002 (38).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (37).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (36).jpg | 2025-11-20 22:07 | 782 | |
![[IMG]](/icons/image2.gif) | image002 (35).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (28).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (27).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (26).png | 2025-11-20 22:07 | 1.2K | |
![[IMG]](/icons/image2.gif) | image002 (25).png | 2025-11-20 22:07 | 2.5K | |
![[IMG]](/icons/image2.gif) | image002 (1).gif | 2025-11-20 22:07 | 1.5K | |
![[IMG]](/icons/image2.gif) | image001 (101).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (100).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (99).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (98).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (97).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (41).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (40).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (39).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (38).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (37).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (36).png | 2025-11-20 22:07 | 293 | |
![[ ]](/icons/unknown.gif) | Welcome_MoH_Geo (2).docx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | Strategic_purchasing_strategy_SSA_7JUNE2018_CLEAN.docx | 2025-11-20 22:07 | 197K | |
![[ ]](/icons/layout.gif) | Scientific_Programm_Final_Eng (2).pdf | 2025-11-20 22:07 | 128K | |
![[ ]](/icons/layout.gif) | Save-the-Date_22_07_2018 Rijksmuseum.pdf | 2025-11-20 22:07 | 118K | |
![[ ]](/icons/layout.gif) | STH Presentation - Company Overview.pdf | 2025-11-20 22:07 | 20M | |
![[ ]](/icons/unknown.gif) | SPS_WG_CH1_CH2_7JUNE2018 (3).docx | 2025-11-20 22:07 | 132K | |
![[ ]](/icons/layout.gif) | List of Speakers_with image_eng (2).pdf | 2025-11-20 22:07 | 895K | |
![[ ]](/icons/layout.gif) | Letter to an interviewer - Dr Sergeenko_GEO_Tallinn conference (1).pdf | 2025-11-20 22:07 | 65K | |
![[ ]](/icons/unknown.gif) | Interviewee questions -1-1 (3).docx | 2025-11-20 22:07 | 97K | |
![[ ]](/icons/unknown.gif) | Initiatives_0706_SPSWG_homework (3).xlsx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | Initiatives_0606(2).xlsx | 2025-11-20 22:07 | 26K | |
![[ ]](/icons/unknown.gif) | Glutaric-aciduraia.docx | 2025-11-20 22:07 | 21K | |
![[ ]](/icons/unknown.gif) | Glutaric-aciduraia-30_05_18.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | GEO_StratAnal_07062018.pptx | 2025-11-20 22:07 | 128K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_CLEANED_0706_SPWG_homework (3).xlsx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_CLEANED_0606.xlsx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_01_06.xlsx | 2025-11-20 22:07 | 33K | |
![[ ]](/icons/layout.gif) | GEO-reform-gesundheitswesen-d.pdf | 2025-11-20 22:07 | 876K | |
![[ ]](/icons/unknown.gif) | Curriculum vitae van Maggie De Block_EN.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | Copy of GEO_Indicators_05 06.xlsx | 2025-11-20 22:07 | 24K | |
![[ ]](/icons/unknown.gif) | Copy of GEO_Indicators_05 06 (1).xlsx | 2025-11-20 22:07 | 25K | |
![[TXT]](/icons/text.gif) | ATT00002 (17).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (21).htm | 2025-11-20 22:07 | 216 | |
![[ ]](/icons/layout.gif) | 20180605_Prodacapo-Proposal_and_information_about_DRG-grouper_Software_Solution_for_Georgia_Ministry_of_health.pdf | 2025-11-20 22:07 | 935K | |
![[ ]](/icons/layout.gif) | 20180605_Prodacapo-Proposal_and_information_about_DRG-grouper_Software_Solution_for_Georgia_Ministry_of_health (1).pdf | 2025-11-20 22:07 | 935K | |
![[ ]](/icons/layout.gif) | 20180604_MoH_Miragesyndrom.pdf | 2025-11-20 22:07 | 338K | |
![[ ]](/icons/unknown.gif) | 2018 წლის გეგმა-ჯანდაცვა.docx | 2025-11-20 22:07 | 44K | |
![[ ]](/icons/unknown.gif) | 7_ დადგენილების პროექტი - ჯანდაცვის დეპარტამენტი.docx | 2025-11-20 22:07 | 51K | |
![[ ]](/icons/unknown.gif) | 7_ დადგენილების პროექტი - ჯანდაცვის დეპარტამენტი (1).docx | 2025-11-20 22:07 | 49K | |
![[ ]](/icons/unknown.gif) | 7_ დადგენილების პროექტი - ჯანდაცვა.docx | 2025-11-20 22:07 | 34K | |
![[ ]](/icons/layout.gif) | წერილი უწყებებს - CTC.pdf | 2025-11-20 22:07 | 76K | |
![[ ]](/icons/layout.gif) | წერილი საგარეოს ბრიტანეთზე.pdf | 2025-11-20 22:07 | 126K | |
![[ ]](/icons/layout.gif) | შრომის პასუხი ბრიტანეთზე.pdf | 2025-11-20 22:07 | 93K | |
![[ ]](/icons/unknown.gif) | შვეიცარიის საელჩოს-30_04_2018 (00000002).docx | 2025-11-20 22:07 | 112K | |
![[ ]](/icons/unknown.gif) | სლოვაკეთის დელეგაციის ვიზიტი 7 ივნისი.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/layout.gif) | საკონტაქტო_პირის_გამოყოფა.pdf | 2025-11-20 22:07 | 186K | |
![[ ]](/icons/unknown.gif) | პარლამენტის რეკომენდაციები სახალხო დამცველის ანგარიშზე_MoLHSA.docx | 2025-11-20 22:07 | 47K | |
![[ ]](/icons/unknown.gif) | კომენტარები_დაბერების_ანგარიშზე_UN (1).rtf | 2025-11-20 22:07 | 493K | |
![[ ]](/icons/unknown.gif) | ინგლ_ შვეიცარიის საელჩოს-30_04_2018 (1).docx | 2025-11-20 22:07 | 86K | |
![[ ]](/icons/layout.gif) | იმპლემენტაციის შეფასების მიმოხილვა (OIA).pdf | 2025-11-20 22:07 | 111K | |
![[ ]](/icons/layout.gif) | იმპლემენტაციის დეტალური მიმოხილვა (DIS).pdf | 2025-11-20 22:07 | 515K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი გაერო.docx | 2025-11-20 22:07 | 45K | |
![[ ]](/icons/layout.gif) | გაერო-ს_უშიშროების_საბჭოს_კონტრტერორისტული_კომიტეტის_(CTC)_დელეგაციის_ვიზიტის_დღის_წესრიგი.pdf | 2025-11-20 22:07 | 68K | |
![[ ]](/icons/layout.gif) | simple_agenda.pdf | 2025-11-20 22:07 | 26K | |
![[IMG]](/icons/image2.gif) | image018.jpg | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image017.jpg | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image016.png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image015.jpg | 2025-11-20 22:07 | 833 | |
![[IMG]](/icons/image2.gif) | image014.jpg | 2025-11-20 22:07 | 726 | |
![[IMG]](/icons/image2.gif) | image013.jpg | 2025-11-20 22:07 | 770 | |
![[IMG]](/icons/image2.gif) | image012.jpg | 2025-11-20 22:07 | 705 | |
![[IMG]](/icons/image2.gif) | image011.jpg | 2025-11-20 22:07 | 772 | |
![[IMG]](/icons/image2.gif) | image008.jpg | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image007 (1).jpg | 2025-11-20 22:07 | 833 | |
![[IMG]](/icons/image2.gif) | image006 (1).jpg | 2025-11-20 22:07 | 726 | |
![[IMG]](/icons/image2.gif) | image005 (2).jpg | 2025-11-20 22:07 | 770 | |
![[IMG]](/icons/image2.gif) | image004 (8).png | 2025-11-20 22:07 | 6.1K | |
![[IMG]](/icons/image2.gif) | image004 (3).jpg | 2025-11-20 22:07 | 705 | |
![[IMG]](/icons/image2.gif) | image003 (15).jpg | 2025-11-20 22:07 | 772 | |
![[IMG]](/icons/image2.gif) | image003 (14).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (34).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (33).jpg | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | image002 (24).png | 2025-11-20 22:07 | 2.5K | |
![[IMG]](/icons/image2.gif) | image002 (23).png | 2025-11-20 22:07 | 2.5K | |
![[IMG]](/icons/image2.gif) | image001.gif | 2025-11-20 22:07 | 6.9K | |
![[IMG]](/icons/image2.gif) | image001 (96).jpg | 2025-11-20 22:07 | 4.1K | |
![[IMG]](/icons/image2.gif) | image001 (95).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (94).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (93).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (92).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (91).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (90).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (89).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (88).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (87).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (86).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (35).png | 2025-11-20 22:07 | 2.1K | |
![[IMG]](/icons/image2.gif) | image001 (34).png | 2025-11-20 22:07 | 266K | |
![[IMG]](/icons/image2.gif) | image001 (33).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (32).png | 2025-11-20 22:07 | 15K | |
![[IMG]](/icons/image2.gif) | image001 (31).png | 2025-11-20 22:07 | 293 | |
![[IMG]](/icons/image2.gif) | image001 (30).png | 2025-11-20 22:07 | 293 | |
![[IMG]](/icons/image2.gif) | image001 (1).gif | 2025-11-20 22:07 | 6.9K | |
![[ ]](/icons/unknown.gif) | escap.docx | 2025-11-20 22:07 | 25K | |
![[IMG]](/icons/image2.gif) | STAR_ITIH0_ITI_4464302_1.png | 2025-11-20 22:07 | 1.1K | |
![[IMG]](/icons/image2.gif) | PastedGraphic-2.tiff | 2025-11-20 22:07 | 40K | |
![[IMG]](/icons/image2.gif) | PastedGraphic-2 (1).tiff | 2025-11-20 22:07 | 40K | |
![[ ]](/icons/layout.gif) | Odisharia, Nino.pdf | 2025-11-20 22:07 | 274K | |
![[ ]](/icons/unknown.gif) | MoHLSA_UNICEF_MOU Functional assessment of Disbility.docx | 2025-11-20 22:07 | 68K | |
![[ ]](/icons/layout.gif) | Letter to an interviewer - Dr Sergeenko_GEO_Tallinn conference.pdf | 2025-11-20 22:07 | 65K | |
![[ ]](/icons/layout.gif) | Letter on the field trip in Georgia.pdf | 2025-11-20 22:07 | 479K | |
![[ ]](/icons/unknown.gif) | Interviewee questions -1-1 (2).docx | 2025-11-20 22:07 | 97K | |
![[ ]](/icons/layout.gif) | Image080618140047.pdf | 2025-11-20 22:07 | 53K | |
![[ ]](/icons/layout.gif) | HF course 2018 brochure.pdf | 2025-11-20 22:07 | 404K | |
![[ ]](/icons/unknown.gif) | Draft Programme v_3.doc | 2025-11-20 22:07 | 580K | |
![[ ]](/icons/unknown.gif) | Batumi Conference - Preliminary Agenda - 7_ 06_18_.docx | 2025-11-20 22:07 | 45K | |
![[ ]](/icons/layout.gif) | Barkalaia.pdf | 2025-11-20 22:07 | 131K | |
![[ ]](/icons/layout.gif) | Barkalaia (1).pdf | 2025-11-20 22:07 | 131K | |
![[ ]](/icons/unknown.gif) | Agenda_66143 v2.doc | 2025-11-20 22:07 | 203K | |
![[ ]](/icons/unknown.gif) | Ac simple agenda 2018.docx | 2025-11-20 22:07 | 14K | |
![[TXT]](/icons/text.gif) | ATT00004 (8).htm | 2025-11-20 22:07 | 179 | |
![[TXT]](/icons/text.gif) | ATT00003 (10).htm | 2025-11-20 22:07 | 227 | |
![[TXT]](/icons/text.gif) | ATT00002 (16).htm | 2025-11-20 22:07 | 227 | |
![[TXT]](/icons/text.gif) | ATT00002 (15).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001.txt | 2025-11-20 22:07 | 25 | |
![[TXT]](/icons/text.gif) | ATT00001 (20).htm | 2025-11-20 22:07 | 227 | |
![[TXT]](/icons/text.gif) | ATT00001 (19).htm | 2025-11-20 22:07 | 216 | |
![[ ]](/icons/layout.gif) | 2018_14_05_AC_OpC-GE_feedback_EU_agreed_(2).pdf | 2025-11-20 22:07 | 117K | |
![[ ]](/icons/unknown.gif) | 2018 14 05 AC OpC-GE feedback_EU agreed.docx | 2025-11-20 22:07 | 49K | |
![[ ]](/icons/unknown.gif) | 070618 agenda with timing (1).docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/layout.gif) | 07_06_2017_annotated_agenda_with_timing.pdf | 2025-11-20 22:07 | 59K | |
![[ ]](/icons/unknown.gif) | 07 06 2017 annotated agenda with timing.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/layout.gif) | ჯანდაცვის_სამინისტროს.pdf | 2025-11-20 22:07 | 368K | |
![[ ]](/icons/unknown.gif) | შეფასების ფორმა საერთაშორისო სამ_ from nino.xlsx | 2025-11-20 22:07 | 43K | |
![[ ]](/icons/unknown.gif) | პრესრელიზი.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | ასოცირების ქვეკომიტეტისთვს 11_06_2018 (1).docx | 2025-11-20 22:07 | 31K | |
![[IMG]](/icons/image2.gif) | ~WRD209 (1).jpg | 2025-11-20 22:07 | 823 | |
![[IMG]](/icons/image2.gif) | ~WRD000.jpg | 2025-11-20 22:07 | 823 | |
![[ ]](/icons/layout.gif) | nomination for HIV Ministerial meeting_Georgia_.pdf | 2025-11-20 22:07 | 96K | |
![[ ]](/icons/unknown.gif) | mirage sindrome.docx | 2025-11-20 22:07 | 18K | |
![[IMG]](/icons/image2.gif) | image006.jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image006 (2).png | 2025-11-20 22:07 | 1.7K | |
![[IMG]](/icons/image2.gif) | image005.jpg | 2025-11-20 22:07 | 937 | |
![[IMG]](/icons/image2.gif) | image005 (3).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image005 (2).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image005 (1).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image004 (7).png | 2025-11-20 22:07 | 729 | |
![[IMG]](/icons/image2.gif) | image004 (6).png | 2025-11-20 22:07 | 824 | |
![[IMG]](/icons/image2.gif) | image004 (5).png | 2025-11-20 22:07 | 824 | |
![[IMG]](/icons/image2.gif) | image003 (13).png | 2025-11-20 22:07 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (12).png | 2025-11-20 22:07 | 504 | |
![[IMG]](/icons/image2.gif) | image003 (11).png | 2025-11-20 22:07 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (10).png | 2025-11-20 22:07 | 830 | |
![[IMG]](/icons/image2.gif) | image003 (9).png | 2025-11-20 22:07 | 830 | |
![[IMG]](/icons/image2.gif) | image002 (32).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (31).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (30).jpg | 2025-11-20 22:07 | 1.6K | |
![[IMG]](/icons/image2.gif) | image002 (29).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (28).jpg | 2025-11-20 22:07 | 913 | |
![[IMG]](/icons/image2.gif) | image002 (27).jpg | 2025-11-20 22:07 | 10K | |
![[IMG]](/icons/image2.gif) | image002 (26).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (25).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (22).png | 2025-11-20 22:07 | 170 | |
![[IMG]](/icons/image2.gif) | image002 (21).png | 2025-11-20 22:07 | 2.5K | |
![[IMG]](/icons/image2.gif) | image002 (20).png | 2025-11-20 22:07 | 2.5K | |
![[IMG]](/icons/image2.gif) | image002 (19).png | 2025-11-20 22:07 | 2.5K | |
![[IMG]](/icons/image2.gif) | image002 (18).png | 2025-11-20 22:07 | 2.5K | |
![[IMG]](/icons/image2.gif) | image002 (17).png | 2025-11-20 22:07 | 2.5K | |
![[IMG]](/icons/image2.gif) | image002 (16).png | 2025-11-20 22:07 | 170 | |
![[IMG]](/icons/image2.gif) | image002 (15).png | 2025-11-20 22:07 | 817 | |
![[IMG]](/icons/image2.gif) | image002 (14).png | 2025-11-20 22:07 | 817 | |
![[IMG]](/icons/image2.gif) | image001 (85).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (84).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (83).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (82).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (81).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (80).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (79).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (78).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (77).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (76).jpg | 2025-11-20 22:07 | 4.7K | |
![[IMG]](/icons/image2.gif) | image001 (75).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (74).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (73).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (72).jpg | 2025-11-20 22:07 | 5.6K | |
![[IMG]](/icons/image2.gif) | image001 (29).png | 2025-11-20 22:07 | 6.1K | |
![[IMG]](/icons/image2.gif) | image001 (28).png | 2025-11-20 22:07 | 170 | |
![[IMG]](/icons/image2.gif) | image001 (27).png | 2025-11-20 22:07 | 293 | |
![[IMG]](/icons/image2.gif) | image001 (26).png | 2025-11-20 22:07 | 293 | |
![[IMG]](/icons/image2.gif) | image001 (25).png | 2025-11-20 22:07 | 293 | |
![[IMG]](/icons/image2.gif) | image001 (24).png | 2025-11-20 22:07 | 293 | |
![[IMG]](/icons/image2.gif) | image001 (23).png | 2025-11-20 22:07 | 293 | |
![[IMG]](/icons/image2.gif) | image001 (22).png | 2025-11-20 22:07 | 170 | |
![[IMG]](/icons/image2.gif) | image001 (21).png | 2025-11-20 22:07 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (20).png | 2025-11-20 22:07 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (19).png | 2025-11-20 22:07 | 38K | |
![[ ]](/icons/unknown.gif) | escap 2.docx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/unknown.gif) | annex-State Fund.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | achievements in Health Care.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/layout.gif) | Tiflis1121.pdf | 2025-11-20 22:07 | 294K | |
![[ ]](/icons/unknown.gif) | SPS_WG_CH1_CH2_7JUNE2018 (2).docx | 2025-11-20 22:07 | 132K | |
![[ ]](/icons/unknown.gif) | SC-VI_3_final draft agenda_19_04_2018.docx | 2025-11-20 22:07 | 26K | |
![[ ]](/icons/unknown.gif) | MCH-ICPD.docx | 2025-11-20 22:07 | 415K | |
![[ ]](/icons/unknown.gif) | MCH-ICPD - 13_06.docx | 2025-11-20 22:07 | 399K | |
![[ ]](/icons/unknown.gif) | MCH-ICPD (1).docx | 2025-11-20 22:07 | 415K | |
![[ ]](/icons/unknown.gif) | Letter to the MFA 1.docx | 2025-11-20 22:07 | 21K | |
![[ ]](/icons/unknown.gif) | Koç.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | Interviewee questions -1-1.docx | 2025-11-20 22:07 | 28K | |
![[ ]](/icons/unknown.gif) | Interviewee questions -1-1 (1).docx | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/unknown.gif) | Initiatives_0706_SPSWG_homework (2).xlsx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_CLEANED_0706_SPWG_homework (2).xlsx | 2025-11-20 22:07 | 17K | |
![[TXT]](/icons/text.gif) | ATT00006 (6).htm | 2025-11-20 22:07 | 179 | |
![[TXT]](/icons/text.gif) | ATT00006 (5).htm | 2025-11-20 22:07 | 179 | |
![[TXT]](/icons/text.gif) | ATT00005 (6).htm | 2025-11-20 22:07 | 725 | |
![[TXT]](/icons/text.gif) | ATT00005 (5).htm | 2025-11-20 22:07 | 725 | |
![[TXT]](/icons/text.gif) | ATT00004 (7).htm | 2025-11-20 22:07 | 1.8K | |
![[TXT]](/icons/text.gif) | ATT00004 (6).htm | 2025-11-20 22:07 | 1.8K | |
![[TXT]](/icons/text.gif) | ATT00003 (9).htm | 2025-11-20 22:07 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00003 (8).htm | 2025-11-20 22:07 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00002 (14).htm | 2025-11-20 22:07 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00002 (13).htm | 2025-11-20 22:07 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00001 (18).htm | 2025-11-20 22:07 | 1.0K | |
![[TXT]](/icons/text.gif) | ATT00001 (17).htm | 2025-11-20 22:07 | 1.0K | |
![[ ]](/icons/unknown.gif) | 120618 agenda with timing and speakers.docx | 2025-11-20 22:07 | 23K | |
![[ ]](/icons/layout.gif) | წერილი გეგმებზე.pdf | 2025-11-20 22:07 | 69K | |
![[ ]](/icons/unknown.gif) | ტედროსთან სასაუბრო.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | სამოქმედო_გეგმის_ფორმა.xlsx | 2025-11-20 22:07 | 8.9K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა 2018-2020_MoLHSA.docx | 2025-11-20 22:07 | 220K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა 2018-2020_MoLHSA (5).docx | 2025-11-20 22:07 | 155K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა 2018-2020_MoLHSA (4).docx | 2025-11-20 22:07 | 155K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა 2018-2020_MoLHSA (3).docx | 2025-11-20 22:07 | 153K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა 2018-2020_MoLHSA (2).docx | 2025-11-20 22:07 | 161K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა 2018-2020_MoLHSA (1).docx | 2025-11-20 22:07 | 219K | |
![[ ]](/icons/unknown.gif) | მირაჟის სინდრომი.docx | 2025-11-20 22:07 | 19K | |
![[IMG]](/icons/image2.gif) | ~WRD209.jpg | 2025-11-20 22:07 | 823 | |
![[ ]](/icons/layout.gif) | neusoft.pdf | 2025-11-20 22:07 | 1.7M | |
![[IMG]](/icons/image2.gif) | image007.jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image006 (1).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image005.png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image005 (1).png | 2025-11-20 22:07 | 824 | |
![[IMG]](/icons/image2.gif) | image004 (4).png | 2025-11-20 22:07 | 830 | |
![[IMG]](/icons/image2.gif) | image004 (3).png | 2025-11-20 22:07 | 15K | |
![[IMG]](/icons/image2.gif) | image004 (2).png | 2025-11-20 22:07 | 824 | |
![[IMG]](/icons/image2.gif) | image004 (2).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (13).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (12).jpg | 2025-11-20 22:07 | 1.6K | |
![[IMG]](/icons/image2.gif) | image003 (8).png | 2025-11-20 22:07 | 125 | |
![[IMG]](/icons/image2.gif) | image003 (7).png | 2025-11-20 22:07 | 16K | |
![[IMG]](/icons/image2.gif) | image003 (6).png | 2025-11-20 22:07 | 830 | |
![[IMG]](/icons/image2.gif) | image002 (24).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (23).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (22).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (21).jpg | 2025-11-20 22:07 | 1.6K | |
![[IMG]](/icons/image2.gif) | image002 (20).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (19).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (18).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (17).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (13).png | 2025-11-20 22:07 | 817 | |
![[IMG]](/icons/image2.gif) | image002 (12).png | 2025-11-20 22:07 | 170 | |
![[IMG]](/icons/image2.gif) | image002 (11).png | 2025-11-20 22:07 | 817 | |
![[IMG]](/icons/image2.gif) | image001 (71).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (70).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (69).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (68).jpg | 2025-11-20 22:07 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (67).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (66).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (65).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (64).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (63).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (62).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (61).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (60).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (59).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (58).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (57).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (56).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (18).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (17).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (16).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image001 (15).png | 2025-11-20 22:07 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (14).png | 2025-11-20 22:07 | 170 | |
![[IMG]](/icons/image2.gif) | image001 (13).png | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (12).png | 2025-11-20 22:07 | 22K | |
![[IMG]](/icons/image2.gif) | image001 (11).png | 2025-11-20 22:07 | 38K | |
![[TXT]](/icons/text.gif) | attachments-replaced-with-links.txt | 2025-11-20 22:07 | 225 | |
![[ ]](/icons/unknown.gif) | WHOEURO RC68e Invite MS.PDF | 2025-11-20 22:07 | 129K | |
![[ ]](/icons/layout.gif) | SummerSchool2018ProvisionalProgramme 18_06_2018_E.pdf | 2025-11-20 22:07 | 378K | |
![[ ]](/icons/layout.gif) | SR on health.pdf | 2025-11-20 22:07 | 508K | |
![[ ]](/icons/layout.gif) | RC68e InformationNote.pdf | 2025-11-20 22:07 | 159K | |
![[ ]](/icons/unknown.gif) | RC68e Credentials.docx | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/unknown.gif) | Performance__monit_indic_templates_for_DRG_WG_feedback.docx | 2025-11-20 22:07 | 46K | |
![[ ]](/icons/unknown.gif) | Performance__monit_indic_templates_for_DRG_WG_feedback (1).docx | 2025-11-20 22:07 | 46K | |
![[ ]](/icons/layout.gif) | New planning framework.pdf | 2025-11-20 22:07 | 177K | |
![[ ]](/icons/unknown.gif) | MCH-ICPD JOINT.docx | 2025-11-20 22:07 | 413K | |
![[ ]](/icons/unknown.gif) | Legal approximation with EU law in the area of health and safety at work.docx | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/unknown.gif) | Legal approximation with EU law in the area of health and safety at work (1).docx | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/layout.gif) | Georgia.pdf | 2025-11-20 22:07 | 57K | |
![[ ]](/icons/layout.gif) | GEO_Nomination_Letter.pdf | 2025-11-20 22:07 | 224K | |
![[ ]](/icons/layout.gif) | GEO 120618 Nomination letter.pdf | 2025-11-20 22:07 | 63K | |
![[ ]](/icons/unknown.gif) | Draft_DRG_comm_plan_May2018_for_DRG_WG_Feedback.docx | 2025-11-20 22:07 | 40K | |
![[ ]](/icons/unknown.gif) | Draft_DRG_comm_plan_May2018_for_DRG_WG_Feedback (1).docx | 2025-11-20 22:07 | 40K | |
![[ ]](/icons/unknown.gif) | Draft_DRG_background_note_FAQ_May2018_for_DRG_WG_feedback.docx | 2025-11-20 22:07 | 40K | |
![[ ]](/icons/unknown.gif) | Draft_DRG_background_note_FAQ_May2018_for_DRG_WG_feedback (1).docx | 2025-11-20 22:07 | 40K | |
![[ ]](/icons/unknown.gif) | Copy of შეფასების ფორმა საერთაშორისო სამ_ from nino.xlsx | 2025-11-20 22:07 | 43K | |
![[ ]](/icons/layout.gif) | C_L_19_2018 Spanish.pdf | 2025-11-20 22:07 | 49K | |
![[ ]](/icons/layout.gif) | C_L_19_2018 Russian.pdf | 2025-11-20 22:07 | 82K | |
![[ ]](/icons/layout.gif) | C_L_19_2018 French.pdf | 2025-11-20 22:07 | 56K | |
![[ ]](/icons/layout.gif) | C_L_19_2018 Chinese.pdf | 2025-11-20 22:07 | 175K | |
![[ ]](/icons/layout.gif) | C_L_19_2018 Arabic.pdf | 2025-11-20 22:07 | 61K | |
![[ ]](/icons/layout.gif) | C_L_19_2018 (AMR consultation).pdf | 2025-11-20 22:07 | 86K | |
![[ ]](/icons/layout.gif) | C_L_18_2018 Spanish.pdf | 2025-11-20 22:07 | 53K | |
![[ ]](/icons/layout.gif) | C_L_18_2018 Russian.pdf | 2025-11-20 22:07 | 97K | |
![[ ]](/icons/layout.gif) | C_L_18_2018 French.pdf | 2025-11-20 22:07 | 59K | |
![[ ]](/icons/layout.gif) | C_L_18_2018 Chinese.pdf | 2025-11-20 22:07 | 182K | |
![[ ]](/icons/layout.gif) | C_L_18_2018 Arabic.pdf | 2025-11-20 22:07 | 76K | |
![[ ]](/icons/layout.gif) | C_L_18_2018 (Code of practice IRHP).pdf | 2025-11-20 22:07 | 89K | |
![[TXT]](/icons/text.gif) | ATT00006 (4).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00006 (3).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005 (4).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (3).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (5).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (4).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (3).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00003 (7).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (6).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (5).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (4).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (12).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (11).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (10).htm | 2025-11-20 22:07 | 344 | |
![[TXT]](/icons/text.gif) | ATT00002 (9).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (8).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (16).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (15).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (14).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (13).htm | 2025-11-20 22:07 | 3.3K | |
![[TXT]](/icons/text.gif) | ATT00001 (12).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (11).htm | 2025-11-20 22:07 | 216 | |
![[ ]](/icons/layout.gif) | 180611 GEO WHA letter to MOLHSA.pdf | 2025-11-20 22:07 | 129K | |
![[ ]](/icons/unknown.gif) | 2018 Nomination form.docx | 2025-11-20 22:07 | 25K | |
![[ ]](/icons/unknown.gif) | 2018-2020 programa - 17_06_18.docx | 2025-11-20 22:07 | 180K | |
![[ ]](/icons/unknown.gif) | 249_შრომის უსაფრთხოება (2).rtf | 2025-11-20 22:07 | 1.2M | |
![[ ]](/icons/unknown.gif) | 26th brussels edited meeting.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/layout.gif) | წერილი ჯანდაცვას.pdf | 2025-11-20 22:07 | 280K | |
![[ ]](/icons/unknown.gif) | შეფასების ფორმა.xlsx | 2025-11-20 22:07 | 47K | |
![[ ]](/icons/unknown.gif) | ტელეფონები 14_06_2018.xlsx | 2025-11-20 22:07 | 49K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა 2018-2020_MoLHSA-ჯანდაცვა_სოციალური_შრომა.docx | 2025-11-20 22:07 | 163K | |
![[ ]](/icons/unknown.gif) | სამთავრობო პროგრამა 2018-2020_MoLHSA-ჯანდაცვა_სოციალური_შრომა (1).docx | 2025-11-20 22:07 | 162K | |
![[ ]](/icons/unknown.gif) | მეილი.doc | 2025-11-20 22:07 | 35K | |
![[ ]](/icons/unknown.gif) | ასოცირების ქვეკომიტეტისთვს 11_06_2018.docx | 2025-11-20 22:07 | 31K | |
![[IMG]](/icons/image2.gif) | image004 (1).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (11).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (10).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (9).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (8).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (7).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (5).png | 2025-11-20 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | image002 (16).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (15).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (14).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (13).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (12).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (11).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (10).png | 2025-11-20 22:07 | 1.3K | |
![[IMG]](/icons/image2.gif) | image002 (10).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (9).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image002 (8).png | 2025-11-20 22:07 | 7.1K | |
![[IMG]](/icons/image2.gif) | image001 (55).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (54).jpg | 2025-11-20 22:07 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (53).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (52).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (51).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (50).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (49).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (48).jpg | 2025-11-20 22:07 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (47).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (46).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (45).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (44).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (43).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (42).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (41).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (40).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (39).jpg | 2025-11-20 22:07 | 4.4K | |
![[IMG]](/icons/image2.gif) | image001 (38).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (37).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (10).png | 2025-11-20 22:07 | 1.2K | |
![[IMG]](/icons/image2.gif) | image001 (9).png | 2025-11-20 22:07 | 8.5K | |
![[IMG]](/icons/image2.gif) | image001 (8).png | 2025-11-20 22:07 | 21K | |
![[IMG]](/icons/image2.gif) | image001 (7).png | 2025-11-20 22:07 | 12K | |
![[ ]](/icons/layout.gif) | U_S_ Embassy Invitation.pdf | 2025-11-20 22:07 | 142K | |
![[ ]](/icons/layout.gif) | U_S_ Embassy Invitation (1).pdf | 2025-11-20 22:07 | 139K | |
![[ ]](/icons/unknown.gif) | SPS_WG_CH1_CH2_7JUNE2018 (1).docx | 2025-11-20 22:07 | 65K | |
![[ ]](/icons/unknown.gif) | Initiatives_0706_SPSWG_homework (1).xlsx | 2025-11-20 22:07 | 23K | |
![[ ]](/icons/unknown.gif) | Human rights in the context of HIV and AIDS.DOCX | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/unknown.gif) | Human rights in the context of HIV and AIDS (1).DOCX | 2025-11-20 22:07 | 27K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_CLEANED_0706_SPWG_homework (1).xlsx | 2025-11-20 22:07 | 21K | |
![[ ]](/icons/layout.gif) | From the Ministry of Labour Health and Social Affairs of Georgia June 21, 2018.pdf | 2025-11-20 22:07 | 156K | |
![[ ]](/icons/layout.gif) | From_the_Ministry_of_Labour,_Health_and_Social_Affairs_of_Georgia_June20th,_2018.pdf | 2025-11-20 22:07 | 74K | |
![[ ]](/icons/unknown.gif) | Elimination of discrimination against women and girls.docx | 2025-11-20 22:07 | 48K | |
![[ ]](/icons/unknown.gif) | Elimination of discrimination against women and girls (1).docx | 2025-11-20 22:07 | 48K | |
![[ ]](/icons/unknown.gif) | Brussel - Health Sector development Strategy.docx | 2025-11-20 22:07 | 15K | |
![[TXT]](/icons/text.gif) | ATT00026 (1).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00025 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00024 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00023 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00022 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00021 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00020 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00019 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00018 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00017 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00016 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00015 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00014 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00013 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00012 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00011 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00010 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00009 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00008 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00007 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00006 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (3).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (7).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (10).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (9).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (8).htm | 2025-11-20 22:07 | 406 | |
![[ ]](/icons/unknown.gif) | 2018 19 06 AC 2018 OC-labour.docx | 2025-11-20 22:07 | 53K | |
![[ ]](/icons/unknown.gif) | 2018 19 06 AC 2018 OC-initial draft.docx | 2025-11-20 22:07 | 41K | |
![[ ]](/icons/unknown.gif) | 2018 19 06 AC 2018 OC-initial draft-22_06.docx | 2025-11-20 22:07 | 52K | |
![[ ]](/icons/unknown.gif) | 2018 19 06 AC 2018 OC-initial draft (3).docx | 2025-11-20 22:07 | 52K | |
![[ ]](/icons/unknown.gif) | 2018 19 06 AC 2018 OC-initial draft (2).docx | 2025-11-20 22:07 | 43K | |
![[ ]](/icons/unknown.gif) | 2018 19 06 AC 2018 OC-initial draft (1).docx | 2025-11-20 22:07 | 52K | |
![[ ]](/icons/unknown.gif) | 25_ EU-Lisa (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 24_ EUROPOL (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 23_ Eurojust (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 22_ EDA (1).docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 21_ Frontex (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 20_ ETF (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 19_ ENISA (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 18_ CEPOL (1).docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | 17_ ECHA (1).docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 16_ EMCDDA (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 15_ GSA (1).docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 14_ EUROFOUND (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 13_ ERA (1).docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 12_ EIGE (1).docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | 11_ EFSA (1).docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 10_ EU-OSHA (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 9_ EUISS (1).docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 8_ EUIPO (1).docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | 7_ EMSA (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 6_ EFCA (1).docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 5_ EEA (1).docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 4_ ECDC (1).docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 3_ EASO (1).docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 2_ EASA (1).docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 1_ CPVO (1).docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | 070618 agenda with timing.docx | 2025-11-20 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | სახალხო დამცველის წერილი.djvu | 2025-11-20 22:07 | 41K | |
![[ ]](/icons/unknown.gif) | სამოქმედო გეგმა.xlsx | 2025-11-20 22:07 | 8.8K | |
![[ ]](/icons/unknown.gif) | მარიამს.docx | 2025-11-20 22:07 | 32K | |
![[ ]](/icons/unknown.gif) | proeqti.docx | 2025-11-20 22:07 | 15K | |
![[IMG]](/icons/image2.gif) | image003 (6).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (5).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image003 (4).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image002 (9).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (8).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (7).png | 2025-11-20 22:07 | 7.1K | |
![[IMG]](/icons/image2.gif) | image002 (7).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (6).png | 2025-11-20 22:07 | 38K | |
![[IMG]](/icons/image2.gif) | image002 (6).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (5).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (36).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (35).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (34).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (33).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (32).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (31).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (30).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (29).jpg | 2025-11-20 22:07 | 7.7K | |
![[IMG]](/icons/image2.gif) | image001 (28).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (27).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (26).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (25).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (24).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (23).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (22).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (21).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (20).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (19).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (18).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (17).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (16).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (15).jpg | 2025-11-20 22:07 | 4.8K | |
![[ ]](/icons/unknown.gif) | draft operational conclusions 2018 COMMENTS.doc | 2025-11-20 22:07 | 101K | |
![[ ]](/icons/unknown.gif) | draft operational conclusions 2018 (3) (002).doc | 2025-11-20 22:07 | 94K | |
![[ ]](/icons/unknown.gif) | Welcome_MoH_Geo.docx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | Welcome_MoH_Geo (1).docx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/layout.gif) | TYL HE Dr Sergeenko_MoH Georgia_22062018.pdf | 2025-11-20 22:07 | 235K | |
![[ ]](/icons/layout.gif) | TT.pdf | 2025-11-20 22:07 | 521K | |
![[ ]](/icons/layout.gif) | Scientific_Programm_Final_Eng.pdf | 2025-11-20 22:07 | 128K | |
![[ ]](/icons/layout.gif) | Scientific_Programm_Final_Eng (1).pdf | 2025-11-20 22:07 | 128K | |
![[ ]](/icons/unknown.gif) | RM - სახელმძღვანელო 8_06_2016.docx | 2025-11-20 22:07 | 30K | |
![[ ]](/icons/unknown.gif) | PV list pharmcompaniesupdated.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | PV list NRA.docx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/layout.gif) | MD.pdf | 2025-11-20 22:07 | 755K | |
![[ ]](/icons/layout.gif) | List of Speakers_with image_eng.pdf | 2025-11-20 22:07 | 895K | |
![[ ]](/icons/layout.gif) | List of Speakers_with image_eng (1).pdf | 2025-11-20 22:07 | 895K | |
![[IMG]](/icons/image2.gif) | Dgebuadze_Passport.jpg | 2025-11-20 22:07 | 3.5M | |
![[ ]](/icons/unknown.gif) | DRG_feedback_report_framework_piloting_hospitals_25062018.docx | 2025-11-20 22:07 | 36K | |
![[ ]](/icons/unknown.gif) | Copy of Copy of სამოქმედო_გეგმი_HR_International relations.xlsx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/layout.gif) | C_L_21_2018 Spanish.pdf | 2025-11-20 22:07 | 127K | |
![[ ]](/icons/layout.gif) | C_L_21_2018 Russian.pdf | 2025-11-20 22:07 | 218K | |
![[ ]](/icons/layout.gif) | C_L_21_2018 French.pdf | 2025-11-20 22:07 | 135K | |
![[ ]](/icons/layout.gif) | C_L_21_2018 Chinese.pdf | 2025-11-20 22:07 | 540K | |
![[ ]](/icons/layout.gif) | C_L_21_2018 Arabic.pdf | 2025-11-20 22:07 | 144K | |
![[ ]](/icons/layout.gif) | C_L_21_2018 (EB144 draft prov agenda).pdf | 2025-11-20 22:07 | 86K | |
![[ ]](/icons/layout.gif) | C_L_20_2018 Spanish.pdf | 2025-11-20 22:07 | 454K | |
![[ ]](/icons/layout.gif) | C_L_20_2018 Russian.pdf | 2025-11-20 22:07 | 567K | |
![[ ]](/icons/layout.gif) | C_L_20_2018 French.pdf | 2025-11-20 22:07 | 486K | |
![[ ]](/icons/layout.gif) | C_L_20_2018 Chinese.pdf | 2025-11-20 22:07 | 1.9M | |
![[ ]](/icons/layout.gif) | C_L_20_2018 Arabic.pdf | 2025-11-20 22:07 | 512K | |
![[ ]](/icons/layout.gif) | C_L_20_2018 (2019 Foundation Prizes).pdf | 2025-11-20 22:07 | 376K | |
![[ ]](/icons/unknown.gif) | Annex.docx | 2025-11-20 22:07 | 14K | |
![[TXT]](/icons/text.gif) | ATT00026.htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00025.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00024.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00023.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00022.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00021.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00020.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00019.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00018.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00017.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00016.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00015.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00014.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00013.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00012.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00011.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00010.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00009.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00008.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00007.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00006 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00005 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004 (1).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (6).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (7).htm | 2025-11-20 22:07 | 406 | |
![[ ]](/icons/unknown.gif) | 25_ EU-Lisa.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 24_ EUROPOL.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 23_ Eurojust.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 22_ EDA.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 21_ Frontex.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 20_ ETF.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 19_ ENISA.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 18_ CEPOL.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | 17_ ECHA.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 16_ EMCDDA.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 15_ GSA.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 14_ EUROFOUND.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 13_ ERA.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 12_ EIGE.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | 11_ EFSA.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 10_ EU-OSHA.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 9_ EUISS.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 8_ EUIPO.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | 7_ EMSA.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 6_ EFCA.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | 5_ EEA.docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | 4_ ECDC.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 3_ EASO.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 2_ EASA.docx | 2025-11-20 22:07 | 18K | |
![[ ]](/icons/unknown.gif) | 1_ CPVO.docx | 2025-11-20 22:07 | 19K | |
![[ ]](/icons/unknown.gif) | შინაგანაწესი_26_06_2018.docx | 2025-11-20 22:07 | 53K | |
![[ ]](/icons/unknown.gif) | შეთანხმების_ფურცელი_26_04__2018.doc | 2025-11-20 22:07 | 69K | |
![[ ]](/icons/unknown.gif) | პროექტი.docx | 2025-11-20 22:07 | 36K | |
![[ ]](/icons/unknown.gif) | პროექტი (1).docx | 2025-11-20 22:07 | 36K | |
![[ ]](/icons/unknown.gif) | მცირ_მთავრ_იდეა.docx | 2025-11-20 22:07 | 16K | |
![[ ]](/icons/unknown.gif) | მცირ მთავრ იდეა_ კომენტ_.docx | 2025-11-20 22:07 | 20K | |
![[ ]](/icons/unknown.gif) | მაღალმთიანი გეგმა.xlsx | 2025-11-20 22:07 | 20K | |
![[IMG]](/icons/image2.gif) | image008.png | 2025-11-20 22:07 | 43K | |
![[IMG]](/icons/image2.gif) | image007.png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image006.png | 2025-11-20 22:07 | 41K | |
![[IMG]](/icons/image2.gif) | image004.png | 2025-11-20 22:07 | 43K | |
![[IMG]](/icons/image2.gif) | image004.jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image004 (1).png | 2025-11-20 22:07 | 43K | |
![[IMG]](/icons/image2.gif) | image003 (4).png | 2025-11-20 22:07 | 41K | |
![[IMG]](/icons/image2.gif) | image003 (3).png | 2025-11-20 22:07 | 41K | |
![[IMG]](/icons/image2.gif) | image003 (3).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (2).png | 2025-11-20 22:07 | 43K | |
![[IMG]](/icons/image2.gif) | image003 (2).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image003 (1).png | 2025-11-20 22:07 | 43K | |
![[IMG]](/icons/image2.gif) | image003 (1).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (5).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (4).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (4).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (3).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image002 (3).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (2).png | 2025-11-20 22:07 | 41K | |
![[IMG]](/icons/image2.gif) | image002 (2).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002 (1).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (14).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (13).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (12).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (11).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (10).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (9).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (8).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (7).jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (6).png | 2025-11-20 22:07 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (6).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (5).png | 2025-11-20 22:07 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (5).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (4).png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001 (4).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (3).png | 2025-11-20 22:07 | 1.2K | |
![[IMG]](/icons/image2.gif) | image001 (3).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (2).png | 2025-11-20 22:07 | 41K | |
![[IMG]](/icons/image2.gif) | image001 (2).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001 (1).jpg | 2025-11-20 22:07 | 4.8K | |
![[ ]](/icons/layout.gif) | WHO CC Academy Workshops Concept Note.pdf | 2025-11-20 22:07 | 431K | |
![[ ]](/icons/layout.gif) | WHO CC Academy Preliminary Agenda _ Nov 2018.pdf | 2025-11-20 22:07 | 219K | |
![[ ]](/icons/unknown.gif) | WHO CC Academy Leadership invitation counterparts Nov 2018.docx | 2025-11-20 22:07 | 719K | |
![[ ]](/icons/unknown.gif) | ToR for a National Insitution_FCTC 2030 September.docx | 2025-11-20 22:07 | 24K | |
![[ ]](/icons/unknown.gif) | SPS_WG_CH1_CH2_7JUNE2018.docx | 2025-11-20 22:07 | 132K | |
![[ ]](/icons/unknown.gif) | QMS list NRA.docx | 2025-11-20 22:07 | 14K | |
![[IMG]](/icons/image2.gif) | Picture (Device Independent Bitmap) 1.jpg | 2025-11-20 22:07 | 4.7K | |
![[ ]](/icons/layout.gif) | Nomination of Dr_ Amiran Gamkrelidze.pdf | 2025-11-20 22:07 | 132K | |
![[ ]](/icons/unknown.gif) | New Ministry (2).docx | 2025-11-20 22:07 | 35K | |
![[ ]](/icons/unknown.gif) | New Ministry (1).docx | 2025-11-20 22:07 | 36K | |
![[ ]](/icons/layout.gif) | Letter_of_intent_Tbilisi_signed_2.pdf | 2025-11-20 22:07 | 162K | |
![[ ]](/icons/layout.gif) | Letter_of_intent_Tbilisi_FINAL.pdf | 2025-11-20 22:07 | 24K | |
![[ ]](/icons/unknown.gif) | LEPL Emergency Situations Coordination and Urgent Assistance Center Questionnaire.docx | 2025-11-20 22:07 | 15K | |
![[ ]](/icons/unknown.gif) | Initiatives_0706_SPSWG_homework.xlsx | 2025-11-20 22:07 | 13K | |
![[ ]](/icons/unknown.gif) | Goals and initiatives - SP.xlsx | 2025-11-20 22:07 | 10K | |
![[ ]](/icons/unknown.gif) | Goals and initiatives - SP (1).xlsx | 2025-11-20 22:07 | 10K | |
![[ ]](/icons/unknown.gif) | GEO_Indicators_CLEANED_0706_SPWG_homework.xlsx | 2025-11-20 22:07 | 17K | |
![[ ]](/icons/layout.gif) | GEO.pdf | 2025-11-20 22:07 | 55K | |
![[ ]](/icons/layout.gif) | C_L_22_2018 Spanish.pdf | 2025-11-20 22:07 | 59K | |
![[ ]](/icons/layout.gif) | C_L_22_2018 Russian.pdf | 2025-11-20 22:07 | 111K | |
![[ ]](/icons/layout.gif) | C_L_22_2018 French.pdf | 2025-11-20 22:07 | 65K | |
![[ ]](/icons/layout.gif) | C_L_22_2018 Chinese.pdf | 2025-11-20 22:07 | 193K | |
![[ ]](/icons/layout.gif) | C_L_22_2018 Arabic.pdf | 2025-11-20 22:07 | 77K | |
![[ ]](/icons/layout.gif) | C_L_22_2018 (PIP survey).pdf | 2025-11-20 22:07 | 94K | |
![[TXT]](/icons/text.gif) | ATT00006.htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00005.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00004.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00003 (1).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002.htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (5).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (4).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00002 (3).htm | 2025-11-20 22:07 | 334 | |
![[TXT]](/icons/text.gif) | ATT00002 (2).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00002 (1).htm | 2025-11-20 22:07 | 168 | |
![[TXT]](/icons/text.gif) | ATT00001 (6).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (5).htm | 2025-11-20 22:07 | 4.7K | |
![[TXT]](/icons/text.gif) | ATT00001 (4).htm | 2025-11-20 22:07 | 4.9K | |
![[TXT]](/icons/text.gif) | ATT00001 (3).htm | 2025-11-20 22:07 | 216 | |
![[TXT]](/icons/text.gif) | ATT00001 (2).htm | 2025-11-20 22:07 | 5.0K | |
![[TXT]](/icons/text.gif) | ATT00001 (1).htm | 2025-11-20 22:07 | 216 | |
![[ ]](/icons/unknown.gif) | 27_06.pptx | 2025-11-20 22:07 | 2.5M | |
![[ ]](/icons/unknown.gif) | 27_06 (1).pptx | 2025-11-20 22:07 | 3.9M | |
![[ ]](/icons/unknown.gif) | 4th NAP__draft_28 June.docx | 2025-11-20 22:07 | 272K | |
![[ ]](/icons/unknown.gif) | 4th NAP__draft_28 June (1).docx | 2025-11-20 22:07 | 272K | |
![[ ]](/icons/layout.gif) | 02_ScopeAndPurpose_E.pdf | 2025-11-20 22:07 | 69K | |
![[ ]](/icons/unknown.gif) | ინგლ_ შვეიცარიის საელჩოს-30_04_2018.docx | 2025-11-20 22:07 | 95K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი (3).docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | დღის წესრიგი (3) (1).docx | 2025-11-20 22:07 | 14K | |
![[ ]](/icons/unknown.gif) | გეგმა-მაღალმთიანი.xlsx | 2025-11-20 22:07 | 18K | |
![[IMG]](/icons/image2.gif) | image003.png | 2025-11-20 22:07 | 43K | |
![[IMG]](/icons/image2.gif) | image003.jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image002.png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image002.jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image002 (1).jpg | 2025-11-20 22:07 | 4.8K | |
![[IMG]](/icons/image2.gif) | image001.png | 2025-11-20 22:07 | 11K | |
![[IMG]](/icons/image2.gif) | image001.jpg | 2025-11-20 22:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | image001 (1).png | 2025-11-20 22:07 | 41K | |
![[ ]](/icons/unknown.gif) | New Ministry.docx | 2025-11-20 22:07 | 36K | |
![[ ]](/icons/layout.gif) | Letter of Intent_signed by Geo.pdf | 2025-11-20 22:07 | 562K | |
![[ ]](/icons/unknown.gif) | Health Care Reform_report_29_06_2018.docx | 2025-11-20 22:07 | 90K | |
![[ ]](/icons/unknown.gif) | Appendix_State health programs.docx | 2025-11-20 22:07 | 207K | |
![[TXT]](/icons/text.gif) | ATT00001.htm | 2025-11-20 22:07 | 168 | |
![[ ]](/icons/layout.gif) | 260_TRANS_ENV_THE PEP_MIN_2019e.pdf | 2025-11-20 22:07 | 74K | |
![[ ]](/icons/layout.gif) | წერილი შვეიცარიაზე.pdf | 2025-11-20 22:07 | 383K | |
|